-
Notifications
You must be signed in to change notification settings - Fork 1
/
Copy pathReducers-1611593064619220824.json
1 lines (1 loc) · 861 KB
/
Reducers-1611593064619220824.json
1
{"apiReducers":{"target_id_list":[{"id":2,"title":"NUDT7A","project_id":[2],"protein_set":[15617,15618,15619,15620,15621,15622,15623,15624,15625,15626,15627,15628,15629,15630,15631],"template_protein":"/media/pdbs/NUDT7A-x0140_1_apo_hYaNUGN.pdb","metadata":null,"zip_archive":null},{"id":4,"title":"ATAD","project_id":[2],"protein_set":[13044,13045,13046,13047,13048,13049,13050,13051],"template_protein":"/media/pdbs/ATAD2A-x1712_1_apo_QcCBCZx.pdb","metadata":null,"zip_archive":null},{"id":5,"title":"BRD1A","project_id":[2],"protein_set":[13055,13056,13057,13058,13059,13060,13061,13062,13063,13064,13065,13066,13067,13068,13069,13070,13071,13072,13073],"template_protein":"/media/pdbs/BRD1A-x0900_1_apo_X36iTCu.pdb","metadata":null,"zip_archive":null},{"id":7,"title":"DCP2B","project_id":[2],"protein_set":[14666,14667,14668,14669,14670,14671,14672,14673,14674,14675,14676,14677,14678,14679,14680,14681,14682,14683,14684,14685,14686,14687,14688,14689,14690,14691,14692,14693,14694,14695,14696,14697,14698,14699,14700,14701,14702,14703,14704,14705,14706,14707,14708,14709,14710,14711,14712,14713,14714,14715,14716,14717,14718,14719,14720,14721,14722,14723,14724,14725,14726,14727,14728,14729,14730,14731,14732,14733,14734,14735,14736,14737,14738],"template_protein":"/media/pdbs/DCP2B-x0020_1_apo_5td9srg.pdb","metadata":null,"zip_archive":null},{"id":8,"title":"FAM83BA","project_id":[2],"protein_set":[13325,13326,13327,13328,13329,13330,13331,13332,13333,13334,13335,13336,13337,13338],"template_protein":"/media/pdbs/FAM83BA-x0131_1_apo_G2blbbF.pdb","metadata":null,"zip_archive":null},{"id":12,"title":"MURD","project_id":[2],"protein_set":[6378,6379,6380,6381],"template_protein":"/media/pdbs/MURD-x0349_apo_0Z35oUA.pdb","metadata":null,"zip_archive":null},{"id":15,"title":"NUDT4A","project_id":[2],"protein_set":[13536,13537,13538,13539,13540,13541,13542,13543],"template_protein":"/media/pdbs/NUDT4A-x0159_1_apo_MptlW5D.pdb","metadata":null,"zip_archive":null},{"id":17,"title":"OXA10OTA","project_id":[2],"protein_set":[13953,13954,13955,13956,13957,13958,13959,13960,13961,13962,13963,13964,13965,13966,13967,13968,13969,13970],"template_protein":"/media/pdbs/OXA10OTA-x0038_1_apo_b0APxOF.pdb","metadata":null,"zip_archive":null},{"id":18,"title":"PARP14A","project_id":[2],"protein_set":[13971,13972,13973,13974,13975,13976,13977,13978,13979,13980,13981,13982,13983,13984,13985,13986,13987,13988],"template_protein":"/media/pdbs/PARP14A-x0137_1_apo_RiuanPQ.pdb","metadata":null,"zip_archive":null},{"id":19,"title":"PHIPA","project_id":[2],"protein_set":[32646,32657,32651,32628,32655,32616,32629,32620,32640,32611,32630,32623,32653,32617,32631,32618,32648,32641,32619,32632,32634,32654,32659,32622,32642,32615,32612,32625,32660,32621,32626,32649,32643,32627,32663,32635,32644,32662,32656,32650,32639,32645,32647,32614,32652,32613,32636,32658,32624,32661,32638,32633,32637],"template_protein":"/media/pdbs/PHIPA-x20671_0_apo.pdb","metadata":"https://fragalysis.apps.xchem.diamond.ac.uk/media/metadata/metadata_oHB8XOf.csv","zip_archive":"https://fragalysis.apps.xchem.diamond.ac.uk/media/targets/PHIPA.zip"},{"id":20,"title":"PTP1B","project_id":[2],"protein_set":[6480,6481,6482,6483,6484,6485,6486,6487,6488,6489,6490,6491,6492,6493,6494,6495,6496,6497,6498,6499,6500,6501,6502,6503,6504,6505,6506,6507,6508,6509,6510,6511,6512,6513,6514,6515,6516,6517,6518,6519,6520,6521,6522,6523,6524,6525,6526,6527,6528,6529,6530,6531,6532,6533,6534,6535,6536,6537,6538,6539,6540,6541,6542,6543,6544,6545,6546,6547,6548,6549,6550,6551,6552,6553,6554,6555,6556,6557,6558,6559,6560,6561,6562,6563,6564,6565,6566,6567,6568,6569,6570,6571,6572,6573,6574,6575,6576,6577,6578,6579,6580,6581,6582,6583,6584,6585,6586,6587,6588,6589,6590,6591,6592,6593,6594,6595,6596,6597,6598,6599,6600,6601,6602,6603,6604,6605,6606,6607,6608,6609,6610,6611,6612,6613,6614,6615,6616,6617,6618],"template_protein":"/media/pdbs/PTP1B-y0049_apo_N9naW4T.pdb","metadata":null,"zip_archive":null},{"id":22,"title":"SMTGR","project_id":[2],"protein_set":[7192,7193,7194,7195,7196,7197,7198,7199,7200,7201,7202,7203,7204,7205,7206,7207,7208,7209,7210,7211,7212,7213,7214,7215],"template_protein":"/media/pdbs/smTGR-x2053_apo_zrHDWbw.pdb","metadata":null,"zip_archive":null},{"id":29,"title":"ATAD2A","project_id":[2],"protein_set":[13052,13053,13054],"template_protein":"/media/pdbs/ATAD2A-x1803_1_apo_D4wOsMM.pdb","metadata":null,"zip_archive":null},{"id":30,"title":"CAMK1DA","project_id":[2],"protein_set":[13074,13075,13076,13077,13078,13079,13080,13081,13082,13083,13084,13085,13086,13087,13088,13089,13090,13091,13092],"template_protein":"/media/pdbs/CAMK1DA-x0049_1_apo_Xd3Xer3.pdb","metadata":null,"zip_archive":null},{"id":31,"title":"DCLRE1AA","project_id":[2],"protein_set":[13247,13218,13219,13220,13221,13222,13223,13224,13225,13226,13227,13228,13229,13230,13231,13232,13233,13234,13235,13236,13237,13238,13239,13240,13241,13242,13243,13244,13245,13246,13248,13249,13250,13251],"template_protein":"/media/pdbs/DCLRE1AA-x1013_1_apo_98NeoJT.pdb","metadata":null,"zip_archive":null},{"id":32,"title":"FALZA","project_id":[2],"protein_set":[6928,6929,6930,6931,6932,6933,6934,6935],"template_protein":"/media/pdbs/FALZA-x0079_1_apo_pDzqSU5.pdb","metadata":null,"zip_archive":null},{"id":35,"title":"HAO1A","project_id":[2],"protein_set":[6938,6939,6940,6941,6942,6943,6944,6945,6946,6947,6948,6949,6950,6951,6952,6953,6954,6955,6956,6957,6958,6959,6960,6961,6962,6963,6964,6965,6966,6967,6968,6969,6970,6971,6972,6973,6974,6975,6976,6977,6978,6979,6980,6981,6982,6983],"template_protein":"/media/pdbs/HAO1A-x0208_1_apo_MQrMrik.pdb","metadata":null,"zip_archive":null},{"id":37,"title":"MUREECA","project_id":[2],"protein_set":[17944,17945,17946,17947,17948,17949,17950,17951,17952,17953,17954,17955,17956,17957,17958,17959,17960,17961,17962,17963,17964,17965],"template_protein":"/media/pdbs/MUREECA-x0114_1_apo_SbbuYzF.pdb","metadata":null,"zip_archive":null},{"id":38,"title":"NUDT21A","project_id":[2],"protein_set":[13491,13492,13493,13494,13495,13496,13497,13498,13499,13500,13501,13502,13503,13504,13505,13506,13507,13508,13509,13510,13511,13512,13513,13514,13515,13516,13517,13518,13519,13520,13521,13522,13523,13524,13525,13526,13527,13528,13529,13530,13531,13532,13533,13534,13535],"template_protein":"/media/pdbs/NUDT21A-x0159_1_apo_VSKfMPI.pdb","metadata":null,"zip_archive":null},{"id":39,"title":"NUDT4","project_id":[2],"protein_set":[7069,7070,7071,7072,7073,7074],"template_protein":"/media/pdbs/NUDT4A-x0159_apo_Z09M2Hp.pdb","metadata":null,"zip_archive":null},{"id":40,"title":"NUDT5A","project_id":[2],"protein_set":[18136,18137,18138,18139,18140,18141,18142,18143,18144,18145,18146,18147,18148,18149,18150,18151,18152,18153,18154,18155,18156,18157,18158,18159,18160,18161,18162,18163,18164,18165,18166,18167,18168,18169,18170,18171,18172,18173,18174,18175,18176,18177,18178,18179,18180,18181,18182,18183,18184,18185,18186,18187,18188,18189,18190,18191,18192,18193,18194,18195,18196,18197,18198,18199,18200,18201,18202,18203,18204,18205,18206,18207,18208,18209,18210,18211,18212,18213,18214,18215,18216,18217,18218,18219,18220,18221,18222,18223,18224,18225,18226,18227,18228,18229,18230,18231,18232,18233,18234,18235,18236,18237,18238,18239,18240,18241,18242,18243,18244,18245,18246,18247,18248,18249,18250,18251,18252,18253,18254,18255,18256,18257,18258,18259,18260,18261,18262,18263,18264,18265,18266,18267,18268,18269,18270,18271,18272,18273,18274,18275,18276,18277,18278,18279,18280,18281,18282,18283,18284,18285,18286,18287,18288,18289,18290,18291,18292,18293,18294,18295,18296,18297,18298,18299,18300,18301,18302,18303,18304],"template_protein":"/media/pdbs/NUDT5A-x0114_1_apo_lZ7GhcD.pdb","metadata":null,"zip_archive":null},{"id":41,"title":"NUDT7A_CRUDE","project_id":[2],"protein_set":[13690,13657,13658,13659,13660,13661,13662,13663,13664,13665,13666,13667,13668,13669,13670,13671,13672,13673,13674,13675,13676,13677,13678,13679,13680,13681,13682,13683,13684,13685,13686,13687,13688,13689,13691,13692,13693,13694,13695,13696,13697,13698,13699,13700,13701,13702,13703,13704,13705,13706,13707,13708,13709,13710,13711,13712,13713,13714,13715,13716,13717,13718,13719,13720,13721,13722,13723,13724,13725,13726,13727,13728,13729,13730,13731,13732,13733,13734,13735,13736,13737,13738,13739,13740,13741,13742,13743,13744,13745,13746,13747,13748,13749,13750,13751,13752,13753,13754,13755,13756,13757,13758,13759,13760,13761,13762,13763,13764,13765,13766,13767,13768,13769,13770,13771,13772,13773,13774,13775,13776,13777,13778,13779,13780,13781,13782,13783,13784,13785,13786,13787,13788,13789,13790,13791,13792,13793,13794,13795,13796,13797,13798,13799,13800,13801,13802,13803,13804,13805,13806,13807,13808,13809,13810,13811,13812,13813,13814,13815,13816,13817,13818,13819,13820,13821,13822,13823,13824,13825,13826,13827,13828,13829,13830,13831,13832,13833,13834,13835,13836,13837,13838,13839,13840,13841,13842,13843,13844,13845,13846,13847,13848,13849,13850,13851,13852,13853,13854,13855,13856,13857,13858,13859,13860,13861,13862,13863,13864,13865,13866,13867,13868,13869,13870,13871,13872,13873,13874,13875,13876,13877,13878,13879,13880,13881,13882,13883,13884,13885,13886,13887,13888,13889,13890,13891,13892,13893,13894,13895,13896,13897,13898,13899,13900,13901,13902,13903,13904,13905,13906,13907,13908,13909,13910,13911,13912,13913,13914,13915,13916,13917,13918,13919,13920,13921,13922,13923,13924,13925,13926,13927,13928,13929,13930,13931,13932,13933,13934,13935,13936,13937,13938,13939,13940,13941,13942,13943,13944,13945,13946,13947,13948,13949,13950,13951],"template_protein":"/media/pdbs/NUDT7A_Crude-x0230_2_apo_NEcz29u.pdb","metadata":null,"zip_archive":null},{"id":46,"title":"smTGRNEW","project_id":[2],"protein_set":[7216,7217,7218,7219,7220,7221,7222,7223,7224],"template_protein":"/media/pdbs/smTGR-x20531_apo_ddCGiaP.pdb","metadata":null,"zip_archive":null},{"id":47,"title":"STAG1A","project_id":[2],"protein_set":[14789,14790,14791,14792,14793,14794,14795,14796,14797,14798,14799,14800,14801,14802,14803,14804,14805,14806,14807,14808,14809],"template_protein":"/media/pdbs/STAG1A-x0237_1_apo_T6h9LGK.pdb","metadata":null,"zip_archive":null},{"id":48,"title":"TBXTA","project_id":[2],"protein_set":[14810,14811,14812,14813,14814,14815,14816,14817,14818,14819,14820,14821,14822,14823,14824,14825,14826,14827,14828,14829,14830,14831,14832,14833,14834,14835,14836,14837,14838,14839,14840,14841,14842,14843,14844,14845,14846,14847,14848,14849,14850,14851,14852,14853,14854,14855,14856,14857,14858,14859,14860,14861,14862],"template_protein":"/media/pdbs/TBXTA-x0024_1_apo_kFHAPSk.pdb","metadata":null,"zip_archive":null},{"id":50,"title":"VIM2","project_id":[2],"protein_set":[14416,14414,14415,14410,14411,14412,14413,14417,14418,14419,14420,14421,14422,14423,14424,14425,14426,14427,14428,14429,14430,14431,14432,14433,14434,14435,14436,14437,14438,14439,14440,14441,14442,14443,14444,14445,14446,14447,14448,14449,14450,14451,14452,14453,14454,14455,14456,14457,14458,14459,14460,14461,14462,14463,14464,14465,14466,14467,14468,14469,14470,14471,14472,14473,14474,14475,14476,14477,14478,14479,14480,14481,14482,14483,14484,14485,14486,14487,14488,14489,14490,14491,14492,14493,14494,14495,14496,14497,14498,14499,14500,14501,14502,14503,14504,14505,14506,14507,14508,14509,14510,14511,14512,14513,14514,14515,14516,14517,14518,14519,14520,14521,14522,14523,14524,14525,14526,14527,14528,14529,14530,14531,14532,14533,14534,14535,14536,14537,14538,14539,14540,14541,14542,14543,14544,14545,14546,14547,14548,14549,14550,14551,14552,14553,14554,14555,14556,14557,14558,14559,14560,14561,14562,14563,14564,14565,14566,14567,14568,14569,14570,14571,14572,14573],"template_protein":"/media/pdbs/VIM2-MB-11_3_apo_rfpPQz8.pdb","metadata":null,"zip_archive":null},{"id":51,"title":"XX02KALRNA","project_id":[2],"protein_set":[14902,14903,14904,14905,14906,14907,14908,14909,14910,14911,14912,14913],"template_protein":"/media/pdbs/XX02KALRNA-x1376_1_apo_9VSCvR8.pdb","metadata":null,"zip_archive":null},{"id":52,"title":"TNCA","project_id":[2],"protein_set":[14354,14355,14356,14357,14358,14359,14360,14361,14362,14363,14364,14365,14366,14367,14368,14369,14370],"template_protein":"/media/pdbs/TNCA-x0062_1_apo_Vc9bxy2.pdb","metadata":null,"zip_archive":null},{"id":53,"title":"ALAS2A","project_id":[2],"protein_set":[17966],"template_protein":"NOT AVAILABLE","metadata":null,"zip_archive":null},{"id":54,"title":"EPB41L3A","project_id":[2],"protein_set":[18435,18460,31243,31233,31217,31218,31251,31234,31219,31220,31244,31235,31221,31222,18428,31223,31263,31224,31236,31225,31245,31226,31237,31227,31252,31228,31238,31229,31246,31230,31239,31231,31257,31232,31247,31240,31253,31241,31248,31242,31261,31254,31249,31258,31250,31255,31265,31259,31256,31262,31260,31264],"template_protein":"/media/pdbs/EPB41L3A-x0306_1_apo.pdb","metadata":"https://fragalysis.apps.xchem.diamond.ac.uk/media/metadata/metadata_NJuLr98.csv","zip_archive":"https://fragalysis.apps.xchem.diamond.ac.uk/media/targets/EPB41L3A.zip"},{"id":61,"title":"mArh","project_id":[2],"protein_set":[31678,31674,31681,31675,31671,31672,31679,31676,31673,31683,31677,31682,31680,31686,31685,31684,31687,31688,31689,31690,31691,31692,31693,31694,31695,31696,31697,31698,31700,31704,31701,31707,31702,31699,31705,31703,31710,31706,31709,31708,31711,31712,31713,31714,31715,31716,31717,31718,31719,31720,31721,31722,31723,31724,31725,31726,31727,31728,31729,31730,31731,31732,31733,31734,31747,31735,31756,31736,31748,31737,31738,31749,31739,31762,31757,31740,31750,31741,31742,31751,31743,31766,31758,31744,31752,31745,31746,31753,31763,31759,31754,31755,31769,31760,31764,31761,31767,31765,31772,31768,31771,31770,31773,31774,31775,31776,31777,31778,31779,31780,31794,31781,31810,31782,31795,31783,31804,31784,31796,31785,31818,31786,31815,31797,31787,31805,31788,31798,31789,31811,31790,31799,31791,31806,31792,31800,31793,31807,31801,31812,31802,31808,31803,31816,31809,31813,31822,31819,31814,31817,31821,31820,31823,31825,31824,31826,31827,31828,31829,31830,31831,31854,31832,31845,31833,31865,31834,31846,31835,31855,31836,31847,31837,31861,31838,31848,31839,31856,31840,31849,31841,31868,31842,31850,31843,31857,31844,31851,31862,31852,31858,31853,31866,31863,31859,31860,31872,31864,31867,31869,31871,31870,31916,31887,31898,31888,31873,31906,31874,31889,31875,31899,31876,31890,31877,31912,31878,31891,31879,31900,31880,31892,31881,31907,31882,31893,31883,31901,31884,31894,31885,31886,31919,31902,31895,31908,31896,31903,31897,31913,31909,31904,31905,31917,31914,31910,31911,31921,31915,31918,31920,31924,31922,31923,31925,31926,31927,31928,31929,31930,31931,31969,31932,31949,31933,31961,31934,31950,31935,31975,31936,31951,31937,31962,31938,31952,31939,31970,31940,31953,31941,31963,31942,31954,31943,31979,31944,31955,31945,31964,31946,31956,31947,31971,31948,31965,31957,31958,31976,31966,31959,31960,31972,31967,31982,31968,31973,31977,31980,31974,31984,31978,31983,31981,31987,31985,31986,31988,31989,31990,31991,31992,31993,31994,31996,31995,31997,31998,31999,32000,32001,32002,32003,32004,32005],"template_protein":"/media/pdbs/mArh-3ew5_B_0B_apo.pdb","metadata":"https://fragalysis.apps.xchem.diamond.ac.uk/media/metadata/metadata_7AuLXgA.csv","zip_archive":"https://fragalysis.apps.xchem.diamond.ac.uk/media/targets/mArh.zip"},{"id":65,"title":"INPP5DA","project_id":[2],"protein_set":[31501,31518,31510,31503,31504,31512,31505,31524,31506,31519,31513,31507,31508,31514,31509,31528,31515,31521,31516,31517,31525,31522,31523,31526,31535,31531,31527,31530,31532,31533,31534,31536,31537,31539,31499,31500,31540,31542,31550,31543,31544,31574,31551,31546,31565,31547,31552,31548,31549,31584,31553,31555,31566,31556,31575,31567,31557,31558,31580,31568,31559,31560,31576,31569,31561,31562,31587,31570,31564,31571,31577,31573,31578,31582,31579,31583,31585,31586,31588,31589,31591,31592,31593,31595,31596,31541,31594,31605,31606,31607,31597,31598,31599,31600,31601,31602,31603,31604,31502,31511,31520,31529,31538,31545,31554,31563,31572,31581,31590],"template_protein":"/media/pdbs/INPP5DA-x0021_0_apo.pdb","metadata":"https://fragalysis.apps.xchem.diamond.ac.uk/media/metadata/metadata_MR1dz1c.csv","zip_archive":"https://fragalysis.apps.xchem.diamond.ac.uk/media/targets/INPP5DA.zip"},{"id":66,"title":"nsp13","project_id":[2],"protein_set":[40304,40335,40336,40337,40338,40287,40276,40288,40289,40277,40290,40291,40278,40292,40279,40293,40280,40281,40282,40283,40284,40285,40286,40305,40294,40306,40307,40295,40308,40309,40296,40310,40297,40311,40298,40299,40300,40301,40302,40303,40323,40324,40312,40325,40313,40326,40327,40314,40328,40329,40315,40316,40317,40318,40319,40320,40321,40322,40330,40331,40332,40333,40334,40339,40340],"template_protein":"/media/pdbs/nsp13-x0257_0B_apo.pdb","metadata":"https://fragalysis.apps.xchem.diamond.ac.uk/media/metadata/metadata_Y8Y99vz.csv","zip_archive":"https://fragalysis.apps.xchem.diamond.ac.uk/media/targets/nsp13.zip"},{"id":67,"title":"Mac1","project_id":[2],"protein_set":[37438,37473,37407,37372,37380,37386,37371,37376,37373,37394,37388,37377,37374,37368,37385,37384,37382,37381,37390,37379,37389,37378,37375,37369,37391,37392,37393,37387,37383,37370,37399,37420,37405,37417,37414,37418,37404,37411,37408,37406,37395,37415,37421,37397,37401,37403,37402,37413,37412,37416,37423,37396,37410,37422,37419,37424,37409,37400,37447,37437,37456,37432,37434,37426,37463,37427,37436,37433,37453,37450,37444,37443,37442,37441,37451,37457,37435,37428,37460,37440,37425,37430,37455,37445,37431,37439,37459,37446,37467,37466,37458,37465,37448,37462,37461,37449,37454,37429,37464,37452,37492,37489,37491,37488,37487,37498,37495,37477,37480,37479,37476,37469,37474,37471,37496,37483,37499,37493,37494,37486,37485,37478,37490,37482,37500,37484,37481,37475,37470,37497,37516,37515,37514,37513,37512,37506,37503,37508,37511,37510,37502,37504,37591,37519,37561,37517,37520,37521,37565,37518,37501,37601,37558,37602,37538,37468,37507,37509,37398,37505,37472,37542,37545,37536,37523,37546,37563,37548,37552,37549,37525,37524,37539,37562,37551,37547,37553,37559,37555,37556,37550,37564,37566,37526,37522,37531,37529,37532,37535,37568,37560,37543,37554,37544,37527,37537,37530,37528,37533,37540,37534,37567,37557,37541,37592,37595,37578,37580,37589,37594,37597,37569,37596,37570,37598,37579,37590,37577,37584,37571,37588,37586,37587,37572,37593,37583,37581,37576,37575,37574,37573,37599,37600,37582,37585,37643,37625,37636,37638,37642,37615,37613,37624,37611,37603,37639,37610,37609,37612,37635,37633,37632,37637,37640,37621,37629,37626,37641,37618,37606,37604,37628,37622,37627,37617,37634,37623,37608,37605,37644,37607,37616,37620,37631,37630,37619,37614],"template_protein":"/media/pdbs/Mac1-DLS-X0681_0A_apo_YaUy11d.pdb","metadata":"https://fragalysis.apps.xchem.diamond.ac.uk/media/metadata/metadata_wAHiLRP.csv","zip_archive":"https://fragalysis.apps.xchem.diamond.ac.uk/media/targets/Mac1.zip"},{"id":68,"title":"Mpro","project_id":[2],"protein_set":[39984,40386,40041,40000,40008,40029,39960,40105,40159,39987,40114,40044,39896,40009,39962,40068,40033,40155,39935,40181,39929,40173,39889,39890,40063,40069,40138,40110,40144,40195,40021,39945,39895,39918,39904,39888,39891,39905,39892,39893,39902,39908,39898,39909,39907,39897,39900,39899,39906,39894,39903,39910,39901,39915,39912,39916,39913,39920,39911,39917,39922,39919,39924,39921,39925,39923,39914,39926,39927,39967,39959,39954,39958,39934,39933,39941,39953,39928,39972,39957,39956,39939,39975,39964,39949,39940,39944,39966,39943,39930,39938,39931,39942,39948,39932,39955,39936,39950,39969,39947,39946,39971,39961,39952,39937,39963,39977,39974,39951,39965,39970,39973,39968,39976,39982,39979,39978,39981,39980,39985,39988,39997,39991,39990,39995,39989,39998,39993,39996,39986,39992,39994,39999,39983,40003,40004,40007,40001,40005,40006,40002,40024,40014,40030,40059,40022,40011,40013,40040,40037,40012,40043,40060,40018,40056,40054,40025,40062,40026,40031,40057,40050,40051,40065,40052,40046,40038,40039,40058,40016,40035,40020,40010,40027,40042,40034,40023,40017,40028,40019,40053,40048,40047,40055,40045,40061,40064,40049,40032,40015,40036,40094,40082,40101,40078,40097,40119,40080,40118,40099,40067,40075,40091,40074,40121,40098,40096,40073,40093,40087,40079,40066,40076,40086,40120,40095,40090,40092,40083,40072,40109,40085,40088,40104,40117,40107,40081,40113,40108,40115,40089,40100,40111,40106,40112,40103,40084,40116,40070,40102,40077,40071,40124,40122,40127,40125,40128,40123,40126,40385,40130,40158,40168,40152,40154,40166,40167,40137,40132,40145,40133,40183,40134,40157,40136,40143,40162,40160,40142,40139,40151,40165,40140,40171,40135,40156,40147,40149,40163,40153,40164,40146,40150,40148,40161,40185,40141,40170,40175,40179,40174,40180,40172,40176,40182,40177,40169,40184,40178,40131,40129,40222,40224,40191,40189,40192,40201,40199,40193,40230,40212,40203,40187,40241,40188,40206,40196,40218,40194,40226,40239,40229,40207,40240,40213,40200,40236,40209,40198,40223,40227,40205,40210,40231,40215,40202,40233,40190,40197,40214,40220,40217,40235,40228,40204,40216,40186,40238,40211,40234,40232,40225,40237,40219,40208,40221,40405,40406,40407,40408,40341,40342,40343,40344,40345,40346,40347,40348,40349,40350,40351,40352,40353,40354,40355,40356,40357,40358,40359,40360,40361,40362,40363,40364,40365,40366,40367,40368,40369,40370,40371,40372,40373,40374,40375,40376,40377,40378,40379,40380,40381,40382,40383,40384,40387,40388,40389,40390,40391,40392,40393,40394,40395,40396,40397,40398,40399,40400,40401,40402,40403,40404,40409,40410,40411,40412,40413,40414,40415,40416,40417,40418,40419,40420,40421,40422,40423,40424,40425,40426,40427,40428,40429,40430,40431,40432,40433,40434,40435,40436,40437,40438,40439,40440,40441,40442,40443,40444,40445,40446,40447,40448,40449,40450,40451],"template_protein":"/media/pdbs/Mpro-x10417_0A_apo.pdb","metadata":"https://fragalysis.apps.xchem.diamond.ac.uk/media/metadata/metadata_hL61MZl.csv","zip_archive":"https://fragalysis.apps.xchem.diamond.ac.uk/media/targets/Mpro.zip"},{"id":69,"title":"NSP15_B","project_id":[2],"protein_set":[37646,37645,37652,37647,37650,37648,37653,37649],"template_protein":"/media/pdbs/NSP15_B-x0422_1B_apo.pdb","metadata":"https://fragalysis.apps.xchem.diamond.ac.uk/media/metadata/metadata.csv","zip_archive":"https://fragalysis.apps.xchem.diamond.ac.uk/media/targets/NSP15_B.zip"},{"id":70,"title":"MUREECOLI","project_id":[2],"protein_set":[40246,40263,40266,40260,40269,40272,40257,40275,40264,40261,40250,40247,40273,40254,40267,40258,40270,40251,40248,40274,40265,40245,40255,40262,40252,40259,40268,40249,40271,40256,40253,40242,40243,40244],"template_protein":"/media/pdbs/MUREECOLI-7B61_0B_apo_QRs2Wwd.pdb","metadata":"https://fragalysis.apps.xchem.diamond.ac.uk/media/metadata/metadata_GdyxtUF.csv","zip_archive":"https://fragalysis.apps.xchem.diamond.ac.uk/media/targets/MUREECOLI.zip"}],"mol_group_list":[{"id":238505,"group_type":"MC","mol_id":[37457,37466,37458,37460,37471,37461,37467,37462,37474,37463,37468,37464,37465,37469,37470,37473,37475,37478,37477,37483,37484,37486,37495,37496,37500,37497,37503,37506,37509,37515,37516,37517,37518,37527,37545,37521,37528,37530,37531,37548,37532,37533,37539,37540,37550,37549,37551,37554,37555,37556,37558,37580,37560,37568,37562,37569,37563,37565,37578,37576,37577,37581,37584],"target_id":67,"x_com":27.238283583303307,"y_com":49.21699084151727,"z_com":-7.016167950826643,"description":"A1 - Adenine site (XChem)"},{"id":238506,"group_type":"MC","mol_id":[37588,37591,37592,37605,37606,37607,37608,37599,37600,37609,37601,37602,37610,37603,37604,37611,37625,37612,37634,37613,37614,37641,37615,37635,37645,37628,37618,37648,37621,37642,37631,37624,37637,37638,37639,37652,37640,37644,37651,37650,37653,37654,37655,37658,37659,37660,37669,37675,37679,37676,37686,37666,37667,37668,37677,37680,37683,37678,37681,37685,37684,37687,37690,37693,37716,37722,37717,37699,37700,37702,37711,37718,37704,37727,37706,37713,37714,37715,37724,37730,37721,37728,37726,37732,37729,37731],"target_id":67,"x_com":27.726189840367525,"y_com":48.088785194747636,"z_com":-6.333846525371354,"description":"A2 - Adenine site (UCSF)"},{"id":238507,"group_type":"MC","mol_id":[37493,37507,37522,37529,37534,37552,37553,37582,37574,37575,37583],"target_id":67,"x_com":31.65100795413972,"y_com":43.278296929879644,"z_com":-5.619644133695017,"description":"B1 - Oxyanion hole (XChem)"},{"id":238508,"group_type":"MC","mol_id":[37626,37627,37616,37617,37619,37629,37620,37636,37622,37623,37632,37633,37643,37647,37649,37657,37661,37662,37670,37663,37664,37665,37672,37673,37682,37688,37689,37691,37692,37694,37695,37696,37697,37710,37701,37712,37725],"target_id":67,"x_com":30.4582845424678,"y_com":44.33355534090772,"z_com":-5.312019470354383,"description":"B2 - Oxyanion hole (UCSF)"},{"id":238509,"group_type":"MC","mol_id":[37502,37505,37492,37501,37541,37544,37566,37567],"target_id":67,"x_com":20.998018064109196,"y_com":44.09051650025461,"z_com":9.46426046740865,"description":"C1 - Catalytic site (XChem)"},{"id":238510,"group_type":"MC","mol_id":[37671],"target_id":67,"x_com":21.284898853882172,"y_com":45.698160485758876,"z_com":9.998337938938745,"description":"C2 - Catalytic site (UCSF)"},{"id":238511,"group_type":"MC","mol_id":[37479,37480,37481,37485,37488,37512,37525,37526,37523,37557,37579],"target_id":67,"x_com":35.1959499106428,"y_com":40.31313119348975,"z_com":-2.94943982944573,"description":"D1 - Glycine rich loop (XChem)"},{"id":238512,"group_type":"MC","mol_id":[37709,37705],"target_id":67,"x_com":36.3677463490233,"y_com":41.33177382856768,"z_com":-3.5796752218781913,"description":"D2 - Glycine rich loop (UCSF)"},{"id":238513,"group_type":"MC","mol_id":[37733],"target_id":67,"x_com":27.838442456374175,"y_com":49.94959833576108,"z_com":2.3046774018529543,"description":"E1 - Diphosphate site (UCSF)"},{"id":238514,"group_type":"MC","mol_id":[37656,37707,37708,37698,37719,37720],"target_id":67,"x_com":6.59239776235854,"y_com":36.529496855505464,"z_com":-3.246374871271202,"description":"I - Dimer interface (UCSF)"},{"id":238515,"group_type":"MC","mol_id":[37499,37491,37511,37519,37542,37547,37571],"target_id":67,"x_com":11.41205112673282,"y_com":44.112625007100824,"z_com":-17.965020610280543,"description":"K1 - K90 site (XChem)"},{"id":238516,"group_type":"MC","mol_id":[37589,37590,37593,37595,37596,37597,37598],"target_id":67,"x_com":9.780446439600953,"y_com":46.73529399938116,"z_com":-16.922835940982644,"description":"K2 - K90 site (UCSF)"},{"id":238517,"group_type":"MC","mol_id":[37630,37646,37674,37703,37723],"target_id":67,"x_com":18.064064408695742,"y_com":41.290467751815086,"z_com":-5.883202868377023,"description":"O - Other (UCSF)"},{"id":238518,"group_type":"MC","mol_id":[37482,37487,37494,37498,37504,37508,37513,37514,37520,37536,37538,37543,37546,37559,37573,37564,37570,37585],"target_id":67,"x_com":14.38901707971803,"y_com":40.50514141903764,"z_com":-12.77409756223947,"description":"S1 - Surface (XChem)"},{"id":238519,"group_type":"MC","mol_id":[37586,37587,37594],"target_id":67,"x_com":23.065233312370676,"y_com":38.83915549847696,"z_com":-10.827840363258138,"description":"S2 - Surface (UCSF)"},{"id":238520,"group_type":"MC","mol_id":[37459,37472,37476,37489,37490,37510,37535,37524,37537,37561,37572],"target_id":67,"x_com":14.703284696109689,"y_com":36.083419530772645,"z_com":-5.466467746407585,"description":"X1 - Xtal contact (XChem)"}],"molecule_list":{"0":{"id":37457,"smiles":"c1ncc2c(n1)NCC2","cmpd_id":5067,"prot_id":37368,"protein_code":"Mac1-DLS-EU0034A:EN300-321461","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-EU0034_0A_apo_VjNQ65L.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 9 10 0 0 0 0 0 0 0 0999 V2000\n 28.6950 51.7270 -7.5540 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.1600 50.5930 -6.6460 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.0190 51.0140 -8.6300 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.3620 49.6890 -8.6990 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.0360 49.3690 -7.5170 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.1020 48.8400 -9.7140 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.5190 47.5900 -9.4780 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.1810 47.1340 -8.4130 N 0 0 0 0 0 0 0 0 0 0 0 0\n 29.4220 48.0420 -7.4580 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 1 1 0\n 4 3 1 0\n 5 4 2 0\n 5 2 1 0\n 6 4 1 0\n 7 6 2 0\n 8 7 1 0\n 9 8 2 0\n 9 5 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":121.06,"logp":0.44,"tpsa":37.81,"ha":9,"hacc":3,"hdon":1,"rots":0,"rings":2,"velec":46,"number":0},"1":{"id":37458,"smiles":"Cc1n[nH]c(N)c1C#N","cmpd_id":5068,"prot_id":37369,"protein_code":"Mac1-DLS-EU0046A:EN300-43406","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-EU0046_0A_apo_h8vAPmV.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 9 9 0 0 0 0 0 0 0 0999 V2000\n 30.3780 48.4210 -5.7980 N 0 0 0 0 0 0 0 0 0 0 0 0\n 29.7600 48.9280 -6.6170 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.9950 49.5130 -7.6700 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.3420 48.9020 -8.7740 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.1770 47.4470 -9.0650 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.8320 50.9030 -7.8840 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.2700 51.8980 -7.1370 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.1300 51.0520 -9.0540 N 0 0 0 0 0 0 0 0 0 0 0 0\n 27.8400 49.8260 -9.5980 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 3 0\n 3 2 1 0\n 4 3 1 0\n 5 4 1 0\n 6 3 2 0\n 7 6 1 0\n 8 6 1 0\n 9 4 2 0\n 9 8 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":122.06,"logp":0.17,"tpsa":78.49,"ha":9,"hacc":3,"hdon":2,"rots":0,"rings":1,"velec":46,"number":0},"2":{"id":37460,"smiles":"NCc1cncc(Br)c1","cmpd_id":5069,"prot_id":37371,"protein_code":"Mac1-DLS-EU0056A:Z3034471507","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-EU0056_0A_apo_FUlgi75.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 9 9 0 0 0 0 0 0 0 0999 V2000\n 28.3970 50.9770 -8.1160 Br 0 0 0 0 0 0 0 0 0 0 0 0\n 28.6540 52.7820 -7.6160 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.2110 53.7890 -8.4460 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.1990 53.0840 -6.3860 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.3050 54.3430 -5.9530 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.8610 55.3140 -6.7580 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.2960 55.1050 -8.0070 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.7250 56.2460 -8.8190 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.8040 56.9190 -9.5400 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 2 0\n 4 2 1 0\n 5 4 2 0\n 6 5 1 0\n 7 3 1 0\n 7 6 2 0\n 8 7 1 0\n 9 8 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":185.98,"logp":1.3,"tpsa":38.91,"ha":9,"hacc":2,"hdon":1,"rots":1,"rings":1,"velec":48,"number":0},"3":{"id":37461,"smiles":"CC(=O)Nc1nccs1","cmpd_id":5070,"prot_id":37372,"protein_code":"Mac1-DLS-EU0087A:AB-601_30915014","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-EU0087_0A_apo_p8J9IOb.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 9 9 0 0 0 0 0 0 0 0999 V2000\n 29.2290 51.7430 -6.7120 O 0 0 0 0 0 0 0 0 0 0 0 0\n 28.8290 52.1500 -7.7960 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.7440 53.6110 -8.1190 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.4310 51.3060 -8.7910 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.5360 49.9280 -8.7750 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.1860 49.0070 -7.4470 S 0 0 0 0 0 0 0 0 0 0 0 0\n 28.9490 47.5650 -8.3800 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.4150 47.8750 -9.5820 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.1810 49.2160 -9.8210 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 2 0\n 3 2 1 0\n 4 2 1 0\n 5 4 1 0\n 6 5 1 0\n 7 6 1 0\n 8 7 2 0\n 9 8 1 0\n 9 5 2 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":142.02,"logp":1.1,"tpsa":41.99,"ha":9,"hacc":3,"hdon":1,"rots":1,"rings":1,"velec":48,"number":0},"4":{"id":37462,"smiles":"Cc1ccncc1CO","cmpd_id":5071,"prot_id":37373,"protein_code":"Mac1-DLS-EU0123A:EN300-108952","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-EU0123_0A_apo_MAQQBjW.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 9 9 0 0 0 0 0 0 0 0999 V2000\n 28.3060 51.0150 -8.4370 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.7130 51.8390 -7.2550 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.9510 53.2200 -7.3720 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.7350 53.9500 -8.6690 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.3550 54.2450 -8.8810 O 0 0 0 0 0 0 0 0 0 0 0 0\n 29.2490 53.9380 -6.2180 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.2900 53.3850 -4.9990 N 0 0 0 0 0 0 0 0 0 0 0 0\n 29.1240 52.0620 -4.9200 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.8220 51.2580 -6.0010 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 2 0\n 4 3 1 0\n 5 4 1 0\n 6 3 1 0\n 7 6 2 0\n 8 7 1 0\n 9 2 1 0\n 9 8 2 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":123.07,"logp":0.88,"tpsa":33.12,"ha":9,"hacc":2,"hdon":1,"rots":1,"rings":1,"velec":48,"number":0},"5":{"id":37463,"smiles":"Cc1nc(C#N)c(N)o1","cmpd_id":5072,"prot_id":37374,"protein_code":"Mac1-DLS-EU0144A:EN300-301084","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-EU0144_0A_apo_tra2UIb.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 9 9 0 0 0 0 0 0 0 0999 V2000\n 29.9200 49.6780 -5.6940 N 0 0 0 0 0 0 0 0 0 0 0 0\n 29.6190 50.6950 -6.1200 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.2310 51.9420 -6.6950 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.6340 53.1530 -6.1760 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.4010 52.1590 -7.7280 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.6970 51.3690 -8.5400 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.2680 53.5050 -7.9000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 29.0460 54.0330 -6.9050 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.0550 55.5020 -6.7230 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 3 0\n 3 2 1 0\n 4 3 1 0\n 5 3 2 0\n 6 5 1 0\n 7 5 1 0\n 8 7 1 0\n 8 4 2 0\n 9 8 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":123.04,"logp":0.44,"tpsa":75.84,"ha":9,"hacc":4,"hdon":1,"rots":0,"rings":1,"velec":46,"number":0},"6":{"id":37464,"smiles":"NCCn1ccccc1=O","cmpd_id":5073,"prot_id":37375,"protein_code":"Mac1-DLS-EU0172A:EN300-105873","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-EU0172_0A_apo_hB2qmXd.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 10 10 0 0 0 0 0 0 0 0999 V2000\n 28.1840 55.9650 -9.3970 N 0 0 0 0 0 0 0 0 0 0 0 0\n 27.9710 54.7370 -8.6230 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.2840 53.9950 -8.4550 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.1480 52.7870 -7.6170 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.9810 51.5610 -8.1920 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.8670 50.4560 -7.4370 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.8800 50.5630 -6.0370 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.0040 51.7690 -5.4480 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.1570 52.9570 -6.2210 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.2920 54.0970 -5.7460 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 1 0\n 4 3 1 0\n 5 4 1 0\n 6 5 2 0\n 7 6 1 0\n 8 7 2 0\n 9 4 1 0\n 9 8 1 0\n 10 9 2 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":138.08,"logp":-0.19,"tpsa":48.02,"ha":10,"hacc":3,"hdon":1,"rots":2,"rings":1,"velec":54,"number":0},"7":{"id":37465,"smiles":"NCC(=O)Nc1nccs1","cmpd_id":5074,"prot_id":37376,"protein_code":"Mac1-DLS-EU0238A:STK497968","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-EU0238_0A_apo_DpChdDW.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 10 10 0 0 0 0 0 0 0 0999 V2000\n 29.3080 54.6090 -6.8350 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.7860 53.8370 -7.9810 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.8950 52.3520 -7.7310 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.3760 51.5540 -8.7060 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.5180 50.1810 -8.7390 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.1820 49.4870 -9.8000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.3360 48.1410 -9.5340 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.7710 47.8370 -8.3000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.1960 49.2660 -7.4300 S 0 0 0 0 0 0 0 0 0 0 0 0\n 29.4010 51.8970 -6.7200 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 1 0\n 4 3 1 0\n 5 4 1 0\n 6 5 2 0\n 7 6 1 0\n 8 7 2 0\n 9 8 1 0\n 9 5 1 0\n 10 3 2 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":157.03,"logp":0.04,"tpsa":68.01,"ha":10,"hacc":4,"hdon":2,"rots":2,"rings":1,"velec":54,"number":0},"8":{"id":37466,"smiles":"Nc1cnc2[nH]ncc2c1","cmpd_id":5075,"prot_id":37377,"protein_code":"Mac1-DLS-EU0241A:STL414928","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-EU0241_0A_apo_mLtC3xg.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 10 11 0 0 0 0 0 0 0 0999 V2000\n 29.8010 46.4530 -8.1970 N 0 0 0 0 0 0 0 0 0 0 0 0\n 29.2670 47.7140 -8.2620 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.5070 48.6340 -7.2410 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.0670 49.9520 -7.3780 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.3640 50.3170 -8.5500 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.0660 49.5100 -9.6000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.4890 48.2380 -9.4810 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.1640 51.1610 -6.6440 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.5790 52.1580 -7.2840 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.0860 51.6340 -8.4480 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 2 0\n 4 3 1 0\n 5 4 2 0\n 6 5 1 0\n 7 2 1 0\n 7 6 2 0\n 8 4 1 0\n 9 8 2 0\n 10 9 1 0\n 10 5 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":134.06,"logp":0.54,"tpsa":67.59,"ha":10,"hacc":3,"hdon":2,"rots":0,"rings":2,"velec":50,"number":0},"9":{"id":37467,"smiles":"O=c1[nH]cnc2ccccc12","cmpd_id":5076,"prot_id":37378,"protein_code":"Mac1-DLS-EU0291A:EN300-17035","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-EU0291_0A_apo_tvbJNYV.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 11 12 0 0 0 0 0 0 0 0999 V2000\n 29.5150 50.2250 -5.4540 O 0 0 0 0 0 0 0 0 0 0 0 0\n 29.1680 50.4640 -6.6080 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.8300 51.7490 -6.9740 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.3690 52.0540 -8.2060 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.2020 51.1950 -9.1500 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.5120 49.8550 -8.8960 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.0020 49.4410 -7.6340 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.3420 48.0800 -7.4030 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.1360 47.1650 -8.4030 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.6070 47.5800 -9.6400 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.3630 48.8970 -9.9050 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 2 0\n 3 2 1 0\n 4 3 1 0\n 5 4 2 0\n 6 5 1 0\n 7 6 2 0\n 7 2 1 0\n 8 7 1 0\n 9 8 2 0\n 10 9 1 0\n 11 10 2 0\n 11 6 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":146.05,"logp":0.92,"tpsa":45.75,"ha":11,"hacc":2,"hdon":1,"rots":0,"rings":2,"velec":54,"number":0},"10":{"id":37468,"smiles":"Nc1cnc2c(c1)COCC2","cmpd_id":5077,"prot_id":37379,"protein_code":"Mac1-DLS-EU0293A:Z1613477500","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-EU0293_0A_apo_oT8y0Gk.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 11 12 0 0 0 0 0 0 0 0999 V2000\n 29.7720 46.2730 -8.2350 N 0 0 0 0 0 0 0 0 0 0 0 0\n 29.3120 47.5350 -8.4090 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.5120 48.4910 -7.4140 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.0910 49.8000 -7.6330 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.3040 50.8670 -6.5990 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.2230 52.1650 -7.1890 O 0 0 0 0 0 0 0 0 0 0 0 0\n 27.9850 52.3430 -7.8710 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.9470 51.4910 -9.1200 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.4330 50.0960 -8.8350 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.2550 49.1870 -9.8240 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.6380 47.9210 -9.5890 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 2 0\n 4 3 1 0\n 5 4 1 0\n 6 5 1 0\n 7 6 1 0\n 8 7 1 0\n 9 8 1 0\n 9 4 2 0\n 10 9 1 0\n 11 2 1 0\n 11 10 2 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":150.08,"logp":0.74,"tpsa":48.14,"ha":11,"hacc":3,"hdon":1,"rots":0,"rings":2,"velec":58,"number":0},"11":{"id":37469,"smiles":"CNC(=O)c1ccc(=O)[nH]c1","cmpd_id":5078,"prot_id":37380,"protein_code":"Mac1-DLS-EU0342A:EN300-52144","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-EU0342_0A_apo_jhclG8l.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 11 11 0 0 0 0 0 0 0 0999 V2000\n 28.0320 46.8900 -9.0030 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.4820 48.0270 -8.2160 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.4000 49.2680 -8.6960 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.6090 50.4000 -7.7360 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.0360 50.1770 -6.4220 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.2180 51.2210 -5.5690 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.3880 51.6940 -8.1550 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.5690 52.7250 -7.2970 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.9750 52.5600 -5.9990 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.1230 53.5820 -5.2760 O 0 0 0 0 0 0 0 0 0 0 0 0\n 28.1680 49.4810 -9.8880 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 1 0\n 4 3 1 0\n 5 4 1 0\n 6 5 2 0\n 7 4 2 0\n 8 7 1 0\n 9 8 1 0\n 9 6 1 0\n 10 9 2 0\n 11 3 2 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":152.06,"logp":-0.27,"tpsa":61.96,"ha":11,"hacc":2,"hdon":2,"rots":1,"rings":1,"velec":58,"number":0},"12":{"id":37470,"smiles":"CC(=O)Nc1cc(Br)c[nH]c1=O","cmpd_id":5079,"prot_id":37381,"protein_code":"Mac1-DLS-EU0424A:Z838838708","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-EU0424_0A_apo_18wJt62.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 12 12 0 0 0 0 0 0 0 0999 V2000\n 28.8250 53.6260 -5.0740 O 0 0 0 0 0 0 0 0 0 0 0 0\n 28.9470 54.1720 -6.1710 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.8580 55.6580 -6.3380 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.1620 53.4680 -7.3170 N 0 0 0 0 0 0 0 0 0 0 0 0\n 29.1200 52.0740 -7.3830 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.2640 51.5940 -8.4710 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.6970 52.3520 -9.2470 O 0 0 0 0 0 0 0 0 0 0 0 0\n 28.1020 50.2390 -8.5540 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.6740 49.3650 -7.6890 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.4610 49.8270 -6.7080 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.2460 48.5860 -5.5210 Br 0 0 0 0 0 0 0 0 0 0 0 0\n 29.7110 51.1950 -6.5380 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 2 0\n 3 2 1 0\n 4 2 1 0\n 5 4 1 0\n 6 5 1 0\n 7 6 2 0\n 8 6 1 0\n 9 8 1 0\n 10 9 2 0\n 11 10 1 0\n 12 10 1 0\n 12 5 2 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":229.97,"logp":1.1,"tpsa":61.96,"ha":12,"hacc":2,"hdon":2,"rots":1,"rings":1,"velec":64,"number":0},"13":{"id":37471,"smiles":"NCc1cnc2ccccc2c1","cmpd_id":5080,"prot_id":37382,"protein_code":"Mac1-DLS-EU0481A:STK346965","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-EU0481_0A_apo_XGbr7RT.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 12 13 0 0 0 0 0 0 0 0999 V2000\n 28.7300 56.4980 -9.7480 N 0 0 0 0 0 0 0 0 0 0 0 0\n 27.9160 56.2110 -8.5690 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.4560 54.9960 -7.8520 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.0100 55.0880 -6.5810 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.3610 54.0620 -5.8330 N 0 0 0 0 0 0 0 0 0 0 0 0\n 29.1660 52.8040 -6.3490 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.6510 52.6060 -7.6410 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.3070 53.7450 -8.3850 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.4480 51.6800 -5.5420 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.2340 50.4200 -6.0220 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.7370 50.2240 -7.2970 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.4450 51.2870 -8.0990 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 1 0\n 4 3 2 0\n 5 4 1 0\n 6 5 2 0\n 7 6 1 0\n 8 7 2 0\n 8 3 1 0\n 9 6 1 0\n 10 9 2 0\n 11 10 1 0\n 12 11 2 0\n 12 7 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":158.08,"logp":1.69,"tpsa":38.91,"ha":12,"hacc":2,"hdon":1,"rots":1,"rings":2,"velec":60,"number":0},"14":{"id":37473,"smiles":"NC(=O)C1=Cc2ccccc2OC1","cmpd_id":5082,"prot_id":37384,"protein_code":"Mac1-DLS-EU0569A:Z145120524","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-EU0569_0A_apo_Dm3IMbN.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 13 14 0 0 0 0 0 0 0 0999 V2000\n 27.6750 57.3510 -7.8530 O 0 0 0 0 0 0 0 0 0 0 0 0\n 27.5900 56.2710 -8.4640 C 0 0 0 0 0 0 0 0 0 0 0 0\n 26.8790 56.1590 -9.5820 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.2600 55.0460 -7.9290 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.9500 55.1980 -6.6040 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.9880 53.9910 -5.8130 O 0 0 0 0 0 0 0 0 0 0 0 0\n 28.9370 52.7720 -6.4440 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.6430 52.6530 -7.8040 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.1920 53.8250 -8.4940 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.1830 51.6540 -5.6670 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.1650 50.4010 -6.2530 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.9120 50.2660 -7.5950 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.6570 51.3800 -8.3730 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 2 0\n 3 2 1 0\n 4 2 1 0\n 5 4 1 0\n 6 5 1 0\n 7 6 1 0\n 8 7 2 0\n 9 8 1 0\n 9 4 2 0\n 10 7 1 0\n 11 10 2 0\n 12 11 1 0\n 13 12 2 0\n 13 8 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":175.06,"logp":0.95,"tpsa":52.32,"ha":13,"hacc":2,"hdon":1,"rots":1,"rings":2,"velec":66,"number":0},"15":{"id":37474,"smiles":"CNC(=O)Cn1cnc2ccccc21","cmpd_id":5083,"prot_id":37385,"protein_code":"Mac1-DLS-EU0704A:EN300-697611","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-EU0704_0A_apo_IwIl9Nm.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 14 15 0 0 0 0 0 0 0 0999 V2000\n 27.1270 56.9430 -7.5290 O 0 0 0 0 0 0 0 0 0 0 0 0\n 27.3390 56.1760 -8.4690 C 0 0 0 0 0 0 0 0 0 0 0 0\n 26.5920 56.1590 -9.5690 N 0 0 0 0 0 0 0 0 0 0 0 0\n 26.0430 57.3640 -10.1630 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.5920 55.3140 -8.5380 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.7150 54.3670 -7.4290 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.9430 54.6540 -6.1160 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.0980 53.5940 -5.3590 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.9630 52.5190 -6.2400 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.7210 52.9850 -7.5320 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.0220 51.1480 -6.0030 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.8310 50.2810 -7.0670 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.5770 50.7640 -8.3450 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.5250 52.1240 -8.6000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 2 0\n 3 2 1 0\n 4 3 1 0\n 5 2 1 0\n 6 5 1 0\n 7 6 1 0\n 8 7 2 0\n 9 8 1 0\n 10 9 2 0\n 10 6 1 0\n 11 9 1 0\n 12 11 2 0\n 13 12 1 0\n 14 13 2 0\n 14 10 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":189.09,"logp":0.78,"tpsa":46.92,"ha":14,"hacc":3,"hdon":1,"rots":2,"rings":2,"velec":72,"number":0},"16":{"id":37475,"smiles":"CCc1c(C(=O)NC)[nH]c(C)c1C(C)=O","cmpd_id":5084,"prot_id":37386,"protein_code":"Mac1-DLS-EU0716A:Z605596346","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-EU0716_0A_apo_jVjTKB7.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 15 15 0 0 0 0 0 0 0 0999 V2000\n 27.5380 56.8590 -5.5800 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.6960 56.1400 -6.2600 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.2550 55.0840 -7.2370 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.6200 55.3140 -8.4710 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.0420 56.5130 -9.0950 C 0 0 0 0 0 0 0 0 0 0 0 0\n 26.7990 56.4750 -10.4000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 26.2080 57.5990 -11.0970 C 0 0 0 0 0 0 0 0 0 0 0 0\n 26.7290 57.4990 -8.4220 O 0 0 0 0 0 0 0 0 0 0 0 0\n 27.4350 54.0660 -9.0600 N 0 0 0 0 0 0 0 0 0 0 0 0\n 27.9910 53.0960 -8.3110 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.9050 51.6630 -8.7280 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.5220 53.6880 -7.1740 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.1450 52.9200 -6.1020 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.6660 51.5480 -6.4020 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.1290 53.3430 -4.9370 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 1 0\n 4 3 2 0\n 5 4 1 0\n 6 5 1 0\n 7 6 1 0\n 8 5 2 0\n 9 4 1 0\n 10 9 1 0\n 11 10 1 0\n 12 10 2 0\n 12 3 1 0\n 13 12 1 0\n 14 13 1 0\n 15 13 2 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":208.12,"logp":1.45,"tpsa":61.96,"ha":15,"hacc":2,"hdon":2,"rots":3,"rings":1,"velec":82,"number":0},"17":{"id":37477,"smiles":"Cc1ccc(NC(=O)N[C@@H](C)CO)cc1F","cmpd_id":5086,"prot_id":37388,"protein_code":"Mac1-DLS-EU0815A:Z409974522","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-EU0815_0A_apo_2UaF08J.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 16 16 0 0 0 0 0 0 0 0999 V2000\n 28.1520 58.6780 -10.2460 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.1400 57.7050 -9.6720 C 0 0 1 0 0 0 0 0 0 0 0 0\n 25.8920 57.6260 -10.5130 C 0 0 0 0 0 0 0 0 0 0 0 0\n 25.1540 58.8340 -10.5110 O 0 0 0 0 0 0 0 0 0 0 0 0\n 27.7310 56.3720 -9.6100 N 0 0 0 0 0 0 0 0 0 0 0 0\n 27.8590 55.6410 -8.4840 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.1920 54.3390 -8.7490 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.5720 53.2820 -7.8990 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.8770 53.4320 -6.5500 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.2020 52.3110 -5.8250 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.4540 52.4720 -4.5040 F 0 0 0 0 0 0 0 0 0 0 0 0\n 29.2920 51.0540 -6.3830 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.6650 49.8480 -5.5760 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.9940 50.9220 -7.7330 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.6440 52.0250 -8.4860 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.7010 56.1120 -7.3510 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 6\n 3 2 1 0\n 4 3 1 0\n 5 2 1 0\n 6 5 1 0\n 7 6 1 0\n 8 7 1 0\n 9 8 2 0\n 10 9 1 0\n 11 10 1 0\n 12 10 2 0\n 13 12 1 0\n 14 12 1 0\n 15 14 2 0\n 15 8 1 0\n 16 6 2 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":226.11,"logp":1.64,"tpsa":61.36,"ha":16,"hacc":2,"hdon":3,"rots":3,"rings":1,"velec":88,"number":0},"18":{"id":37478,"smiles":"CNC(=O)c1cc2ccc(F)cc2nc1C","cmpd_id":5087,"prot_id":37389,"protein_code":"Mac1-DLS-EU0844A:Z199959602","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-EU0844_0A_apo_3fbwpKF.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 16 17 0 0 0 0 0 0 0 0999 V2000\n 26.7840 57.3040 -7.9450 O 0 0 0 0 0 0 0 0 0 0 0 0\n 27.4290 56.5280 -8.6440 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.4800 56.6390 -9.9700 N 0 0 0 0 0 0 0 0 0 0 0 0\n 26.7910 57.6990 -10.6830 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.1760 55.3730 -8.0450 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.8650 55.4710 -6.7990 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.1040 56.7740 -6.0950 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.9390 54.1340 -8.5770 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.4340 52.9910 -7.9370 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.1800 53.1700 -6.7630 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.3890 54.4110 -6.2090 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.1430 51.6790 -8.3620 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.5420 50.6070 -7.6330 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.2490 50.8120 -6.4840 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.4530 49.7520 -5.6590 F 0 0 0 0 0 0 0 0 0 0 0 0\n 29.6280 52.0340 -6.0540 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 2 0\n 3 2 1 0\n 4 3 1 0\n 5 2 1 0\n 6 5 2 0\n 7 6 1 0\n 8 5 1 0\n 9 8 2 0\n 10 9 1 0\n 11 10 2 0\n 11 6 1 0\n 12 9 1 0\n 13 12 2 0\n 14 13 1 0\n 15 14 1 0\n 16 14 2 0\n 16 10 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":218.09,"logp":2.04,"tpsa":41.99,"ha":16,"hacc":2,"hdon":1,"rots":1,"rings":2,"velec":82,"number":0},"19":{"id":37483,"smiles":"COc1ccc(NC(=O)Nc2cccs2)cn1","cmpd_id":718,"prot_id":37394,"protein_code":"Mac1-DLS-X0104A:Z1152242726","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-X0104_0A_apo_nRgtuh2.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 17 18 0 0 0 0 0 0 0 0999 V2000\n 27.9240 56.4830 -7.5930 O 0 0 0 0 0 0 0 0 0 0 0 0\n 27.6450 55.8590 -8.6190 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.1280 56.5000 -9.7530 N 0 0 0 0 0 0 0 0 0 0 0 0\n 26.8950 57.8720 -9.9070 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.4830 59.0900 -8.7930 S 0 0 0 0 0 0 0 0 0 0 0 0\n 26.8150 60.3450 -9.7540 C 0 0 0 0 0 0 0 0 0 0 0 0\n 26.1780 59.8770 -10.8560 C 0 0 0 0 0 0 0 0 0 0 0 0\n 26.2010 58.4380 -10.9780 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.8040 54.5040 -8.7630 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.4490 53.6150 -7.8790 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.0220 54.0960 -6.7130 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.4720 53.2140 -5.7570 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.4110 52.2330 -8.0570 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.8710 51.3540 -7.1610 N 0 0 0 0 0 0 0 0 0 0 0 0\n 29.3800 51.8540 -6.0420 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.8650 51.0600 -5.0710 O 0 0 0 0 0 0 0 0 0 0 0 0\n 29.8480 49.6490 -5.2810 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 2 0\n 3 2 1 0\n 4 3 1 0\n 5 4 1 0\n 6 5 1 0\n 7 6 2 0\n 8 7 1 0\n 8 4 2 0\n 9 2 1 0\n 10 9 1 0\n 11 10 2 0\n 12 11 1 0\n 13 10 1 0\n 14 13 2 0\n 15 14 1 0\n 15 12 2 0\n 16 15 1 0\n 17 16 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":249.06,"logp":2.8,"tpsa":63.25,"ha":17,"hacc":4,"hdon":2,"rots":3,"rings":2,"velec":88,"number":104},"20":{"id":37484,"smiles":"O=C(Nc1ccccc1)Nc1cccnc1","cmpd_id":3840,"prot_id":37395,"protein_code":"Mac1-DLS-X0128A:Z44592329","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-X0128_0A_apo_j2ToIhb.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 16 17 0 0 0 0 0 0 0 0999 V2000\n 27.5810 56.1380 -7.3950 O 0 0 0 0 0 0 0 0 0 0 0 0\n 27.5000 55.5660 -8.4790 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.9460 54.2950 -8.6920 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.4350 53.3910 -7.7330 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.0720 53.8080 -6.5680 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.4920 52.9680 -5.6180 N 0 0 0 0 0 0 0 0 0 0 0 0\n 29.3010 51.6570 -5.8300 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.6810 51.1460 -6.9460 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.2350 52.0260 -7.9120 C 0 0 0 0 0 0 0 0 0 0 0 0\n 26.9230 56.1050 -9.6030 N 0 0 0 0 0 0 0 0 0 0 0 0\n 25.9140 57.0980 -9.6860 C 0 0 0 0 0 0 0 0 0 0 0 0\n 25.7650 57.7930 -10.8840 C 0 0 0 0 0 0 0 0 0 0 0 0\n 24.7520 58.7320 -11.0170 C 0 0 0 0 0 0 0 0 0 0 0 0\n 23.8900 58.9880 -9.9600 C 0 0 0 0 0 0 0 0 0 0 0 0\n 24.0480 58.3100 -8.7640 C 0 0 0 0 0 0 0 0 0 0 0 0\n 25.0470 57.3580 -8.6260 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 2 0\n 3 2 1 0\n 4 3 1 0\n 5 4 2 0\n 6 5 1 0\n 7 6 2 0\n 8 7 1 0\n 9 8 2 0\n 9 4 1 0\n 10 2 1 0\n 11 10 1 0\n 12 11 2 0\n 13 12 1 0\n 14 13 2 0\n 15 14 1 0\n 16 15 2 0\n 16 11 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":213.09,"logp":2.73,"tpsa":54.02,"ha":16,"hacc":2,"hdon":2,"rots":2,"rings":2,"velec":80,"number":128},"21":{"id":37486,"smiles":"COc1ccc(NC(=O)Nc2ccncc2)cc1","cmpd_id":120,"prot_id":37397,"protein_code":"Mac1-DLS-X0142A:Z321318226","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-X0142_0A_apo_icJcpuu.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 18 19 0 0 0 0 0 0 0 0999 V2000\n 29.0550 54.5350 -6.1750 O 0 0 0 0 0 0 0 0 0 0 0 0\n 28.5900 54.2260 -7.2730 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.4330 52.9390 -7.7130 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.8000 51.7520 -7.0590 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.1400 51.7050 -5.7140 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.5230 50.4880 -5.1830 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.5850 49.3530 -5.8900 N 0 0 0 0 0 0 0 0 0 0 0 0\n 29.2330 49.4210 -7.1790 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.8340 50.5860 -7.8060 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.1150 55.1190 -8.1980 N 0 0 0 0 0 0 0 0 0 0 0 0\n 27.8910 56.5110 -8.0720 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.7870 57.1870 -6.8570 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.5000 58.5420 -6.8350 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.7030 57.2070 -9.2630 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.4080 58.5580 -9.2440 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.3000 59.2270 -8.0280 C 0 0 0 0 0 0 0 0 0 0 0 0\n 26.9310 60.5480 -7.9310 O 0 0 0 0 0 0 0 0 0 0 0 0\n 26.6050 61.2620 -9.1290 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 2 0\n 3 2 1 0\n 4 3 1 0\n 5 4 2 0\n 6 5 1 0\n 7 6 2 0\n 8 7 1 0\n 9 8 2 0\n 9 4 1 0\n 10 2 1 0\n 11 10 1 0\n 12 11 2 0\n 13 12 1 0\n 14 11 1 0\n 15 14 2 0\n 16 15 1 0\n 16 13 2 0\n 17 16 1 0\n 18 17 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":243.1,"logp":2.73,"tpsa":63.25,"ha":18,"hacc":3,"hdon":2,"rots":3,"rings":2,"velec":92,"number":142},"22":{"id":37495,"smiles":"OCC1CCN(c2ncccn2)CC1","cmpd_id":131,"prot_id":37406,"protein_code":"Mac1-DLS-X0282A:Z645232558","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-X0282_0A_apo_TFFROiW.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 14 15 0 0 0 0 0 0 0 0999 V2000\n 29.2910 55.3930 -6.0150 O 0 0 0 0 0 0 0 0 0 0 0 0\n 29.4460 54.9110 -7.3500 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.0300 53.4630 -7.5230 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.0070 52.9720 -8.5330 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.5560 51.6810 -9.1310 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.8020 50.6300 -8.1320 N 0 0 0 0 0 0 0 0 0 0 0 0\n 29.6120 51.0810 -6.9910 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.1820 52.4180 -6.4290 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.7560 49.3050 -8.4810 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.2120 49.0090 -9.6860 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.2380 47.7130 -10.0180 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.7910 46.7290 -9.2230 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.3680 47.1460 -8.0480 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.3540 48.4250 -7.6340 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 1 0\n 4 3 1 0\n 5 4 1 0\n 6 5 1 0\n 7 6 1 0\n 8 7 1 0\n 8 3 1 0\n 9 6 1 0\n 10 9 2 0\n 11 10 1 0\n 12 11 2 0\n 13 12 1 0\n 14 13 2 0\n 14 9 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":193.12,"logp":0.69,"tpsa":49.25,"ha":14,"hacc":4,"hdon":1,"rots":2,"rings":2,"velec":76,"number":282},"23":{"id":37496,"smiles":"CNCC(=O)Nc1cc(C)ccn1","cmpd_id":3949,"prot_id":37407,"protein_code":"Mac1-DLS-X0290A:Z927746322","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-X0290_0A_apo_EdXrU65.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 13 13 0 0 0 0 0 0 0 0999 V2000\n 29.6200 52.2460 -6.7710 O 0 0 0 0 0 0 0 0 0 0 0 0\n 28.9620 52.5160 -7.7720 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.7080 53.9620 -8.1580 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.5750 54.9000 -7.4320 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.8440 55.6740 -6.4230 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.4160 51.5860 -8.5980 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.5930 50.1890 -8.5830 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.2230 49.5230 -9.7000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.3820 48.1870 -9.7010 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.9220 47.4790 -8.6400 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.3360 48.1670 -7.5020 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.0110 47.4500 -6.3590 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.1470 49.5440 -7.4630 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 2 0\n 3 2 1 0\n 4 3 1 0\n 5 4 1 0\n 6 2 1 0\n 7 6 1 0\n 8 7 2 0\n 9 8 1 0\n 10 9 2 0\n 11 10 1 0\n 12 11 1 0\n 13 11 2 0\n 13 7 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":179.11,"logp":0.55,"tpsa":54.02,"ha":13,"hacc":3,"hdon":2,"rots":3,"rings":1,"velec":70,"number":290},"24":{"id":37497,"smiles":"CCCC(=O)NCc1nc2ccccc2[nH]1","cmpd_id":588,"prot_id":37408,"protein_code":"Mac1-DLS-X0299A:Z26781952","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-X0299_0A_apo_Bh2B2CE.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 16 17 0 0 0 0 0 0 0 0999 V2000\n 26.5430 57.1080 -7.6510 O 0 0 0 0 0 0 0 0 0 0 0 0\n 27.1990 56.7660 -8.6310 C 0 0 0 0 0 0 0 0 0 0 0 0\n 26.6010 56.7840 -10.0200 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.0470 57.9610 -10.8650 C 0 0 0 0 0 0 0 0 0 0 0 0\n 26.2570 59.2240 -10.5950 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.4600 56.3460 -8.5350 N 0 0 0 0 0 0 0 0 0 0 0 0\n 29.0430 55.9980 -7.2540 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.0140 54.4820 -7.0510 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.7040 53.6110 -8.0420 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.7610 52.3450 -7.5010 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.1210 52.5220 -6.1660 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.2730 53.8840 -5.9030 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.5420 51.0890 -8.0410 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.7010 49.9920 -7.2100 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.0600 50.1520 -5.8750 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.2720 51.4140 -5.3400 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 2 0\n 3 2 1 0\n 4 3 1 0\n 5 4 1 0\n 6 2 1 0\n 7 6 1 0\n 8 7 1 0\n 9 8 2 0\n 10 9 1 0\n 11 10 2 0\n 12 11 1 0\n 12 8 1 0\n 13 10 1 0\n 14 13 2 0\n 15 14 1 0\n 16 15 2 0\n 16 11 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":217.12,"logp":1.98,"tpsa":57.78,"ha":16,"hacc":2,"hdon":2,"rots":4,"rings":2,"velec":84,"number":299},"25":{"id":37500,"smiles":"O=C(NCc1nc2ccccc2[nH]1)c1ccco1","cmpd_id":419,"prot_id":37411,"protein_code":"Mac1-DLS-X0371A:Z26781964","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-X0371_0A_apo_DK274Q7.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 18 20 0 0 0 0 0 0 0 0999 V2000\n 26.7930 57.3040 -7.2310 O 0 0 0 0 0 0 0 0 0 0 0 0\n 27.2360 56.8980 -8.3090 C 0 0 0 0 0 0 0 0 0 0 0 0\n 26.5700 57.2490 -9.5850 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.0570 56.7040 -10.7380 O 0 0 0 0 0 0 0 0 0 0 0 0\n 26.2380 57.1500 -11.7390 C 0 0 0 0 0 0 0 0 0 0 0 0\n 25.2860 57.9370 -11.2560 C 0 0 0 0 0 0 0 0 0 0 0 0\n 25.4880 58.0120 -9.8610 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.3220 56.1270 -8.4030 N 0 0 0 0 0 0 0 0 0 0 0 0\n 29.0770 55.7520 -7.2250 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.0130 54.2650 -6.9770 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.6570 53.4010 -7.9570 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.7220 52.1320 -7.4230 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.1300 52.3040 -6.1000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.2990 53.6610 -5.8390 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.4890 50.8800 -7.9600 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.6850 49.7780 -7.1400 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.0960 49.9340 -5.8200 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.3190 51.1930 -5.2850 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 2 0\n 3 2 1 0\n 4 3 1 0\n 5 4 1 0\n 6 5 2 0\n 7 6 1 0\n 7 3 2 0\n 8 2 1 0\n 9 8 1 0\n 10 9 1 0\n 11 10 2 0\n 12 11 1 0\n 13 12 2 0\n 14 13 1 0\n 14 10 1 0\n 15 12 1 0\n 16 15 2 0\n 17 16 1 0\n 18 17 2 0\n 18 13 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":241.09,"logp":2.09,"tpsa":70.92,"ha":18,"hacc":3,"hdon":2,"rots":3,"rings":3,"velec":90,"number":371},"26":{"id":37503,"smiles":"NC(=O)c1c[nH]c(C2CC2)n1","cmpd_id":512,"prot_id":37414,"protein_code":"Mac1-DLS-X0421A:Z1407672867","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-X0421_0A_apo_UId9Gcy.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 11 12 0 0 0 0 0 0 0 0999 V2000\n 29.5590 48.1970 -6.5240 O 0 0 0 0 0 0 0 0 0 0 0 0\n 29.5210 49.3730 -6.1360 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.8470 49.7350 -4.9020 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.9960 50.4410 -7.0260 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.0580 51.7950 -6.7060 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.5160 52.3930 -7.7590 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.1130 51.5290 -8.7150 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.4210 50.2950 -8.2550 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.3600 53.8480 -7.9950 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.5750 54.7270 -8.0670 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.6770 54.8290 -6.9020 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 2 0\n 3 2 1 0\n 4 2 1 0\n 5 4 1 0\n 6 5 2 0\n 7 6 1 0\n 8 7 1 0\n 8 4 2 0\n 9 6 1 0\n 10 9 1 0\n 11 9 1 0\n 11 10 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":151.07,"logp":0.39,"tpsa":71.77,"ha":11,"hacc":2,"hdon":2,"rots":2,"rings":2,"velec":58,"number":421},"27":{"id":37506,"smiles":"CS(=O)(=O)Cc1nc2ccccc2[nH]1","cmpd_id":3854,"prot_id":37417,"protein_code":"Mac1-DLS-X0438A:Z126932614","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-X0438_0A_apo_w6aJZXI.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 14 15 0 0 0 0 0 0 0 0999 V2000\n 26.9880 56.6630 -6.2260 O 0 0 0 0 0 0 0 0 0 0 0 0\n 27.7390 56.9550 -7.4160 S 0 0 0 0 0 0 0 0 0 0 0 0\n 28.0960 58.3310 -7.6520 O 0 0 0 0 0 0 0 0 0 0 0 0\n 26.8630 56.3480 -8.8100 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.2440 55.9960 -7.3770 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.0910 54.5310 -7.1850 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.7460 53.6740 -8.1740 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.7230 52.4130 -7.6270 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.0590 52.5810 -6.2850 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.2920 53.9280 -6.0290 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.4660 51.1670 -8.1690 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.5700 50.0660 -7.3320 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.9090 50.2160 -5.9910 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.1400 51.4730 -5.4510 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 2 0\n 3 2 2 0\n 2 4 1 0\n 5 2 1 0\n 6 5 1 0\n 7 6 2 0\n 8 7 1 0\n 9 8 2 0\n 10 9 1 0\n 10 6 1 0\n 11 8 1 0\n 12 11 2 0\n 13 12 1 0\n 14 13 2 0\n 14 9 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":210.05,"logp":1.11,"tpsa":62.82,"ha":14,"hacc":3,"hdon":1,"rots":2,"rings":2,"velec":74,"number":438},"28":{"id":37509,"smiles":"CC(C)C(=O)NCc1nc2ccccc2[nH]1","cmpd_id":3953,"prot_id":37420,"protein_code":"Mac1-DLS-X0471A:Z26781943","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-X0471_0A_apo_kOWyFeC.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 16 17 0 0 0 0 0 0 0 0999 V2000\n 26.7470 57.0960 -7.9770 O 0 0 0 0 0 0 0 0 0 0 0 0\n 27.7050 57.0250 -8.7490 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.5930 57.4530 -10.2110 C 0 0 0 0 0 0 0 0 0 0 0 0\n 26.1780 57.2580 -10.6850 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.0590 58.8930 -10.3850 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.9010 56.5830 -8.3630 N 0 0 0 0 0 0 0 0 0 0 0 0\n 29.1470 56.1300 -7.0100 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.0140 54.6320 -6.9290 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.5130 53.8870 -7.9420 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.4920 52.5780 -7.5120 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.0270 52.5990 -6.2240 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.3410 53.9120 -5.8730 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.0590 51.4050 -8.1090 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.1980 50.2260 -7.3910 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.7500 50.2290 -6.1110 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.1630 51.4100 -5.5130 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 2 0\n 3 2 1 0\n 3 4 1 0\n 5 3 1 0\n 6 2 1 0\n 7 6 1 0\n 8 7 1 0\n 9 8 2 0\n 10 9 1 0\n 11 10 2 0\n 12 11 1 0\n 12 8 1 0\n 13 10 1 0\n 14 13 2 0\n 15 14 1 0\n 16 15 2 0\n 16 11 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":217.12,"logp":1.84,"tpsa":57.78,"ha":16,"hacc":2,"hdon":2,"rots":3,"rings":2,"velec":84,"number":471},"29":{"id":37515,"smiles":"COc1ccc2sc(N)nc2c1","cmpd_id":195,"prot_id":37426,"protein_code":"Mac1-DLS-X0574A:Z1954800564","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-X0574_0A_apo_7QDxh52.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 12 13 0 0 0 0 0 0 0 0999 V2000\n 28.6490 47.5700 -10.7720 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.5850 48.4820 -9.8220 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.9340 48.0470 -8.1500 S 0 0 0 0 0 0 0 0 0 0 0 0\n 28.3710 49.7490 -10.0420 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.5070 50.4810 -8.8690 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.8210 49.7300 -7.7290 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.0670 50.3430 -6.5090 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.0030 51.7200 -6.4390 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.4100 51.8620 -8.7780 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.6560 52.4640 -7.5570 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.5340 53.8170 -7.3800 O 0 0 0 0 0 0 0 0 0 0 0 0\n 28.1390 54.6160 -8.5010 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 1 0\n 4 2 2 0\n 5 4 1 0\n 6 3 1 0\n 6 5 2 0\n 7 6 1 0\n 8 7 2 0\n 9 5 1 0\n 10 9 2 0\n 10 8 1 0\n 11 10 1 0\n 12 11 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":180.04,"logp":1.89,"tpsa":48.14,"ha":12,"hacc":4,"hdon":1,"rots":1,"rings":2,"velec":62,"number":574},"30":{"id":37516,"smiles":"NC(=O)c1cnc(C(F)(F)F)nc1","cmpd_id":198,"prot_id":37427,"protein_code":"Mac1-DLS-X0587A:Z1745658474","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-X0587_0A_apo_EOo612O.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 13 13 0 0 0 0 0 0 0 0999 V2000\n 29.3530 51.0720 -4.7730 F 0 0 0 0 0 0 0 0 0 0 0 0\n 29.6700 51.1240 -6.0590 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.1290 50.0630 -6.6260 F 0 0 0 0 0 0 0 0 0 0 0 0\n 30.9700 50.9490 -6.1500 F 0 0 0 0 0 0 0 0 0 0 0 0\n 29.2240 52.4220 -6.6960 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.5620 52.3570 -7.8560 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.1750 53.5490 -8.3320 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.5480 53.5030 -5.9750 N 0 0 0 0 0 0 0 0 0 0 0 0\n 29.1340 54.6630 -6.4990 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.4200 54.7550 -7.6870 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.8440 56.0510 -8.1850 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.9710 57.0770 -7.5000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 27.1800 56.0360 -9.3390 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 1 0\n 4 2 1 0\n 5 2 1 0\n 6 5 2 0\n 7 6 1 0\n 8 5 1 0\n 9 8 2 0\n 10 7 2 0\n 10 9 1 0\n 11 10 1 0\n 12 11 2 0\n 13 11 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":191.03,"logp":0.59,"tpsa":68.87,"ha":13,"hacc":3,"hdon":1,"rots":1,"rings":1,"velec":70,"number":587},"31":{"id":37517,"smiles":"CNC(=O)c1ccc(S(N)(=O)=O)cc1","cmpd_id":250,"prot_id":37428,"protein_code":"Mac1-DLS-X0591A:Z165170770","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-X0591_0A_apo_Tt69iSv.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 14 14 0 0 0 0 0 0 0 0999 V2000\n 31.1110 48.0200 -2.3980 O 0 0 0 0 0 0 0 0 0 0 0 0\n 31.0300 47.8000 -3.8160 S 0 0 0 0 0 0 0 0 0 0 0 0\n 32.2190 47.4030 -4.5220 O 0 0 0 0 0 0 0 0 0 0 0 0\n 29.9220 46.6530 -4.0540 N 0 0 0 0 0 0 0 0 0 0 0 0\n 30.4530 49.2970 -4.5600 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.0110 50.3320 -3.7510 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.6010 51.5190 -4.3300 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.4630 49.4360 -5.9410 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.0370 50.6260 -6.5080 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.6250 51.6830 -5.7110 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.3090 53.0310 -6.2680 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.4180 54.0360 -5.5740 O 0 0 0 0 0 0 0 0 0 0 0 0\n 28.9030 53.0800 -7.5330 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.4950 54.3210 -8.1610 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 2 0\n 3 2 2 0\n 2 4 1 0\n 5 2 1 0\n 6 5 2 0\n 7 6 1 0\n 8 5 1 0\n 9 8 2 0\n 10 9 1 0\n 10 7 2 0\n 11 10 1 0\n 12 11 2 0\n 13 11 1 0\n 14 13 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":214.04,"logp":-0.31,"tpsa":89.26,"ha":14,"hacc":3,"hdon":2,"rots":2,"rings":1,"velec":76,"number":591},"32":{"id":37518,"smiles":"NC(=O)c1cnn(CCO)c1","cmpd_id":3954,"prot_id":37429,"protein_code":"Mac1-DLS-X0592A:Z1562205518","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-X0592_0A_apo_LHofLhV.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 11 11 0 0 0 0 0 0 0 0999 V2000\n 29.2660 49.3630 -6.9280 O 0 0 0 0 0 0 0 0 0 0 0 0\n 28.8640 50.3610 -7.5350 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.2520 50.3300 -8.7120 N 0 0 0 0 0 0 0 0 0 0 0 0\n 29.0650 51.6820 -6.9090 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.8730 52.9100 -7.5110 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.1010 53.8430 -6.5720 N 0 0 0 0 0 0 0 0 0 0 0 0\n 29.4270 53.3020 -5.3730 N 0 0 0 0 0 0 0 0 0 0 0 0\n 29.4190 51.9980 -5.5880 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.0350 55.2940 -6.7090 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.8540 55.6920 -8.1530 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.5850 55.2660 -8.6480 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 2 0\n 3 2 1 0\n 4 2 1 0\n 5 4 2 0\n 6 5 1 0\n 7 6 1 0\n 8 4 1 0\n 8 7 2 0\n 9 6 1 0\n 10 9 1 0\n 11 10 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":155.07,"logp":-1.03,"tpsa":81.14,"ha":11,"hacc":4,"hdon":2,"rots":3,"rings":1,"velec":60,"number":592},"33":{"id":37521,"smiles":"CCC(=O)Nc1nc(C)cs1","cmpd_id":282,"prot_id":37432,"protein_code":"Mac1-DLS-X0626A:Z30820160","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-X0626_0A_apo_uzXr4Gs.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 11 11 0 0 0 0 0 0 0 0999 V2000\n 29.2360 52.9870 -6.1530 O 0 0 0 0 0 0 0 0 0 0 0 0\n 28.8520 53.3260 -7.2680 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.7100 54.7580 -7.6950 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.2470 55.6980 -6.7010 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.5120 52.4500 -8.2470 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.6360 51.0870 -8.1410 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.1870 50.2760 -6.7150 S 0 0 0 0 0 0 0 0 0 0 0 0\n 28.9480 48.7820 -7.5410 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.5000 48.9820 -8.8030 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.3150 50.3130 -9.1470 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.2550 47.9270 -9.8340 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 2 0\n 3 2 1 0\n 4 3 1 0\n 5 2 1 0\n 6 5 1 0\n 7 6 1 0\n 8 7 1 0\n 9 8 2 0\n 10 9 1 0\n 10 6 2 0\n 11 9 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":170.05,"logp":1.8,"tpsa":41.99,"ha":11,"hacc":3,"hdon":1,"rots":2,"rings":1,"velec":60,"number":626},"34":{"id":37527,"smiles":"NC(=O)[C@H]1CCCn2ccnc21","cmpd_id":3958,"prot_id":37438,"protein_code":"Mac1-DLS-X0681A:Z1324853681","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-X0681_0A_apo_YaUy11d.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 12 13 0 0 0 0 0 0 0 0999 V2000\n 30.1220 48.8480 -5.9260 O 0 0 0 0 0 0 0 0 0 0 0 0\n 29.5820 49.9420 -6.1090 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.1920 50.7370 -5.1300 N 0 0 0 0 0 0 0 0 0 0 0 0\n 29.4070 50.5390 -7.4870 C 0 0 2 0 0 0 0 0 0 0 0 0\n 30.3230 51.6890 -7.4960 C 0 0 0 0 0 0 0 0 0 0 0 0\n 31.4930 51.7090 -6.8910 N 0 0 0 0 0 0 0 0 0 0 0 0\n 31.9390 53.0040 -7.0400 C 0 0 0 0 0 0 0 0 0 0 0 0\n 31.0570 53.7290 -7.7620 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.0220 52.8840 -8.0460 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.7670 53.2240 -8.7190 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.8700 52.0070 -8.8640 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.9700 51.0870 -7.6540 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 2 0\n 3 2 1 0\n 4 2 1 1\n 5 4 1 0\n 6 5 2 0\n 7 6 1 0\n 8 7 2 0\n 9 8 1 0\n 9 5 1 0\n 10 9 1 0\n 11 10 1 0\n 12 11 1 0\n 12 4 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":165.09,"logp":0.25,"tpsa":60.91,"ha":12,"hacc":3,"hdon":1,"rots":1,"rings":2,"velec":64,"number":681},"35":{"id":37528,"smiles":"CCNc1ccc(C#N)cn1","cmpd_id":3834,"prot_id":37439,"protein_code":"Mac1-DLS-X0685A:Z219104216","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-X0685_0A_apo_KHBo4QB.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 11 11 0 0 0 0 0 0 0 0999 V2000\n 29.9080 49.1440 -4.7070 N 0 0 0 0 0 0 0 0 0 0 0 0\n 29.5680 49.9090 -5.4800 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.1500 50.9090 -6.4200 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.5940 50.5520 -7.6430 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.1530 51.5370 -8.5060 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.2610 52.2640 -6.1200 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.8440 53.2320 -6.9400 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.2910 52.8730 -8.1090 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.7760 53.8600 -8.8870 N 0 0 0 0 0 0 0 0 0 0 0 0\n 27.8660 55.2890 -8.5910 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.1650 55.8820 -9.0820 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 3 0\n 3 2 1 0\n 4 3 2 0\n 5 4 1 0\n 6 3 1 0\n 7 6 2 0\n 8 7 1 0\n 8 5 2 0\n 9 8 1 0\n 10 9 1 0\n 11 10 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":147.08,"logp":1.39,"tpsa":48.71,"ha":11,"hacc":3,"hdon":1,"rots":2,"rings":1,"velec":56,"number":685},"36":{"id":37530,"smiles":"CNc1ncccn1","cmpd_id":298,"prot_id":37441,"protein_code":"Mac1-DLS-X0689A:Z54628578","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-X0689_0A_apo_UHe0K63.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 8 8 0 0 0 0 0 0 0 0999 V2000\n 28.1390 52.0920 -7.8340 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.9900 51.1340 -8.9080 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.3700 49.8510 -8.8550 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.8960 49.4110 -7.6890 N 0 0 0 0 0 0 0 0 0 0 0 0\n 29.1960 48.1000 -7.6480 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.9810 47.2370 -8.7070 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.4490 47.8070 -9.8540 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.1490 49.1100 -9.9630 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 1 0\n 4 3 2 0\n 5 4 1 0\n 6 5 2 0\n 7 6 1 0\n 8 7 2 0\n 8 3 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":109.06,"logp":0.52,"tpsa":37.81,"ha":8,"hacc":3,"hdon":1,"rots":1,"rings":1,"velec":42,"number":689},"37":{"id":37531,"smiles":"CS(=O)(=O)Nc1ccc(C(N)=O)cc1","cmpd_id":98,"prot_id":37442,"protein_code":"Mac1-DLS-X0711A:mArh-x0711","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-X0711_0A_apo_kauNMDc.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 14 14 0 0 0 0 0 0 0 0999 V2000\n 29.3290 54.3930 -5.9950 O 0 0 0 0 0 0 0 0 0 0 0 0\n 29.0600 53.6180 -6.9180 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.6230 54.0290 -8.0970 N 0 0 0 0 0 0 0 0 0 0 0 0\n 29.2090 52.1450 -6.7070 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.0410 51.2460 -7.7520 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.1780 49.8860 -7.5410 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.5160 51.6550 -5.4450 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.6540 50.2960 -5.2280 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.4790 49.3990 -6.2750 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.4160 47.9950 -6.0100 N 0 0 0 0 0 0 0 0 0 0 0 0\n 30.5360 46.8400 -6.2570 S 0 0 0 0 0 0 0 0 0 0 0 0\n 30.1170 45.7050 -5.4930 O 0 0 0 0 0 0 0 0 0 0 0 0\n 30.7060 46.6960 -7.6710 O 0 0 0 0 0 0 0 0 0 0 0 0\n 32.0280 47.4480 -5.5690 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 2 0\n 3 2 1 0\n 4 2 1 0\n 5 4 2 0\n 6 5 1 0\n 7 4 1 0\n 8 7 2 0\n 9 6 2 0\n 9 8 1 0\n 10 9 1 0\n 11 10 1 0\n 12 11 2 0\n 13 11 2 0\n 11 14 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":214.04,"logp":0.16,"tpsa":89.26,"ha":14,"hacc":3,"hdon":2,"rots":3,"rings":1,"velec":76,"number":711},"38":{"id":37532,"smiles":"Cc1nn(C)c(C)c1CC(N)=O","cmpd_id":3959,"prot_id":37443,"protein_code":"Mac1-DLS-X0722A:Z287484230","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-X0722_0A_apo_QVojih9.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 12 12 0 0 0 0 0 0 0 0999 V2000\n 29.1090 53.6310 -5.3170 O 0 0 0 0 0 0 0 0 0 0 0 0\n 29.3720 52.7910 -6.1820 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.2210 53.0120 -7.1760 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.7220 51.4300 -6.1290 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.5510 50.7680 -7.4690 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.9210 51.2900 -8.6120 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.2590 52.6170 -8.7810 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.8820 49.4690 -7.8210 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.6240 48.4660 -7.0090 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.4470 49.2850 -9.0820 N 0 0 0 0 0 0 0 0 0 0 0 0\n 27.8710 50.4010 -9.5910 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.4860 48.0750 -9.8940 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 2 0\n 3 2 1 0\n 4 2 1 0\n 5 4 1 0\n 6 5 1 0\n 7 6 1 0\n 8 5 2 0\n 9 8 1 0\n 10 8 1 0\n 11 10 1 0\n 11 6 2 0\n 12 10 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":167.11,"logp":0.06,"tpsa":60.91,"ha":12,"hacc":3,"hdon":1,"rots":2,"rings":1,"velec":66,"number":722},"39":{"id":37533,"smiles":"CNCc1cnn(-c2ccccc2)c1","cmpd_id":99,"prot_id":37444,"protein_code":"Mac1-DLS-X0724A:Z102768020","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-X0724_0A_apo_Ks9l6cR.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 14 15 0 0 0 0 0 0 0 0999 V2000\n 27.6400 57.8050 -10.8180 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.2660 56.7690 -9.9910 N 0 0 0 0 0 0 0 0 0 0 0 0\n 27.4040 56.3790 -8.8730 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.0810 55.3510 -8.0430 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.1480 54.0110 -8.3280 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.8220 53.4160 -7.3210 N 0 0 0 0 0 0 0 0 0 0 0 0\n 29.2170 54.3130 -6.3710 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.7700 55.4760 -6.8160 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.1170 52.0300 -7.1620 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.9050 51.6120 -6.1000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.0190 50.2630 -5.8160 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.3820 49.3370 -6.6040 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.6200 49.7530 -7.6810 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.4860 51.1020 -7.9660 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 1 0\n 4 3 1 0\n 5 4 2 0\n 6 5 1 0\n 7 6 1 0\n 8 7 2 0\n 8 4 1 0\n 9 6 1 0\n 10 9 2 0\n 11 10 1 0\n 12 11 2 0\n 13 12 1 0\n 14 13 2 0\n 14 9 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":187.11,"logp":1.59,"tpsa":29.85,"ha":14,"hacc":3,"hdon":1,"rots":3,"rings":2,"velec":72,"number":724},"40":{"id":37539,"smiles":"CC(=O)N1[C@H]2CC[C@@H]1Cc1ncccc12","cmpd_id":3963,"prot_id":37450,"protein_code":"Mac1-DLS-X0742A:POB0103","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-X0742_0A_apo_7wOrDno.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 15 17 0 0 0 0 0 0 0 0999 V2000\n 32.3650 51.7060 -6.9870 O 0 0 0 0 0 0 0 0 0 0 0 0\n 31.4030 52.3090 -7.4550 C 0 0 0 0 0 0 0 0 0 0 0 0\n 31.5210 53.7000 -7.9970 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.1890 51.7100 -7.5340 N 0 0 0 0 0 0 0 0 0 0 0 0\n 29.8890 50.4380 -6.8720 C 0 0 1 0 0 0 0 0 0 0 0 0\n 28.5810 50.7860 -6.1550 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.9050 51.8260 -7.0890 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.9460 52.1790 -8.1600 C 0 0 2 0 0 0 0 0 0 0 0 0\n 29.4740 49.4760 -7.9730 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.6640 48.1080 -7.8050 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.2860 47.2380 -8.8110 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.7240 47.7610 -9.9690 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.5390 49.0710 -10.1820 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.9010 49.9120 -9.1980 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.7180 51.3870 -9.4400 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 2 0\n 3 2 1 0\n 4 2 1 0\n 5 4 1 0\n 5 6 1 1\n 7 6 1 0\n 8 7 1 1\n 8 4 1 0\n 9 5 1 0\n 10 9 2 0\n 11 10 1 0\n 12 11 2 0\n 13 12 1 0\n 14 13 2 0\n 14 9 1 0\n 15 14 1 0\n 15 8 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":202.11,"logp":1.69,"tpsa":33.2,"ha":15,"hacc":2,"hdon":0,"rots":0,"rings":3,"velec":78,"number":742},"41":{"id":37540,"smiles":"O=C(O)[C@@H]1CCC[C@@H]1c1ccsc1","cmpd_id":3964,"prot_id":37451,"protein_code":"Mac1-DLS-X0766A:POB0128","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-X0766_0A_apo_FRBGyJU.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 13 14 0 0 0 0 0 0 0 0999 V2000\n 31.1140 45.7420 -8.4760 O 0 0 0 0 0 0 0 0 0 0 0 0\n 32.0390 46.2180 -7.6910 C 0 0 0 0 0 0 0 0 0 0 0 0\n 33.0430 46.7320 -8.0790 O 0 0 0 0 0 0 0 0 0 0 0 0\n 31.7800 46.0130 -6.2250 C 0 0 2 0 0 0 0 0 0 0 0 0\n 29.1680 48.0870 -7.3270 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.7450 49.3850 -7.5450 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.2870 49.1680 -5.6470 C 0 0 0 0 0 0 0 0 0 0 0 0\n 31.7210 44.5220 -5.8600 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.2450 44.2070 -5.7070 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.0400 47.9510 -6.2190 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.4800 46.6280 -5.6370 C 0 0 1 0 0 0 0 0 0 0 0 0\n 29.4280 50.4280 -6.4170 S 0 0 0 0 0 0 0 0 0 0 0 0\n 29.4670 45.5030 -5.8740 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 2 0\n 3 2 1 0\n 4 2 1 6\n 6 5 2 0\n 8 4 1 0\n 9 8 1 0\n 10 5 1 0\n 10 7 2 0\n 11 10 1 6\n 11 4 1 0\n 12 7 1 0\n 12 6 1 0\n 13 11 1 0\n 13 9 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":196.06,"logp":2.72,"tpsa":37.3,"ha":13,"hacc":2,"hdon":1,"rots":2,"rings":2,"velec":70,"number":766},"42":{"id":37545,"smiles":"COc1cccc([C@H]2CCOC[C@H]2C(=O)O)c1","cmpd_id":3968,"prot_id":37456,"protein_code":"Mac1-DLS-X0805A:POB0136","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-X0805_0A_apo_tTDcxik.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 17 18 0 0 0 0 0 0 0 0999 V2000\n 31.1620 46.0110 -8.4640 O 0 0 0 0 0 0 0 0 0 0 0 0\n 32.1180 46.1010 -7.7370 C 0 0 0 0 0 0 0 0 0 0 0 0\n 33.2850 46.4710 -8.1400 O 0 0 0 0 0 0 0 0 0 0 0 0\n 32.0760 45.7930 -6.2630 C 0 0 2 0 0 0 0 0 0 0 0 0\n 32.0460 44.2850 -6.0700 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.7710 43.6780 -6.3810 O 0 0 0 0 0 0 0 0 0 0 0 0\n 29.7400 44.2210 -5.5480 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.5600 45.6970 -5.7980 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.8710 46.4560 -5.5440 C 0 0 2 0 0 0 0 0 0 0 0 0\n 30.7530 47.9360 -5.8650 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.5780 48.4600 -6.4010 C 0 0 0 0 0 0 0 0 0 0 0 0\n 31.8170 48.7920 -5.6180 C 0 0 0 0 0 0 0 0 0 0 0 0\n 31.7080 50.1480 -5.8860 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.5290 50.6730 -6.3990 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.4710 49.8190 -6.6640 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.2640 50.1950 -7.2030 O 0 0 0 0 0 0 0 0 0 0 0 0\n 28.0390 51.5720 -7.5050 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 2 0\n 4 2 1 6\n 5 4 1 0\n 6 5 1 0\n 7 6 1 0\n 8 7 1 0\n 9 8 1 0\n 9 4 1 0\n 9 10 1 6\n 11 10 2 0\n 12 10 1 0\n 13 12 2 0\n 14 13 1 0\n 15 11 1 0\n 15 14 2 0\n 16 15 1 0\n 17 16 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":236.1,"logp":1.9,"tpsa":55.76,"ha":17,"hacc":3,"hdon":1,"rots":3,"rings":2,"velec":92,"number":805},"43":{"id":37548,"smiles":"O=c1cc(I)cc[nH]1","cmpd_id":3971,"prot_id":37459,"protein_code":"Mac1-DLS-X0837A:NCL-00023824","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-X0837_0A_apo_DqbRkgX.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 8 8 0 0 0 0 0 0 0 0999 V2000\n 29.8990 49.2560 -5.5900 I 0 0 0 0 0 0 0 0 0 0 0 0\n 29.1250 50.9450 -6.5790 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.3170 52.1370 -6.0090 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.4690 50.8170 -7.8550 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.0590 51.9480 -8.4610 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.2740 53.1560 -7.8910 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.9070 53.3320 -6.6800 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.1240 54.4840 -6.2750 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 2 0\n 4 2 1 0\n 5 4 2 0\n 6 5 1 0\n 7 6 1 0\n 7 3 1 0\n 8 7 2 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":220.93,"logp":0.98,"tpsa":32.86,"ha":8,"hacc":1,"hdon":1,"rots":0,"rings":1,"velec":42,"number":837},"44":{"id":37549,"smiles":"O=c1cc(Br)cc[nH]1","cmpd_id":3972,"prot_id":37460,"protein_code":"Mac1-DLS-X0844A:NCL-00023825","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-X0844_0A_apo_CUdiSnk.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 8 8 0 0 0 0 0 0 0 0999 V2000\n 29.7580 49.3480 -5.5230 Br 0 0 0 0 0 0 0 0 0 0 0 0\n 29.1250 50.9060 -6.3670 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.2990 52.0970 -5.7560 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.5650 50.8030 -7.6660 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.2590 51.9530 -8.2860 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.4860 53.1520 -7.6910 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.9910 53.2910 -6.4250 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.1230 54.4250 -5.9470 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 2 0\n 4 2 1 0\n 5 4 2 0\n 6 5 1 0\n 7 6 1 0\n 7 3 1 0\n 8 7 2 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":172.95,"logp":1.14,"tpsa":32.86,"ha":8,"hacc":1,"hdon":1,"rots":0,"rings":1,"velec":42,"number":844},"45":{"id":37550,"smiles":"Brc1ccnc2ncccc12","cmpd_id":3973,"prot_id":37461,"protein_code":"Mac1-DLS-X0849A:NCL-00023833","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-X0849_0A_apo_MWLRd62.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 11 12 0 0 0 0 0 0 0 0999 V2000\n 29.3330 49.6380 -5.0230 Br 0 0 0 0 0 0 0 0 0 0 0 0\n 28.7690 50.2230 -6.7160 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.6820 49.2920 -7.7660 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.9760 47.9090 -7.7140 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.7720 47.1310 -8.8060 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.3000 47.7230 -9.9640 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.0120 49.0080 -10.0850 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.1790 49.7990 -8.9870 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.7960 51.0990 -9.1440 N 0 0 0 0 0 0 0 0 0 0 0 0\n 27.9200 51.9030 -8.1020 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.4070 51.5260 -6.8700 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 2 0\n 4 3 1 0\n 5 4 2 0\n 6 5 1 0\n 7 6 2 0\n 8 7 1 0\n 8 3 1 0\n 9 8 2 0\n 10 9 1 0\n 11 10 2 0\n 11 2 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":207.96,"logp":2.39,"tpsa":25.78,"ha":11,"hacc":2,"hdon":0,"rots":0,"rings":2,"velec":54,"number":849},"46":{"id":37551,"smiles":"N#Cc1cc(Br)ccc1O","cmpd_id":3974,"prot_id":37462,"protein_code":"Mac1-DLS-X0852B:NCL-00024661","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-X0852_0B_apo_66E2qVD.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 10 10 0 0 0 0 0 0 0 0999 V2000\n 27.0030 57.4560 -4.9950 Br 0 0 0 0 0 0 0 0 0 0 0 0\n 26.9550 57.2840 -6.8850 C 0 0 0 0 0 0 0 0 0 0 0 0\n 25.8640 57.7790 -7.5680 C 0 0 0 0 0 0 0 0 0 0 0 0\n 25.7600 57.5330 -8.9330 C 0 0 0 0 0 0 0 0 0 0 0 0\n 24.6550 58.0820 -9.6740 C 0 0 0 0 0 0 0 0 0 0 0 0\n 23.7670 58.5430 -10.2250 N 0 0 0 0 0 0 0 0 0 0 0 0\n 27.9590 56.5840 -7.5220 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.8540 56.3350 -8.8780 C 0 0 0 0 0 0 0 0 0 0 0 0\n 26.7530 56.7950 -9.5990 C 0 0 0 0 0 0 0 0 0 0 0 0\n 26.6500 56.5460 -10.9280 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 2 0\n 4 3 1 0\n 5 4 1 0\n 6 5 3 0\n 7 2 1 0\n 8 7 2 0\n 9 4 2 0\n 9 8 1 0\n 10 9 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":196.95,"logp":2.03,"tpsa":44.02,"ha":10,"hacc":2,"hdon":1,"rots":0,"rings":1,"velec":50,"number":852},"47":{"id":37554,"smiles":"O=C1CNC(=O)N1","cmpd_id":3977,"prot_id":37465,"protein_code":"Mac1-DLS-X0895A:Z57131035","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-X0895_0A_apo_yztwNqr.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 7 7 0 0 0 0 0 0 0 0999 V2000\n 28.6810 53.3970 -7.5760 O 0 0 0 0 0 0 0 0 0 0 0 0\n 28.6850 52.1740 -7.6720 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.0400 51.3130 -6.7130 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.9050 49.9360 -7.1340 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.3210 51.4430 -8.7780 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.4370 50.1010 -8.5770 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.2490 49.2400 -9.4360 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 2 0\n 3 2 1 0\n 4 3 1 0\n 5 2 1 0\n 6 5 1 0\n 6 4 1 0\n 7 6 2 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":100.03,"logp":-1.17,"tpsa":58.2,"ha":7,"hacc":2,"hdon":2,"rots":0,"rings":1,"velec":38,"number":895},"48":{"id":37555,"smiles":"O=C1CNC(=O)N1","cmpd_id":3977,"prot_id":37466,"protein_code":"Mac1-DLS-X0895_1A:Z57131035","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-X0895_1A_apo_s4TRSlS.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 7 7 0 0 0 0 0 0 0 0999 V2000\n 29.3400 50.9750 -5.9010 O 0 0 0 0 0 0 0 0 0 0 0 0\n 28.8610 50.8990 -7.0220 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.1180 51.8360 -7.6170 N 0 0 0 0 0 0 0 0 0 0 0 0\n 27.6840 51.4370 -8.9340 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.9770 49.8390 -7.8970 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.3270 50.0640 -9.0730 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.3150 49.2840 -10.0270 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 2 0\n 3 2 1 0\n 4 3 1 0\n 5 2 1 0\n 6 5 1 0\n 6 4 1 0\n 7 6 2 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":100.03,"logp":-1.17,"tpsa":58.2,"ha":7,"hacc":2,"hdon":2,"rots":0,"rings":1,"velec":38,"number":895},"49":{"id":37556,"smiles":"O=C1CCCN1","cmpd_id":3978,"prot_id":37467,"protein_code":"Mac1-DLS-X0900A:Z940713508","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-X0900_0A_apo_COlRJX2.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 6 6 0 0 0 0 0 0 0 0999 V2000\n 29.2770 53.5930 -5.5440 O 0 0 0 0 0 0 0 0 0 0 0 0\n 29.0310 52.6960 -6.3530 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.1250 51.3970 -6.1050 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.6600 50.5500 -7.1930 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.0170 51.5320 -8.1490 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.5810 52.8850 -7.7640 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 2 0\n 3 2 1 0\n 4 3 1 0\n 5 4 1 0\n 6 5 1 0\n 6 2 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":85.05,"logp":-0.1,"tpsa":29.1,"ha":6,"hacc":1,"hdon":1,"rots":0,"rings":1,"velec":34,"number":900},"50":{"id":37558,"smiles":"Oc1ccccn1","cmpd_id":1605,"prot_id":37469,"protein_code":"Mac1-DLS-X0905A:Z1741982125","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-X0905_0A_apo_fhRCMsh.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 7 7 0 0 0 0 0 0 0 0999 V2000\n 29.2460 53.6810 -5.5670 O 0 0 0 0 0 0 0 0 0 0 0 0\n 28.9740 52.5210 -6.1550 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.4200 52.5630 -7.3960 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.2150 51.3820 -8.0090 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.5240 50.1630 -7.4420 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.0600 50.1470 -6.1670 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.2990 51.3370 -5.4940 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 2 0\n 4 3 1 0\n 5 4 2 0\n 6 5 1 0\n 7 6 2 0\n 7 2 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":95.04,"logp":0.79,"tpsa":33.12,"ha":7,"hacc":2,"hdon":1,"rots":0,"rings":1,"velec":36,"number":905},"51":{"id":37560,"smiles":"Nc1nnc[nH]1","cmpd_id":3979,"prot_id":37471,"protein_code":"Mac1-DLS-X0910A:Z56866006","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-X0910_0A_apo_oDCQPxX.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 6 6 0 0 0 0 0 0 0 0999 V2000\n 29.4630 49.2420 -6.5280 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.9120 48.8210 -7.6680 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.9990 47.5330 -8.0990 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.3740 47.4820 -9.2920 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.8970 48.7280 -9.6120 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.2500 49.5640 -8.5560 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 1 0\n 4 3 1 0\n 5 4 2 0\n 6 5 1 0\n 6 2 2 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":84.04,"logp":-0.61,"tpsa":67.59,"ha":6,"hacc":3,"hdon":2,"rots":0,"rings":1,"velec":32,"number":910},"52":{"id":37562,"smiles":"Nc1nnc[nH]1","cmpd_id":3979,"prot_id":37473,"protein_code":"Mac1-DLS-X0910_1A:Z56866006","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-X0910_1A_apo_9BAW9YE.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 6 6 0 0 0 0 0 0 0 0999 V2000\n 29.3230 55.1300 -7.4950 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.9380 53.9350 -7.0200 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.2470 53.0190 -7.7740 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.0060 51.9600 -6.9750 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.5480 52.2040 -5.7120 N 0 0 0 0 0 0 0 0 0 0 0 0\n 29.1320 53.4680 -5.7790 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 1 0\n 4 3 1 0\n 5 4 2 0\n 6 5 1 0\n 6 2 2 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":84.04,"logp":-0.61,"tpsa":67.59,"ha":6,"hacc":3,"hdon":2,"rots":0,"rings":1,"velec":32,"number":910},"53":{"id":37563,"smiles":"Nc1ccncc1","cmpd_id":3980,"prot_id":37474,"protein_code":"Mac1-DLS-X0918A:Z955123498","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-X0918_0A_apo_j03w8Hj.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 7 7 0 0 0 0 0 0 0 0999 V2000\n 29.0710 53.2290 -5.2850 N 0 0 0 0 0 0 0 0 0 0 0 0\n 29.0180 52.0580 -6.0110 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.5600 50.8750 -5.5130 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.4580 49.7150 -6.2610 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.8510 49.6570 -7.4570 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.3350 50.8020 -7.9370 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.3990 52.0070 -7.2610 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 2 0\n 4 3 1 0\n 5 4 2 0\n 6 5 1 0\n 7 6 2 0\n 7 2 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":94.05,"logp":0.66,"tpsa":38.91,"ha":7,"hacc":2,"hdon":1,"rots":0,"rings":1,"velec":36,"number":918},"54":{"id":37565,"smiles":"Nc1ccncc1","cmpd_id":3980,"prot_id":37476,"protein_code":"Mac1-DLS-X0918_1A:Z955123498","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-X0918_1A_apo_PXKovc5.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 7 7 0 0 0 0 0 0 0 0999 V2000\n 28.3980 53.3150 -7.9560 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.7070 52.1290 -7.3370 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.1520 52.0950 -6.0150 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.4720 50.8790 -5.4380 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.3740 49.7070 -6.0850 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.9400 49.7450 -7.3540 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.6020 50.9150 -8.0090 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 2 0\n 4 3 1 0\n 5 4 2 0\n 6 5 1 0\n 7 6 2 0\n 7 2 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":94.05,"logp":0.66,"tpsa":38.91,"ha":7,"hacc":2,"hdon":1,"rots":0,"rings":1,"velec":36,"number":918},"55":{"id":37568,"smiles":"O=c1cccn[nH]1","cmpd_id":3981,"prot_id":37479,"protein_code":"Mac1-DLS-X0926A:Z3219959731","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-X0926_0A_apo_am1o8D4.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 7 7 0 0 0 0 0 0 0 0999 V2000\n 29.2000 53.4360 -5.8430 O 0 0 0 0 0 0 0 0 0 0 0 0\n 28.8440 52.3540 -6.3330 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.2340 51.1890 -5.7610 N 0 0 0 0 0 0 0 0 0 0 0 0\n 29.0080 49.9330 -6.2480 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.3520 49.8550 -7.3740 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.8620 50.9730 -8.0670 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.1060 52.1990 -7.5520 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 2 0\n 3 2 1 0\n 4 3 1 0\n 5 4 2 0\n 6 5 1 0\n 7 6 2 0\n 7 2 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":96.03,"logp":-0.23,"tpsa":45.75,"ha":7,"hacc":2,"hdon":1,"rots":0,"rings":1,"velec":36,"number":926},"56":{"id":37569,"smiles":"NC1NCCCN1","cmpd_id":3982,"prot_id":37480,"protein_code":"Mac1-DLS-X0933A:Z1954800348","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-X0933_0A_apo_46Ten18.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 7 7 0 0 0 0 0 0 0 0999 V2000\n 28.3440 53.8680 -8.2300 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.5150 52.6940 -7.7180 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.1510 52.4130 -6.5650 N 0 0 0 0 0 0 0 0 0 0 0 0\n 29.2260 51.0780 -5.9650 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.1130 50.0190 -7.0240 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.9460 50.2840 -7.9430 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.9450 51.6770 -8.3970 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 1 0\n 4 3 1 0\n 5 4 1 0\n 6 5 1 0\n 7 6 1 0\n 7 2 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":101.1,"logp":-1.19,"tpsa":50.08,"ha":7,"hacc":3,"hdon":3,"rots":0,"rings":1,"velec":42,"number":933},"57":{"id":37576,"smiles":"N#Cc1c[nH]cn1","cmpd_id":3984,"prot_id":37487,"protein_code":"Mac1-DLS-X0962A:Z2301685688","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-X0962_0A_apo_KwWRoyE.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 7 7 0 0 0 0 0 0 0 0999 V2000\n 29.6170 48.7500 -6.0650 N 0 0 0 0 0 0 0 0 0 0 0 0\n 29.2590 49.7060 -6.5720 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.7720 50.8790 -7.2420 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.9050 52.1680 -6.7090 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.3950 53.0690 -7.5050 N 0 0 0 0 0 0 0 0 0 0 0 0\n 27.8540 52.2670 -8.6490 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.1740 50.8470 -8.3800 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 3 0\n 3 2 1 0\n 4 3 2 0\n 5 4 1 0\n 6 5 1 0\n 7 6 2 0\n 7 3 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":93.03,"logp":0.28,"tpsa":52.47,"ha":7,"hacc":2,"hdon":1,"rots":0,"rings":1,"velec":34,"number":962},"58":{"id":37577,"smiles":"N#Cc1c[nH]cn1","cmpd_id":3984,"prot_id":37488,"protein_code":"Mac1-DLS-X0962B:Z2301685688","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-X0962_0B_apo_xXo9ryD.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 7 7 0 0 0 0 0 0 0 0999 V2000\n 27.5720 57.5210 -5.1510 N 0 0 0 0 0 0 0 0 0 0 0 0\n 27.5220 57.2260 -6.2520 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.4060 56.8270 -7.6230 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.4620 56.3900 -8.4300 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.0380 56.0570 -9.6190 N 0 0 0 0 0 0 0 0 0 0 0 0\n 26.5740 56.2910 -9.5770 C 0 0 0 0 0 0 0 0 0 0 0 0\n 26.2750 56.8080 -8.2340 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 3 0\n 3 2 1 0\n 4 3 2 0\n 5 4 1 0\n 6 5 1 0\n 7 6 2 0\n 7 3 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":93.03,"logp":0.28,"tpsa":52.47,"ha":7,"hacc":2,"hdon":1,"rots":0,"rings":1,"velec":34,"number":962},"59":{"id":37578,"smiles":"N#Cc1c[nH]cn1","cmpd_id":3984,"prot_id":37489,"protein_code":"Mac1-DLS-X0962_1A:Z2301685688","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-X0962_1A_apo_TXVyD5X.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 7 7 0 0 0 0 0 0 0 0999 V2000\n 29.1890 50.0260 -6.0560 N 0 0 0 0 0 0 0 0 0 0 0 0\n 29.0280 51.0740 -6.4860 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.8620 52.4110 -6.9810 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.3930 53.5050 -6.2810 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.1360 54.6230 -6.8760 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.3730 54.2330 -8.0990 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.2430 52.7430 -8.0570 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 3 0\n 3 2 1 0\n 4 3 2 0\n 5 4 1 0\n 6 5 1 0\n 7 6 2 0\n 7 3 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":93.03,"logp":0.28,"tpsa":52.47,"ha":7,"hacc":2,"hdon":1,"rots":0,"rings":1,"velec":34,"number":962},"60":{"id":37580,"smiles":"c1cnc2ncccc2c1","cmpd_id":3985,"prot_id":37491,"protein_code":"Mac1-DLS-X0967A:SF003","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-X0967_0A_apo_8f2Ftcf.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 10 11 0 0 0 0 0 0 0 0999 V2000\n 28.3470 53.5630 -8.2750 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.6120 54.7730 -7.7160 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.6470 52.3890 -7.5630 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.2200 52.5320 -6.2830 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.4730 53.7500 -5.7290 N 0 0 0 0 0 0 0 0 0 0 0 0\n 29.1660 54.8160 -6.4500 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.4250 51.0860 -8.0340 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.7770 50.0250 -7.2620 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.3410 50.2600 -6.0180 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.5640 51.4610 -5.5130 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 2 0\n 3 1 1 0\n 4 3 2 0\n 5 4 1 0\n 6 5 2 0\n 6 2 1 0\n 7 3 1 0\n 8 7 2 0\n 9 8 1 0\n 10 9 2 0\n 10 4 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":130.05,"logp":1.63,"tpsa":25.78,"ha":10,"hacc":2,"hdon":0,"rots":0,"rings":2,"velec":48,"number":967},"61":{"id":37581,"smiles":"Nc1nnc2ccccn12","cmpd_id":3986,"prot_id":37492,"protein_code":"Mac1-DLS-X0969A:SF005","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-X0969_0A_apo_BnZU6yD.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 10 11 0 0 0 0 0 0 0 0999 V2000\n 27.8770 54.3430 -8.6060 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.4710 53.7950 -7.5300 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.5400 52.4290 -7.3370 N 0 0 0 0 0 0 0 0 0 0 0 0\n 29.1750 52.2900 -6.1070 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.4420 53.4850 -5.5870 N 0 0 0 0 0 0 0 0 0 0 0 0\n 29.0010 54.4430 -6.5080 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.1190 51.3410 -8.0780 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.3520 50.0980 -7.6160 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.0180 49.9140 -6.3800 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.4210 50.9890 -5.6320 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 1 0\n 4 3 1 0\n 5 4 2 0\n 6 5 1 0\n 6 2 2 0\n 7 3 1 0\n 8 7 2 0\n 9 8 1 0\n 10 9 2 0\n 10 4 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":134.06,"logp":0.31,"tpsa":56.21,"ha":10,"hacc":4,"hdon":1,"rots":0,"rings":2,"velec":50,"number":969},"62":{"id":37584,"smiles":"Clc1ccc2nnnn2n1","cmpd_id":3989,"prot_id":37495,"protein_code":"Mac1-DLS-X1018A:SF054","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-X1018_0A_apo_MHnY3t3.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 10 11 0 0 0 0 0 0 0 0999 V2000\n 28.9400 55.4910 -6.6880 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 28.9680 53.7790 -6.9170 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.3760 53.1010 -5.8900 N 0 0 0 0 0 0 0 0 0 0 0 0\n 29.3890 51.7780 -6.1520 N 0 0 0 0 0 0 0 0 0 0 0 0\n 29.8020 50.8800 -5.2410 N 0 0 0 0 0 0 0 0 0 0 0 0\n 29.6720 49.7280 -5.8230 N 0 0 0 0 0 0 0 0 0 0 0 0\n 29.1860 49.8600 -7.0810 N 0 0 0 0 0 0 0 0 0 0 0 0\n 29.0230 51.1550 -7.2620 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.5600 51.9290 -8.3380 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.5450 53.2570 -8.1690 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 2 0\n 4 3 1 0\n 5 4 1 0\n 6 5 2 0\n 7 6 1 0\n 8 7 2 0\n 8 4 1 0\n 9 8 1 0\n 10 9 2 0\n 10 2 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":155,"logp":0.17,"tpsa":55.97,"ha":10,"hacc":5,"hdon":0,"rots":0,"rings":2,"velec":50,"number":1018}},"cached_mol_lists":{},"all_mol_lists":{"238505":[{"id":37457,"smiles":"c1ncc2c(n1)NCC2","cmpd_id":5067,"prot_id":37368,"protein_code":"Mac1-DLS-EU0034A:EN300-321461","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-EU0034_0A_apo_VjNQ65L.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 9 10 0 0 0 0 0 0 0 0999 V2000\n 28.6950 51.7270 -7.5540 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.1600 50.5930 -6.6460 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.0190 51.0140 -8.6300 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.3620 49.6890 -8.6990 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.0360 49.3690 -7.5170 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.1020 48.8400 -9.7140 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.5190 47.5900 -9.4780 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.1810 47.1340 -8.4130 N 0 0 0 0 0 0 0 0 0 0 0 0\n 29.4220 48.0420 -7.4580 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 1 1 0\n 4 3 1 0\n 5 4 2 0\n 5 2 1 0\n 6 4 1 0\n 7 6 2 0\n 8 7 1 0\n 9 8 2 0\n 9 5 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":121.06,"logp":0.44,"tpsa":37.81,"ha":9,"hacc":3,"hdon":1,"rots":0,"rings":2,"velec":46,"number":0},{"id":37458,"smiles":"Cc1n[nH]c(N)c1C#N","cmpd_id":5068,"prot_id":37369,"protein_code":"Mac1-DLS-EU0046A:EN300-43406","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-EU0046_0A_apo_h8vAPmV.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 9 9 0 0 0 0 0 0 0 0999 V2000\n 30.3780 48.4210 -5.7980 N 0 0 0 0 0 0 0 0 0 0 0 0\n 29.7600 48.9280 -6.6170 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.9950 49.5130 -7.6700 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.3420 48.9020 -8.7740 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.1770 47.4470 -9.0650 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.8320 50.9030 -7.8840 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.2700 51.8980 -7.1370 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.1300 51.0520 -9.0540 N 0 0 0 0 0 0 0 0 0 0 0 0\n 27.8400 49.8260 -9.5980 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 3 0\n 3 2 1 0\n 4 3 1 0\n 5 4 1 0\n 6 3 2 0\n 7 6 1 0\n 8 6 1 0\n 9 4 2 0\n 9 8 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":122.06,"logp":0.17,"tpsa":78.49,"ha":9,"hacc":3,"hdon":2,"rots":0,"rings":1,"velec":46,"number":0},{"id":37460,"smiles":"NCc1cncc(Br)c1","cmpd_id":5069,"prot_id":37371,"protein_code":"Mac1-DLS-EU0056A:Z3034471507","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-EU0056_0A_apo_FUlgi75.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 9 9 0 0 0 0 0 0 0 0999 V2000\n 28.3970 50.9770 -8.1160 Br 0 0 0 0 0 0 0 0 0 0 0 0\n 28.6540 52.7820 -7.6160 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.2110 53.7890 -8.4460 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.1990 53.0840 -6.3860 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.3050 54.3430 -5.9530 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.8610 55.3140 -6.7580 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.2960 55.1050 -8.0070 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.7250 56.2460 -8.8190 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.8040 56.9190 -9.5400 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 2 0\n 4 2 1 0\n 5 4 2 0\n 6 5 1 0\n 7 3 1 0\n 7 6 2 0\n 8 7 1 0\n 9 8 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":185.98,"logp":1.3,"tpsa":38.91,"ha":9,"hacc":2,"hdon":1,"rots":1,"rings":1,"velec":48,"number":0},{"id":37461,"smiles":"CC(=O)Nc1nccs1","cmpd_id":5070,"prot_id":37372,"protein_code":"Mac1-DLS-EU0087A:AB-601_30915014","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-EU0087_0A_apo_p8J9IOb.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 9 9 0 0 0 0 0 0 0 0999 V2000\n 29.2290 51.7430 -6.7120 O 0 0 0 0 0 0 0 0 0 0 0 0\n 28.8290 52.1500 -7.7960 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.7440 53.6110 -8.1190 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.4310 51.3060 -8.7910 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.5360 49.9280 -8.7750 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.1860 49.0070 -7.4470 S 0 0 0 0 0 0 0 0 0 0 0 0\n 28.9490 47.5650 -8.3800 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.4150 47.8750 -9.5820 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.1810 49.2160 -9.8210 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 2 0\n 3 2 1 0\n 4 2 1 0\n 5 4 1 0\n 6 5 1 0\n 7 6 1 0\n 8 7 2 0\n 9 8 1 0\n 9 5 2 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":142.02,"logp":1.1,"tpsa":41.99,"ha":9,"hacc":3,"hdon":1,"rots":1,"rings":1,"velec":48,"number":0},{"id":37462,"smiles":"Cc1ccncc1CO","cmpd_id":5071,"prot_id":37373,"protein_code":"Mac1-DLS-EU0123A:EN300-108952","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-EU0123_0A_apo_MAQQBjW.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 9 9 0 0 0 0 0 0 0 0999 V2000\n 28.3060 51.0150 -8.4370 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.7130 51.8390 -7.2550 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.9510 53.2200 -7.3720 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.7350 53.9500 -8.6690 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.3550 54.2450 -8.8810 O 0 0 0 0 0 0 0 0 0 0 0 0\n 29.2490 53.9380 -6.2180 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.2900 53.3850 -4.9990 N 0 0 0 0 0 0 0 0 0 0 0 0\n 29.1240 52.0620 -4.9200 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.8220 51.2580 -6.0010 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 2 0\n 4 3 1 0\n 5 4 1 0\n 6 3 1 0\n 7 6 2 0\n 8 7 1 0\n 9 2 1 0\n 9 8 2 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":123.07,"logp":0.88,"tpsa":33.12,"ha":9,"hacc":2,"hdon":1,"rots":1,"rings":1,"velec":48,"number":0},{"id":37463,"smiles":"Cc1nc(C#N)c(N)o1","cmpd_id":5072,"prot_id":37374,"protein_code":"Mac1-DLS-EU0144A:EN300-301084","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-EU0144_0A_apo_tra2UIb.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 9 9 0 0 0 0 0 0 0 0999 V2000\n 29.9200 49.6780 -5.6940 N 0 0 0 0 0 0 0 0 0 0 0 0\n 29.6190 50.6950 -6.1200 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.2310 51.9420 -6.6950 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.6340 53.1530 -6.1760 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.4010 52.1590 -7.7280 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.6970 51.3690 -8.5400 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.2680 53.5050 -7.9000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 29.0460 54.0330 -6.9050 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.0550 55.5020 -6.7230 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 3 0\n 3 2 1 0\n 4 3 1 0\n 5 3 2 0\n 6 5 1 0\n 7 5 1 0\n 8 7 1 0\n 8 4 2 0\n 9 8 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":123.04,"logp":0.44,"tpsa":75.84,"ha":9,"hacc":4,"hdon":1,"rots":0,"rings":1,"velec":46,"number":0},{"id":37464,"smiles":"NCCn1ccccc1=O","cmpd_id":5073,"prot_id":37375,"protein_code":"Mac1-DLS-EU0172A:EN300-105873","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-EU0172_0A_apo_hB2qmXd.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 10 10 0 0 0 0 0 0 0 0999 V2000\n 28.1840 55.9650 -9.3970 N 0 0 0 0 0 0 0 0 0 0 0 0\n 27.9710 54.7370 -8.6230 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.2840 53.9950 -8.4550 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.1480 52.7870 -7.6170 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.9810 51.5610 -8.1920 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.8670 50.4560 -7.4370 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.8800 50.5630 -6.0370 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.0040 51.7690 -5.4480 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.1570 52.9570 -6.2210 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.2920 54.0970 -5.7460 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 1 0\n 4 3 1 0\n 5 4 1 0\n 6 5 2 0\n 7 6 1 0\n 8 7 2 0\n 9 4 1 0\n 9 8 1 0\n 10 9 2 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":138.08,"logp":-0.19,"tpsa":48.02,"ha":10,"hacc":3,"hdon":1,"rots":2,"rings":1,"velec":54,"number":0},{"id":37465,"smiles":"NCC(=O)Nc1nccs1","cmpd_id":5074,"prot_id":37376,"protein_code":"Mac1-DLS-EU0238A:STK497968","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-EU0238_0A_apo_DpChdDW.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 10 10 0 0 0 0 0 0 0 0999 V2000\n 29.3080 54.6090 -6.8350 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.7860 53.8370 -7.9810 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.8950 52.3520 -7.7310 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.3760 51.5540 -8.7060 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.5180 50.1810 -8.7390 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.1820 49.4870 -9.8000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.3360 48.1410 -9.5340 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.7710 47.8370 -8.3000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.1960 49.2660 -7.4300 S 0 0 0 0 0 0 0 0 0 0 0 0\n 29.4010 51.8970 -6.7200 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 1 0\n 4 3 1 0\n 5 4 1 0\n 6 5 2 0\n 7 6 1 0\n 8 7 2 0\n 9 8 1 0\n 9 5 1 0\n 10 3 2 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":157.03,"logp":0.04,"tpsa":68.01,"ha":10,"hacc":4,"hdon":2,"rots":2,"rings":1,"velec":54,"number":0},{"id":37466,"smiles":"Nc1cnc2[nH]ncc2c1","cmpd_id":5075,"prot_id":37377,"protein_code":"Mac1-DLS-EU0241A:STL414928","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-EU0241_0A_apo_mLtC3xg.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 10 11 0 0 0 0 0 0 0 0999 V2000\n 29.8010 46.4530 -8.1970 N 0 0 0 0 0 0 0 0 0 0 0 0\n 29.2670 47.7140 -8.2620 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.5070 48.6340 -7.2410 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.0670 49.9520 -7.3780 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.3640 50.3170 -8.5500 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.0660 49.5100 -9.6000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.4890 48.2380 -9.4810 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.1640 51.1610 -6.6440 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.5790 52.1580 -7.2840 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.0860 51.6340 -8.4480 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 2 0\n 4 3 1 0\n 5 4 2 0\n 6 5 1 0\n 7 2 1 0\n 7 6 2 0\n 8 4 1 0\n 9 8 2 0\n 10 9 1 0\n 10 5 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":134.06,"logp":0.54,"tpsa":67.59,"ha":10,"hacc":3,"hdon":2,"rots":0,"rings":2,"velec":50,"number":0},{"id":37467,"smiles":"O=c1[nH]cnc2ccccc12","cmpd_id":5076,"prot_id":37378,"protein_code":"Mac1-DLS-EU0291A:EN300-17035","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-EU0291_0A_apo_tvbJNYV.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 11 12 0 0 0 0 0 0 0 0999 V2000\n 29.5150 50.2250 -5.4540 O 0 0 0 0 0 0 0 0 0 0 0 0\n 29.1680 50.4640 -6.6080 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.8300 51.7490 -6.9740 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.3690 52.0540 -8.2060 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.2020 51.1950 -9.1500 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.5120 49.8550 -8.8960 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.0020 49.4410 -7.6340 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.3420 48.0800 -7.4030 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.1360 47.1650 -8.4030 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.6070 47.5800 -9.6400 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.3630 48.8970 -9.9050 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 2 0\n 3 2 1 0\n 4 3 1 0\n 5 4 2 0\n 6 5 1 0\n 7 6 2 0\n 7 2 1 0\n 8 7 1 0\n 9 8 2 0\n 10 9 1 0\n 11 10 2 0\n 11 6 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":146.05,"logp":0.92,"tpsa":45.75,"ha":11,"hacc":2,"hdon":1,"rots":0,"rings":2,"velec":54,"number":0},{"id":37468,"smiles":"Nc1cnc2c(c1)COCC2","cmpd_id":5077,"prot_id":37379,"protein_code":"Mac1-DLS-EU0293A:Z1613477500","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-EU0293_0A_apo_oT8y0Gk.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 11 12 0 0 0 0 0 0 0 0999 V2000\n 29.7720 46.2730 -8.2350 N 0 0 0 0 0 0 0 0 0 0 0 0\n 29.3120 47.5350 -8.4090 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.5120 48.4910 -7.4140 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.0910 49.8000 -7.6330 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.3040 50.8670 -6.5990 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.2230 52.1650 -7.1890 O 0 0 0 0 0 0 0 0 0 0 0 0\n 27.9850 52.3430 -7.8710 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.9470 51.4910 -9.1200 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.4330 50.0960 -8.8350 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.2550 49.1870 -9.8240 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.6380 47.9210 -9.5890 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 2 0\n 4 3 1 0\n 5 4 1 0\n 6 5 1 0\n 7 6 1 0\n 8 7 1 0\n 9 8 1 0\n 9 4 2 0\n 10 9 1 0\n 11 2 1 0\n 11 10 2 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":150.08,"logp":0.74,"tpsa":48.14,"ha":11,"hacc":3,"hdon":1,"rots":0,"rings":2,"velec":58,"number":0},{"id":37469,"smiles":"CNC(=O)c1ccc(=O)[nH]c1","cmpd_id":5078,"prot_id":37380,"protein_code":"Mac1-DLS-EU0342A:EN300-52144","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-EU0342_0A_apo_jhclG8l.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 11 11 0 0 0 0 0 0 0 0999 V2000\n 28.0320 46.8900 -9.0030 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.4820 48.0270 -8.2160 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.4000 49.2680 -8.6960 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.6090 50.4000 -7.7360 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.0360 50.1770 -6.4220 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.2180 51.2210 -5.5690 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.3880 51.6940 -8.1550 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.5690 52.7250 -7.2970 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.9750 52.5600 -5.9990 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.1230 53.5820 -5.2760 O 0 0 0 0 0 0 0 0 0 0 0 0\n 28.1680 49.4810 -9.8880 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 1 0\n 4 3 1 0\n 5 4 1 0\n 6 5 2 0\n 7 4 2 0\n 8 7 1 0\n 9 8 1 0\n 9 6 1 0\n 10 9 2 0\n 11 3 2 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":152.06,"logp":-0.27,"tpsa":61.96,"ha":11,"hacc":2,"hdon":2,"rots":1,"rings":1,"velec":58,"number":0},{"id":37470,"smiles":"CC(=O)Nc1cc(Br)c[nH]c1=O","cmpd_id":5079,"prot_id":37381,"protein_code":"Mac1-DLS-EU0424A:Z838838708","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-EU0424_0A_apo_18wJt62.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 12 12 0 0 0 0 0 0 0 0999 V2000\n 28.8250 53.6260 -5.0740 O 0 0 0 0 0 0 0 0 0 0 0 0\n 28.9470 54.1720 -6.1710 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.8580 55.6580 -6.3380 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.1620 53.4680 -7.3170 N 0 0 0 0 0 0 0 0 0 0 0 0\n 29.1200 52.0740 -7.3830 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.2640 51.5940 -8.4710 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.6970 52.3520 -9.2470 O 0 0 0 0 0 0 0 0 0 0 0 0\n 28.1020 50.2390 -8.5540 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.6740 49.3650 -7.6890 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.4610 49.8270 -6.7080 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.2460 48.5860 -5.5210 Br 0 0 0 0 0 0 0 0 0 0 0 0\n 29.7110 51.1950 -6.5380 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 2 0\n 3 2 1 0\n 4 2 1 0\n 5 4 1 0\n 6 5 1 0\n 7 6 2 0\n 8 6 1 0\n 9 8 1 0\n 10 9 2 0\n 11 10 1 0\n 12 10 1 0\n 12 5 2 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":229.97,"logp":1.1,"tpsa":61.96,"ha":12,"hacc":2,"hdon":2,"rots":1,"rings":1,"velec":64,"number":0},{"id":37471,"smiles":"NCc1cnc2ccccc2c1","cmpd_id":5080,"prot_id":37382,"protein_code":"Mac1-DLS-EU0481A:STK346965","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-EU0481_0A_apo_XGbr7RT.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 12 13 0 0 0 0 0 0 0 0999 V2000\n 28.7300 56.4980 -9.7480 N 0 0 0 0 0 0 0 0 0 0 0 0\n 27.9160 56.2110 -8.5690 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.4560 54.9960 -7.8520 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.0100 55.0880 -6.5810 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.3610 54.0620 -5.8330 N 0 0 0 0 0 0 0 0 0 0 0 0\n 29.1660 52.8040 -6.3490 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.6510 52.6060 -7.6410 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.3070 53.7450 -8.3850 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.4480 51.6800 -5.5420 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.2340 50.4200 -6.0220 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.7370 50.2240 -7.2970 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.4450 51.2870 -8.0990 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 1 0\n 4 3 2 0\n 5 4 1 0\n 6 5 2 0\n 7 6 1 0\n 8 7 2 0\n 8 3 1 0\n 9 6 1 0\n 10 9 2 0\n 11 10 1 0\n 12 11 2 0\n 12 7 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":158.08,"logp":1.69,"tpsa":38.91,"ha":12,"hacc":2,"hdon":1,"rots":1,"rings":2,"velec":60,"number":0},{"id":37473,"smiles":"NC(=O)C1=Cc2ccccc2OC1","cmpd_id":5082,"prot_id":37384,"protein_code":"Mac1-DLS-EU0569A:Z145120524","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-EU0569_0A_apo_Dm3IMbN.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 13 14 0 0 0 0 0 0 0 0999 V2000\n 27.6750 57.3510 -7.8530 O 0 0 0 0 0 0 0 0 0 0 0 0\n 27.5900 56.2710 -8.4640 C 0 0 0 0 0 0 0 0 0 0 0 0\n 26.8790 56.1590 -9.5820 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.2600 55.0460 -7.9290 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.9500 55.1980 -6.6040 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.9880 53.9910 -5.8130 O 0 0 0 0 0 0 0 0 0 0 0 0\n 28.9370 52.7720 -6.4440 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.6430 52.6530 -7.8040 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.1920 53.8250 -8.4940 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.1830 51.6540 -5.6670 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.1650 50.4010 -6.2530 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.9120 50.2660 -7.5950 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.6570 51.3800 -8.3730 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 2 0\n 3 2 1 0\n 4 2 1 0\n 5 4 1 0\n 6 5 1 0\n 7 6 1 0\n 8 7 2 0\n 9 8 1 0\n 9 4 2 0\n 10 7 1 0\n 11 10 2 0\n 12 11 1 0\n 13 12 2 0\n 13 8 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":175.06,"logp":0.95,"tpsa":52.32,"ha":13,"hacc":2,"hdon":1,"rots":1,"rings":2,"velec":66,"number":0},{"id":37474,"smiles":"CNC(=O)Cn1cnc2ccccc21","cmpd_id":5083,"prot_id":37385,"protein_code":"Mac1-DLS-EU0704A:EN300-697611","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-EU0704_0A_apo_IwIl9Nm.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 14 15 0 0 0 0 0 0 0 0999 V2000\n 27.1270 56.9430 -7.5290 O 0 0 0 0 0 0 0 0 0 0 0 0\n 27.3390 56.1760 -8.4690 C 0 0 0 0 0 0 0 0 0 0 0 0\n 26.5920 56.1590 -9.5690 N 0 0 0 0 0 0 0 0 0 0 0 0\n 26.0430 57.3640 -10.1630 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.5920 55.3140 -8.5380 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.7150 54.3670 -7.4290 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.9430 54.6540 -6.1160 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.0980 53.5940 -5.3590 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.9630 52.5190 -6.2400 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.7210 52.9850 -7.5320 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.0220 51.1480 -6.0030 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.8310 50.2810 -7.0670 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.5770 50.7640 -8.3450 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.5250 52.1240 -8.6000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 2 0\n 3 2 1 0\n 4 3 1 0\n 5 2 1 0\n 6 5 1 0\n 7 6 1 0\n 8 7 2 0\n 9 8 1 0\n 10 9 2 0\n 10 6 1 0\n 11 9 1 0\n 12 11 2 0\n 13 12 1 0\n 14 13 2 0\n 14 10 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":189.09,"logp":0.78,"tpsa":46.92,"ha":14,"hacc":3,"hdon":1,"rots":2,"rings":2,"velec":72,"number":0},{"id":37475,"smiles":"CCc1c(C(=O)NC)[nH]c(C)c1C(C)=O","cmpd_id":5084,"prot_id":37386,"protein_code":"Mac1-DLS-EU0716A:Z605596346","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-EU0716_0A_apo_jVjTKB7.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 15 15 0 0 0 0 0 0 0 0999 V2000\n 27.5380 56.8590 -5.5800 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.6960 56.1400 -6.2600 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.2550 55.0840 -7.2370 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.6200 55.3140 -8.4710 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.0420 56.5130 -9.0950 C 0 0 0 0 0 0 0 0 0 0 0 0\n 26.7990 56.4750 -10.4000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 26.2080 57.5990 -11.0970 C 0 0 0 0 0 0 0 0 0 0 0 0\n 26.7290 57.4990 -8.4220 O 0 0 0 0 0 0 0 0 0 0 0 0\n 27.4350 54.0660 -9.0600 N 0 0 0 0 0 0 0 0 0 0 0 0\n 27.9910 53.0960 -8.3110 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.9050 51.6630 -8.7280 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.5220 53.6880 -7.1740 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.1450 52.9200 -6.1020 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.6660 51.5480 -6.4020 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.1290 53.3430 -4.9370 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 1 0\n 4 3 2 0\n 5 4 1 0\n 6 5 1 0\n 7 6 1 0\n 8 5 2 0\n 9 4 1 0\n 10 9 1 0\n 11 10 1 0\n 12 10 2 0\n 12 3 1 0\n 13 12 1 0\n 14 13 1 0\n 15 13 2 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":208.12,"logp":1.45,"tpsa":61.96,"ha":15,"hacc":2,"hdon":2,"rots":3,"rings":1,"velec":82,"number":0},{"id":37477,"smiles":"Cc1ccc(NC(=O)N[C@@H](C)CO)cc1F","cmpd_id":5086,"prot_id":37388,"protein_code":"Mac1-DLS-EU0815A:Z409974522","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-EU0815_0A_apo_2UaF08J.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 16 16 0 0 0 0 0 0 0 0999 V2000\n 28.1520 58.6780 -10.2460 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.1400 57.7050 -9.6720 C 0 0 1 0 0 0 0 0 0 0 0 0\n 25.8920 57.6260 -10.5130 C 0 0 0 0 0 0 0 0 0 0 0 0\n 25.1540 58.8340 -10.5110 O 0 0 0 0 0 0 0 0 0 0 0 0\n 27.7310 56.3720 -9.6100 N 0 0 0 0 0 0 0 0 0 0 0 0\n 27.8590 55.6410 -8.4840 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.1920 54.3390 -8.7490 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.5720 53.2820 -7.8990 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.8770 53.4320 -6.5500 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.2020 52.3110 -5.8250 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.4540 52.4720 -4.5040 F 0 0 0 0 0 0 0 0 0 0 0 0\n 29.2920 51.0540 -6.3830 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.6650 49.8480 -5.5760 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.9940 50.9220 -7.7330 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.6440 52.0250 -8.4860 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.7010 56.1120 -7.3510 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 6\n 3 2 1 0\n 4 3 1 0\n 5 2 1 0\n 6 5 1 0\n 7 6 1 0\n 8 7 1 0\n 9 8 2 0\n 10 9 1 0\n 11 10 1 0\n 12 10 2 0\n 13 12 1 0\n 14 12 1 0\n 15 14 2 0\n 15 8 1 0\n 16 6 2 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":226.11,"logp":1.64,"tpsa":61.36,"ha":16,"hacc":2,"hdon":3,"rots":3,"rings":1,"velec":88,"number":0},{"id":37478,"smiles":"CNC(=O)c1cc2ccc(F)cc2nc1C","cmpd_id":5087,"prot_id":37389,"protein_code":"Mac1-DLS-EU0844A:Z199959602","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-EU0844_0A_apo_3fbwpKF.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 16 17 0 0 0 0 0 0 0 0999 V2000\n 26.7840 57.3040 -7.9450 O 0 0 0 0 0 0 0 0 0 0 0 0\n 27.4290 56.5280 -8.6440 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.4800 56.6390 -9.9700 N 0 0 0 0 0 0 0 0 0 0 0 0\n 26.7910 57.6990 -10.6830 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.1760 55.3730 -8.0450 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.8650 55.4710 -6.7990 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.1040 56.7740 -6.0950 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.9390 54.1340 -8.5770 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.4340 52.9910 -7.9370 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.1800 53.1700 -6.7630 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.3890 54.4110 -6.2090 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.1430 51.6790 -8.3620 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.5420 50.6070 -7.6330 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.2490 50.8120 -6.4840 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.4530 49.7520 -5.6590 F 0 0 0 0 0 0 0 0 0 0 0 0\n 29.6280 52.0340 -6.0540 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 2 0\n 3 2 1 0\n 4 3 1 0\n 5 2 1 0\n 6 5 2 0\n 7 6 1 0\n 8 5 1 0\n 9 8 2 0\n 10 9 1 0\n 11 10 2 0\n 11 6 1 0\n 12 9 1 0\n 13 12 2 0\n 14 13 1 0\n 15 14 1 0\n 16 14 2 0\n 16 10 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":218.09,"logp":2.04,"tpsa":41.99,"ha":16,"hacc":2,"hdon":1,"rots":1,"rings":2,"velec":82,"number":0},{"id":37483,"smiles":"COc1ccc(NC(=O)Nc2cccs2)cn1","cmpd_id":718,"prot_id":37394,"protein_code":"Mac1-DLS-X0104A:Z1152242726","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-X0104_0A_apo_nRgtuh2.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 17 18 0 0 0 0 0 0 0 0999 V2000\n 27.9240 56.4830 -7.5930 O 0 0 0 0 0 0 0 0 0 0 0 0\n 27.6450 55.8590 -8.6190 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.1280 56.5000 -9.7530 N 0 0 0 0 0 0 0 0 0 0 0 0\n 26.8950 57.8720 -9.9070 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.4830 59.0900 -8.7930 S 0 0 0 0 0 0 0 0 0 0 0 0\n 26.8150 60.3450 -9.7540 C 0 0 0 0 0 0 0 0 0 0 0 0\n 26.1780 59.8770 -10.8560 C 0 0 0 0 0 0 0 0 0 0 0 0\n 26.2010 58.4380 -10.9780 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.8040 54.5040 -8.7630 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.4490 53.6150 -7.8790 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.0220 54.0960 -6.7130 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.4720 53.2140 -5.7570 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.4110 52.2330 -8.0570 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.8710 51.3540 -7.1610 N 0 0 0 0 0 0 0 0 0 0 0 0\n 29.3800 51.8540 -6.0420 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.8650 51.0600 -5.0710 O 0 0 0 0 0 0 0 0 0 0 0 0\n 29.8480 49.6490 -5.2810 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 2 0\n 3 2 1 0\n 4 3 1 0\n 5 4 1 0\n 6 5 1 0\n 7 6 2 0\n 8 7 1 0\n 8 4 2 0\n 9 2 1 0\n 10 9 1 0\n 11 10 2 0\n 12 11 1 0\n 13 10 1 0\n 14 13 2 0\n 15 14 1 0\n 15 12 2 0\n 16 15 1 0\n 17 16 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":249.06,"logp":2.8,"tpsa":63.25,"ha":17,"hacc":4,"hdon":2,"rots":3,"rings":2,"velec":88,"number":104},{"id":37484,"smiles":"O=C(Nc1ccccc1)Nc1cccnc1","cmpd_id":3840,"prot_id":37395,"protein_code":"Mac1-DLS-X0128A:Z44592329","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-X0128_0A_apo_j2ToIhb.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 16 17 0 0 0 0 0 0 0 0999 V2000\n 27.5810 56.1380 -7.3950 O 0 0 0 0 0 0 0 0 0 0 0 0\n 27.5000 55.5660 -8.4790 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.9460 54.2950 -8.6920 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.4350 53.3910 -7.7330 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.0720 53.8080 -6.5680 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.4920 52.9680 -5.6180 N 0 0 0 0 0 0 0 0 0 0 0 0\n 29.3010 51.6570 -5.8300 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.6810 51.1460 -6.9460 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.2350 52.0260 -7.9120 C 0 0 0 0 0 0 0 0 0 0 0 0\n 26.9230 56.1050 -9.6030 N 0 0 0 0 0 0 0 0 0 0 0 0\n 25.9140 57.0980 -9.6860 C 0 0 0 0 0 0 0 0 0 0 0 0\n 25.7650 57.7930 -10.8840 C 0 0 0 0 0 0 0 0 0 0 0 0\n 24.7520 58.7320 -11.0170 C 0 0 0 0 0 0 0 0 0 0 0 0\n 23.8900 58.9880 -9.9600 C 0 0 0 0 0 0 0 0 0 0 0 0\n 24.0480 58.3100 -8.7640 C 0 0 0 0 0 0 0 0 0 0 0 0\n 25.0470 57.3580 -8.6260 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 2 0\n 3 2 1 0\n 4 3 1 0\n 5 4 2 0\n 6 5 1 0\n 7 6 2 0\n 8 7 1 0\n 9 8 2 0\n 9 4 1 0\n 10 2 1 0\n 11 10 1 0\n 12 11 2 0\n 13 12 1 0\n 14 13 2 0\n 15 14 1 0\n 16 15 2 0\n 16 11 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":213.09,"logp":2.73,"tpsa":54.02,"ha":16,"hacc":2,"hdon":2,"rots":2,"rings":2,"velec":80,"number":128},{"id":37486,"smiles":"COc1ccc(NC(=O)Nc2ccncc2)cc1","cmpd_id":120,"prot_id":37397,"protein_code":"Mac1-DLS-X0142A:Z321318226","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-X0142_0A_apo_icJcpuu.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 18 19 0 0 0 0 0 0 0 0999 V2000\n 29.0550 54.5350 -6.1750 O 0 0 0 0 0 0 0 0 0 0 0 0\n 28.5900 54.2260 -7.2730 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.4330 52.9390 -7.7130 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.8000 51.7520 -7.0590 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.1400 51.7050 -5.7140 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.5230 50.4880 -5.1830 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.5850 49.3530 -5.8900 N 0 0 0 0 0 0 0 0 0 0 0 0\n 29.2330 49.4210 -7.1790 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.8340 50.5860 -7.8060 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.1150 55.1190 -8.1980 N 0 0 0 0 0 0 0 0 0 0 0 0\n 27.8910 56.5110 -8.0720 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.7870 57.1870 -6.8570 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.5000 58.5420 -6.8350 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.7030 57.2070 -9.2630 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.4080 58.5580 -9.2440 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.3000 59.2270 -8.0280 C 0 0 0 0 0 0 0 0 0 0 0 0\n 26.9310 60.5480 -7.9310 O 0 0 0 0 0 0 0 0 0 0 0 0\n 26.6050 61.2620 -9.1290 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 2 0\n 3 2 1 0\n 4 3 1 0\n 5 4 2 0\n 6 5 1 0\n 7 6 2 0\n 8 7 1 0\n 9 8 2 0\n 9 4 1 0\n 10 2 1 0\n 11 10 1 0\n 12 11 2 0\n 13 12 1 0\n 14 11 1 0\n 15 14 2 0\n 16 15 1 0\n 16 13 2 0\n 17 16 1 0\n 18 17 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":243.1,"logp":2.73,"tpsa":63.25,"ha":18,"hacc":3,"hdon":2,"rots":3,"rings":2,"velec":92,"number":142},{"id":37495,"smiles":"OCC1CCN(c2ncccn2)CC1","cmpd_id":131,"prot_id":37406,"protein_code":"Mac1-DLS-X0282A:Z645232558","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-X0282_0A_apo_TFFROiW.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 14 15 0 0 0 0 0 0 0 0999 V2000\n 29.2910 55.3930 -6.0150 O 0 0 0 0 0 0 0 0 0 0 0 0\n 29.4460 54.9110 -7.3500 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.0300 53.4630 -7.5230 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.0070 52.9720 -8.5330 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.5560 51.6810 -9.1310 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.8020 50.6300 -8.1320 N 0 0 0 0 0 0 0 0 0 0 0 0\n 29.6120 51.0810 -6.9910 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.1820 52.4180 -6.4290 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.7560 49.3050 -8.4810 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.2120 49.0090 -9.6860 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.2380 47.7130 -10.0180 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.7910 46.7290 -9.2230 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.3680 47.1460 -8.0480 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.3540 48.4250 -7.6340 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 1 0\n 4 3 1 0\n 5 4 1 0\n 6 5 1 0\n 7 6 1 0\n 8 7 1 0\n 8 3 1 0\n 9 6 1 0\n 10 9 2 0\n 11 10 1 0\n 12 11 2 0\n 13 12 1 0\n 14 13 2 0\n 14 9 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":193.12,"logp":0.69,"tpsa":49.25,"ha":14,"hacc":4,"hdon":1,"rots":2,"rings":2,"velec":76,"number":282},{"id":37496,"smiles":"CNCC(=O)Nc1cc(C)ccn1","cmpd_id":3949,"prot_id":37407,"protein_code":"Mac1-DLS-X0290A:Z927746322","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-X0290_0A_apo_EdXrU65.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 13 13 0 0 0 0 0 0 0 0999 V2000\n 29.6200 52.2460 -6.7710 O 0 0 0 0 0 0 0 0 0 0 0 0\n 28.9620 52.5160 -7.7720 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.7080 53.9620 -8.1580 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.5750 54.9000 -7.4320 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.8440 55.6740 -6.4230 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.4160 51.5860 -8.5980 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.5930 50.1890 -8.5830 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.2230 49.5230 -9.7000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.3820 48.1870 -9.7010 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.9220 47.4790 -8.6400 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.3360 48.1670 -7.5020 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.0110 47.4500 -6.3590 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.1470 49.5440 -7.4630 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 2 0\n 3 2 1 0\n 4 3 1 0\n 5 4 1 0\n 6 2 1 0\n 7 6 1 0\n 8 7 2 0\n 9 8 1 0\n 10 9 2 0\n 11 10 1 0\n 12 11 1 0\n 13 11 2 0\n 13 7 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":179.11,"logp":0.55,"tpsa":54.02,"ha":13,"hacc":3,"hdon":2,"rots":3,"rings":1,"velec":70,"number":290},{"id":37497,"smiles":"CCCC(=O)NCc1nc2ccccc2[nH]1","cmpd_id":588,"prot_id":37408,"protein_code":"Mac1-DLS-X0299A:Z26781952","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-X0299_0A_apo_Bh2B2CE.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 16 17 0 0 0 0 0 0 0 0999 V2000\n 26.5430 57.1080 -7.6510 O 0 0 0 0 0 0 0 0 0 0 0 0\n 27.1990 56.7660 -8.6310 C 0 0 0 0 0 0 0 0 0 0 0 0\n 26.6010 56.7840 -10.0200 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.0470 57.9610 -10.8650 C 0 0 0 0 0 0 0 0 0 0 0 0\n 26.2570 59.2240 -10.5950 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.4600 56.3460 -8.5350 N 0 0 0 0 0 0 0 0 0 0 0 0\n 29.0430 55.9980 -7.2540 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.0140 54.4820 -7.0510 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.7040 53.6110 -8.0420 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.7610 52.3450 -7.5010 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.1210 52.5220 -6.1660 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.2730 53.8840 -5.9030 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.5420 51.0890 -8.0410 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.7010 49.9920 -7.2100 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.0600 50.1520 -5.8750 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.2720 51.4140 -5.3400 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 2 0\n 3 2 1 0\n 4 3 1 0\n 5 4 1 0\n 6 2 1 0\n 7 6 1 0\n 8 7 1 0\n 9 8 2 0\n 10 9 1 0\n 11 10 2 0\n 12 11 1 0\n 12 8 1 0\n 13 10 1 0\n 14 13 2 0\n 15 14 1 0\n 16 15 2 0\n 16 11 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":217.12,"logp":1.98,"tpsa":57.78,"ha":16,"hacc":2,"hdon":2,"rots":4,"rings":2,"velec":84,"number":299},{"id":37500,"smiles":"O=C(NCc1nc2ccccc2[nH]1)c1ccco1","cmpd_id":419,"prot_id":37411,"protein_code":"Mac1-DLS-X0371A:Z26781964","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-X0371_0A_apo_DK274Q7.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 18 20 0 0 0 0 0 0 0 0999 V2000\n 26.7930 57.3040 -7.2310 O 0 0 0 0 0 0 0 0 0 0 0 0\n 27.2360 56.8980 -8.3090 C 0 0 0 0 0 0 0 0 0 0 0 0\n 26.5700 57.2490 -9.5850 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.0570 56.7040 -10.7380 O 0 0 0 0 0 0 0 0 0 0 0 0\n 26.2380 57.1500 -11.7390 C 0 0 0 0 0 0 0 0 0 0 0 0\n 25.2860 57.9370 -11.2560 C 0 0 0 0 0 0 0 0 0 0 0 0\n 25.4880 58.0120 -9.8610 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.3220 56.1270 -8.4030 N 0 0 0 0 0 0 0 0 0 0 0 0\n 29.0770 55.7520 -7.2250 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.0130 54.2650 -6.9770 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.6570 53.4010 -7.9570 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.7220 52.1320 -7.4230 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.1300 52.3040 -6.1000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.2990 53.6610 -5.8390 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.4890 50.8800 -7.9600 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.6850 49.7780 -7.1400 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.0960 49.9340 -5.8200 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.3190 51.1930 -5.2850 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 2 0\n 3 2 1 0\n 4 3 1 0\n 5 4 1 0\n 6 5 2 0\n 7 6 1 0\n 7 3 2 0\n 8 2 1 0\n 9 8 1 0\n 10 9 1 0\n 11 10 2 0\n 12 11 1 0\n 13 12 2 0\n 14 13 1 0\n 14 10 1 0\n 15 12 1 0\n 16 15 2 0\n 17 16 1 0\n 18 17 2 0\n 18 13 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":241.09,"logp":2.09,"tpsa":70.92,"ha":18,"hacc":3,"hdon":2,"rots":3,"rings":3,"velec":90,"number":371},{"id":37503,"smiles":"NC(=O)c1c[nH]c(C2CC2)n1","cmpd_id":512,"prot_id":37414,"protein_code":"Mac1-DLS-X0421A:Z1407672867","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-X0421_0A_apo_UId9Gcy.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 11 12 0 0 0 0 0 0 0 0999 V2000\n 29.5590 48.1970 -6.5240 O 0 0 0 0 0 0 0 0 0 0 0 0\n 29.5210 49.3730 -6.1360 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.8470 49.7350 -4.9020 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.9960 50.4410 -7.0260 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.0580 51.7950 -6.7060 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.5160 52.3930 -7.7590 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.1130 51.5290 -8.7150 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.4210 50.2950 -8.2550 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.3600 53.8480 -7.9950 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.5750 54.7270 -8.0670 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.6770 54.8290 -6.9020 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 2 0\n 3 2 1 0\n 4 2 1 0\n 5 4 1 0\n 6 5 2 0\n 7 6 1 0\n 8 7 1 0\n 8 4 2 0\n 9 6 1 0\n 10 9 1 0\n 11 9 1 0\n 11 10 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":151.07,"logp":0.39,"tpsa":71.77,"ha":11,"hacc":2,"hdon":2,"rots":2,"rings":2,"velec":58,"number":421},{"id":37506,"smiles":"CS(=O)(=O)Cc1nc2ccccc2[nH]1","cmpd_id":3854,"prot_id":37417,"protein_code":"Mac1-DLS-X0438A:Z126932614","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-X0438_0A_apo_w6aJZXI.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 14 15 0 0 0 0 0 0 0 0999 V2000\n 26.9880 56.6630 -6.2260 O 0 0 0 0 0 0 0 0 0 0 0 0\n 27.7390 56.9550 -7.4160 S 0 0 0 0 0 0 0 0 0 0 0 0\n 28.0960 58.3310 -7.6520 O 0 0 0 0 0 0 0 0 0 0 0 0\n 26.8630 56.3480 -8.8100 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.2440 55.9960 -7.3770 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.0910 54.5310 -7.1850 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.7460 53.6740 -8.1740 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.7230 52.4130 -7.6270 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.0590 52.5810 -6.2850 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.2920 53.9280 -6.0290 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.4660 51.1670 -8.1690 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.5700 50.0660 -7.3320 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.9090 50.2160 -5.9910 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.1400 51.4730 -5.4510 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 2 0\n 3 2 2 0\n 2 4 1 0\n 5 2 1 0\n 6 5 1 0\n 7 6 2 0\n 8 7 1 0\n 9 8 2 0\n 10 9 1 0\n 10 6 1 0\n 11 8 1 0\n 12 11 2 0\n 13 12 1 0\n 14 13 2 0\n 14 9 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":210.05,"logp":1.11,"tpsa":62.82,"ha":14,"hacc":3,"hdon":1,"rots":2,"rings":2,"velec":74,"number":438},{"id":37509,"smiles":"CC(C)C(=O)NCc1nc2ccccc2[nH]1","cmpd_id":3953,"prot_id":37420,"protein_code":"Mac1-DLS-X0471A:Z26781943","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-X0471_0A_apo_kOWyFeC.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 16 17 0 0 0 0 0 0 0 0999 V2000\n 26.7470 57.0960 -7.9770 O 0 0 0 0 0 0 0 0 0 0 0 0\n 27.7050 57.0250 -8.7490 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.5930 57.4530 -10.2110 C 0 0 0 0 0 0 0 0 0 0 0 0\n 26.1780 57.2580 -10.6850 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.0590 58.8930 -10.3850 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.9010 56.5830 -8.3630 N 0 0 0 0 0 0 0 0 0 0 0 0\n 29.1470 56.1300 -7.0100 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.0140 54.6320 -6.9290 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.5130 53.8870 -7.9420 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.4920 52.5780 -7.5120 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.0270 52.5990 -6.2240 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.3410 53.9120 -5.8730 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.0590 51.4050 -8.1090 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.1980 50.2260 -7.3910 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.7500 50.2290 -6.1110 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.1630 51.4100 -5.5130 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 2 0\n 3 2 1 0\n 3 4 1 0\n 5 3 1 0\n 6 2 1 0\n 7 6 1 0\n 8 7 1 0\n 9 8 2 0\n 10 9 1 0\n 11 10 2 0\n 12 11 1 0\n 12 8 1 0\n 13 10 1 0\n 14 13 2 0\n 15 14 1 0\n 16 15 2 0\n 16 11 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":217.12,"logp":1.84,"tpsa":57.78,"ha":16,"hacc":2,"hdon":2,"rots":3,"rings":2,"velec":84,"number":471},{"id":37515,"smiles":"COc1ccc2sc(N)nc2c1","cmpd_id":195,"prot_id":37426,"protein_code":"Mac1-DLS-X0574A:Z1954800564","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-X0574_0A_apo_7QDxh52.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 12 13 0 0 0 0 0 0 0 0999 V2000\n 28.6490 47.5700 -10.7720 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.5850 48.4820 -9.8220 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.9340 48.0470 -8.1500 S 0 0 0 0 0 0 0 0 0 0 0 0\n 28.3710 49.7490 -10.0420 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.5070 50.4810 -8.8690 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.8210 49.7300 -7.7290 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.0670 50.3430 -6.5090 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.0030 51.7200 -6.4390 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.4100 51.8620 -8.7780 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.6560 52.4640 -7.5570 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.5340 53.8170 -7.3800 O 0 0 0 0 0 0 0 0 0 0 0 0\n 28.1390 54.6160 -8.5010 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 1 0\n 4 2 2 0\n 5 4 1 0\n 6 3 1 0\n 6 5 2 0\n 7 6 1 0\n 8 7 2 0\n 9 5 1 0\n 10 9 2 0\n 10 8 1 0\n 11 10 1 0\n 12 11 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":180.04,"logp":1.89,"tpsa":48.14,"ha":12,"hacc":4,"hdon":1,"rots":1,"rings":2,"velec":62,"number":574},{"id":37516,"smiles":"NC(=O)c1cnc(C(F)(F)F)nc1","cmpd_id":198,"prot_id":37427,"protein_code":"Mac1-DLS-X0587A:Z1745658474","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-X0587_0A_apo_EOo612O.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 13 13 0 0 0 0 0 0 0 0999 V2000\n 29.3530 51.0720 -4.7730 F 0 0 0 0 0 0 0 0 0 0 0 0\n 29.6700 51.1240 -6.0590 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.1290 50.0630 -6.6260 F 0 0 0 0 0 0 0 0 0 0 0 0\n 30.9700 50.9490 -6.1500 F 0 0 0 0 0 0 0 0 0 0 0 0\n 29.2240 52.4220 -6.6960 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.5620 52.3570 -7.8560 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.1750 53.5490 -8.3320 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.5480 53.5030 -5.9750 N 0 0 0 0 0 0 0 0 0 0 0 0\n 29.1340 54.6630 -6.4990 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.4200 54.7550 -7.6870 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.8440 56.0510 -8.1850 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.9710 57.0770 -7.5000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 27.1800 56.0360 -9.3390 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 1 0\n 4 2 1 0\n 5 2 1 0\n 6 5 2 0\n 7 6 1 0\n 8 5 1 0\n 9 8 2 0\n 10 7 2 0\n 10 9 1 0\n 11 10 1 0\n 12 11 2 0\n 13 11 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":191.03,"logp":0.59,"tpsa":68.87,"ha":13,"hacc":3,"hdon":1,"rots":1,"rings":1,"velec":70,"number":587},{"id":37517,"smiles":"CNC(=O)c1ccc(S(N)(=O)=O)cc1","cmpd_id":250,"prot_id":37428,"protein_code":"Mac1-DLS-X0591A:Z165170770","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-X0591_0A_apo_Tt69iSv.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 14 14 0 0 0 0 0 0 0 0999 V2000\n 31.1110 48.0200 -2.3980 O 0 0 0 0 0 0 0 0 0 0 0 0\n 31.0300 47.8000 -3.8160 S 0 0 0 0 0 0 0 0 0 0 0 0\n 32.2190 47.4030 -4.5220 O 0 0 0 0 0 0 0 0 0 0 0 0\n 29.9220 46.6530 -4.0540 N 0 0 0 0 0 0 0 0 0 0 0 0\n 30.4530 49.2970 -4.5600 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.0110 50.3320 -3.7510 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.6010 51.5190 -4.3300 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.4630 49.4360 -5.9410 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.0370 50.6260 -6.5080 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.6250 51.6830 -5.7110 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.3090 53.0310 -6.2680 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.4180 54.0360 -5.5740 O 0 0 0 0 0 0 0 0 0 0 0 0\n 28.9030 53.0800 -7.5330 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.4950 54.3210 -8.1610 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 2 0\n 3 2 2 0\n 2 4 1 0\n 5 2 1 0\n 6 5 2 0\n 7 6 1 0\n 8 5 1 0\n 9 8 2 0\n 10 9 1 0\n 10 7 2 0\n 11 10 1 0\n 12 11 2 0\n 13 11 1 0\n 14 13 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":214.04,"logp":-0.31,"tpsa":89.26,"ha":14,"hacc":3,"hdon":2,"rots":2,"rings":1,"velec":76,"number":591},{"id":37518,"smiles":"NC(=O)c1cnn(CCO)c1","cmpd_id":3954,"prot_id":37429,"protein_code":"Mac1-DLS-X0592A:Z1562205518","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-X0592_0A_apo_LHofLhV.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 11 11 0 0 0 0 0 0 0 0999 V2000\n 29.2660 49.3630 -6.9280 O 0 0 0 0 0 0 0 0 0 0 0 0\n 28.8640 50.3610 -7.5350 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.2520 50.3300 -8.7120 N 0 0 0 0 0 0 0 0 0 0 0 0\n 29.0650 51.6820 -6.9090 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.8730 52.9100 -7.5110 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.1010 53.8430 -6.5720 N 0 0 0 0 0 0 0 0 0 0 0 0\n 29.4270 53.3020 -5.3730 N 0 0 0 0 0 0 0 0 0 0 0 0\n 29.4190 51.9980 -5.5880 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.0350 55.2940 -6.7090 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.8540 55.6920 -8.1530 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.5850 55.2660 -8.6480 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 2 0\n 3 2 1 0\n 4 2 1 0\n 5 4 2 0\n 6 5 1 0\n 7 6 1 0\n 8 4 1 0\n 8 7 2 0\n 9 6 1 0\n 10 9 1 0\n 11 10 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":155.07,"logp":-1.03,"tpsa":81.14,"ha":11,"hacc":4,"hdon":2,"rots":3,"rings":1,"velec":60,"number":592},{"id":37521,"smiles":"CCC(=O)Nc1nc(C)cs1","cmpd_id":282,"prot_id":37432,"protein_code":"Mac1-DLS-X0626A:Z30820160","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-X0626_0A_apo_uzXr4Gs.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 11 11 0 0 0 0 0 0 0 0999 V2000\n 29.2360 52.9870 -6.1530 O 0 0 0 0 0 0 0 0 0 0 0 0\n 28.8520 53.3260 -7.2680 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.7100 54.7580 -7.6950 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.2470 55.6980 -6.7010 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.5120 52.4500 -8.2470 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.6360 51.0870 -8.1410 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.1870 50.2760 -6.7150 S 0 0 0 0 0 0 0 0 0 0 0 0\n 28.9480 48.7820 -7.5410 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.5000 48.9820 -8.8030 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.3150 50.3130 -9.1470 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.2550 47.9270 -9.8340 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 2 0\n 3 2 1 0\n 4 3 1 0\n 5 2 1 0\n 6 5 1 0\n 7 6 1 0\n 8 7 1 0\n 9 8 2 0\n 10 9 1 0\n 10 6 2 0\n 11 9 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":170.05,"logp":1.8,"tpsa":41.99,"ha":11,"hacc":3,"hdon":1,"rots":2,"rings":1,"velec":60,"number":626},{"id":37527,"smiles":"NC(=O)[C@H]1CCCn2ccnc21","cmpd_id":3958,"prot_id":37438,"protein_code":"Mac1-DLS-X0681A:Z1324853681","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-X0681_0A_apo_YaUy11d.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 12 13 0 0 0 0 0 0 0 0999 V2000\n 30.1220 48.8480 -5.9260 O 0 0 0 0 0 0 0 0 0 0 0 0\n 29.5820 49.9420 -6.1090 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.1920 50.7370 -5.1300 N 0 0 0 0 0 0 0 0 0 0 0 0\n 29.4070 50.5390 -7.4870 C 0 0 2 0 0 0 0 0 0 0 0 0\n 30.3230 51.6890 -7.4960 C 0 0 0 0 0 0 0 0 0 0 0 0\n 31.4930 51.7090 -6.8910 N 0 0 0 0 0 0 0 0 0 0 0 0\n 31.9390 53.0040 -7.0400 C 0 0 0 0 0 0 0 0 0 0 0 0\n 31.0570 53.7290 -7.7620 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.0220 52.8840 -8.0460 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.7670 53.2240 -8.7190 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.8700 52.0070 -8.8640 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.9700 51.0870 -7.6540 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 2 0\n 3 2 1 0\n 4 2 1 1\n 5 4 1 0\n 6 5 2 0\n 7 6 1 0\n 8 7 2 0\n 9 8 1 0\n 9 5 1 0\n 10 9 1 0\n 11 10 1 0\n 12 11 1 0\n 12 4 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":165.09,"logp":0.25,"tpsa":60.91,"ha":12,"hacc":3,"hdon":1,"rots":1,"rings":2,"velec":64,"number":681},{"id":37528,"smiles":"CCNc1ccc(C#N)cn1","cmpd_id":3834,"prot_id":37439,"protein_code":"Mac1-DLS-X0685A:Z219104216","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-X0685_0A_apo_KHBo4QB.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 11 11 0 0 0 0 0 0 0 0999 V2000\n 29.9080 49.1440 -4.7070 N 0 0 0 0 0 0 0 0 0 0 0 0\n 29.5680 49.9090 -5.4800 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.1500 50.9090 -6.4200 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.5940 50.5520 -7.6430 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.1530 51.5370 -8.5060 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.2610 52.2640 -6.1200 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.8440 53.2320 -6.9400 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.2910 52.8730 -8.1090 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.7760 53.8600 -8.8870 N 0 0 0 0 0 0 0 0 0 0 0 0\n 27.8660 55.2890 -8.5910 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.1650 55.8820 -9.0820 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 3 0\n 3 2 1 0\n 4 3 2 0\n 5 4 1 0\n 6 3 1 0\n 7 6 2 0\n 8 7 1 0\n 8 5 2 0\n 9 8 1 0\n 10 9 1 0\n 11 10 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":147.08,"logp":1.39,"tpsa":48.71,"ha":11,"hacc":3,"hdon":1,"rots":2,"rings":1,"velec":56,"number":685},{"id":37530,"smiles":"CNc1ncccn1","cmpd_id":298,"prot_id":37441,"protein_code":"Mac1-DLS-X0689A:Z54628578","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-X0689_0A_apo_UHe0K63.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 8 8 0 0 0 0 0 0 0 0999 V2000\n 28.1390 52.0920 -7.8340 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.9900 51.1340 -8.9080 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.3700 49.8510 -8.8550 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.8960 49.4110 -7.6890 N 0 0 0 0 0 0 0 0 0 0 0 0\n 29.1960 48.1000 -7.6480 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.9810 47.2370 -8.7070 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.4490 47.8070 -9.8540 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.1490 49.1100 -9.9630 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 1 0\n 4 3 2 0\n 5 4 1 0\n 6 5 2 0\n 7 6 1 0\n 8 7 2 0\n 8 3 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":109.06,"logp":0.52,"tpsa":37.81,"ha":8,"hacc":3,"hdon":1,"rots":1,"rings":1,"velec":42,"number":689},{"id":37531,"smiles":"CS(=O)(=O)Nc1ccc(C(N)=O)cc1","cmpd_id":98,"prot_id":37442,"protein_code":"Mac1-DLS-X0711A:mArh-x0711","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-X0711_0A_apo_kauNMDc.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 14 14 0 0 0 0 0 0 0 0999 V2000\n 29.3290 54.3930 -5.9950 O 0 0 0 0 0 0 0 0 0 0 0 0\n 29.0600 53.6180 -6.9180 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.6230 54.0290 -8.0970 N 0 0 0 0 0 0 0 0 0 0 0 0\n 29.2090 52.1450 -6.7070 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.0410 51.2460 -7.7520 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.1780 49.8860 -7.5410 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.5160 51.6550 -5.4450 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.6540 50.2960 -5.2280 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.4790 49.3990 -6.2750 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.4160 47.9950 -6.0100 N 0 0 0 0 0 0 0 0 0 0 0 0\n 30.5360 46.8400 -6.2570 S 0 0 0 0 0 0 0 0 0 0 0 0\n 30.1170 45.7050 -5.4930 O 0 0 0 0 0 0 0 0 0 0 0 0\n 30.7060 46.6960 -7.6710 O 0 0 0 0 0 0 0 0 0 0 0 0\n 32.0280 47.4480 -5.5690 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 2 0\n 3 2 1 0\n 4 2 1 0\n 5 4 2 0\n 6 5 1 0\n 7 4 1 0\n 8 7 2 0\n 9 6 2 0\n 9 8 1 0\n 10 9 1 0\n 11 10 1 0\n 12 11 2 0\n 13 11 2 0\n 11 14 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":214.04,"logp":0.16,"tpsa":89.26,"ha":14,"hacc":3,"hdon":2,"rots":3,"rings":1,"velec":76,"number":711},{"id":37532,"smiles":"Cc1nn(C)c(C)c1CC(N)=O","cmpd_id":3959,"prot_id":37443,"protein_code":"Mac1-DLS-X0722A:Z287484230","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-X0722_0A_apo_QVojih9.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 12 12 0 0 0 0 0 0 0 0999 V2000\n 29.1090 53.6310 -5.3170 O 0 0 0 0 0 0 0 0 0 0 0 0\n 29.3720 52.7910 -6.1820 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.2210 53.0120 -7.1760 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.7220 51.4300 -6.1290 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.5510 50.7680 -7.4690 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.9210 51.2900 -8.6120 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.2590 52.6170 -8.7810 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.8820 49.4690 -7.8210 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.6240 48.4660 -7.0090 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.4470 49.2850 -9.0820 N 0 0 0 0 0 0 0 0 0 0 0 0\n 27.8710 50.4010 -9.5910 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.4860 48.0750 -9.8940 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 2 0\n 3 2 1 0\n 4 2 1 0\n 5 4 1 0\n 6 5 1 0\n 7 6 1 0\n 8 5 2 0\n 9 8 1 0\n 10 8 1 0\n 11 10 1 0\n 11 6 2 0\n 12 10 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":167.11,"logp":0.06,"tpsa":60.91,"ha":12,"hacc":3,"hdon":1,"rots":2,"rings":1,"velec":66,"number":722},{"id":37533,"smiles":"CNCc1cnn(-c2ccccc2)c1","cmpd_id":99,"prot_id":37444,"protein_code":"Mac1-DLS-X0724A:Z102768020","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-X0724_0A_apo_Ks9l6cR.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 14 15 0 0 0 0 0 0 0 0999 V2000\n 27.6400 57.8050 -10.8180 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.2660 56.7690 -9.9910 N 0 0 0 0 0 0 0 0 0 0 0 0\n 27.4040 56.3790 -8.8730 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.0810 55.3510 -8.0430 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.1480 54.0110 -8.3280 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.8220 53.4160 -7.3210 N 0 0 0 0 0 0 0 0 0 0 0 0\n 29.2170 54.3130 -6.3710 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.7700 55.4760 -6.8160 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.1170 52.0300 -7.1620 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.9050 51.6120 -6.1000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.0190 50.2630 -5.8160 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.3820 49.3370 -6.6040 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.6200 49.7530 -7.6810 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.4860 51.1020 -7.9660 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 1 0\n 4 3 1 0\n 5 4 2 0\n 6 5 1 0\n 7 6 1 0\n 8 7 2 0\n 8 4 1 0\n 9 6 1 0\n 10 9 2 0\n 11 10 1 0\n 12 11 2 0\n 13 12 1 0\n 14 13 2 0\n 14 9 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":187.11,"logp":1.59,"tpsa":29.85,"ha":14,"hacc":3,"hdon":1,"rots":3,"rings":2,"velec":72,"number":724},{"id":37539,"smiles":"CC(=O)N1[C@H]2CC[C@@H]1Cc1ncccc12","cmpd_id":3963,"prot_id":37450,"protein_code":"Mac1-DLS-X0742A:POB0103","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-X0742_0A_apo_7wOrDno.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 15 17 0 0 0 0 0 0 0 0999 V2000\n 32.3650 51.7060 -6.9870 O 0 0 0 0 0 0 0 0 0 0 0 0\n 31.4030 52.3090 -7.4550 C 0 0 0 0 0 0 0 0 0 0 0 0\n 31.5210 53.7000 -7.9970 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.1890 51.7100 -7.5340 N 0 0 0 0 0 0 0 0 0 0 0 0\n 29.8890 50.4380 -6.8720 C 0 0 1 0 0 0 0 0 0 0 0 0\n 28.5810 50.7860 -6.1550 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.9050 51.8260 -7.0890 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.9460 52.1790 -8.1600 C 0 0 2 0 0 0 0 0 0 0 0 0\n 29.4740 49.4760 -7.9730 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.6640 48.1080 -7.8050 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.2860 47.2380 -8.8110 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.7240 47.7610 -9.9690 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.5390 49.0710 -10.1820 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.9010 49.9120 -9.1980 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.7180 51.3870 -9.4400 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 2 0\n 3 2 1 0\n 4 2 1 0\n 5 4 1 0\n 5 6 1 1\n 7 6 1 0\n 8 7 1 1\n 8 4 1 0\n 9 5 1 0\n 10 9 2 0\n 11 10 1 0\n 12 11 2 0\n 13 12 1 0\n 14 13 2 0\n 14 9 1 0\n 15 14 1 0\n 15 8 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":202.11,"logp":1.69,"tpsa":33.2,"ha":15,"hacc":2,"hdon":0,"rots":0,"rings":3,"velec":78,"number":742},{"id":37540,"smiles":"O=C(O)[C@@H]1CCC[C@@H]1c1ccsc1","cmpd_id":3964,"prot_id":37451,"protein_code":"Mac1-DLS-X0766A:POB0128","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-X0766_0A_apo_FRBGyJU.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 13 14 0 0 0 0 0 0 0 0999 V2000\n 31.1140 45.7420 -8.4760 O 0 0 0 0 0 0 0 0 0 0 0 0\n 32.0390 46.2180 -7.6910 C 0 0 0 0 0 0 0 0 0 0 0 0\n 33.0430 46.7320 -8.0790 O 0 0 0 0 0 0 0 0 0 0 0 0\n 31.7800 46.0130 -6.2250 C 0 0 2 0 0 0 0 0 0 0 0 0\n 29.1680 48.0870 -7.3270 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.7450 49.3850 -7.5450 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.2870 49.1680 -5.6470 C 0 0 0 0 0 0 0 0 0 0 0 0\n 31.7210 44.5220 -5.8600 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.2450 44.2070 -5.7070 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.0400 47.9510 -6.2190 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.4800 46.6280 -5.6370 C 0 0 1 0 0 0 0 0 0 0 0 0\n 29.4280 50.4280 -6.4170 S 0 0 0 0 0 0 0 0 0 0 0 0\n 29.4670 45.5030 -5.8740 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 2 0\n 3 2 1 0\n 4 2 1 6\n 6 5 2 0\n 8 4 1 0\n 9 8 1 0\n 10 5 1 0\n 10 7 2 0\n 11 10 1 6\n 11 4 1 0\n 12 7 1 0\n 12 6 1 0\n 13 11 1 0\n 13 9 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":196.06,"logp":2.72,"tpsa":37.3,"ha":13,"hacc":2,"hdon":1,"rots":2,"rings":2,"velec":70,"number":766},{"id":37545,"smiles":"COc1cccc([C@H]2CCOC[C@H]2C(=O)O)c1","cmpd_id":3968,"prot_id":37456,"protein_code":"Mac1-DLS-X0805A:POB0136","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-X0805_0A_apo_tTDcxik.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 17 18 0 0 0 0 0 0 0 0999 V2000\n 31.1620 46.0110 -8.4640 O 0 0 0 0 0 0 0 0 0 0 0 0\n 32.1180 46.1010 -7.7370 C 0 0 0 0 0 0 0 0 0 0 0 0\n 33.2850 46.4710 -8.1400 O 0 0 0 0 0 0 0 0 0 0 0 0\n 32.0760 45.7930 -6.2630 C 0 0 2 0 0 0 0 0 0 0 0 0\n 32.0460 44.2850 -6.0700 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.7710 43.6780 -6.3810 O 0 0 0 0 0 0 0 0 0 0 0 0\n 29.7400 44.2210 -5.5480 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.5600 45.6970 -5.7980 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.8710 46.4560 -5.5440 C 0 0 2 0 0 0 0 0 0 0 0 0\n 30.7530 47.9360 -5.8650 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.5780 48.4600 -6.4010 C 0 0 0 0 0 0 0 0 0 0 0 0\n 31.8170 48.7920 -5.6180 C 0 0 0 0 0 0 0 0 0 0 0 0\n 31.7080 50.1480 -5.8860 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.5290 50.6730 -6.3990 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.4710 49.8190 -6.6640 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.2640 50.1950 -7.2030 O 0 0 0 0 0 0 0 0 0 0 0 0\n 28.0390 51.5720 -7.5050 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 2 0\n 4 2 1 6\n 5 4 1 0\n 6 5 1 0\n 7 6 1 0\n 8 7 1 0\n 9 8 1 0\n 9 4 1 0\n 9 10 1 6\n 11 10 2 0\n 12 10 1 0\n 13 12 2 0\n 14 13 1 0\n 15 11 1 0\n 15 14 2 0\n 16 15 1 0\n 17 16 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":236.1,"logp":1.9,"tpsa":55.76,"ha":17,"hacc":3,"hdon":1,"rots":3,"rings":2,"velec":92,"number":805},{"id":37548,"smiles":"O=c1cc(I)cc[nH]1","cmpd_id":3971,"prot_id":37459,"protein_code":"Mac1-DLS-X0837A:NCL-00023824","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-X0837_0A_apo_DqbRkgX.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 8 8 0 0 0 0 0 0 0 0999 V2000\n 29.8990 49.2560 -5.5900 I 0 0 0 0 0 0 0 0 0 0 0 0\n 29.1250 50.9450 -6.5790 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.3170 52.1370 -6.0090 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.4690 50.8170 -7.8550 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.0590 51.9480 -8.4610 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.2740 53.1560 -7.8910 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.9070 53.3320 -6.6800 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.1240 54.4840 -6.2750 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 2 0\n 4 2 1 0\n 5 4 2 0\n 6 5 1 0\n 7 6 1 0\n 7 3 1 0\n 8 7 2 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":220.93,"logp":0.98,"tpsa":32.86,"ha":8,"hacc":1,"hdon":1,"rots":0,"rings":1,"velec":42,"number":837},{"id":37549,"smiles":"O=c1cc(Br)cc[nH]1","cmpd_id":3972,"prot_id":37460,"protein_code":"Mac1-DLS-X0844A:NCL-00023825","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-X0844_0A_apo_CUdiSnk.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 8 8 0 0 0 0 0 0 0 0999 V2000\n 29.7580 49.3480 -5.5230 Br 0 0 0 0 0 0 0 0 0 0 0 0\n 29.1250 50.9060 -6.3670 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.2990 52.0970 -5.7560 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.5650 50.8030 -7.6660 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.2590 51.9530 -8.2860 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.4860 53.1520 -7.6910 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.9910 53.2910 -6.4250 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.1230 54.4250 -5.9470 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 2 0\n 4 2 1 0\n 5 4 2 0\n 6 5 1 0\n 7 6 1 0\n 7 3 1 0\n 8 7 2 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":172.95,"logp":1.14,"tpsa":32.86,"ha":8,"hacc":1,"hdon":1,"rots":0,"rings":1,"velec":42,"number":844},{"id":37550,"smiles":"Brc1ccnc2ncccc12","cmpd_id":3973,"prot_id":37461,"protein_code":"Mac1-DLS-X0849A:NCL-00023833","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-X0849_0A_apo_MWLRd62.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 11 12 0 0 0 0 0 0 0 0999 V2000\n 29.3330 49.6380 -5.0230 Br 0 0 0 0 0 0 0 0 0 0 0 0\n 28.7690 50.2230 -6.7160 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.6820 49.2920 -7.7660 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.9760 47.9090 -7.7140 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.7720 47.1310 -8.8060 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.3000 47.7230 -9.9640 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.0120 49.0080 -10.0850 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.1790 49.7990 -8.9870 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.7960 51.0990 -9.1440 N 0 0 0 0 0 0 0 0 0 0 0 0\n 27.9200 51.9030 -8.1020 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.4070 51.5260 -6.8700 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 2 0\n 4 3 1 0\n 5 4 2 0\n 6 5 1 0\n 7 6 2 0\n 8 7 1 0\n 8 3 1 0\n 9 8 2 0\n 10 9 1 0\n 11 10 2 0\n 11 2 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":207.96,"logp":2.39,"tpsa":25.78,"ha":11,"hacc":2,"hdon":0,"rots":0,"rings":2,"velec":54,"number":849},{"id":37551,"smiles":"N#Cc1cc(Br)ccc1O","cmpd_id":3974,"prot_id":37462,"protein_code":"Mac1-DLS-X0852B:NCL-00024661","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-X0852_0B_apo_66E2qVD.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 10 10 0 0 0 0 0 0 0 0999 V2000\n 27.0030 57.4560 -4.9950 Br 0 0 0 0 0 0 0 0 0 0 0 0\n 26.9550 57.2840 -6.8850 C 0 0 0 0 0 0 0 0 0 0 0 0\n 25.8640 57.7790 -7.5680 C 0 0 0 0 0 0 0 0 0 0 0 0\n 25.7600 57.5330 -8.9330 C 0 0 0 0 0 0 0 0 0 0 0 0\n 24.6550 58.0820 -9.6740 C 0 0 0 0 0 0 0 0 0 0 0 0\n 23.7670 58.5430 -10.2250 N 0 0 0 0 0 0 0 0 0 0 0 0\n 27.9590 56.5840 -7.5220 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.8540 56.3350 -8.8780 C 0 0 0 0 0 0 0 0 0 0 0 0\n 26.7530 56.7950 -9.5990 C 0 0 0 0 0 0 0 0 0 0 0 0\n 26.6500 56.5460 -10.9280 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 2 0\n 4 3 1 0\n 5 4 1 0\n 6 5 3 0\n 7 2 1 0\n 8 7 2 0\n 9 4 2 0\n 9 8 1 0\n 10 9 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":196.95,"logp":2.03,"tpsa":44.02,"ha":10,"hacc":2,"hdon":1,"rots":0,"rings":1,"velec":50,"number":852},{"id":37554,"smiles":"O=C1CNC(=O)N1","cmpd_id":3977,"prot_id":37465,"protein_code":"Mac1-DLS-X0895A:Z57131035","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-X0895_0A_apo_yztwNqr.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 7 7 0 0 0 0 0 0 0 0999 V2000\n 28.6810 53.3970 -7.5760 O 0 0 0 0 0 0 0 0 0 0 0 0\n 28.6850 52.1740 -7.6720 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.0400 51.3130 -6.7130 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.9050 49.9360 -7.1340 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.3210 51.4430 -8.7780 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.4370 50.1010 -8.5770 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.2490 49.2400 -9.4360 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 2 0\n 3 2 1 0\n 4 3 1 0\n 5 2 1 0\n 6 5 1 0\n 6 4 1 0\n 7 6 2 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":100.03,"logp":-1.17,"tpsa":58.2,"ha":7,"hacc":2,"hdon":2,"rots":0,"rings":1,"velec":38,"number":895},{"id":37555,"smiles":"O=C1CNC(=O)N1","cmpd_id":3977,"prot_id":37466,"protein_code":"Mac1-DLS-X0895_1A:Z57131035","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-X0895_1A_apo_s4TRSlS.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 7 7 0 0 0 0 0 0 0 0999 V2000\n 29.3400 50.9750 -5.9010 O 0 0 0 0 0 0 0 0 0 0 0 0\n 28.8610 50.8990 -7.0220 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.1180 51.8360 -7.6170 N 0 0 0 0 0 0 0 0 0 0 0 0\n 27.6840 51.4370 -8.9340 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.9770 49.8390 -7.8970 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.3270 50.0640 -9.0730 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.3150 49.2840 -10.0270 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 2 0\n 3 2 1 0\n 4 3 1 0\n 5 2 1 0\n 6 5 1 0\n 6 4 1 0\n 7 6 2 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":100.03,"logp":-1.17,"tpsa":58.2,"ha":7,"hacc":2,"hdon":2,"rots":0,"rings":1,"velec":38,"number":895},{"id":37556,"smiles":"O=C1CCCN1","cmpd_id":3978,"prot_id":37467,"protein_code":"Mac1-DLS-X0900A:Z940713508","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-X0900_0A_apo_COlRJX2.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 6 6 0 0 0 0 0 0 0 0999 V2000\n 29.2770 53.5930 -5.5440 O 0 0 0 0 0 0 0 0 0 0 0 0\n 29.0310 52.6960 -6.3530 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.1250 51.3970 -6.1050 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.6600 50.5500 -7.1930 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.0170 51.5320 -8.1490 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.5810 52.8850 -7.7640 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 2 0\n 3 2 1 0\n 4 3 1 0\n 5 4 1 0\n 6 5 1 0\n 6 2 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":85.05,"logp":-0.1,"tpsa":29.1,"ha":6,"hacc":1,"hdon":1,"rots":0,"rings":1,"velec":34,"number":900},{"id":37558,"smiles":"Oc1ccccn1","cmpd_id":1605,"prot_id":37469,"protein_code":"Mac1-DLS-X0905A:Z1741982125","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-X0905_0A_apo_fhRCMsh.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 7 7 0 0 0 0 0 0 0 0999 V2000\n 29.2460 53.6810 -5.5670 O 0 0 0 0 0 0 0 0 0 0 0 0\n 28.9740 52.5210 -6.1550 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.4200 52.5630 -7.3960 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.2150 51.3820 -8.0090 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.5240 50.1630 -7.4420 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.0600 50.1470 -6.1670 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.2990 51.3370 -5.4940 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 2 0\n 4 3 1 0\n 5 4 2 0\n 6 5 1 0\n 7 6 2 0\n 7 2 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":95.04,"logp":0.79,"tpsa":33.12,"ha":7,"hacc":2,"hdon":1,"rots":0,"rings":1,"velec":36,"number":905},{"id":37560,"smiles":"Nc1nnc[nH]1","cmpd_id":3979,"prot_id":37471,"protein_code":"Mac1-DLS-X0910A:Z56866006","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-X0910_0A_apo_oDCQPxX.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 6 6 0 0 0 0 0 0 0 0999 V2000\n 29.4630 49.2420 -6.5280 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.9120 48.8210 -7.6680 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.9990 47.5330 -8.0990 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.3740 47.4820 -9.2920 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.8970 48.7280 -9.6120 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.2500 49.5640 -8.5560 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 1 0\n 4 3 1 0\n 5 4 2 0\n 6 5 1 0\n 6 2 2 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":84.04,"logp":-0.61,"tpsa":67.59,"ha":6,"hacc":3,"hdon":2,"rots":0,"rings":1,"velec":32,"number":910},{"id":37562,"smiles":"Nc1nnc[nH]1","cmpd_id":3979,"prot_id":37473,"protein_code":"Mac1-DLS-X0910_1A:Z56866006","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-X0910_1A_apo_9BAW9YE.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 6 6 0 0 0 0 0 0 0 0999 V2000\n 29.3230 55.1300 -7.4950 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.9380 53.9350 -7.0200 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.2470 53.0190 -7.7740 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.0060 51.9600 -6.9750 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.5480 52.2040 -5.7120 N 0 0 0 0 0 0 0 0 0 0 0 0\n 29.1320 53.4680 -5.7790 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 1 0\n 4 3 1 0\n 5 4 2 0\n 6 5 1 0\n 6 2 2 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":84.04,"logp":-0.61,"tpsa":67.59,"ha":6,"hacc":3,"hdon":2,"rots":0,"rings":1,"velec":32,"number":910},{"id":37563,"smiles":"Nc1ccncc1","cmpd_id":3980,"prot_id":37474,"protein_code":"Mac1-DLS-X0918A:Z955123498","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-X0918_0A_apo_j03w8Hj.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 7 7 0 0 0 0 0 0 0 0999 V2000\n 29.0710 53.2290 -5.2850 N 0 0 0 0 0 0 0 0 0 0 0 0\n 29.0180 52.0580 -6.0110 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.5600 50.8750 -5.5130 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.4580 49.7150 -6.2610 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.8510 49.6570 -7.4570 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.3350 50.8020 -7.9370 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.3990 52.0070 -7.2610 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 2 0\n 4 3 1 0\n 5 4 2 0\n 6 5 1 0\n 7 6 2 0\n 7 2 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":94.05,"logp":0.66,"tpsa":38.91,"ha":7,"hacc":2,"hdon":1,"rots":0,"rings":1,"velec":36,"number":918},{"id":37565,"smiles":"Nc1ccncc1","cmpd_id":3980,"prot_id":37476,"protein_code":"Mac1-DLS-X0918_1A:Z955123498","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-X0918_1A_apo_PXKovc5.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 7 7 0 0 0 0 0 0 0 0999 V2000\n 28.3980 53.3150 -7.9560 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.7070 52.1290 -7.3370 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.1520 52.0950 -6.0150 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.4720 50.8790 -5.4380 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.3740 49.7070 -6.0850 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.9400 49.7450 -7.3540 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.6020 50.9150 -8.0090 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 2 0\n 4 3 1 0\n 5 4 2 0\n 6 5 1 0\n 7 6 2 0\n 7 2 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":94.05,"logp":0.66,"tpsa":38.91,"ha":7,"hacc":2,"hdon":1,"rots":0,"rings":1,"velec":36,"number":918},{"id":37568,"smiles":"O=c1cccn[nH]1","cmpd_id":3981,"prot_id":37479,"protein_code":"Mac1-DLS-X0926A:Z3219959731","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-X0926_0A_apo_am1o8D4.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 7 7 0 0 0 0 0 0 0 0999 V2000\n 29.2000 53.4360 -5.8430 O 0 0 0 0 0 0 0 0 0 0 0 0\n 28.8440 52.3540 -6.3330 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.2340 51.1890 -5.7610 N 0 0 0 0 0 0 0 0 0 0 0 0\n 29.0080 49.9330 -6.2480 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.3520 49.8550 -7.3740 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.8620 50.9730 -8.0670 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.1060 52.1990 -7.5520 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 2 0\n 3 2 1 0\n 4 3 1 0\n 5 4 2 0\n 6 5 1 0\n 7 6 2 0\n 7 2 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":96.03,"logp":-0.23,"tpsa":45.75,"ha":7,"hacc":2,"hdon":1,"rots":0,"rings":1,"velec":36,"number":926},{"id":37569,"smiles":"NC1NCCCN1","cmpd_id":3982,"prot_id":37480,"protein_code":"Mac1-DLS-X0933A:Z1954800348","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-X0933_0A_apo_46Ten18.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 7 7 0 0 0 0 0 0 0 0999 V2000\n 28.3440 53.8680 -8.2300 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.5150 52.6940 -7.7180 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.1510 52.4130 -6.5650 N 0 0 0 0 0 0 0 0 0 0 0 0\n 29.2260 51.0780 -5.9650 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.1130 50.0190 -7.0240 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.9460 50.2840 -7.9430 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.9450 51.6770 -8.3970 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 1 0\n 4 3 1 0\n 5 4 1 0\n 6 5 1 0\n 7 6 1 0\n 7 2 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":101.1,"logp":-1.19,"tpsa":50.08,"ha":7,"hacc":3,"hdon":3,"rots":0,"rings":1,"velec":42,"number":933},{"id":37576,"smiles":"N#Cc1c[nH]cn1","cmpd_id":3984,"prot_id":37487,"protein_code":"Mac1-DLS-X0962A:Z2301685688","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-X0962_0A_apo_KwWRoyE.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 7 7 0 0 0 0 0 0 0 0999 V2000\n 29.6170 48.7500 -6.0650 N 0 0 0 0 0 0 0 0 0 0 0 0\n 29.2590 49.7060 -6.5720 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.7720 50.8790 -7.2420 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.9050 52.1680 -6.7090 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.3950 53.0690 -7.5050 N 0 0 0 0 0 0 0 0 0 0 0 0\n 27.8540 52.2670 -8.6490 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.1740 50.8470 -8.3800 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 3 0\n 3 2 1 0\n 4 3 2 0\n 5 4 1 0\n 6 5 1 0\n 7 6 2 0\n 7 3 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":93.03,"logp":0.28,"tpsa":52.47,"ha":7,"hacc":2,"hdon":1,"rots":0,"rings":1,"velec":34,"number":962},{"id":37577,"smiles":"N#Cc1c[nH]cn1","cmpd_id":3984,"prot_id":37488,"protein_code":"Mac1-DLS-X0962B:Z2301685688","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-X0962_0B_apo_xXo9ryD.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 7 7 0 0 0 0 0 0 0 0999 V2000\n 27.5720 57.5210 -5.1510 N 0 0 0 0 0 0 0 0 0 0 0 0\n 27.5220 57.2260 -6.2520 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.4060 56.8270 -7.6230 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.4620 56.3900 -8.4300 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.0380 56.0570 -9.6190 N 0 0 0 0 0 0 0 0 0 0 0 0\n 26.5740 56.2910 -9.5770 C 0 0 0 0 0 0 0 0 0 0 0 0\n 26.2750 56.8080 -8.2340 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 3 0\n 3 2 1 0\n 4 3 2 0\n 5 4 1 0\n 6 5 1 0\n 7 6 2 0\n 7 3 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":93.03,"logp":0.28,"tpsa":52.47,"ha":7,"hacc":2,"hdon":1,"rots":0,"rings":1,"velec":34,"number":962},{"id":37578,"smiles":"N#Cc1c[nH]cn1","cmpd_id":3984,"prot_id":37489,"protein_code":"Mac1-DLS-X0962_1A:Z2301685688","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-X0962_1A_apo_TXVyD5X.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 7 7 0 0 0 0 0 0 0 0999 V2000\n 29.1890 50.0260 -6.0560 N 0 0 0 0 0 0 0 0 0 0 0 0\n 29.0280 51.0740 -6.4860 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.8620 52.4110 -6.9810 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.3930 53.5050 -6.2810 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.1360 54.6230 -6.8760 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.3730 54.2330 -8.0990 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.2430 52.7430 -8.0570 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 3 0\n 3 2 1 0\n 4 3 2 0\n 5 4 1 0\n 6 5 1 0\n 7 6 2 0\n 7 3 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":93.03,"logp":0.28,"tpsa":52.47,"ha":7,"hacc":2,"hdon":1,"rots":0,"rings":1,"velec":34,"number":962},{"id":37580,"smiles":"c1cnc2ncccc2c1","cmpd_id":3985,"prot_id":37491,"protein_code":"Mac1-DLS-X0967A:SF003","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-X0967_0A_apo_8f2Ftcf.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 10 11 0 0 0 0 0 0 0 0999 V2000\n 28.3470 53.5630 -8.2750 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.6120 54.7730 -7.7160 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.6470 52.3890 -7.5630 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.2200 52.5320 -6.2830 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.4730 53.7500 -5.7290 N 0 0 0 0 0 0 0 0 0 0 0 0\n 29.1660 54.8160 -6.4500 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.4250 51.0860 -8.0340 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.7770 50.0250 -7.2620 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.3410 50.2600 -6.0180 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.5640 51.4610 -5.5130 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 2 0\n 3 1 1 0\n 4 3 2 0\n 5 4 1 0\n 6 5 2 0\n 6 2 1 0\n 7 3 1 0\n 8 7 2 0\n 9 8 1 0\n 10 9 2 0\n 10 4 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":130.05,"logp":1.63,"tpsa":25.78,"ha":10,"hacc":2,"hdon":0,"rots":0,"rings":2,"velec":48,"number":967},{"id":37581,"smiles":"Nc1nnc2ccccn12","cmpd_id":3986,"prot_id":37492,"protein_code":"Mac1-DLS-X0969A:SF005","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-X0969_0A_apo_BnZU6yD.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 10 11 0 0 0 0 0 0 0 0999 V2000\n 27.8770 54.3430 -8.6060 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.4710 53.7950 -7.5300 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.5400 52.4290 -7.3370 N 0 0 0 0 0 0 0 0 0 0 0 0\n 29.1750 52.2900 -6.1070 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.4420 53.4850 -5.5870 N 0 0 0 0 0 0 0 0 0 0 0 0\n 29.0010 54.4430 -6.5080 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.1190 51.3410 -8.0780 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.3520 50.0980 -7.6160 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.0180 49.9140 -6.3800 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.4210 50.9890 -5.6320 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 1 0\n 4 3 1 0\n 5 4 2 0\n 6 5 1 0\n 6 2 2 0\n 7 3 1 0\n 8 7 2 0\n 9 8 1 0\n 10 9 2 0\n 10 4 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":134.06,"logp":0.31,"tpsa":56.21,"ha":10,"hacc":4,"hdon":1,"rots":0,"rings":2,"velec":50,"number":969},{"id":37584,"smiles":"Clc1ccc2nnnn2n1","cmpd_id":3989,"prot_id":37495,"protein_code":"Mac1-DLS-X1018A:SF054","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-X1018_0A_apo_MHnY3t3.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 10 11 0 0 0 0 0 0 0 0999 V2000\n 28.9400 55.4910 -6.6880 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 28.9680 53.7790 -6.9170 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.3760 53.1010 -5.8900 N 0 0 0 0 0 0 0 0 0 0 0 0\n 29.3890 51.7780 -6.1520 N 0 0 0 0 0 0 0 0 0 0 0 0\n 29.8020 50.8800 -5.2410 N 0 0 0 0 0 0 0 0 0 0 0 0\n 29.6720 49.7280 -5.8230 N 0 0 0 0 0 0 0 0 0 0 0 0\n 29.1860 49.8600 -7.0810 N 0 0 0 0 0 0 0 0 0 0 0 0\n 29.0230 51.1550 -7.2620 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.5600 51.9290 -8.3380 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.5450 53.2570 -8.1690 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 2 0\n 4 3 1 0\n 5 4 1 0\n 6 5 2 0\n 7 6 1 0\n 8 7 2 0\n 8 4 1 0\n 9 8 1 0\n 10 9 2 0\n 10 2 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":155,"logp":0.17,"tpsa":55.97,"ha":10,"hacc":5,"hdon":0,"rots":0,"rings":2,"velec":50,"number":1018}],"238506":[{"id":37588,"smiles":"Cc1ccnc(N)c1","cmpd_id":4017,"prot_id":37499,"protein_code":"Mac1-UCSF-C120A:ZINC000000149580","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-UCSF-C120_0A_apo_bFhhKNK.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 8 8 0 0 0 0 0 0 0 0999 V2000\n 29.7830 53.8220 -5.4680 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.5930 52.4810 -6.1750 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.0540 51.3160 -5.5780 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.8750 50.1140 -6.2530 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.2790 50.0750 -7.4270 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.8350 51.1710 -8.0120 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.1760 51.0750 -9.2970 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.9660 52.4140 -7.4110 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 2 0\n 4 3 1 0\n 5 4 2 0\n 6 5 1 0\n 7 6 1 0\n 8 6 2 0\n 8 2 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":108.07,"logp":0.97,"tpsa":38.91,"ha":8,"hacc":2,"hdon":1,"rots":0,"rings":1,"velec":42,"number":0},{"id":37591,"smiles":"Nc1nc2ccccc2c(=O)[nH]1","cmpd_id":4019,"prot_id":37502,"protein_code":"Mac1-UCSF-C194A:ZINC000013514509","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-UCSF-C194_0A_apo_V6SMggN.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 12 13 0 0 0 0 0 0 0 0999 V2000\n 27.8970 55.5780 -9.0200 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.3820 54.5050 -8.1700 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.3820 53.1220 -8.6570 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.8790 52.0250 -7.7770 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.8840 50.6950 -8.2530 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.3500 49.6660 -7.4300 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.8160 49.9530 -6.1410 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.8080 51.2660 -5.6750 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.3370 52.3070 -6.5070 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.3450 53.7490 -5.9920 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.7370 53.9810 -4.8920 O 0 0 0 0 0 0 0 0 0 0 0 0\n 28.8630 54.8070 -6.8380 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 2 0\n 4 3 1 0\n 5 4 2 0\n 6 5 1 0\n 7 6 2 0\n 8 7 1 0\n 9 8 2 0\n 9 4 1 0\n 10 9 1 0\n 11 10 2 0\n 12 10 1 0\n 12 2 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":161.06,"logp":0.51,"tpsa":71.77,"ha":12,"hacc":3,"hdon":2,"rots":0,"rings":2,"velec":60,"number":0},{"id":37592,"smiles":"Nc1nccc2ccccc12","cmpd_id":4020,"prot_id":37503,"protein_code":"Mac1-UCSF-C242A:ZINC000000154817","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-UCSF-C242_0A_apo_8droc7M.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 11 12 0 0 0 0 0 0 0 0999 V2000\n 28.3150 51.7220 -9.2010 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.6790 50.3170 -9.2160 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.5420 49.6030 -10.3140 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.8370 48.3220 -10.3950 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.3500 47.6840 -9.2680 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.5300 48.4170 -8.0500 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.0460 47.8140 -6.8680 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.2030 48.5770 -5.7150 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.8520 49.9290 -5.7110 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.3480 50.5210 -6.8560 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.1920 49.7410 -8.0300 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 2 0\n 4 3 1 0\n 5 4 2 0\n 6 5 1 0\n 7 6 1 0\n 8 7 2 0\n 9 8 1 0\n 10 9 2 0\n 11 6 2 0\n 11 10 1 0\n 11 2 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":144.07,"logp":1.82,"tpsa":38.91,"ha":11,"hacc":2,"hdon":1,"rots":0,"rings":2,"velec":54,"number":0},{"id":37599,"smiles":"CC(C)OCCn1c(=S)[nH]c(=O)c2[nH]ccc21","cmpd_id":6425,"prot_id":37510,"protein_code":"Mac1-UCSF-P0115A:ZINC000034618676","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-UCSF-P0115_0A_apo_siR1fdf.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 17 18 0 0 0 0 0 0 0 0999 V2000\n 27.5570 46.7000 -2.3170 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.4250 45.5030 -2.8120 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.6460 44.3030 -3.2960 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.3160 45.9050 -3.8350 O 0 0 0 0 0 0 0 0 0 0 0 0\n 29.8450 44.9780 -4.7240 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.6290 45.7960 -5.7020 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.8130 46.5530 -6.6900 N 0 0 0 0 0 0 0 0 0 0 0 0\n 29.4370 47.9720 -6.5360 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.8360 48.6970 -7.5220 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.5380 48.0100 -8.8290 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.0510 48.5590 -9.7000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 28.8320 46.6490 -8.9620 N 0 0 0 0 0 0 0 0 0 0 0 0\n 29.4700 45.9150 -7.9310 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.8010 44.3780 -8.2070 S 0 0 0 0 0 0 0 0 0 0 0 0\n 28.6830 49.9570 -7.0830 N 0 0 0 0 0 0 0 0 0 0 0 0\n 29.1260 50.0740 -5.8530 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.6120 48.8440 -5.4820 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 1 0\n 4 2 1 0\n 5 4 1 0\n 6 5 1 0\n 7 6 1 0\n 8 7 1 0\n 9 8 2 0\n 10 9 1 0\n 11 10 2 0\n 12 10 1 0\n 13 12 1 0\n 13 7 1 0\n 14 13 2 0\n 15 9 1 0\n 16 15 1 0\n 17 8 1 0\n 17 16 2 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":253.09,"logp":1.81,"tpsa":62.81,"ha":17,"hacc":4,"hdon":2,"rots":4,"rings":2,"velec":92,"number":0},{"id":37600,"smiles":"CC(C)OCCn1c(=S)[nH]c(=O)c2[nH]ccc21","cmpd_id":6425,"prot_id":37511,"protein_code":"Mac1-UCSF-P0115_1A:ZINC000034618676","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-UCSF-P0115_1A_apo_r5pUU9L.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 17 18 0 0 0 0 0 0 0 0999 V2000\n 32.7280 47.2050 -6.5160 C 0 0 0 0 0 0 0 0 0 0 0 0\n 32.7330 46.7760 -5.0390 C 0 0 0 0 0 0 0 0 0 0 0 0\n 33.2640 47.8560 -4.0810 C 0 0 0 0 0 0 0 0 0 0 0 0\n 31.4450 46.5140 -4.5800 O 0 0 0 0 0 0 0 0 0 0 0 0\n 31.0170 45.2640 -4.8450 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.8850 45.3600 -5.7840 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.5690 46.4750 -6.6770 N 0 0 0 0 0 0 0 0 0 0 0 0\n 29.2590 47.9090 -6.4690 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.8170 48.6880 -7.5060 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.6260 48.0390 -8.8600 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.2390 48.6090 -9.7620 O 0 0 0 0 0 0 0 0 0 0 0 0\n 28.8540 46.6720 -9.0030 N 0 0 0 0 0 0 0 0 0 0 0 0\n 29.3520 45.8980 -7.9500 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.7430 44.3590 -8.1990 S 0 0 0 0 0 0 0 0 0 0 0 0\n 28.6760 49.9520 -7.0670 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.9720 50.0290 -5.7800 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.3420 48.7630 -5.3800 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 1 0\n 4 2 1 0\n 5 4 1 0\n 6 5 1 0\n 7 6 1 0\n 8 7 1 0\n 9 8 2 0\n 10 9 1 0\n 11 10 2 0\n 12 10 1 0\n 13 12 1 0\n 13 7 1 0\n 14 13 2 0\n 15 9 1 0\n 16 15 1 0\n 17 8 1 0\n 17 16 2 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":253.09,"logp":1.81,"tpsa":62.81,"ha":17,"hacc":4,"hdon":2,"rots":4,"rings":2,"velec":92,"number":0},{"id":37601,"smiles":"c1coc(CNc2ncnc3[nH]cnc23)c1","cmpd_id":6426,"prot_id":37512,"protein_code":"Mac1-UCSF-P0116A:ZINC000000001601","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-UCSF-P0116_0A_apo_D6RAJIW.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 16 18 0 0 0 0 0 0 0 0999 V2000\n 31.5340 54.8290 -9.5850 C 0 0 0 0 0 0 0 0 0 0 0 0\n 32.0130 54.0910 -8.5380 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.9700 53.5930 -7.8720 O 0 0 0 0 0 0 0 0 0 0 0 0\n 29.8250 53.9600 -8.4760 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.4190 53.5720 -8.0180 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.0960 52.2300 -8.4670 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.5940 51.1000 -7.6990 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.9890 51.2380 -6.4690 N 0 0 0 0 0 0 0 0 0 0 0 0\n 29.4440 50.2340 -5.7710 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.5010 49.0080 -6.2430 N 0 0 0 0 0 0 0 0 0 0 0 0\n 29.0910 48.7970 -7.4870 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.0070 47.7060 -8.2310 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.5110 48.0700 -9.3940 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.2670 49.3450 -9.4390 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.6060 49.8310 -8.2400 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.1470 54.7490 -9.5490 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 2 0\n 3 2 1 0\n 4 3 1 0\n 5 4 1 0\n 6 5 1 0\n 7 6 1 0\n 8 7 2 0\n 9 8 1 0\n 10 9 2 0\n 11 10 1 0\n 12 11 1 0\n 13 12 1 0\n 14 13 2 0\n 15 11 2 0\n 15 14 1 0\n 15 7 1 0\n 16 4 2 0\n 16 1 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":215.08,"logp":1.56,"tpsa":79.63,"ha":16,"hacc":5,"hdon":2,"rots":3,"rings":3,"velec":80,"number":0},{"id":37602,"smiles":"Nc1c2c(nc3ncnn13)CCC2","cmpd_id":6427,"prot_id":37513,"protein_code":"Mac1-UCSF-P0123A:ZINC000007636250","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-UCSF-P0123_0A_apo_dZ7Qjkk.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 13 15 0 0 0 0 0 0 0 0999 V2000\n 28.1190 51.6020 -8.9150 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.7050 52.1670 -7.7120 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.7830 53.5080 -7.5630 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.3360 54.6400 -8.4980 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.0720 55.8180 -7.9820 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.2420 55.5170 -6.5340 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.3250 54.0360 -6.4260 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.8100 53.2830 -5.4500 N 0 0 0 0 0 0 0 0 0 0 0 0\n 29.7550 51.9240 -5.6350 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.1330 50.9020 -4.8380 N 0 0 0 0 0 0 0 0 0 0 0 0\n 29.8390 49.7530 -5.4930 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.2700 50.0410 -6.6530 N 0 0 0 0 0 0 0 0 0 0 0 0\n 29.1780 51.3970 -6.7230 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 2 0\n 4 3 1 0\n 5 4 1 0\n 6 5 1 0\n 7 3 1 0\n 7 6 1 0\n 8 7 2 0\n 9 8 1 0\n 10 9 2 0\n 11 10 1 0\n 12 11 2 0\n 13 12 1 0\n 13 9 1 0\n 13 2 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":175.09,"logp":0.2,"tpsa":69.1,"ha":13,"hacc":5,"hdon":1,"rots":0,"rings":3,"velec":66,"number":0},{"id":37603,"smiles":"Cn1ccc2c(N)ncnc21","cmpd_id":6428,"prot_id":37514,"protein_code":"Mac1-UCSF-P0124A:ZINC000001674697","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-UCSF-P0124_0A_apo_84Id18T.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 11 12 0 0 0 0 0 0 0 0999 V2000\n 29.7090 46.4160 -5.9660 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.4450 47.7850 -6.1510 N 0 0 0 0 0 0 0 0 0 0 0 0\n 29.6090 48.8440 -5.3620 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.1690 49.9830 -6.0540 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.7300 49.5120 -7.3180 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.1590 50.0490 -8.5100 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.9130 51.4930 -8.6330 N 0 0 0 0 0 0 0 0 0 0 0 0\n 27.8510 49.2420 -9.5390 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.0630 47.9370 -9.4300 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.5730 47.3670 -8.3690 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.9220 48.1540 -7.3090 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 1 0\n 4 3 2 0\n 5 4 1 0\n 6 5 2 0\n 7 6 1 0\n 8 6 1 0\n 9 8 2 0\n 10 9 1 0\n 11 10 2 0\n 11 2 1 0\n 11 5 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":148.07,"logp":0.55,"tpsa":56.73,"ha":11,"hacc":4,"hdon":1,"rots":0,"rings":2,"velec":56,"number":0},{"id":37604,"smiles":"Cn1ccc2c(N)ncnc21","cmpd_id":6428,"prot_id":37515,"protein_code":"Mac1-UCSF-P0124_1A:ZINC000001674697","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-UCSF-P0124_1A_apo_pTFaxJT.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 11 12 0 0 0 0 0 0 0 0999 V2000\n 28.8880 55.5730 -6.8920 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.7450 54.1920 -7.2730 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.2740 53.8390 -8.4480 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.2200 52.4370 -8.4660 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.6890 51.9760 -7.2100 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.9170 50.7020 -6.6000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.6870 49.4840 -7.3290 N 0 0 0 0 0 0 0 0 0 0 0 0\n 29.3850 50.6770 -5.3840 N 0 0 0 0 0 0 0 0 0 0 0 0\n 29.6300 51.8350 -4.7490 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.4440 53.0380 -5.2640 N 0 0 0 0 0 0 0 0 0 0 0 0\n 29.0290 53.1230 -6.5390 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 1 0\n 4 3 2 0\n 5 4 1 0\n 6 5 1 0\n 7 6 1 0\n 8 6 2 0\n 9 8 1 0\n 10 9 2 0\n 11 5 2 0\n 11 2 1 0\n 11 10 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":148.07,"logp":0.55,"tpsa":56.73,"ha":11,"hacc":4,"hdon":1,"rots":0,"rings":2,"velec":56,"number":0},{"id":37605,"smiles":"Cc1c(C)n(Cc2ccco2)c2ncnc(N)c12","cmpd_id":6254,"prot_id":37516,"protein_code":"Mac1-UCSF-P0131A:ZINC000003888754","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-UCSF-P0131_0A_apo_OpEOU86.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 18 20 0 0 0 0 0 0 0 0999 V2000\n 30.3720 49.3130 -3.7480 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.7710 49.2300 -5.1330 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.2620 50.2750 -5.8790 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.1580 51.7100 -5.4050 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.8260 49.7010 -7.1030 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.2090 50.0940 -8.3250 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.8440 51.4620 -8.5130 N 0 0 0 0 0 0 0 0 0 0 0 0\n 27.9730 49.1900 -9.2570 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.2880 47.9270 -9.0520 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.8890 47.5220 -7.9800 N 0 0 0 0 0 0 0 0 0 0 0 0\n 29.1490 48.3850 -7.0110 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.6920 48.1230 -5.8390 N 0 0 0 0 0 0 0 0 0 0 0 0\n 30.1270 46.7970 -5.4840 C 0 0 0 0 0 0 0 0 0 0 0 0\n 31.5420 46.5940 -5.9920 C 0 0 0 0 0 0 0 0 0 0 0 0\n 32.1290 45.5240 -6.6490 C 0 0 0 0 0 0 0 0 0 0 0 0\n 33.4540 45.8930 -6.8490 C 0 0 0 0 0 0 0 0 0 0 0 0\n 33.6330 47.1620 -6.3040 C 0 0 0 0 0 0 0 0 0 0 0 0\n 32.4390 47.5340 -5.7840 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 2 0\n 4 3 1 0\n 5 3 1 0\n 6 5 2 0\n 7 6 1 0\n 8 6 1 0\n 9 8 2 0\n 10 9 1 0\n 11 10 2 0\n 11 5 1 0\n 12 11 1 0\n 12 2 1 0\n 13 12 1 0\n 14 13 1 0\n 15 14 2 0\n 16 15 1 0\n 17 16 2 0\n 18 14 1 0\n 18 17 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":242.12,"logp":2.27,"tpsa":69.87,"ha":18,"hacc":5,"hdon":1,"rots":2,"rings":3,"velec":92,"number":0},{"id":37606,"smiles":"Nc1ncnc2ccccc12","cmpd_id":6429,"prot_id":37517,"protein_code":"Mac1-UCSF-P0132A:ZINC000000331945","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-UCSF-P0132_0A_apo_afV0cJc.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 11 12 0 0 0 0 0 0 0 0999 V2000\n 27.9850 52.1930 -8.9550 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.4610 52.9020 -7.8140 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.5640 54.2120 -7.7470 N 0 0 0 0 0 0 0 0 0 0 0 0\n 29.0720 54.6820 -6.6240 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.4820 53.9410 -5.6250 N 0 0 0 0 0 0 0 0 0 0 0 0\n 29.3620 52.6060 -5.6740 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.7860 51.7430 -4.6040 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.7590 50.3800 -4.6920 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.2650 49.8150 -5.8680 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.8340 50.5940 -6.8840 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.8640 52.0300 -6.7830 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 2 0\n 4 3 1 0\n 5 4 2 0\n 6 5 1 0\n 7 6 2 0\n 8 7 1 0\n 9 8 2 0\n 10 9 1 0\n 11 10 2 0\n 11 6 1 0\n 11 2 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":145.06,"logp":1.21,"tpsa":51.8,"ha":11,"hacc":3,"hdon":1,"rots":0,"rings":2,"velec":54,"number":0},{"id":37607,"smiles":"F[C@@H]1CCCN(c2ncnc3[nH]ccc23)C1","cmpd_id":6430,"prot_id":37518,"protein_code":"Mac1-UCSF-P0137A:ZINC000336438345","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-UCSF-P0137_0A_apo_VDZcRjs.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 16 18 0 0 0 0 0 0 0 0999 V2000\n 31.9250 47.5940 -4.9430 C 0 0 2 0 0 0 0 0 0 0 0 0\n 32.9170 46.8090 -5.6430 C 0 0 0 0 0 0 0 0 0 0 0 0\n 32.5380 46.3730 -6.9480 C 0 0 0 0 0 0 0 0 0 0 0 0\n 31.0610 46.1410 -6.9600 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.2300 47.3570 -6.6080 N 0 0 0 0 0 0 0 0 0 0 0 0\n 30.4200 47.5010 -5.1810 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.3860 48.0630 -7.4960 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.0380 47.4070 -8.5820 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.3890 47.9600 -9.5110 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.9260 49.1240 -9.4330 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.2170 49.8550 -8.3880 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.8630 51.0750 -8.0790 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.2800 51.3750 -6.8530 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.9680 50.3490 -6.3800 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.9050 49.3580 -7.3450 C 0 0 0 0 0 0 0 0 0 0 0 0\n 32.0330 48.8260 -5.2820 F 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 1 0\n 4 3 1 0\n 5 4 1 0\n 6 5 1 0\n 6 1 1 0\n 7 5 1 0\n 8 7 2 0\n 9 8 1 0\n 10 9 2 0\n 11 10 1 0\n 12 11 1 0\n 13 12 1 0\n 14 13 2 0\n 15 7 1 0\n 15 14 1 0\n 15 11 2 0\n 1 16 1 6\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":220.11,"logp":1.9,"tpsa":44.81,"ha":16,"hacc":3,"hdon":1,"rots":1,"rings":3,"velec":84,"number":0},{"id":37608,"smiles":"Cn1cnc2c(N)nc(N)nc21","cmpd_id":6431,"prot_id":37519,"protein_code":"Mac1-UCSF-P0138A:ZINC000026180281","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-UCSF-P0138_0A_apo_a9Qnhpx.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 12 13 0 0 0 0 0 0 0 0999 V2000\n 29.8850 47.2810 -5.3960 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.4910 48.5970 -5.8760 N 0 0 0 0 0 0 0 0 0 0 0 0\n 29.5320 49.7170 -5.1830 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.1050 50.6790 -5.9100 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.8130 50.1610 -7.1300 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.3460 50.6800 -8.3490 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.0180 52.0820 -8.5670 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.2120 49.8640 -9.3560 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.4790 48.5840 -9.2480 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.2560 47.7740 -10.3980 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.9150 48.0390 -8.1710 N 0 0 0 0 0 0 0 0 0 0 0 0\n 29.0780 48.8500 -7.0920 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 1 0\n 4 3 2 0\n 5 4 1 0\n 6 5 2 0\n 7 6 1 0\n 8 6 1 0\n 9 8 2 0\n 10 9 1 0\n 11 9 1 0\n 12 11 2 0\n 12 2 1 0\n 12 5 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":164.08,"logp":-0.47,"tpsa":95.64,"ha":12,"hacc":6,"hdon":2,"rots":0,"rings":2,"velec":62,"number":0},{"id":37609,"smiles":"CN(CCC([O-])O)C1NCNC2NCCC21","cmpd_id":6432,"prot_id":37520,"protein_code":"Mac1-UCSF-P0139A:ZINC000263392672","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-UCSF-P0139_0A_apo_TP4oNht.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 16 17 0 0 0 0 0 0 0 0999 V2000\n 29.8080 48.3160 -5.0720 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.4320 47.5360 -6.2380 N 0 0 0 0 0 0 0 0 0 0 0 0\n 29.6530 46.1560 -6.3000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 31.2090 45.8580 -6.2490 C 0 0 0 0 0 0 0 0 0 0 0 0\n 31.9120 45.8100 -7.6170 C 0 0 0 0 0 0 0 0 0 0 0 0\n 31.1920 45.6010 -8.5260 O 0 0 0 0 0 0 0 0 0 0 0 0\n 33.1140 45.9100 -7.8640 O 0 0 0 0 0 0 0 0 0 0 0 0\n 28.8700 48.1360 -7.3500 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.5260 47.3670 -8.3320 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.0090 47.8390 -9.4180 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.7960 49.0810 -9.5620 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.1030 49.9410 -8.5950 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.9730 51.2230 -8.5160 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.4200 51.6100 -7.3190 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.8760 50.5800 -6.5780 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.6680 49.4890 -7.4250 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 1 0\n 4 3 1 0\n 5 4 1 0\n 6 5 1 0\n 7 5 1 0\n 8 2 1 0\n 9 8 1 0\n 10 9 1 0\n 11 10 1 0\n 12 11 1 0\n 13 12 1 0\n 14 13 1 0\n 15 14 1 0\n 16 8 1 0\n 16 15 1 0\n 16 12 1 0\nM CHG 1 7 -1\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":230.17,"logp":-1.97,"tpsa":79.79,"ha":16,"hacc":6,"hdon":5,"rots":4,"rings":2,"velec":94,"number":0},{"id":37610,"smiles":"CN(CCC([O-])O)C1NCNC2NCCC21","cmpd_id":6432,"prot_id":37521,"protein_code":"Mac1-UCSF-P0139_1A:ZINC000263392672","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-UCSF-P0139_1A_apo_ztmd8oW.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 16 17 0 0 0 0 0 0 0 0999 V2000\n 29.8220 48.3240 -5.0730 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.3800 47.5560 -6.2220 N 0 0 0 0 0 0 0 0 0 0 0 0\n 29.3970 46.1750 -6.2420 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.7900 45.9170 -6.7690 C 0 0 0 0 0 0 0 0 0 0 0 0\n 31.5270 45.0380 -5.8170 C 0 0 0 0 0 0 0 0 0 0 0 0\n 31.2410 43.8800 -5.6820 O 0 0 0 0 0 0 0 0 0 0 0 0\n 32.3780 45.6080 -5.1980 O 0 0 0 0 0 0 0 0 0 0 0 0\n 28.8600 48.1450 -7.3580 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.5150 47.3750 -8.3540 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.0060 47.8520 -9.4340 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.8000 49.0940 -9.5700 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.1050 49.9500 -8.5980 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.9780 51.2300 -8.5180 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.4180 51.6160 -7.3180 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.8650 50.5820 -6.5750 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.6590 49.4960 -7.4260 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 1 0\n 4 3 1 0\n 5 4 1 0\n 6 5 1 0\n 7 5 1 0\n 8 2 1 0\n 9 8 1 0\n 10 9 1 0\n 11 10 1 0\n 12 11 1 0\n 13 12 1 0\n 14 13 1 0\n 15 14 1 0\n 16 8 1 0\n 16 15 1 0\n 16 12 1 0\nM CHG 1 7 -1\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":230.17,"logp":-1.97,"tpsa":79.79,"ha":16,"hacc":6,"hdon":5,"rots":4,"rings":2,"velec":94,"number":0},{"id":37611,"smiles":"c1nc(N2CCCC3(CC3)C2)c2cc[nH]c2n1","cmpd_id":6433,"prot_id":37522,"protein_code":"Mac1-UCSF-P0142A:ZINC000274438208","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-UCSF-P0142_0A_apo_zNRh7zV.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 17 20 0 0 0 0 0 0 0 0999 V2000\n 31.6720 43.8250 -6.3200 C 0 0 0 0 0 0 0 0 0 0 0 0\n 31.8470 44.8570 -7.4150 C 0 0 0 0 0 0 0 0 0 0 0 0\n 31.3630 45.3080 -6.0080 C 0 0 0 0 0 0 0 0 0 0 0 0\n 32.2840 45.9810 -5.0720 C 0 0 0 0 0 0 0 0 0 0 0 0\n 32.1770 47.4280 -4.8840 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.8040 48.0780 -5.2070 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.7970 47.2640 -6.0500 N 0 0 0 0 0 0 0 0 0 0 0 0\n 29.9160 45.7790 -5.8390 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.1390 47.8050 -7.2380 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.7930 47.1060 -8.3170 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.2200 47.6870 -9.3650 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.9380 48.9750 -9.3730 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.2350 49.7420 -8.3010 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.0690 51.0600 -7.9850 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.5360 51.3390 -6.7710 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.0400 50.1790 -6.2530 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.8410 49.1880 -7.2250 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 1 0\n 3 1 1 0\n 4 3 1 0\n 5 4 1 0\n 6 5 1 0\n 7 6 1 0\n 8 7 1 0\n 8 3 1 0\n 9 7 1 0\n 10 9 2 0\n 11 10 1 0\n 12 11 2 0\n 13 12 1 0\n 14 13 1 0\n 15 14 1 0\n 16 15 2 0\n 17 9 1 0\n 17 16 1 0\n 17 13 2 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":228.14,"logp":2.34,"tpsa":44.81,"ha":17,"hacc":3,"hdon":1,"rots":1,"rings":4,"velec":88,"number":0},{"id":37612,"smiles":"c1nc(N2CCC[C@H]3COC[C@H]32)c2cc[nH]c2n1","cmpd_id":6434,"prot_id":37523,"protein_code":"Mac1-UCSF-P0148A:ZINC000374420934","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-UCSF-P0148_0A_apo_3293FMR.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 18 21 0 0 0 0 0 0 0 0999 V2000\n 32.3530 47.9290 -3.8590 C 0 0 0 0 0 0 0 0 0 0 0 0\n 31.0990 48.3990 -3.1990 O 0 0 0 0 0 0 0 0 0 0 0 0\n 30.2340 48.5530 -4.5540 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.3080 47.4150 -4.9960 C 0 0 2 0 0 0 0 0 0 0 0 0\n 31.8440 46.8780 -4.5000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 32.7210 46.2700 -5.5580 C 0 0 0 0 0 0 0 0 0 0 0 0\n 32.6230 47.2160 -6.5800 C 0 0 0 0 0 0 0 0 0 0 0 0\n 31.1920 46.6890 -7.2680 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.9550 47.2530 -6.5040 N 0 0 0 0 0 0 0 0 0 0 0 0\n 29.2180 47.9780 -7.4880 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.8750 47.2760 -8.5530 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.3050 47.8330 -9.5630 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.9600 49.0570 -9.5620 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.2770 49.8300 -8.5400 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.0880 51.1240 -8.3670 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.5210 51.4950 -7.1880 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.0570 50.4470 -6.5740 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.9540 49.3520 -7.4590 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 1 0\n 4 3 1 6\n 5 4 1 0\n 5 1 1 6\n 6 5 1 0\n 7 6 1 0\n 8 7 1 0\n 9 8 1 0\n 9 4 1 0\n 10 9 1 0\n 11 10 2 0\n 12 11 1 0\n 13 12 2 0\n 14 13 1 0\n 15 14 1 0\n 16 15 1 0\n 17 16 2 0\n 18 10 1 0\n 18 17 1 0\n 18 14 2 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":244.13,"logp":1.57,"tpsa":54.04,"ha":18,"hacc":4,"hdon":1,"rots":1,"rings":4,"velec":94,"number":0},{"id":37613,"smiles":"Cc1nc(Cn2cnc(N)c3ncnc2-3)cs1","cmpd_id":6435,"prot_id":37524,"protein_code":"Mac1-UCSF-P0159A:ZINC000089254160_N3","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-UCSF-P0159_0A_apo_Fzhcs1X.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 17 19 0 0 0 0 0 0 0 0999 V2000\n 27.8970 51.5940 -7.8190 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.5030 50.4080 -7.3000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.4770 49.2370 -8.0740 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.9640 48.9220 -9.2720 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.3190 47.6970 -9.4730 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.9040 47.1350 -8.4430 N 0 0 0 0 0 0 0 0 0 0 0 0\n 29.0490 48.1210 -7.5650 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.5620 48.1460 -6.3670 N 0 0 0 0 0 0 0 0 0 0 0 0\n 30.2190 47.0220 -5.7660 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.3470 46.1860 -4.8690 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.8210 44.9660 -5.1530 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.9100 44.4140 -3.8480 S 0 0 0 0 0 0 0 0 0 0 0 0\n 28.2830 45.7110 -2.9470 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.8500 45.8800 -1.5170 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.0430 46.5860 -3.5750 N 0 0 0 0 0 0 0 0 0 0 0 0\n 29.5340 49.2960 -5.6570 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.0470 50.3700 -6.1540 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 2 0\n 4 3 1 0\n 5 4 2 0\n 6 5 1 0\n 7 6 2 0\n 7 3 1 0\n 8 7 1 0\n 9 8 1 0\n 10 9 1 0\n 11 10 2 0\n 12 11 1 0\n 13 12 1 0\n 14 13 1 0\n 15 13 2 0\n 15 10 1 0\n 16 8 1 0\n 17 16 2 0\n 17 2 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":246.07,"logp":1.17,"tpsa":82.51,"ha":17,"hacc":7,"hdon":1,"rots":2,"rings":3,"velec":86,"number":0},{"id":37614,"smiles":"COc1cc(Cn2cnc(N)c3ncnc2-3)on1","cmpd_id":6436,"prot_id":37525,"protein_code":"Mac1-UCSF-P0161A:ZINC000901381520_N3","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-UCSF-P0161_0A_apo_R67Jpo1.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 18 20 0 0 0 0 0 0 0 0999 V2000\n 27.8410 51.8050 -7.9550 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.3900 50.5870 -7.4300 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.3470 49.4240 -8.1920 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.8980 49.1170 -9.4470 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.2540 47.8740 -9.5980 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.7900 47.3500 -8.4930 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.8140 48.3150 -7.6260 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.2540 48.3130 -6.3840 N 0 0 0 0 0 0 0 0 0 0 0 0\n 29.7640 47.1490 -5.7040 C 0 0 0 0 0 0 0 0 0 0 0 0\n 31.1980 46.8940 -6.1090 C 0 0 0 0 0 0 0 0 0 0 0 0\n 32.3320 47.1000 -5.4310 C 0 0 0 0 0 0 0 0 0 0 0 0\n 33.3960 46.7880 -6.2610 C 0 0 0 0 0 0 0 0 0 0 0 0\n 34.7750 46.7900 -6.0340 O 0 0 0 0 0 0 0 0 0 0 0 0\n 35.1830 47.3900 -4.8730 C 0 0 0 0 0 0 0 0 0 0 0 0\n 32.8500 46.4270 -7.3960 N 0 0 0 0 0 0 0 0 0 0 0 0\n 31.5940 46.6380 -7.2670 O 0 0 0 0 0 0 0 0 0 0 0 0\n 29.2570 49.4470 -5.7250 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.7700 50.5820 -6.2060 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 2 0\n 4 3 1 0\n 5 4 2 0\n 6 5 1 0\n 7 6 2 0\n 7 3 1 0\n 8 7 1 0\n 9 8 1 0\n 10 9 1 0\n 11 10 2 0\n 12 11 1 0\n 13 12 1 0\n 14 13 1 0\n 15 12 2 0\n 16 10 1 0\n 16 15 1 0\n 17 8 1 0\n 18 17 2 0\n 18 2 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":246.09,"logp":0.4,"tpsa":104.88,"ha":18,"hacc":8,"hdon":1,"rots":3,"rings":3,"velec":92,"number":0},{"id":37615,"smiles":"Nc1ncnc(N2C[C@H]3CC[C@@H]2CC3)c1Cl","cmpd_id":6437,"prot_id":37526,"protein_code":"Mac1-UCSF-P0163A:ZINC000365052868","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-UCSF-P0163_0A_apo_tLRcMmy.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 16 18 0 0 0 0 0 0 0 0999 V2000\n 29.1680 50.4420 -5.8810 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 27.7760 51.3190 -8.3360 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.2370 50.0100 -8.4050 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.9520 49.2860 -9.4530 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.3970 48.0830 -9.5180 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.0230 47.5410 -8.5780 N 0 0 0 0 0 0 0 0 0 0 0 0\n 29.3590 48.2020 -7.4740 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.1260 47.5060 -6.4780 N 0 0 0 0 0 0 0 0 0 0 0 0\n 30.7650 46.3090 -6.9550 C 0 0 0 0 0 0 0 0 0 0 0 0\n 32.0430 45.9850 -6.2230 C 0 0 1 0 0 0 0 0 0 0 0 0\n 32.8760 47.2140 -6.4080 C 0 0 0 0 0 0 0 0 0 0 0 0\n 32.2900 48.2030 -5.4230 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.7780 48.1150 -5.3230 C 0 0 2 0 0 0 0 0 0 0 0 0\n 30.3580 46.9090 -4.4600 C 0 0 0 0 0 0 0 0 0 0 0 0\n 31.3780 45.8120 -4.8120 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.9230 49.4860 -7.3580 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3 2 1 0\n 4 3 2 0\n 5 4 1 0\n 6 5 2 0\n 7 6 1 0\n 8 7 1 0\n 9 8 1 0\n 10 9 1 6\n 11 10 1 0\n 12 11 1 0\n 13 8 1 0\n 13 12 1 6\n 14 13 1 0\n 15 10 1 0\n 15 14 1 0\n 16 7 2 0\n 16 3 1 0\n 16 1 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":238.1,"logp":2.09,"tpsa":55.04,"ha":16,"hacc":4,"hdon":1,"rots":1,"rings":4,"velec":86,"number":0},{"id":37618,"smiles":"CC(=O)Nc1ccc(C(=O)O)cc1","cmpd_id":6440,"prot_id":37529,"protein_code":"Mac1-UCSF-P0180A:ZINC000000000226","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-UCSF-P0180_0A_apo_lGZ4trn.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 13 13 0 0 0 0 0 0 0 0999 V2000\n 28.9440 55.3500 -6.8510 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.0810 53.9250 -6.4340 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.4470 53.7220 -5.3820 O 0 0 0 0 0 0 0 0 0 0 0 0\n 28.7100 52.8400 -7.2940 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.8680 51.4280 -6.9130 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.3860 51.0640 -5.7070 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.5970 49.7510 -5.3530 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.2490 48.7480 -6.2490 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.7250 49.0950 -7.4700 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.5380 50.4240 -7.8080 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.4890 47.2980 -5.9090 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.0210 46.9930 -4.8240 O 0 0 0 0 0 0 0 0 0 0 0 0\n 29.1970 46.4430 -6.7630 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 2 0\n 4 2 1 0\n 5 4 1 0\n 6 5 2 0\n 7 6 1 0\n 8 7 2 0\n 9 8 1 0\n 10 9 2 0\n 10 5 1 0\n 11 8 1 0\n 12 11 2 0\n 13 11 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":179.06,"logp":1.34,"tpsa":66.4,"ha":13,"hacc":2,"hdon":2,"rots":2,"rings":1,"velec":68,"number":0},{"id":37621,"smiles":"OCc1nc2ccccc2[nH]1","cmpd_id":6443,"prot_id":37532,"protein_code":"Mac1-UCSF-P0190A:ZINC000000158650","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-UCSF-P0190_0A_apo_aJOYedl.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 11 12 0 0 0 0 0 0 0 0999 V2000\n 28.1990 56.7820 -7.3910 O 0 0 0 0 0 0 0 0 0 0 0 0\n 29.3860 56.2940 -6.8580 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.1310 54.7770 -6.8310 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.4050 54.1100 -5.8050 N 0 0 0 0 0 0 0 0 0 0 0 0\n 29.1190 52.8590 -6.0510 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.2370 51.7190 -5.2570 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.8830 50.5020 -5.7510 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.3930 50.3790 -7.0990 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.3180 51.4510 -7.8430 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.6940 52.7670 -7.3310 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.6770 53.9500 -7.7940 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 1 0\n 4 3 2 0\n 5 4 1 0\n 6 5 2 0\n 7 6 1 0\n 8 7 2 0\n 9 8 1 0\n 10 9 2 0\n 10 5 1 0\n 11 10 1 0\n 11 3 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":148.06,"logp":1.06,"tpsa":48.91,"ha":11,"hacc":2,"hdon":2,"rots":1,"rings":2,"velec":56,"number":0},{"id":37624,"smiles":"NC(=O)c1ccccc1O","cmpd_id":6446,"prot_id":37535,"protein_code":"Mac1-UCSF-P0206A:ZINC000000002055","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-UCSF-P0206_0A_apo_fviLXma.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 10 10 0 0 0 0 0 0 0 0999 V2000\n 28.7590 49.9990 -7.0680 N 0 0 0 0 0 0 0 0 0 0 0 0\n 29.0690 51.0890 -6.2100 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.5440 50.8960 -5.1580 O 0 0 0 0 0 0 0 0 0 0 0 0\n 28.8140 52.5130 -6.7130 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.1850 52.8430 -7.8910 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.0410 54.1900 -8.2120 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.5260 55.1960 -7.4400 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.1580 54.8540 -6.2870 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.2820 53.5350 -5.9590 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.9040 53.1830 -4.8140 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 2 0\n 4 2 1 0\n 5 4 2 0\n 6 5 1 0\n 7 6 2 0\n 8 7 1 0\n 9 4 1 0\n 9 8 2 0\n 10 9 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":137.05,"logp":0.49,"tpsa":63.32,"ha":10,"hacc":2,"hdon":2,"rots":1,"rings":1,"velec":52,"number":0},{"id":37625,"smiles":"CS(=O)(=O)Nc1ccc(C(=O)O)cc1","cmpd_id":6447,"prot_id":37536,"protein_code":"Mac1-UCSF-P0212A:ZINC000000340465","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-UCSF-P0212_0A_apo_2zBBWbY.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 14 14 0 0 0 0 0 0 0 0999 V2000\n 30.3990 54.1670 -8.2370 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.9480 54.2820 -7.1380 S 0 0 0 0 0 0 0 0 0 0 0 0\n 28.1600 55.4020 -7.5850 O 0 0 0 0 0 0 0 0 0 0 0 0\n 29.3600 54.3520 -5.7990 O 0 0 0 0 0 0 0 0 0 0 0 0\n 28.0020 52.9100 -7.3060 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.5960 51.6460 -6.9040 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.8770 51.4450 -5.5680 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.4840 50.2680 -5.1990 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.7240 49.3000 -6.1370 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.4210 49.5030 -7.4400 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.8810 50.6730 -7.8420 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.4270 48.0030 -5.7300 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.7280 47.1360 -6.5450 O 0 0 0 0 0 0 0 0 0 0 0 0\n 30.8050 47.8630 -4.5560 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 2 0\n 4 2 2 0\n 5 2 1 0\n 6 5 1 0\n 7 6 2 0\n 8 7 1 0\n 9 8 2 0\n 10 9 1 0\n 11 10 2 0\n 11 6 1 0\n 12 9 1 0\n 13 12 2 0\n 14 12 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":215.03,"logp":0.76,"tpsa":83.47,"ha":14,"hacc":3,"hdon":2,"rots":3,"rings":1,"velec":76,"number":0},{"id":37628,"smiles":"CSc1ccc(O)c(C(=O)O)c1","cmpd_id":6449,"prot_id":37539,"protein_code":"Mac1-UCSF-P0224A:ZINC000004787230","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-UCSF-P0224_0A_apo_RTjcrKV.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 12 12 0 0 0 0 0 0 0 0999 V2000\n 28.1730 52.6450 -7.9620 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.1300 50.9030 -8.4420 S 0 0 0 0 0 0 0 0 0 0 0 0\n 28.8850 49.9880 -7.1070 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.1960 50.4900 -5.9110 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.8320 49.6500 -4.9850 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.1230 48.3400 -5.3930 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.7510 47.4240 -4.5780 O 0 0 0 0 0 0 0 0 0 0 0 0\n 29.7720 47.9090 -6.6240 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.2240 48.7310 -7.4660 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.1070 46.4970 -7.0470 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.8600 46.0690 -8.1640 O 0 0 0 0 0 0 0 0 0 0 0 0\n 30.5530 45.7650 -6.2420 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 1 0\n 4 3 2 0\n 5 4 1 0\n 6 5 2 0\n 7 6 1 0\n 8 6 1 0\n 9 8 2 0\n 9 3 1 0\n 10 8 1 0\n 11 10 2 0\n 12 10 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":184.02,"logp":1.81,"tpsa":57.53,"ha":12,"hacc":3,"hdon":2,"rots":2,"rings":1,"velec":64,"number":0},{"id":37631,"smiles":"O=C(O)c1ccc2c(c1)CCO2","cmpd_id":647,"prot_id":37542,"protein_code":"Mac1-UCSF-P0228A:ZINC000000039810","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-UCSF-P0228_0A_apo_CWDrEpn.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 12 13 0 0 0 0 0 0 0 0999 V2000\n 29.6470 47.7960 -6.8720 O 0 0 0 0 0 0 0 0 0 0 0 0\n 29.9540 48.3880 -5.8330 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.4880 47.7570 -4.8680 O 0 0 0 0 0 0 0 0 0 0 0 0\n 29.6980 49.8890 -5.7610 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.8170 50.4900 -4.5180 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.6100 51.8300 -4.3630 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.2990 52.6170 -5.4580 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.0910 54.0560 -5.4990 O 0 0 0 0 0 0 0 0 0 0 0 0\n 29.1790 54.3830 -6.8950 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.7980 53.1530 -7.6460 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.1410 52.0460 -6.7180 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.3280 50.6350 -6.8830 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 2 0\n 4 2 1 0\n 5 4 2 0\n 6 5 1 0\n 7 6 2 0\n 8 7 1 0\n 9 8 1 0\n 10 9 1 0\n 11 10 1 0\n 11 7 1 0\n 12 11 2 0\n 12 4 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":164.05,"logp":1.32,"tpsa":46.53,"ha":12,"hacc":2,"hdon":1,"rots":1,"rings":2,"velec":62,"number":0},{"id":37634,"smiles":"O=C(O)CCc1nc2ccccc2[nH]1","cmpd_id":6453,"prot_id":37545,"protein_code":"Mac1-UCSF-P0263A:ZINC000000051581","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-UCSF-P0263_0A_apo_lulOoTt.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 14 15 0 0 0 0 0 0 0 0999 V2000\n 28.7580 59.1400 -6.9620 O 0 0 0 0 0 0 0 0 0 0 0 0\n 27.7810 58.3730 -6.8500 C 0 0 0 0 0 0 0 0 0 0 0 0\n 26.6210 58.8180 -6.8910 O 0 0 0 0 0 0 0 0 0 0 0 0\n 27.9790 56.9100 -6.6040 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.2260 56.2770 -7.2020 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.1090 54.8140 -6.9060 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.3080 54.2240 -5.7490 N 0 0 0 0 0 0 0 0 0 0 0 0\n 29.0140 52.9110 -5.8970 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.0450 51.8100 -5.0140 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.7150 50.5530 -5.5060 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.3420 50.3780 -6.8300 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.2980 51.4630 -7.6860 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.6410 52.7400 -7.2080 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.7160 53.9330 -7.8050 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 2 0\n 4 2 1 0\n 5 4 1 0\n 6 5 1 0\n 7 6 2 0\n 8 7 1 0\n 9 8 2 0\n 10 9 1 0\n 11 10 2 0\n 12 11 1 0\n 13 12 2 0\n 13 8 1 0\n 14 13 1 0\n 14 6 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":190.07,"logp":1.58,"tpsa":65.98,"ha":14,"hacc":2,"hdon":2,"rots":3,"rings":2,"velec":72,"number":0},{"id":37635,"smiles":"O=c1ccc2ccc(O)cc2o1","cmpd_id":6454,"prot_id":37546,"protein_code":"Mac1-UCSF-P0271A:ZINC000000058111","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-UCSF-P0271_0A_apo_vfGinPM.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 12 13 0 0 0 0 0 0 0 0999 V2000\n 29.9720 49.7620 -4.7260 O 0 0 0 0 0 0 0 0 0 0 0 0\n 29.4690 50.7900 -5.5310 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.8910 50.5260 -6.7830 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.4190 51.5950 -7.5620 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.5240 52.9110 -7.0760 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.0220 54.0780 -7.9000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.3360 55.4340 -7.4950 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.8110 55.6540 -6.1020 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.8380 56.7720 -5.6990 O 0 0 0 0 0 0 0 0 0 0 0 0\n 29.2130 54.5230 -5.3010 O 0 0 0 0 0 0 0 0 0 0 0 0\n 29.1040 53.1550 -5.8070 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.5640 52.0890 -5.0550 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 2 0\n 4 3 1 0\n 5 4 2 0\n 6 5 1 0\n 7 6 2 0\n 8 7 1 0\n 9 8 2 0\n 10 8 1 0\n 11 5 1 0\n 11 10 1 0\n 12 11 2 0\n 12 2 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":162.03,"logp":1.5,"tpsa":50.44,"ha":12,"hacc":3,"hdon":1,"rots":0,"rings":2,"velec":60,"number":0},{"id":37637,"smiles":"c1cnc2[nH]ccc2c1","cmpd_id":6456,"prot_id":37548,"protein_code":"Mac1-UCSF-P0282A:ZINC000015442276","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-UCSF-P0282_0A_apo_j0aBjDy.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 9 10 0 0 0 0 0 0 0 0999 V2000\n 28.4440 51.5680 -7.1080 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.8940 50.4460 -6.4500 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.8160 49.3850 -7.3600 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.1380 48.0310 -7.2920 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.8990 47.2630 -8.4320 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.3810 47.8650 -9.5630 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.0630 49.1400 -9.6040 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.2870 49.9040 -8.5170 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.0860 51.2330 -8.3550 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 2 0\n 3 2 1 0\n 4 3 2 0\n 5 4 1 0\n 6 5 2 0\n 7 6 1 0\n 8 7 2 0\n 8 3 1 0\n 9 8 1 0\n 9 1 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":118.05,"logp":1.56,"tpsa":28.68,"ha":9,"hacc":1,"hdon":1,"rots":0,"rings":2,"velec":44,"number":0},{"id":37638,"smiles":"Nc1noc2ccccc12","cmpd_id":471,"prot_id":37549,"protein_code":"Mac1-UCSF-P0283A:ZINC000000161908","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-UCSF-P0283_0A_apo_PwbjyC5.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 10 11 0 0 0 0 0 0 0 0999 V2000\n 28.0150 54.5900 -8.4640 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.5450 54.0220 -7.2570 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.0290 54.6230 -6.1680 N 0 0 0 0 0 0 0 0 0 0 0 0\n 29.4000 53.7180 -5.2750 O 0 0 0 0 0 0 0 0 0 0 0 0\n 29.2040 52.4990 -5.7580 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.4610 51.2270 -5.2170 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.1580 50.1230 -5.9770 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.6030 50.2470 -7.2590 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.3500 51.5030 -7.7960 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.6630 52.6220 -7.0180 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 2 0\n 4 3 1 0\n 5 4 1 0\n 6 5 2 0\n 7 6 1 0\n 8 7 2 0\n 9 8 1 0\n 10 9 2 0\n 10 5 1 0\n 10 2 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":134.05,"logp":1.41,"tpsa":52.05,"ha":10,"hacc":3,"hdon":1,"rots":0,"rings":2,"velec":50,"number":0},{"id":37639,"smiles":"Cc1ccc(O)c(C(=O)O)c1","cmpd_id":6457,"prot_id":37550,"protein_code":"Mac1-UCSF-P0284A:ZINC000000388280","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-UCSF-P0284_0A_apo_TloTd20.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 11 11 0 0 0 0 0 0 0 0999 V2000\n 27.9590 51.3820 -7.3520 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.7500 50.3600 -6.5990 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.2340 50.7300 -5.4040 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.9340 49.8270 -4.6740 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.1200 48.5630 -5.1630 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.8110 47.6480 -4.3920 O 0 0 0 0 0 0 0 0 0 0 0 0\n 29.6320 48.1760 -6.3810 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.9320 49.0900 -7.0700 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.8360 46.7550 -6.8390 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.4580 46.3560 -7.9460 O 0 0 0 0 0 0 0 0 0 0 0 0\n 30.3290 45.9240 -6.1110 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 2 0\n 4 3 1 0\n 5 4 2 0\n 6 5 1 0\n 7 5 1 0\n 8 7 2 0\n 8 2 1 0\n 9 7 1 0\n 10 9 2 0\n 11 9 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":152.05,"logp":1.4,"tpsa":57.53,"ha":11,"hacc":2,"hdon":2,"rots":1,"rings":1,"velec":58,"number":0},{"id":37640,"smiles":"O=C(O)c1cccc2c1OCO2","cmpd_id":6458,"prot_id":37551,"protein_code":"Mac1-UCSF-P0301A:ZINC000000332540","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-UCSF-P0301_0A_apo_0Xk0pWN.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 12 13 0 0 0 0 0 0 0 0999 V2000\n 30.0310 45.8080 -6.2730 O 0 0 0 0 0 0 0 0 0 0 0 0\n 30.2240 46.9170 -5.7720 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.9970 47.0300 -4.7960 O 0 0 0 0 0 0 0 0 0 0 0 0\n 29.5210 48.1420 -6.3770 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.2900 49.2690 -5.6200 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.6480 50.3680 -6.1550 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.2330 50.3470 -7.4630 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.4590 49.2140 -8.2350 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.1820 48.9640 -9.5840 O 0 0 0 0 0 0 0 0 0 0 0 0\n 28.3630 47.5840 -9.7510 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.1970 47.1560 -8.7300 O 0 0 0 0 0 0 0 0 0 0 0 0\n 29.1020 48.1300 -7.7150 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 2 0\n 4 2 1 0\n 5 4 2 0\n 6 5 1 0\n 7 6 2 0\n 8 7 1 0\n 9 8 1 0\n 10 9 1 0\n 11 10 1 0\n 12 11 1 0\n 12 4 1 0\n 12 8 2 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":166.03,"logp":1.11,"tpsa":55.76,"ha":12,"hacc":3,"hdon":1,"rots":1,"rings":2,"velec":62,"number":0},{"id":37641,"smiles":"O=C(O)CNC(=O)c1cccc(O)c1","cmpd_id":6459,"prot_id":37552,"protein_code":"Mac1-UCSF-P0302A:ZINC000006534965","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-UCSF-P0302_0A_apo_Qxh50dX.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 14 14 0 0 0 0 0 0 0 0999 V2000\n 30.5280 44.8420 -6.4200 O 0 0 0 0 0 0 0 0 0 0 0 0\n 30.4320 46.0230 -6.7290 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.4160 46.3140 -7.8830 O 0 0 0 0 0 0 0 0 0 0 0 0\n 30.2820 47.1260 -5.6290 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.8340 48.3100 -6.2080 N 0 0 0 0 0 0 0 0 0 0 0 0\n 29.5550 49.4330 -5.4070 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.7290 49.4150 -4.3040 O 0 0 0 0 0 0 0 0 0 0 0 0\n 29.1160 50.6690 -6.1500 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.5690 50.5390 -7.3780 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.1850 51.6730 -8.1020 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.3720 52.9410 -7.5190 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.9370 53.0360 -6.2680 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.1890 54.2010 -5.6820 O 0 0 0 0 0 0 0 0 0 0 0 0\n 29.3200 51.9310 -5.5590 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 2 0\n 4 2 1 0\n 5 4 1 0\n 6 5 1 0\n 7 6 2 0\n 8 6 1 0\n 9 8 2 0\n 10 9 1 0\n 11 10 2 0\n 12 11 1 0\n 13 12 1 0\n 14 12 2 0\n 14 8 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":195.05,"logp":0.21,"tpsa":86.63,"ha":14,"hacc":3,"hdon":3,"rots":3,"rings":1,"velec":74,"number":0},{"id":37642,"smiles":"NS(=O)(=O)c1nc2ccccc2[nH]1","cmpd_id":6460,"prot_id":37553,"protein_code":"Mac1-UCSF-P0303A:ZINC000006490906","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-UCSF-P0303_0A_apo_ExF7usn.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 13 14 0 0 0 0 0 0 0 0999 V2000\n 29.8640 56.3350 -8.7200 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.6070 56.0660 -7.5950 S 0 0 0 0 0 0 0 0 0 0 0 0\n 27.3690 56.1390 -8.1430 O 0 0 0 0 0 0 0 0 0 0 0 0\n 28.8250 57.0080 -6.5810 O 0 0 0 0 0 0 0 0 0 0 0 0\n 28.7630 54.3880 -7.0240 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.0680 53.9800 -5.8540 N 0 0 0 0 0 0 0 0 0 0 0 0\n 29.0440 52.6830 -5.8950 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.3440 51.7460 -4.9720 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.1960 50.3950 -5.2820 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.8280 50.0080 -6.5270 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.5510 50.9200 -7.4930 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.6670 52.2940 -7.1530 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.5080 53.3990 -7.7870 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 2 0\n 4 2 2 0\n 5 2 1 0\n 6 5 2 0\n 7 6 1 0\n 8 7 2 0\n 9 8 1 0\n 10 9 2 0\n 11 10 1 0\n 12 11 2 0\n 12 7 1 0\n 13 12 1 0\n 13 5 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":197.03,"logp":0.21,"tpsa":88.84,"ha":13,"hacc":3,"hdon":2,"rots":1,"rings":2,"velec":68,"number":0},{"id":37644,"smiles":"c1cc(-c2ncc[nH]2)ccn1","cmpd_id":6462,"prot_id":37555,"protein_code":"Mac1-UCSF-P0306A:ZINC000013283576","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-UCSF-P0306_0A_apo_eibG53h.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 11 12 0 0 0 0 0 0 0 0999 V2000\n 29.0860 55.7670 -6.6460 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.5150 55.4770 -7.8270 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.3530 54.1960 -7.8790 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.7950 53.6890 -6.7400 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.3080 54.6610 -6.0070 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.9300 52.2740 -6.3720 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.4120 51.9030 -5.1470 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.6210 50.5540 -4.8850 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.3650 49.6380 -5.7930 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.9080 49.9590 -6.9760 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.6940 51.2510 -7.2870 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 2 0\n 3 2 1 0\n 4 3 1 0\n 5 4 2 0\n 5 1 1 0\n 6 4 1 0\n 7 6 2 0\n 8 7 1 0\n 9 8 2 0\n 10 9 1 0\n 11 10 2 0\n 11 6 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":145.06,"logp":1.47,"tpsa":41.57,"ha":11,"hacc":2,"hdon":1,"rots":1,"rings":2,"velec":54,"number":0},{"id":37645,"smiles":"c1cc(-c2ncc[nH]2)ccn1","cmpd_id":6462,"prot_id":37556,"protein_code":"Mac1-UCSF-P0306_1A:ZINC000013283576","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-UCSF-P0306_1A_apo_cJVYLQ9.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 11 12 0 0 0 0 0 0 0 0999 V2000\n 28.6310 48.0090 -10.0430 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.8960 47.0930 -9.0600 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.0070 47.7380 -7.9260 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.7780 49.0140 -8.1400 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.5460 49.1630 -9.4710 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.9150 50.0610 -7.0490 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.6730 51.3730 -7.3120 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.8780 52.3920 -6.3770 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.3010 52.0060 -5.1930 N 0 0 0 0 0 0 0 0 0 0 0 0\n 29.5820 50.7320 -4.8820 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.3990 49.7170 -5.8030 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 2 0\n 3 2 1 0\n 4 3 1 0\n 5 4 2 0\n 5 1 1 0\n 6 4 1 0\n 7 6 2 0\n 8 7 1 0\n 9 8 2 0\n 10 9 1 0\n 11 6 1 0\n 11 10 2 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":145.06,"logp":1.47,"tpsa":41.57,"ha":11,"hacc":2,"hdon":1,"rots":1,"rings":2,"velec":54,"number":0},{"id":37648,"smiles":"O=C(O)c1cccc(Cl)c1","cmpd_id":6465,"prot_id":37559,"protein_code":"Mac1-UCSF-P0321A:ZINC000000156863","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-UCSF-P0321_0A_apo_1SgvuPU.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 10 10 0 0 0 0 0 0 0 0999 V2000\n 27.8940 52.2370 -8.5200 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 29.7220 47.5750 -6.8920 O 0 0 0 0 0 0 0 0 0 0 0 0\n 30.0260 48.2770 -5.8900 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.6710 47.8220 -4.9040 O 0 0 0 0 0 0 0 0 0 0 0 0\n 29.5630 49.7230 -5.8730 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.6830 50.4810 -4.7310 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.2370 51.7910 -4.7160 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.6890 52.3450 -5.8560 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.5960 51.5810 -7.0020 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.0120 50.2720 -7.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3 2 1 0\n 4 3 2 0\n 5 3 1 0\n 6 5 2 0\n 7 6 1 0\n 8 7 2 0\n 9 8 1 0\n 9 1 1 0\n 10 9 2 0\n 10 5 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":156,"logp":2.04,"tpsa":37.3,"ha":10,"hacc":1,"hdon":1,"rots":1,"rings":1,"velec":52,"number":0},{"id":37650,"smiles":"O=C(O)c1ccc(O)cc1","cmpd_id":6467,"prot_id":37561,"protein_code":"Mac1-UCSF-P0328A:ZINC000000332752","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-UCSF-P0328_0A_apo_yHF9zMd.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 10 10 0 0 0 0 0 0 0 0999 V2000\n 30.4120 47.6640 -5.0100 O 0 0 0 0 0 0 0 0 0 0 0 0\n 29.8410 48.3180 -5.9210 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.5360 47.7480 -6.9870 O 0 0 0 0 0 0 0 0 0 0 0 0\n 29.5730 49.8150 -5.8160 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.8230 50.4940 -4.6460 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.6010 51.8620 -4.6110 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.1600 52.5610 -5.7170 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.9910 53.9400 -5.6170 O 0 0 0 0 0 0 0 0 0 0 0 0\n 28.9300 51.8850 -6.8930 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.1430 50.5150 -6.9440 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 2 0\n 4 2 1 0\n 5 4 2 0\n 6 5 1 0\n 7 6 2 0\n 8 7 1 0\n 9 7 1 0\n 10 9 2 0\n 10 4 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":138.03,"logp":1.09,"tpsa":57.53,"ha":10,"hacc":2,"hdon":2,"rots":1,"rings":1,"velec":52,"number":0},{"id":37651,"smiles":"Oc1ccc2c(c1)OCO2","cmpd_id":6468,"prot_id":37562,"protein_code":"Mac1-UCSF-P0333A:ZINC000000164504","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-UCSF-P0333_0A_apo_u78kiRL.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 10 11 0 0 0 0 0 0 0 0999 V2000\n 29.6120 48.6280 -5.3180 O 0 0 0 0 0 0 0 0 0 0 0 0\n 29.3100 49.8950 -5.8720 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.7430 49.9540 -7.1330 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.4280 51.1650 -7.7250 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.6810 52.3710 -7.0290 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.4760 53.7250 -7.3780 O 0 0 0 0 0 0 0 0 0 0 0 0\n 29.2380 54.4450 -6.4440 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.3820 53.5500 -5.3710 O 0 0 0 0 0 0 0 0 0 0 0 0\n 29.2450 52.3270 -5.7880 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.5650 51.0800 -5.1920 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 2 0\n 4 3 1 0\n 5 4 2 0\n 6 5 1 0\n 7 6 1 0\n 8 7 1 0\n 9 5 1 0\n 9 8 1 0\n 10 9 2 0\n 10 2 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":138.03,"logp":1.12,"tpsa":38.69,"ha":10,"hacc":3,"hdon":1,"rots":0,"rings":2,"velec":52,"number":0},{"id":37652,"smiles":"Cc1ccc(S(N)(=O)=O)cc1","cmpd_id":6469,"prot_id":37563,"protein_code":"Mac1-UCSF-P0337A:ZINC000000388056","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-UCSF-P0337_0A_apo_IHGuwMJ.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 11 11 0 0 0 0 0 0 0 0999 V2000\n 34.9650 52.5530 -7.2600 C 0 0 0 0 0 0 0 0 0 0 0 0\n 33.5390 52.0410 -7.0770 C 0 0 0 0 0 0 0 0 0 0 0 0\n 32.5060 52.9430 -7.1340 C 0 0 0 0 0 0 0 0 0 0 0 0\n 31.2100 52.5070 -6.9830 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.9590 51.1680 -6.7570 C 0 0 0 0 0 0 0 0 0 0 0 0\n 31.9890 50.2600 -6.6810 C 0 0 0 0 0 0 0 0 0 0 0 0\n 33.2850 50.7000 -6.8450 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.2400 50.6430 -6.5550 S 0 0 0 0 0 0 0 0 0 0 0 0\n 29.1220 49.6850 -5.4750 O 0 0 0 0 0 0 0 0 0 0 0 0\n 28.7370 49.9690 -7.7480 O 0 0 0 0 0 0 0 0 0 0 0 0\n 28.3550 52.0520 -6.2590 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 2 0\n 4 3 1 0\n 5 4 2 0\n 6 5 1 0\n 7 6 2 0\n 7 2 1 0\n 8 5 1 0\n 9 8 2 0\n 10 8 2 0\n 8 11 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":171.04,"logp":0.64,"tpsa":60.16,"ha":11,"hacc":2,"hdon":1,"rots":1,"rings":1,"velec":60,"number":0},{"id":37653,"smiles":"NC(=O)c1cnccn1","cmpd_id":6470,"prot_id":37564,"protein_code":"Mac1-UCSF-P0338A:ZINC000000002005","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-UCSF-P0338_0A_apo_dTQgMls.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 9 9 0 0 0 0 0 0 0 0999 V2000\n 27.8380 52.0830 -9.1680 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.2960 52.6650 -7.9370 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.2410 53.8220 -7.7690 O 0 0 0 0 0 0 0 0 0 0 0 0\n 28.8350 51.7580 -6.8520 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.2690 52.3000 -5.6490 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.7440 51.5170 -4.7020 N 0 0 0 0 0 0 0 0 0 0 0 0\n 29.8230 50.2330 -4.9060 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.4170 49.6910 -6.1030 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.9310 50.4530 -7.0460 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 2 0\n 4 2 1 0\n 5 4 2 0\n 6 5 1 0\n 7 6 2 0\n 8 7 1 0\n 9 8 2 0\n 9 4 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":123.04,"logp":-0.42,"tpsa":68.87,"ha":9,"hacc":3,"hdon":1,"rots":1,"rings":1,"velec":46,"number":0},{"id":37654,"smiles":"NC(=O)c1cnccn1","cmpd_id":6470,"prot_id":37565,"protein_code":"Mac1-UCSF-P0338_1A:ZINC000000002005","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-UCSF-P0338_1A_apo_tJs8qpK.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 9 9 0 0 0 0 0 0 0 0999 V2000\n 28.2840 54.1500 -7.6590 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.9980 53.8400 -6.4300 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.5100 54.6430 -5.7410 O 0 0 0 0 0 0 0 0 0 0 0 0\n 29.1400 52.3720 -6.1280 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.6620 51.8850 -4.9570 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.7950 50.5960 -4.7780 N 0 0 0 0 0 0 0 0 0 0 0 0\n 29.4400 49.7730 -5.7410 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.9300 50.2470 -6.9240 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.7890 51.5420 -7.0790 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 2 0\n 4 2 1 0\n 5 4 2 0\n 6 5 1 0\n 7 6 2 0\n 8 7 1 0\n 9 8 2 0\n 9 4 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":123.04,"logp":-0.42,"tpsa":68.87,"ha":9,"hacc":3,"hdon":1,"rots":1,"rings":1,"velec":46,"number":0},{"id":37655,"smiles":"Nc1nc2ccccc2c(=O)[nH]1","cmpd_id":4019,"prot_id":37566,"protein_code":"Mac1-UCSF-P0341A:ZINC000013514509","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-UCSF-P0341_0A_apo_XacSvZl.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 12 13 0 0 0 0 0 0 0 0999 V2000\n 28.1340 54.9200 -8.3070 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.4600 53.7620 -7.5490 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.2930 52.4950 -8.1840 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.6460 51.2370 -7.4290 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.5040 50.0040 -8.0340 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.8350 48.8600 -7.3530 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.3170 48.9090 -6.0620 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.4680 50.1470 -5.4680 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.1090 51.2870 -6.1400 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.2880 52.6290 -5.5070 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.7290 52.6420 -4.4100 O 0 0 0 0 0 0 0 0 0 0 0 0\n 28.9550 53.8300 -6.2160 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 2 0\n 4 3 1 0\n 5 4 2 0\n 6 5 1 0\n 7 6 2 0\n 8 7 1 0\n 9 8 2 0\n 9 4 1 0\n 10 9 1 0\n 11 10 2 0\n 12 10 1 0\n 12 2 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":161.06,"logp":0.51,"tpsa":71.77,"ha":12,"hacc":3,"hdon":2,"rots":0,"rings":2,"velec":60,"number":0},{"id":37658,"smiles":"Cc1nc(N)ccc1Br","cmpd_id":6473,"prot_id":37569,"protein_code":"Mac1-UCSF-P0345A:ZINC000019015078","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-UCSF-P0345_0A_apo_LxURB07.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 9 9 0 0 0 0 0 0 0 0999 V2000\n 29.1060 54.8440 -6.6280 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.0130 53.3640 -6.2680 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.4590 52.9490 -5.1070 N 0 0 0 0 0 0 0 0 0 0 0 0\n 29.4050 51.6840 -4.7680 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.8780 51.2520 -3.4780 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.8920 50.7420 -5.6330 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.3920 51.1370 -6.8480 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.4710 52.4760 -7.1910 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.7800 53.0330 -8.8960 Br 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 2 0\n 4 3 1 0\n 5 4 1 0\n 6 4 2 0\n 7 6 1 0\n 8 7 2 0\n 8 2 1 0\n 9 8 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":185.98,"logp":1.73,"tpsa":38.91,"ha":9,"hacc":2,"hdon":1,"rots":0,"rings":1,"velec":48,"number":0},{"id":37659,"smiles":"O=C(NO)c1ccccc1O","cmpd_id":6474,"prot_id":37570,"protein_code":"Mac1-UCSF-P0346A:ZINC000018169763","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-UCSF-P0346_0A_apo_2MFhpBP.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 11 11 0 0 0 0 0 0 0 0999 V2000\n 29.0030 54.9370 -7.1190 O 0 0 0 0 0 0 0 0 0 0 0 0\n 29.4350 54.6490 -5.9760 N 0 0 0 0 0 0 0 0 0 0 0 0\n 29.3580 53.3260 -5.5920 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.7700 53.1840 -4.5010 O 0 0 0 0 0 0 0 0 0 0 0 0\n 28.8080 52.2450 -6.5410 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.1810 52.4560 -7.7590 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.7590 51.3390 -8.4990 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.0030 50.0260 -7.9990 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.6120 49.8440 -6.8350 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.0240 50.9570 -6.0920 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.6920 50.7730 -4.8210 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 1 0\n 4 3 2 0\n 5 3 1 0\n 6 5 2 0\n 7 6 1 0\n 8 7 2 0\n 9 8 1 0\n 10 9 2 0\n 10 5 1 0\n 11 10 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":153.04,"logp":0.51,"tpsa":69.56,"ha":11,"hacc":3,"hdon":3,"rots":1,"rings":1,"velec":58,"number":0},{"id":37660,"smiles":"O=C(O)c1cncc(-c2ccccc2)c1","cmpd_id":4022,"prot_id":37571,"protein_code":"Mac1-UCSF-P0347A:ZINC000000159004","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-UCSF-P0347_0A_apo_bnk0aYd.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 15 16 0 0 0 0 0 0 0 0999 V2000\n 30.2070 44.9850 -6.4730 O 0 0 0 0 0 0 0 0 0 0 0 0\n 30.2020 46.0870 -7.0490 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.3810 46.1210 -8.2970 O 0 0 0 0 0 0 0 0 0 0 0 0\n 30.0380 47.3840 -6.2700 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.2960 47.4250 -4.9220 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.2070 48.5550 -4.2290 N 0 0 0 0 0 0 0 0 0 0 0 0\n 29.8800 49.6820 -4.8290 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.6110 49.7340 -6.1980 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.6830 48.5560 -6.9340 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.2290 51.0770 -6.8720 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.2650 51.1190 -7.8420 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.9470 52.3370 -8.4350 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.6470 53.4890 -8.1020 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.6510 53.4500 -7.1690 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.9420 52.2530 -6.5560 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 2 0\n 4 2 1 0\n 5 4 2 0\n 6 5 1 0\n 7 6 2 0\n 8 7 1 0\n 9 4 1 0\n 9 8 2 0\n 10 8 1 0\n 11 10 2 0\n 12 11 1 0\n 13 12 2 0\n 14 13 1 0\n 15 14 2 0\n 15 10 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":199.06,"logp":2.45,"tpsa":50.19,"ha":15,"hacc":2,"hdon":1,"rots":2,"rings":2,"velec":74,"number":0},{"id":37666,"smiles":"NS(=O)(=O)c1cc(Cl)cc(Cl)c1","cmpd_id":6479,"prot_id":37577,"protein_code":"Mac1-UCSF-P0360A:ZINC000000090873","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-UCSF-P0360_0A_apo_OQ4UhGu.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 12 12 0 0 0 0 0 0 0 0999 V2000\n 31.3990 55.4710 -8.6830 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 34.6510 51.5310 -6.9890 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 29.7170 49.2570 -6.2190 N 0 0 0 0 0 0 0 0 0 0 0 0\n 29.2710 50.7120 -6.9520 S 0 0 0 0 0 0 0 0 0 0 0 0\n 28.4640 51.5540 -6.0880 O 0 0 0 0 0 0 0 0 0 0 0 0\n 28.4740 50.5550 -8.1690 O 0 0 0 0 0 0 0 0 0 0 0 0\n 30.7130 51.7510 -7.2900 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.5090 53.0330 -7.7830 C 0 0 0 0 0 0 0 0 0 0 0 0\n 31.6040 53.8410 -8.0360 C 0 0 0 0 0 0 0 0 0 0 0 0\n 32.8640 53.3790 -7.7670 C 0 0 0 0 0 0 0 0 0 0 0 0\n 33.0250 52.1120 -7.2770 C 0 0 0 0 0 0 0 0 0 0 0 0\n 31.9650 51.2830 -7.0200 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4 3 1 0\n 5 4 2 0\n 6 4 2 0\n 7 4 1 0\n 8 7 2 0\n 9 8 1 0\n 9 1 1 0\n 10 9 2 0\n 11 10 1 0\n 11 2 1 0\n 12 7 1 0\n 12 11 2 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":224.94,"logp":1.64,"tpsa":60.16,"ha":12,"hacc":2,"hdon":1,"rots":1,"rings":1,"velec":66,"number":0},{"id":37667,"smiles":"NC(=O)c1ccc(O)cc1","cmpd_id":4018,"prot_id":37578,"protein_code":"Mac1-UCSF-P0361A:ZINC000000157088","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-UCSF-P0361_0A_apo_1dYugFX.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 10 10 0 0 0 0 0 0 0 0999 V2000\n 28.2050 53.8430 -7.8200 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.9300 53.6150 -6.5990 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.3330 54.5460 -6.0100 O 0 0 0 0 0 0 0 0 0 0 0 0\n 29.1810 52.1830 -6.1060 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.5160 51.8900 -4.8040 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.7730 50.5620 -4.4340 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.6510 49.5490 -5.3710 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.8770 48.2170 -5.0040 O 0 0 0 0 0 0 0 0 0 0 0 0\n 29.3200 49.8470 -6.6840 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.0930 51.1580 -7.0220 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 2 0\n 4 2 1 0\n 5 4 2 0\n 6 5 1 0\n 7 6 2 0\n 8 7 1 0\n 9 7 1 0\n 10 9 2 0\n 10 4 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":137.05,"logp":0.49,"tpsa":63.32,"ha":10,"hacc":2,"hdon":2,"rots":1,"rings":1,"velec":52,"number":0},{"id":37668,"smiles":"O=C(O)c1ccc(O)c(F)c1","cmpd_id":6480,"prot_id":37579,"protein_code":"Mac1-UCSF-P0365A:ZINC000000404062","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-UCSF-P0365_0A_apo_S1j7r1O.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 11 11 0 0 0 0 0 0 0 0999 V2000\n 29.3350 47.4850 -7.1290 O 0 0 0 0 0 0 0 0 0 0 0 0\n 29.5880 48.2690 -6.2000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.2160 47.8430 -5.2500 O 0 0 0 0 0 0 0 0 0 0 0 0\n 29.2890 49.7680 -6.2530 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.7780 50.4220 -7.3450 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.5910 51.8140 -7.2970 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.9090 52.5100 -6.1370 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.7850 53.8770 -5.9560 O 0 0 0 0 0 0 0 0 0 0 0 0\n 29.3900 51.8140 -5.0680 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.5850 50.4610 -5.1300 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.6600 52.4720 -3.9160 F 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 2 0\n 4 2 1 0\n 5 4 2 0\n 6 5 1 0\n 7 6 2 0\n 8 7 1 0\n 9 7 1 0\n 10 4 1 0\n 10 9 2 0\n 11 9 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":156.02,"logp":1.23,"tpsa":57.53,"ha":11,"hacc":2,"hdon":2,"rots":1,"rings":1,"velec":58,"number":0},{"id":37669,"smiles":"O=C(O)c1ccc(O)c(F)c1","cmpd_id":6480,"prot_id":37580,"protein_code":"Mac1-UCSF-P0365_1A:ZINC000000404062","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-UCSF-P0365_1A_apo_YbQvh5a.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 11 11 0 0 0 0 0 0 0 0999 V2000\n 28.0730 53.7780 -7.7110 O 0 0 0 0 0 0 0 0 0 0 0 0\n 28.6000 53.3920 -6.6180 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.0350 54.0900 -5.6770 O 0 0 0 0 0 0 0 0 0 0 0 0\n 28.8530 51.9600 -6.4140 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.6020 51.0660 -7.4300 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.8950 49.7580 -7.1950 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.4320 49.3280 -6.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.7490 47.9750 -5.7640 O 0 0 0 0 0 0 0 0 0 0 0 0\n 29.6800 50.1960 -4.9940 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.3930 51.5360 -5.1980 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.1860 49.6740 -3.8220 F 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 2 0\n 4 2 1 0\n 5 4 2 0\n 6 5 1 0\n 7 6 2 0\n 8 7 1 0\n 9 7 1 0\n 10 4 1 0\n 10 9 2 0\n 11 9 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":156.02,"logp":1.23,"tpsa":57.53,"ha":11,"hacc":2,"hdon":2,"rots":1,"rings":1,"velec":58,"number":0},{"id":37675,"smiles":"Cc1ncc(C(=O)O)s1","cmpd_id":6485,"prot_id":37586,"protein_code":"Mac1-UCSF-P0379A:ZINC000001688638","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-UCSF-P0379_0A_apo_IhmKqfd.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 9 9 0 0 0 0 0 0 0 0999 V2000\n 28.6500 52.5470 -6.7010 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.0080 51.1460 -6.2540 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.5670 50.9080 -5.0990 N 0 0 0 0 0 0 0 0 0 0 0 0\n 29.8530 49.6300 -4.8400 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.5410 48.7400 -5.8590 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.8440 49.6990 -7.1050 S 0 0 0 0 0 0 0 0 0 0 0 0\n 29.7890 47.2440 -5.7120 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.5090 46.8490 -4.7660 O 0 0 0 0 0 0 0 0 0 0 0 0\n 29.2540 46.4240 -6.4930 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 2 0\n 4 3 1 0\n 5 4 2 0\n 6 5 1 0\n 6 2 1 0\n 7 5 1 0\n 8 7 2 0\n 9 7 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":143,"logp":1.15,"tpsa":50.19,"ha":9,"hacc":3,"hdon":1,"rots":1,"rings":1,"velec":48,"number":0},{"id":37676,"smiles":"O=C1CSc2cc(C(=O)O)ccc2N1","cmpd_id":6486,"prot_id":37587,"protein_code":"Mac1-UCSF-P0380A:ZINC000098208711","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-UCSF-P0380_0A_apo_0Mm4BYI.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 14 15 0 0 0 0 0 0 0 0999 V2000\n 29.8950 47.8300 -5.9530 O 0 0 0 0 0 0 0 0 0 0 0 0\n 29.7770 48.9230 -5.3490 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.0660 49.0320 -4.1530 O 0 0 0 0 0 0 0 0 0 0 0 0\n 29.3000 50.1460 -6.0750 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.7410 49.9680 -7.3490 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.3090 51.0750 -8.0470 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.4370 52.3410 -7.4760 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.9320 53.5620 -8.3160 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.4950 54.9480 -8.1120 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.1190 55.8410 -8.7520 O 0 0 0 0 0 0 0 0 0 0 0 0\n 29.5680 54.9800 -7.0360 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.1100 54.1650 -5.6020 S 0 0 0 0 0 0 0 0 0 0 0 0\n 28.9790 52.5330 -6.2190 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.4240 51.4120 -5.5090 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 2 0\n 4 2 1 0\n 5 4 2 0\n 6 5 1 0\n 7 6 2 0\n 8 7 1 0\n 9 8 1 0\n 10 9 2 0\n 11 9 1 0\n 12 11 1 0\n 13 12 1 0\n 13 7 1 0\n 14 13 2 0\n 14 4 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":209.01,"logp":1.43,"tpsa":66.4,"ha":14,"hacc":3,"hdon":2,"rots":1,"rings":2,"velec":72,"number":0},{"id":37677,"smiles":"N=C(N)c1ccc2ccccc2c1","cmpd_id":6487,"prot_id":37588,"protein_code":"Mac1-UCSF-P0381B:ZINC000001442764","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-UCSF-P0381_0B_apo_4MvGFa3.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 13 14 0 0 0 0 0 0 0 0999 V2000\n 29.0610 56.3500 -10.0060 N 0 0 0 0 0 0 0 0 0 0 0 0\n 27.8060 56.3600 -9.3180 C 0 0 0 0 0 0 0 0 0 0 0 0\n 26.8470 55.5550 -9.6790 N 0 0 0 0 0 0 0 0 0 0 0 0\n 27.5630 57.3680 -8.1260 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.4920 58.7540 -8.4880 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.2680 59.6800 -7.5330 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.1220 59.3080 -6.1620 C 0 0 0 0 0 0 0 0 0 0 0 0\n 26.9210 60.3340 -5.1900 C 0 0 0 0 0 0 0 0 0 0 0 0\n 26.7820 60.0070 -3.8480 C 0 0 0 0 0 0 0 0 0 0 0 0\n 26.8360 58.6370 -3.4810 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.0470 57.6350 -4.4220 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.2140 57.9640 -5.7900 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.4390 56.9670 -6.7770 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 2 0\n 4 2 1 0\n 5 4 2 0\n 6 5 1 0\n 7 6 2 0\n 8 7 1 0\n 9 8 2 0\n 10 9 1 0\n 11 10 2 0\n 12 7 1 0\n 12 11 1 0\n 13 12 2 0\n 13 4 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":170.08,"logp":2.12,"tpsa":49.87,"ha":13,"hacc":1,"hdon":2,"rots":1,"rings":2,"velec":64,"number":0},{"id":37678,"smiles":"Cc1ncc(C)c(N)n1","cmpd_id":6488,"prot_id":37589,"protein_code":"Mac1-UCSF-P0385A:ZINC000003591110","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-UCSF-P0385_0A_apo_wMOKvVQ.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 9 9 0 0 0 0 0 0 0 0999 V2000\n 28.7930 51.8030 -6.0540 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.6580 50.5320 -6.9060 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.0720 49.2830 -6.5100 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.9010 48.2730 -7.3560 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.3510 48.4650 -8.5390 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.1330 47.3040 -9.4930 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.9630 49.6410 -8.9430 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.0920 50.6760 -8.1610 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.6530 51.9700 -8.5950 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 2 0\n 4 3 1 0\n 5 4 2 0\n 6 5 1 0\n 7 5 1 0\n 8 7 2 0\n 8 2 1 0\n 9 8 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":123.08,"logp":0.68,"tpsa":51.8,"ha":9,"hacc":3,"hdon":1,"rots":0,"rings":1,"velec":48,"number":0},{"id":37679,"smiles":"Cc1ncc(C)c(N)n1","cmpd_id":6488,"prot_id":37590,"protein_code":"Mac1-UCSF-P0385_1A:ZINC000003591110","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-UCSF-P0385_1A_apo_OLBJT5z.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 9 9 0 0 0 0 0 0 0 0999 V2000\n 28.6310 50.1990 -6.6780 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.8140 51.7140 -6.4810 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.4680 52.2110 -5.3810 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.6230 53.5210 -5.2950 N 0 0 0 0 0 0 0 0 0 0 0 0\n 29.1820 54.3300 -6.2220 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.4480 55.8070 -5.9560 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.5560 53.8990 -7.3180 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.3790 52.5830 -7.4600 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.7070 51.9630 -8.5920 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 2 0\n 4 3 1 0\n 5 4 2 0\n 6 5 1 0\n 7 5 1 0\n 8 7 2 0\n 8 2 1 0\n 9 8 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":123.08,"logp":0.68,"tpsa":51.8,"ha":9,"hacc":3,"hdon":1,"rots":0,"rings":1,"velec":48,"number":0},{"id":37680,"smiles":"Nc1nccc2ccccc12","cmpd_id":4020,"prot_id":37591,"protein_code":"Mac1-UCSF-P0387A:ZINC000000154817","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-UCSF-P0387_0A_apo_DABNTtk.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 11 12 0 0 0 0 0 0 0 0999 V2000\n 27.7220 51.4770 -8.7340 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.1030 50.0850 -8.7510 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.8490 49.3600 -9.8260 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.1710 48.0750 -9.8870 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.8080 47.4610 -8.8190 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.1050 48.2090 -7.6430 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.7470 47.6050 -6.5240 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.0270 48.3570 -5.3890 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.6490 49.6960 -5.3470 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.0260 50.2810 -6.4340 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.7390 49.5260 -7.6070 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 2 0\n 4 3 1 0\n 5 4 2 0\n 6 5 1 0\n 7 6 1 0\n 8 7 2 0\n 9 8 1 0\n 10 9 2 0\n 11 6 2 0\n 11 10 1 0\n 11 2 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":144.07,"logp":1.82,"tpsa":38.91,"ha":11,"hacc":2,"hdon":1,"rots":0,"rings":2,"velec":54,"number":0},{"id":37681,"smiles":"Nc1cnccc1C(=O)O","cmpd_id":6489,"prot_id":37592,"protein_code":"Mac1-UCSF-P0392A:ZINC000000165882","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-UCSF-P0392_0A_apo_LKD7AtM.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 10 10 0 0 0 0 0 0 0 0999 V2000\n 28.9240 47.3680 -9.3140 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.8890 48.5700 -8.5160 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.4300 49.7000 -9.1190 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.3670 50.7880 -8.4360 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.7080 50.9060 -7.1620 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.1940 49.8560 -6.4920 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.2860 48.6470 -7.1930 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.7880 47.4920 -6.4100 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.3110 47.7890 -5.3190 O 0 0 0 0 0 0 0 0 0 0 0 0\n 29.6490 46.3010 -6.8090 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 2 0\n 4 3 1 0\n 5 4 2 0\n 6 5 1 0\n 7 2 1 0\n 7 6 2 0\n 8 7 1 0\n 9 8 2 0\n 10 8 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":138.04,"logp":0.36,"tpsa":76.21,"ha":10,"hacc":3,"hdon":2,"rots":1,"rings":1,"velec":52,"number":0},{"id":37683,"smiles":"NC(=O)c1cccnc1","cmpd_id":6491,"prot_id":37594,"protein_code":"Mac1-UCSF-P0396A:ZINC000000005878","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-UCSF-P0396_0A_apo_bOTLExo.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 9 9 0 0 0 0 0 0 0 0999 V2000\n 28.1820 50.5910 -8.5430 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.7280 50.7560 -7.2390 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.0920 49.8640 -6.6040 O 0 0 0 0 0 0 0 0 0 0 0 0\n 28.9270 52.1850 -6.7330 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.6690 53.1870 -7.5870 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.8910 54.4850 -7.2620 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.3830 54.6770 -5.9930 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.6320 53.7110 -5.1950 N 0 0 0 0 0 0 0 0 0 0 0 0\n 29.4460 52.4480 -5.5200 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 2 0\n 4 2 1 0\n 5 4 2 0\n 6 5 1 0\n 7 6 2 0\n 8 7 1 0\n 9 4 1 0\n 9 8 2 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":122.05,"logp":0.18,"tpsa":55.98,"ha":9,"hacc":2,"hdon":1,"rots":1,"rings":1,"velec":46,"number":0},{"id":37684,"smiles":"NC(=O)c1cccnc1","cmpd_id":6491,"prot_id":37595,"protein_code":"Mac1-UCSF-P0396_1A:ZINC000000005878","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-UCSF-P0396_1A_apo_UVwgAL4.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 9 9 0 0 0 0 0 0 0 0999 V2000\n 28.8280 54.6990 -7.5700 N 0 0 0 0 0 0 0 0 0 0 0 0\n 29.1310 53.8930 -6.4390 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.5340 54.2720 -5.4410 O 0 0 0 0 0 0 0 0 0 0 0 0\n 28.9980 52.4180 -6.6240 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.5250 51.5630 -5.6700 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.4090 50.2100 -5.9640 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.8460 49.7900 -7.1360 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.3900 50.6350 -8.0140 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.4410 51.9300 -7.7950 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 2 0\n 4 2 1 0\n 5 4 2 0\n 6 5 1 0\n 7 6 2 0\n 8 7 1 0\n 9 8 2 0\n 9 4 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":122.05,"logp":0.18,"tpsa":55.98,"ha":9,"hacc":2,"hdon":1,"rots":1,"rings":1,"velec":46,"number":0},{"id":37685,"smiles":"Nc1nc2c(Cl)cccc2s1","cmpd_id":6492,"prot_id":37596,"protein_code":"Mac1-UCSF-P0397A:ZINC000008615114","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-UCSF-P0397_0A_apo_M7bsPFJ.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 11 12 0 0 0 0 0 0 0 0999 V2000\n 29.3180 52.6710 -4.0870 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 27.7660 54.5520 -8.9880 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.1700 53.3410 -8.3310 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.5110 53.2670 -7.0030 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.8630 51.9030 -6.6790 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.2670 51.4880 -5.4030 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.5810 50.1700 -5.1670 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.5310 49.2500 -6.2140 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.1500 49.6550 -7.4890 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.8000 50.9920 -7.7200 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.3210 51.8360 -9.0750 S 0 0 0 0 0 0 0 0 0 0 0 0\n 3 2 1 0\n 4 3 2 0\n 5 4 1 0\n 6 5 2 0\n 6 1 1 0\n 7 6 1 0\n 8 7 2 0\n 9 8 1 0\n 10 9 2 0\n 10 5 1 0\n 11 10 1 0\n 11 3 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":183.99,"logp":2.53,"tpsa":38.91,"ha":11,"hacc":3,"hdon":1,"rots":0,"rings":2,"velec":56,"number":0},{"id":37686,"smiles":"Nc1ccc(C(=O)O)c(O)c1","cmpd_id":6493,"prot_id":37597,"protein_code":"Mac1-UCSF-P0398A:ZINC000000000922","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-UCSF-P0398_0A_apo_wApwiH5.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 11 11 0 0 0 0 0 0 0 0999 V2000\n 28.1120 54.1670 -8.3440 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.5000 53.0050 -7.5590 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.4680 51.7000 -8.0780 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.8310 50.6100 -7.2890 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.2140 50.7840 -6.0030 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.6520 49.6070 -5.1250 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.0530 49.8610 -3.9900 O 0 0 0 0 0 0 0 0 0 0 0 0\n 29.6490 48.4020 -5.5110 O 0 0 0 0 0 0 0 0 0 0 0 0\n 29.2560 52.0620 -5.4730 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.6530 52.2520 -4.1700 O 0 0 0 0 0 0 0 0 0 0 0 0\n 28.8950 53.1630 -6.2280 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 2 0\n 4 3 1 0\n 5 4 2 0\n 6 5 1 0\n 7 6 2 0\n 8 6 1 0\n 9 5 1 0\n 10 9 1 0\n 11 9 2 0\n 11 2 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":153.04,"logp":0.67,"tpsa":83.55,"ha":11,"hacc":3,"hdon":3,"rots":1,"rings":1,"velec":58,"number":0},{"id":37687,"smiles":"Nc1nc2ccc(Cl)cc2s1","cmpd_id":6494,"prot_id":37598,"protein_code":"Mac1-UCSF-P0402A:ZINC000016989831","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-UCSF-P0402_0A_apo_rE1hmGJ.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 11 12 0 0 0 0 0 0 0 0999 V2000\n 30.2080 48.0330 -5.2030 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 27.5650 54.6340 -8.9190 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.0310 53.4490 -8.2360 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.4110 53.4600 -6.9330 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.8300 52.1570 -6.5290 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.2610 51.9330 -5.2170 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.6730 50.6730 -4.8790 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.6570 49.6360 -5.7970 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.2130 49.8510 -7.0990 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.8050 51.1450 -7.4670 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.2430 51.8980 -8.8510 S 0 0 0 0 0 0 0 0 0 0 0 0\n 3 2 1 0\n 4 3 2 0\n 5 4 1 0\n 6 5 2 0\n 7 6 1 0\n 8 1 1 0\n 8 7 2 0\n 9 8 1 0\n 10 9 2 0\n 10 5 1 0\n 11 10 1 0\n 11 3 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":183.99,"logp":2.53,"tpsa":38.91,"ha":11,"hacc":3,"hdon":1,"rots":0,"rings":2,"velec":56,"number":0},{"id":37690,"smiles":"O=c1[nH]ccc2ccccc12","cmpd_id":6497,"prot_id":37601,"protein_code":"Mac1-UCSF-P0412A:ZINC000000332651","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-UCSF-P0412_0A_apo_QPbQBdg.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 11 12 0 0 0 0 0 0 0 0999 V2000\n 29.1990 54.6250 -5.4110 O 0 0 0 0 0 0 0 0 0 0 0 0\n 28.8460 53.9720 -6.3300 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.2880 54.5940 -7.5320 N 0 0 0 0 0 0 0 0 0 0 0 0\n 27.8690 53.7750 -8.6390 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.0020 52.2860 -8.5800 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.5780 51.6370 -7.3270 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.7100 50.2400 -7.2640 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.2440 49.6590 -6.1250 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.6490 50.4520 -5.0460 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.5180 51.8290 -5.1040 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.9810 52.4240 -6.2580 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 2 0\n 3 2 1 0\n 4 3 1 0\n 5 4 2 0\n 6 5 1 0\n 7 6 1 0\n 8 7 2 0\n 9 8 1 0\n 10 9 2 0\n 11 6 2 0\n 11 2 1 0\n 11 10 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":145.05,"logp":1.53,"tpsa":32.86,"ha":11,"hacc":1,"hdon":1,"rots":0,"rings":2,"velec":54,"number":0},{"id":37693,"smiles":"Cc1cc(C)nc(N)n1","cmpd_id":6500,"prot_id":37604,"protein_code":"Mac1-UCSF-P0433A:ZINC000000163774","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-UCSF-P0433_0A_apo_qmmVvqN.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 9 9 0 0 0 0 0 0 0 0999 V2000\n 28.1730 50.2800 -7.8040 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.6050 51.4260 -6.8900 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.6390 52.7530 -7.3140 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.0540 53.7160 -6.4040 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.1470 55.1920 -6.7660 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.3640 53.3540 -5.1820 N 0 0 0 0 0 0 0 0 0 0 0 0\n 29.3070 52.1030 -4.8170 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.6620 51.7160 -3.4670 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.9290 51.1740 -5.6560 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 2 0\n 4 3 1 0\n 5 4 1 0\n 6 4 2 0\n 7 6 1 0\n 8 7 1 0\n 9 2 1 0\n 9 7 2 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":123.08,"logp":0.68,"tpsa":51.8,"ha":9,"hacc":3,"hdon":1,"rots":0,"rings":1,"velec":48,"number":0},{"id":37699,"smiles":"Nc1nc2ccc(F)cc2s1","cmpd_id":6506,"prot_id":37610,"protein_code":"Mac1-UCSF-P0451A:ZINC000017744334","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-UCSF-P0451_0A_apo_xli9m9u.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 11 12 0 0 0 0 0 0 0 0999 V2000\n 27.8750 54.6930 -8.9350 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.2410 53.4730 -8.2660 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.6140 53.4270 -6.9530 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.9070 52.0750 -6.5690 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.3260 51.7340 -5.2740 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.5940 50.4090 -5.0010 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.4100 49.4580 -6.0110 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.0020 49.8020 -7.2780 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.7570 51.1330 -7.5660 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.2490 51.9310 -8.9370 S 0 0 0 0 0 0 0 0 0 0 0 0\n 29.6580 48.1650 -5.7540 F 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 2 0\n 4 3 1 0\n 5 4 2 0\n 6 5 1 0\n 7 6 2 0\n 8 7 1 0\n 9 8 2 0\n 9 4 1 0\n 10 9 1 0\n 10 2 1 0\n 11 7 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":168.02,"logp":2.02,"tpsa":38.91,"ha":11,"hacc":3,"hdon":1,"rots":0,"rings":2,"velec":56,"number":0},{"id":37700,"smiles":"NCCC1CNCN1","cmpd_id":6507,"prot_id":37611,"protein_code":"Mac1-UCSF-P0453A:ZINC388081","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-UCSF-P0453_0A_apo_igrUn9E.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 8 8 0 0 0 0 0 0 0 0999 V2000\n 28.9910 54.7910 -8.8670 N 0 0 0 0 0 0 0 0 0 0 0 0\n 29.4960 53.5960 -8.2140 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.3630 52.6490 -7.8310 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.8910 51.3920 -7.0980 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.1110 50.1610 -7.6540 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.5770 49.3710 -6.7170 N 0 0 0 0 0 0 0 0 0 0 0 0\n 29.6800 50.0670 -5.6010 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.2500 51.3020 -5.8320 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 1 0\n 4 3 1 0\n 5 4 1 0\n 6 5 1 0\n 7 6 1 0\n 8 7 1 0\n 8 4 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":115.11,"logp":-1.15,"tpsa":50.08,"ha":8,"hacc":3,"hdon":3,"rots":2,"rings":1,"velec":48,"number":0},{"id":37702,"smiles":"O=S(=O)(Nc1nncs1)c1ccccc1","cmpd_id":6509,"prot_id":37613,"protein_code":"Mac1-UCSF-P0472A:ZINC000000438614","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-UCSF-P0472_0A_apo_BxpTYWy.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 15 16 0 0 0 0 0 0 0 0999 V2000\n 29.4780 50.6380 -4.8060 O 0 0 0 0 0 0 0 0 0 0 0 0\n 30.3300 49.7720 -5.4740 S 0 0 0 0 0 0 0 0 0 0 0 0\n 30.8040 48.7140 -4.6340 O 0 0 0 0 0 0 0 0 0 0 0 0\n 29.5100 48.9710 -6.7220 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.9070 49.8070 -7.6570 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.5790 49.5220 -8.8950 N 0 0 0 0 0 0 0 0 0 0 0 0\n 27.9950 50.5290 -9.5640 N 0 0 0 0 0 0 0 0 0 0 0 0\n 27.8240 51.6620 -8.9110 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.4340 51.4080 -7.3060 S 0 0 0 0 0 0 0 0 0 0 0 0\n 31.7200 50.6910 -6.1810 C 0 0 0 0 0 0 0 0 0 0 0 0\n 32.8020 49.9820 -6.6110 C 0 0 0 0 0 0 0 0 0 0 0 0\n 33.8810 50.6180 -7.1870 C 0 0 0 0 0 0 0 0 0 0 0 0\n 33.8700 51.9920 -7.2950 C 0 0 0 0 0 0 0 0 0 0 0 0\n 32.7840 52.7080 -6.8410 C 0 0 0 0 0 0 0 0 0 0 0 0\n 31.6850 52.0520 -6.3020 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 2 0\n 3 2 2 0\n 2 4 1 0\n 5 4 1 0\n 6 5 2 0\n 7 6 1 0\n 8 7 2 0\n 9 8 1 0\n 9 5 1 0\n 10 2 1 0\n 11 10 2 0\n 12 11 1 0\n 13 12 2 0\n 14 13 1 0\n 15 10 1 0\n 15 14 2 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":241,"logp":1.34,"tpsa":71.95,"ha":15,"hacc":5,"hdon":1,"rots":3,"rings":2,"velec":78,"number":0},{"id":37704,"smiles":"Cc1noc(CNC(=O)c2cccc(C(=O)O)c2)n1","cmpd_id":6511,"prot_id":37615,"protein_code":"Mac1-UCSF-P0496A:ZINC000045014941","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-UCSF-P0496_0A_apo_qf2ykA5.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 19 20 0 0 0 0 0 0 0 0999 V2000\n 24.5980 57.9290 -7.7270 C 0 0 0 0 0 0 0 0 0 0 0 0\n 26.0040 57.7420 -7.1560 C 0 0 0 0 0 0 0 0 0 0 0 0\n 26.5050 58.2610 -6.0300 N 0 0 0 0 0 0 0 0 0 0 0 0\n 27.8020 57.8400 -5.9470 O 0 0 0 0 0 0 0 0 0 0 0 0\n 28.0310 57.0530 -7.0070 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.3230 56.3440 -7.3490 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.0680 54.9500 -7.6910 N 0 0 0 0 0 0 0 0 0 0 0 0\n 29.1420 53.9320 -6.6700 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.3980 54.2260 -5.5620 O 0 0 0 0 0 0 0 0 0 0 0 0\n 28.9030 52.4650 -7.0410 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.3040 52.1500 -8.2470 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.0990 50.8170 -8.5810 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.4960 49.8130 -7.7130 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.0850 50.1490 -6.5080 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.5560 49.0790 -5.5240 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.6790 47.8990 -5.9010 O 0 0 0 0 0 0 0 0 0 0 0 0\n 29.8430 49.4080 -4.3360 O 0 0 0 0 0 0 0 0 0 0 0 0\n 29.2990 51.4660 -6.1870 C 0 0 0 0 0 0 0 0 0 0 0 0\n 26.9370 57.0040 -7.7330 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 2 0\n 4 3 1 0\n 5 4 1 0\n 6 5 1 0\n 7 6 1 0\n 8 7 1 0\n 9 8 2 0\n 10 8 1 0\n 11 10 2 0\n 12 11 1 0\n 13 12 2 0\n 14 13 1 0\n 15 14 1 0\n 16 15 2 0\n 17 15 1 0\n 18 14 2 0\n 18 10 1 0\n 19 2 1 0\n 19 5 2 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":261.07,"logp":1.01,"tpsa":105.32,"ha":19,"hacc":5,"hdon":2,"rots":4,"rings":2,"velec":98,"number":0},{"id":37706,"smiles":"O=c1[nH]c(=O)c2[nH]cnc2[nH]1","cmpd_id":6513,"prot_id":37617,"protein_code":"Mac1-UCSF-P0510A:ZINC000013517187","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-UCSF-P0510_0A_apo_O9SCn0h.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 11 12 0 0 0 0 0 0 0 0999 V2000\n 28.4150 53.3140 -7.2350 O 0 0 0 0 0 0 0 0 0 0 0 0\n 28.4770 52.1260 -7.2950 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.8470 51.3810 -6.2530 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.9370 50.0820 -6.2740 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.2490 49.4800 -5.3020 O 0 0 0 0 0 0 0 0 0 0 0 0\n 28.6720 49.3870 -7.4690 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.6630 48.0780 -7.8440 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.2830 48.0560 -9.0870 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.0390 49.2560 -9.5280 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.2690 50.1250 -8.5320 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.1840 51.4840 -8.4380 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 2 0\n 3 2 1 0\n 4 3 1 0\n 5 4 2 0\n 6 4 1 0\n 7 6 1 0\n 8 7 1 0\n 9 8 2 0\n 10 9 1 0\n 10 6 2 0\n 11 10 1 0\n 11 2 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":152.03,"logp":-1.06,"tpsa":94.4,"ha":11,"hacc":3,"hdon":3,"rots":0,"rings":2,"velec":56,"number":0},{"id":37711,"smiles":"O=C(NCc1ccccc1)c1cnccn1","cmpd_id":6516,"prot_id":37622,"protein_code":"Mac1-UCSF-P0527A:ZINC000000311783","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-UCSF-P0527_0A_apo_wFHK56O.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 16 17 0 0 0 0 0 0 0 0999 V2000\n 30.0680 49.5360 -4.1860 O 0 0 0 0 0 0 0 0 0 0 0 0\n 29.7060 49.3750 -5.2950 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.8760 48.1040 -5.9280 N 0 0 0 0 0 0 0 0 0 0 0 0\n 30.4290 47.0480 -5.1390 C 0 0 0 0 0 0 0 0 0 0 0 0\n 31.9550 46.9430 -5.1730 C 0 0 0 0 0 0 0 0 0 0 0 0\n 32.7870 48.0040 -5.4530 C 0 0 0 0 0 0 0 0 0 0 0 0\n 34.1650 47.8110 -5.4230 C 0 0 0 0 0 0 0 0 0 0 0 0\n 34.7160 46.5980 -5.1120 C 0 0 0 0 0 0 0 0 0 0 0 0\n 33.8800 45.5420 -4.8250 C 0 0 0 0 0 0 0 0 0 0 0 0\n 32.5130 45.7150 -4.8780 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.1700 50.5140 -6.1720 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.2260 51.8110 -5.7100 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.8210 52.8120 -6.4340 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.3480 52.5790 -7.6490 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.3110 51.2730 -8.1240 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.7140 50.2760 -7.3690 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 2 0\n 3 2 1 0\n 4 3 1 0\n 5 4 1 0\n 6 5 2 0\n 7 6 1 0\n 8 7 2 0\n 9 8 1 0\n 10 5 1 0\n 10 9 2 0\n 11 2 1 0\n 12 11 2 0\n 13 12 1 0\n 14 13 2 0\n 15 14 1 0\n 16 15 2 0\n 16 11 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":213.09,"logp":1.41,"tpsa":54.88,"ha":16,"hacc":3,"hdon":1,"rots":3,"rings":2,"velec":80,"number":0},{"id":37713,"smiles":"Nc1cnc2ccccc2c1","cmpd_id":6518,"prot_id":37624,"protein_code":"Mac1-UCSF-P0555A:ZINC000000039224","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-UCSF-P0555_0A_apo_wW7Q5EQ.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 11 12 0 0 0 0 0 0 0 0999 V2000\n 28.6340 55.5810 -8.6420 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.8330 54.5150 -7.6810 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.3120 54.8040 -6.4030 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.5400 53.8830 -5.5310 N 0 0 0 0 0 0 0 0 0 0 0 0\n 29.2770 52.5990 -5.7670 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.5640 51.6600 -4.7480 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.3290 50.3160 -4.9540 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.8510 49.9020 -6.1990 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.6010 50.8050 -7.1950 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.8040 52.1970 -6.9660 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.5650 53.1800 -7.9810 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 2 0\n 4 3 1 0\n 5 4 2 0\n 6 5 1 0\n 7 6 2 0\n 8 7 1 0\n 9 8 2 0\n 10 9 1 0\n 10 5 1 0\n 11 10 2 0\n 11 2 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":144.07,"logp":1.82,"tpsa":38.91,"ha":11,"hacc":2,"hdon":1,"rots":0,"rings":2,"velec":54,"number":0},{"id":37714,"smiles":"O=c1[nH]cnc2c1oc1ccccc12","cmpd_id":6519,"prot_id":37625,"protein_code":"Mac1-UCSF-P0564A:ZINC000008578948","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-UCSF-P0564_0A_apo_vMw7Vt5.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 14 16 0 0 0 0 0 0 0 0999 V2000\n 29.7040 46.2860 -8.3370 O 0 0 0 0 0 0 0 0 0 0 0 0\n 29.9870 46.7240 -7.2280 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.6190 45.8660 -6.3020 N 0 0 0 0 0 0 0 0 0 0 0 0\n 30.9410 46.2620 -4.9720 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.6530 47.5780 -4.5500 N 0 0 0 0 0 0 0 0 0 0 0 0\n 30.0230 48.5000 -5.5180 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.6410 49.8880 -5.3380 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.7370 50.8380 -4.2870 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.2190 52.0960 -4.5230 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.6590 52.4670 -5.7570 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.5650 51.5250 -6.7770 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.0700 50.2380 -6.5510 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.1450 49.1730 -7.4300 O 0 0 0 0 0 0 0 0 0 0 0 0\n 29.6790 48.1340 -6.7970 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 2 0\n 3 2 1 0\n 4 3 1 0\n 5 4 2 0\n 6 5 1 0\n 7 6 1 0\n 8 7 2 0\n 9 8 1 0\n 10 9 2 0\n 11 10 1 0\n 12 11 2 0\n 12 7 1 0\n 13 12 1 0\n 14 6 2 0\n 14 2 1 0\n 14 13 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":186.04,"logp":1.67,"tpsa":58.89,"ha":14,"hacc":3,"hdon":1,"rots":0,"rings":3,"velec":68,"number":0},{"id":37715,"smiles":"O=c1[nH]cnc2c1oc1ccccc12","cmpd_id":6519,"prot_id":37626,"protein_code":"Mac1-UCSF-P0564_1A:ZINC000008578948","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-UCSF-P0564_1A_apo_cnA0Xkm.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 14 16 0 0 0 0 0 0 0 0999 V2000\n 31.3660 46.2000 -8.0130 O 0 0 0 0 0 0 0 0 0 0 0 0\n 31.9260 45.5290 -7.2130 C 0 0 0 0 0 0 0 0 0 0 0 0\n 31.4970 44.2220 -6.9330 N 0 0 0 0 0 0 0 0 0 0 0 0\n 32.1480 43.4070 -5.9880 C 0 0 0 0 0 0 0 0 0 0 0 0\n 33.3460 43.8810 -5.2950 N 0 0 0 0 0 0 0 0 0 0 0 0\n 33.8180 45.2440 -5.6080 C 0 0 0 0 0 0 0 0 0 0 0 0\n 34.9730 46.0270 -5.1360 C 0 0 0 0 0 0 0 0 0 0 0 0\n 36.0150 45.8200 -4.2480 C 0 0 0 0 0 0 0 0 0 0 0 0\n 36.9490 46.8210 -4.0440 C 0 0 0 0 0 0 0 0 0 0 0 0\n 36.8470 48.0360 -4.7170 C 0 0 0 0 0 0 0 0 0 0 0 0\n 35.8300 48.2480 -5.6150 C 0 0 0 0 0 0 0 0 0 0 0 0\n 34.8810 47.2190 -5.8240 C 0 0 0 0 0 0 0 0 0 0 0 0\n 33.8100 47.2140 -6.6430 O 0 0 0 0 0 0 0 0 0 0 0 0\n 33.1770 46.0320 -6.5470 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 2 0\n 3 2 1 0\n 4 3 1 0\n 5 4 2 0\n 6 5 1 0\n 7 6 1 0\n 8 7 2 0\n 9 8 1 0\n 10 9 2 0\n 11 10 1 0\n 12 11 2 0\n 12 7 1 0\n 13 12 1 0\n 14 2 1 0\n 14 13 1 0\n 14 6 2 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":186.04,"logp":1.67,"tpsa":58.89,"ha":14,"hacc":3,"hdon":1,"rots":0,"rings":3,"velec":68,"number":0},{"id":37716,"smiles":"O=C(O)c1ccc2c(c1)OCO2","cmpd_id":6520,"prot_id":37627,"protein_code":"Mac1-UCSF-P0565A:ZINC000000158540","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-UCSF-P0565_0A_apo_CVil67j.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 12 13 0 0 0 0 0 0 0 0999 V2000\n 28.4940 53.0950 -7.2120 O 0 0 0 0 0 0 0 0 0 0 0 0\n 29.0100 52.9880 -6.0880 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.2770 54.0440 -5.4450 O 0 0 0 0 0 0 0 0 0 0 0 0\n 29.3810 51.5930 -5.5870 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.8450 51.4220 -4.3130 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.2090 50.1600 -3.8780 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.1010 49.0660 -4.7400 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.3900 47.7010 -4.5980 O 0 0 0 0 0 0 0 0 0 0 0 0\n 29.6590 47.0500 -5.5900 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.6470 47.9620 -6.6460 O 0 0 0 0 0 0 0 0 0 0 0 0\n 29.6460 49.2290 -6.0090 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.2650 50.4910 -6.4340 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 2 0\n 4 2 1 0\n 5 4 2 0\n 6 5 1 0\n 7 6 2 0\n 8 7 1 0\n 9 8 1 0\n 10 9 1 0\n 11 10 1 0\n 11 7 1 0\n 12 11 2 0\n 12 4 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":166.03,"logp":1.11,"tpsa":55.76,"ha":12,"hacc":3,"hdon":1,"rots":1,"rings":2,"velec":62,"number":0},{"id":37717,"smiles":"Nc1n[nH]c2ccccc12","cmpd_id":6521,"prot_id":37628,"protein_code":"Mac1-UCSF-P0567A:ZINC000003954002","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-UCSF-P0567_0A_apo_KHcvzUc.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 10 11 0 0 0 0 0 0 0 0999 V2000\n 29.1560 47.3910 -9.4570 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.7230 48.7210 -9.1070 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.0980 49.5560 -9.9090 N 0 0 0 0 0 0 0 0 0 0 0 0\n 27.8750 50.6830 -9.2210 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.3460 50.6070 -7.9640 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.3460 51.5290 -6.8800 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.9250 51.1570 -5.6720 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.5000 49.8890 -5.5370 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.4960 48.9840 -6.5990 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.9130 49.3590 -7.8280 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 2 0\n 4 3 1 0\n 5 4 1 0\n 6 5 2 0\n 7 6 1 0\n 8 7 2 0\n 9 8 1 0\n 10 9 2 0\n 10 2 1 0\n 10 5 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":133.06,"logp":1.15,"tpsa":54.7,"ha":10,"hacc":2,"hdon":2,"rots":0,"rings":2,"velec":50,"number":0},{"id":37718,"smiles":"Cc1ccc(C(N)=O)cn1","cmpd_id":6522,"prot_id":37629,"protein_code":"Mac1-UCSF-P0568A:ZINC000000039575","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-UCSF-P0568_0A_apo_2FtO1YX.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 10 10 0 0 0 0 0 0 0 0999 V2000\n 29.0300 55.9360 -6.9100 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.9990 54.4230 -6.8480 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.5570 53.6700 -7.9250 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.5590 52.2910 -7.8240 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.0050 51.7420 -6.6330 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.4120 52.5770 -5.6070 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.3930 53.8690 -5.7310 N 0 0 0 0 0 0 0 0 0 0 0 0\n 29.0740 50.2660 -6.3730 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.4760 49.9050 -5.3180 O 0 0 0 0 0 0 0 0 0 0 0 0\n 28.7090 49.3130 -7.4010 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 2 0\n 4 3 1 0\n 5 4 2 0\n 6 5 1 0\n 7 6 2 0\n 7 2 1 0\n 8 5 1 0\n 9 8 2 0\n 10 8 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":136.06,"logp":0.49,"tpsa":55.98,"ha":10,"hacc":2,"hdon":1,"rots":1,"rings":1,"velec":52,"number":0},{"id":37721,"smiles":"Cc1[nH]c2ccccc2c(=O)c1O","cmpd_id":6524,"prot_id":37632,"protein_code":"Mac1-UCSF-P0572A:ZINC000016343276","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-UCSF-P0572_0A_apo_UY6JEx8.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 13 14 0 0 0 0 0 0 0 0999 V2000\n 28.1570 56.2600 -8.8100 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.4120 54.9940 -8.0130 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.9870 53.7210 -8.5610 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.2290 52.4530 -7.8000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.8140 51.2510 -8.3780 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.0240 50.0540 -7.6880 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.6520 50.0680 -6.4150 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.0750 51.2660 -5.8400 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.8560 52.4750 -6.5290 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.3160 53.8030 -5.9270 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.8360 53.8170 -4.8620 O 0 0 0 0 0 0 0 0 0 0 0 0\n 29.0750 55.0430 -6.6920 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.4690 56.2800 -6.1790 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 1 0\n 4 3 1 0\n 5 4 2 0\n 6 5 1 0\n 7 6 2 0\n 8 7 1 0\n 9 8 2 0\n 9 4 1 0\n 10 9 1 0\n 11 10 2 0\n 12 10 1 0\n 12 2 2 0\n 13 12 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":175.06,"logp":1.54,"tpsa":53.09,"ha":13,"hacc":2,"hdon":2,"rots":0,"rings":2,"velec":66,"number":0},{"id":37722,"smiles":"Nc1nc2[nH]c(=O)cnc2c(=O)[nH]1","cmpd_id":6525,"prot_id":37633,"protein_code":"Mac1-UCSF-P0576A:ZINC000014419577","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-UCSF-P0576_0A_apo_s3tbaGt.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 13 14 0 0 0 0 0 0 0 0999 V2000\n 28.4300 47.5620 -10.4160 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.5940 48.3700 -9.2420 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.4100 49.6740 -9.3860 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.5580 50.4930 -8.3130 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.3620 51.8250 -8.4120 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.5040 52.5990 -7.3470 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.3410 53.7640 -7.4610 O 0 0 0 0 0 0 0 0 0 0 0 0\n 28.8560 52.0440 -6.1180 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.0290 50.7420 -6.0170 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.8900 49.9370 -7.1130 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.0860 48.5240 -7.0140 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.3990 48.0030 -5.9930 O 0 0 0 0 0 0 0 0 0 0 0 0\n 28.9310 47.7890 -8.0950 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 2 0\n 4 3 1 0\n 5 4 1 0\n 6 5 1 0\n 7 6 2 0\n 8 6 1 0\n 9 8 2 0\n 10 9 1 0\n 10 4 2 0\n 11 10 1 0\n 12 11 2 0\n 13 11 1 0\n 13 2 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":179.04,"logp":-1.41,"tpsa":117.52,"ha":13,"hacc":5,"hdon":3,"rots":0,"rings":2,"velec":66,"number":0},{"id":37724,"smiles":"c1nc(N2CCC[C@@H]2C2CCC2)c2cc[nH]c2n1","cmpd_id":6527,"prot_id":37635,"protein_code":"Mac1-UCSF-P0584A:ZINC000263980802","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-UCSF-P0584_0A_apo_4d8yVuE.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 18 21 0 0 0 0 0 0 0 0999 V2000\n 33.4170 45.4900 -7.0680 C 0 0 0 0 0 0 0 0 0 0 0 0\n 32.7550 46.7500 -6.5290 C 0 0 0 0 0 0 0 0 0 0 0 0\n 31.4090 46.1090 -6.7840 C 0 0 0 0 0 0 0 0 0 0 0 0\n 32.1200 44.7770 -6.7390 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.1840 46.4790 -5.8750 C 0 0 1 0 0 0 0 0 0 0 0 0\n 30.5030 46.2880 -4.2590 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.4680 47.4810 -3.6940 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.0160 48.5490 -4.7590 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.7970 47.7180 -6.0400 N 0 0 0 0 0 0 0 0 0 0 0 0\n 29.1440 48.2130 -7.1540 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.9170 47.4140 -8.1050 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.3070 47.7980 -9.2020 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.8920 49.0120 -9.4000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.1400 49.9050 -8.4510 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.8760 51.2310 -8.3900 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.2110 51.7480 -7.2270 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.8170 50.7380 -6.4880 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.7510 49.5650 -7.2830 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 1 0\n 4 3 1 0\n 4 1 1 0\n 5 3 1 6\n 5 6 1 0\n 7 6 1 0\n 8 7 1 0\n 9 5 1 0\n 9 8 1 0\n 10 9 1 0\n 11 10 2 0\n 12 11 1 0\n 13 12 2 0\n 14 13 1 0\n 15 14 1 0\n 16 15 1 0\n 17 16 2 0\n 18 10 1 0\n 18 17 1 0\n 18 14 2 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":242.15,"logp":2.73,"tpsa":44.81,"ha":18,"hacc":3,"hdon":1,"rots":2,"rings":4,"velec":94,"number":0},{"id":37726,"smiles":"Nc1ncn(C[C@H]2CCCO2)c2ncnc1-2","cmpd_id":6529,"prot_id":37637,"protein_code":"Mac1-UCSF-P0588A:ZINC000082473428_N3","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-UCSF-P0588_0A_apo_Fg44fS1.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 16 18 0 0 0 0 0 0 0 0999 V2000\n 27.9820 51.8440 -7.8740 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.5130 50.6410 -7.3100 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.4470 49.4120 -8.0650 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.9550 49.1280 -9.3220 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.2260 47.8430 -9.4950 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.7950 47.3340 -8.4230 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.9390 48.3330 -7.5460 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.4620 48.3290 -6.2960 N 0 0 0 0 0 0 0 0 0 0 0 0\n 30.0250 47.0760 -5.6450 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.9410 46.2670 -4.9790 C 0 0 2 0 0 0 0 0 0 0 0 0\n 28.5440 47.0470 -3.6810 O 0 0 0 0 0 0 0 0 0 0 0 0\n 28.0210 46.2010 -2.8080 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.2910 44.7850 -3.3560 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.2630 45.0270 -4.4740 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.4690 49.4680 -5.6340 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.0030 50.6290 -6.1370 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 2 0\n 4 3 1 0\n 5 4 2 0\n 6 5 1 0\n 7 6 2 0\n 7 3 1 0\n 8 7 1 0\n 9 8 1 0\n 10 9 1 1\n 11 10 1 0\n 12 11 1 0\n 13 12 1 0\n 14 13 1 0\n 14 10 1 0\n 15 8 1 0\n 16 15 2 0\n 16 2 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":219.11,"logp":0.54,"tpsa":78.85,"ha":16,"hacc":6,"hdon":1,"rots":2,"rings":3,"velec":84,"number":0},{"id":37727,"smiles":"Nc1ncn(C[C@H]2CCCO2)c2ncnc1-2","cmpd_id":6529,"prot_id":37638,"protein_code":"Mac1-UCSF-P0588_1A:ZINC000082473428_N3","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-UCSF-P0588_1A_apo_JYBhib9.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 16 18 0 0 0 0 0 0 0 0999 V2000\n 27.9440 51.8970 -7.8820 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.4970 50.6710 -7.3160 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.4610 49.4210 -8.0860 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.9780 49.1070 -9.3440 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.2050 47.7920 -9.5620 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.7970 47.3020 -8.5000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.9540 48.3420 -7.5710 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.5080 48.3870 -6.3020 N 0 0 0 0 0 0 0 0 0 0 0 0\n 30.0800 47.1470 -5.6990 C 0 0 0 0 0 0 0 0 0 0 0 0\n 31.5470 47.1560 -5.8430 C 0 0 2 0 0 0 0 0 0 0 0 0\n 31.9250 47.5130 -7.3270 O 0 0 0 0 0 0 0 0 0 0 0 0\n 32.6040 46.5200 -7.8200 C 0 0 0 0 0 0 0 0 0 0 0 0\n 32.2960 45.3110 -6.8990 C 0 0 0 0 0 0 0 0 0 0 0 0\n 32.0330 45.9250 -5.5780 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.5430 49.5280 -5.5930 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.0270 50.6810 -6.1210 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 2 0\n 4 3 1 0\n 5 4 2 0\n 6 5 1 0\n 7 6 2 0\n 7 3 1 0\n 8 7 1 0\n 9 8 1 0\n 10 9 1 6\n 11 10 1 0\n 12 11 1 0\n 13 12 1 0\n 14 13 1 0\n 14 10 1 0\n 15 8 1 0\n 16 15 2 0\n 16 2 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":219.11,"logp":0.54,"tpsa":78.85,"ha":16,"hacc":6,"hdon":1,"rots":2,"rings":3,"velec":84,"number":0},{"id":37728,"smiles":"NC1NCN(CCC[C@H]2CCOC2)C2NCNC12.Nc1ncn(CCC[C@H]2CCOC2)c2ncnc1-2","cmpd_id":6621,"prot_id":37639,"protein_code":"Mac1-UCSF-P0590A:ZINC000400552187_N3","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-UCSF-P0590_0A_apo_X4FanbW.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 36 40 0 0 0 0 0 0 0 0999 V2000\n 27.8250 52.0780 -7.9200 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.3920 50.8740 -7.3520 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.4320 49.6640 -8.0510 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.0230 49.2920 -9.2750 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.3210 48.0000 -9.4260 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.8930 47.5550 -8.3120 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.9650 48.6050 -7.4710 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.4530 48.6830 -6.2070 N 0 0 0 0 0 0 0 0 0 0 0 0\n 30.0230 47.4700 -5.5920 C 0 0 0 0 0 0 0 0 0 0 0 0\n 31.5220 47.6250 -5.3280 C 0 0 0 0 0 0 0 0 0 0 0 0\n 32.1370 46.2660 -4.9050 C 0 0 0 0 0 0 0 0 0 0 0 0\n 33.1360 45.5860 -5.9440 C 0 0 2 0 0 0 0 0 0 0 0 0\n 32.8020 45.7660 -7.2450 C 0 0 0 0 0 0 0 0 0 0 0 0\n 31.9930 44.4500 -7.7600 O 0 0 0 0 0 0 0 0 0 0 0 0\n 32.0670 43.5310 -6.8920 C 0 0 0 0 0 0 0 0 0 0 0 0\n 33.1510 44.0730 -5.8400 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.4230 49.8340 -5.5370 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.8800 50.9160 -6.1210 N 0 0 0 0 0 0 0 0 0 0 0 0\n 8.0340 52.6550 12.0090 N 0 0 0 0 0 0 0 0 0 0 0 0\n 7.7110 51.2340 12.1260 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4310 50.8160 12.4780 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3060 51.5290 12.7290 N 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3500 50.6370 13.0060 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8530 49.3980 12.9130 N 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1510 49.5210 12.5860 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1190 48.6070 12.3370 N 0 0 0 0 0 0 0 0 0 0 0 0\n 6.8650 47.1690 12.4710 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0560 46.6030 11.3170 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.9360 45.0630 11.4480 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9500 44.3830 10.3870 C 0 0 2 0 0 0 0 0 0 0 0 0\n 3.6580 44.5880 10.7110 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8830 43.2680 10.1920 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6800 42.2630 10.3810 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.1260 42.8750 10.3790 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.3570 49.0020 12.0190 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6620 50.3160 11.8910 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 2 0\n 4 3 1 0\n 5 4 2 0\n 6 5 1 0\n 7 6 2 0\n 7 3 1 0\n 8 7 1 0\n 9 8 1 0\n 10 9 1 0\n 11 10 1 0\n 12 11 1 1\n 13 12 1 0\n 14 13 1 0\n 15 14 1 0\n 16 15 1 0\n 16 12 1 0\n 17 8 1 0\n 18 17 2 0\n 18 2 1 0\n 20 19 1 0\n 21 20 1 0\n 22 21 1 0\n 23 22 1 0\n 24 23 1 0\n 25 24 1 0\n 25 21 1 0\n 26 25 1 0\n 27 26 1 0\n 28 27 1 0\n 29 28 1 0\n 30 29 1 1\n 31 30 1 0\n 32 31 1 0\n 33 32 1 0\n 34 33 1 0\n 34 30 1 0\n 35 26 1 0\n 36 35 1 0\n 36 20 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":255.21,"logp":-1.2,"tpsa":74.58,"ha":18,"hacc":6,"hdon":4,"rots":4,"rings":3,"velec":104,"number":0},{"id":37729,"smiles":"COc1cc(Cn2cnc3c(N)ncnc32)on1","cmpd_id":6622,"prot_id":37640,"protein_code":"Mac1-UCSF-P1444A:ZINC000901381520","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-UCSF-P1444_0A_apo_mzO1iXC.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 18 20 0 0 0 0 0 0 0 0999 V2000\n 34.2110 43.3000 -6.3620 C 0 0 0 0 0 0 0 0 0 0 0 0\n 33.6650 43.9630 -7.4530 O 0 0 0 0 0 0 0 0 0 0 0 0\n 32.8130 45.0510 -7.1620 C 0 0 0 0 0 0 0 0 0 0 0 0\n 31.7370 45.1070 -6.2400 C 0 0 0 0 0 0 0 0 0 0 0 0\n 31.2030 46.3500 -6.3020 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.9910 46.9020 -5.5410 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.5160 48.1830 -6.0500 N 0 0 0 0 0 0 0 0 0 0 0 0\n 29.5800 49.3130 -5.3850 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.0990 50.2950 -6.1040 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.7160 49.7430 -7.2660 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.1270 50.2570 -8.4500 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.8220 51.6660 -8.5390 N 0 0 0 0 0 0 0 0 0 0 0 0\n 27.8550 49.4340 -9.3960 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.1240 48.1780 -9.3240 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.6920 47.6340 -8.2720 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.9960 48.4360 -7.2400 C 0 0 0 0 0 0 0 0 0 0 0 0\n 31.8360 46.9320 -7.2170 O 0 0 0 0 0 0 0 0 0 0 0 0\n 32.8340 46.2510 -7.7620 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 1 0\n 4 3 1 0\n 5 4 2 0\n 6 5 1 0\n 7 6 1 0\n 8 7 1 0\n 9 8 2 0\n 10 9 1 0\n 11 10 2 0\n 12 11 1 0\n 13 11 1 0\n 14 13 2 0\n 15 14 1 0\n 16 15 2 0\n 16 7 1 0\n 16 10 1 0\n 17 5 1 0\n 18 17 1 0\n 18 3 2 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":246.09,"logp":0.45,"tpsa":104.88,"ha":18,"hacc":8,"hdon":1,"rots":3,"rings":3,"velec":92,"number":0},{"id":37730,"smiles":"COc1cc(Cn2cnc3c(N)ncnc32)on1","cmpd_id":6622,"prot_id":37641,"protein_code":"Mac1-UCSF-P1444_1A:ZINC000901381520","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-UCSF-P1444_1A_apo_2Gp3ZUd.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 18 20 0 0 0 0 0 0 0 0999 V2000\n 35.0680 45.9930 -4.9200 C 0 0 0 0 0 0 0 0 0 0 0 0\n 34.8470 46.4940 -6.2060 O 0 0 0 0 0 0 0 0 0 0 0 0\n 33.4970 46.5900 -6.4450 C 0 0 0 0 0 0 0 0 0 0 0 0\n 32.5270 46.6810 -5.4520 C 0 0 0 0 0 0 0 0 0 0 0 0\n 31.3610 46.7160 -6.0980 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.9550 46.8920 -5.5610 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.4980 48.1830 -6.0440 N 0 0 0 0 0 0 0 0 0 0 0 0\n 29.5760 49.3120 -5.3810 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.0980 50.2950 -6.1020 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.7140 49.7460 -7.2650 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.1300 50.2590 -8.4520 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.8300 51.6680 -8.5420 N 0 0 0 0 0 0 0 0 0 0 0 0\n 27.8570 49.4370 -9.3970 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.1210 48.1800 -9.3230 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.6860 47.6360 -8.2680 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.9890 48.4390 -7.2370 C 0 0 0 0 0 0 0 0 0 0 0 0\n 31.6500 46.6760 -7.3190 O 0 0 0 0 0 0 0 0 0 0 0 0\n 32.9010 46.5120 -7.6350 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 1 0\n 4 3 1 0\n 5 4 2 0\n 6 5 1 0\n 7 6 1 0\n 8 7 1 0\n 9 8 2 0\n 10 9 1 0\n 11 10 2 0\n 12 11 1 0\n 13 11 1 0\n 14 13 2 0\n 15 14 1 0\n 16 15 2 0\n 16 7 1 0\n 16 10 1 0\n 17 5 1 0\n 18 17 1 0\n 18 3 2 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":246.09,"logp":0.45,"tpsa":104.88,"ha":18,"hacc":8,"hdon":1,"rots":3,"rings":3,"velec":92,"number":0},{"id":37731,"smiles":"O=C(O)c1cnc2ccccc2c1","cmpd_id":6531,"prot_id":37642,"protein_code":"Mac1-UCSF-P1493A:ZINC000000265642","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-UCSF-P1493_0A_apo_GVfh1Hf.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 13 14 0 0 0 0 0 0 0 0999 V2000\n 29.4370 47.9610 -6.9610 O 0 0 0 0 0 0 0 0 0 0 0 0\n 29.6010 48.6980 -5.9450 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.1020 48.1740 -4.9320 O 0 0 0 0 0 0 0 0 0 0 0 0\n 29.4100 50.2180 -6.0300 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.9260 51.1140 -5.0670 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.8340 52.4330 -5.2180 N 0 0 0 0 0 0 0 0 0 0 0 0\n 29.2110 52.9600 -6.2870 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.1330 54.3510 -6.4260 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.5170 54.9010 -7.5390 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.9540 54.0790 -8.4970 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.0440 52.7030 -8.3940 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.6730 52.1350 -7.2460 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.7830 50.7370 -7.1310 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 2 0\n 4 2 1 0\n 5 4 2 0\n 6 5 1 0\n 7 6 2 0\n 8 7 1 0\n 9 8 2 0\n 10 9 1 0\n 11 10 2 0\n 12 11 1 0\n 12 7 1 0\n 13 12 2 0\n 13 4 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":173.05,"logp":1.93,"tpsa":50.19,"ha":13,"hacc":2,"hdon":1,"rots":1,"rings":2,"velec":64,"number":0},{"id":37732,"smiles":"O=c1[nH]c2cc(Cl)ccc2o1","cmpd_id":6532,"prot_id":37643,"protein_code":"Mac1-UCSF-P1494A:ZINC000084843283","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-UCSF-P1494_0A_apo_khMy6QH.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 11 12 0 0 0 0 0 0 0 0999 V2000\n 30.9170 47.7040 -4.2400 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 30.2150 49.1180 -4.8700 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.1040 50.1660 -4.0290 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.5280 51.3430 -4.4460 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.0320 51.3870 -5.7260 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.3940 52.4340 -6.5040 O 0 0 0 0 0 0 0 0 0 0 0 0\n 28.1280 51.9050 -7.8270 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.6080 52.4300 -8.7910 O 0 0 0 0 0 0 0 0 0 0 0 0\n 28.5920 50.5610 -7.8200 N 0 0 0 0 0 0 0 0 0 0 0 0\n 29.1520 50.2490 -6.5540 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.7650 49.0910 -6.1490 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 2 0\n 4 3 1 0\n 5 4 2 0\n 6 5 1 0\n 7 6 1 0\n 8 7 2 0\n 9 7 1 0\n 10 9 1 0\n 10 5 1 0\n 11 10 2 0\n 11 2 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":168.99,"logp":1.77,"tpsa":46,"ha":11,"hacc":2,"hdon":1,"rots":0,"rings":2,"velec":56,"number":0}],"238507":[{"id":37493,"smiles":"Cc1cccc(C(=O)NCC(=O)O)c1","cmpd_id":3948,"prot_id":37404,"protein_code":"Mac1-DLS-X0253A:Z56827661","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-X0253_0A_apo_kx9lOdP.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 14 14 0 0 0 0 0 0 0 0999 V2000\n 31.1730 45.6160 -8.3280 O 0 0 0 0 0 0 0 0 0 0 0 0\n 32.1720 45.6570 -7.6170 C 0 0 0 0 0 0 0 0 0 0 0 0\n 33.1960 46.4340 -7.8950 O 0 0 0 0 0 0 0 0 0 0 0 0\n 32.2960 44.8680 -6.3300 C 0 0 0 0 0 0 0 0 0 0 0 0\n 33.5210 45.1070 -5.5930 N 0 0 0 0 0 0 0 0 0 0 0 0\n 34.1240 44.1320 -4.9040 C 0 0 0 0 0 0 0 0 0 0 0 0\n 33.6320 43.0220 -4.7350 O 0 0 0 0 0 0 0 0 0 0 0 0\n 35.4310 44.4660 -4.2780 C 0 0 0 0 0 0 0 0 0 0 0 0\n 35.9210 43.6580 -3.2600 C 0 0 0 0 0 0 0 0 0 0 0 0\n 37.0700 44.0250 -2.5790 C 0 0 0 0 0 0 0 0 0 0 0 0\n 37.7390 45.1870 -2.9350 C 0 0 0 0 0 0 0 0 0 0 0 0\n 36.1240 45.6160 -4.6370 C 0 0 0 0 0 0 0 0 0 0 0 0\n 37.2760 45.9970 -3.9670 C 0 0 0 0 0 0 0 0 0 0 0 0\n 37.9700 47.2890 -4.3090 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 2 0\n 3 2 1 0\n 4 2 1 0\n 5 4 1 0\n 6 5 1 0\n 7 6 2 0\n 8 6 1 0\n 9 8 2 0\n 10 9 1 0\n 11 10 2 0\n 12 8 1 0\n 13 12 2 0\n 13 11 1 0\n 14 13 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":193.07,"logp":0.81,"tpsa":66.4,"ha":14,"hacc":2,"hdon":2,"rots":3,"rings":1,"velec":74,"number":253},{"id":37507,"smiles":"C[C@@H](Oc1ccccc1F)C(=O)O","cmpd_id":3952,"prot_id":37418,"protein_code":"Mac1-DLS-X0465A:Z65532537","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-X0465_0A_apo_tEN0CSb.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 13 13 0 0 0 0 0 0 0 0999 V2000\n 31.2510 45.7480 -8.1520 O 0 0 0 0 0 0 0 0 0 0 0 0\n 32.3460 45.7200 -7.5970 C 0 0 0 0 0 0 0 0 0 0 0 0\n 33.4690 46.0580 -8.1790 O 0 0 0 0 0 0 0 0 0 0 0 0\n 32.4840 45.2560 -6.1530 C 0 0 1 0 0 0 0 0 0 0 0 0\n 31.8640 43.8830 -6.0250 C 0 0 0 0 0 0 0 0 0 0 0 0\n 33.8490 45.1440 -5.7330 O 0 0 0 0 0 0 0 0 0 0 0 0\n 34.5660 46.3020 -5.4680 C 0 0 0 0 0 0 0 0 0 0 0 0\n 35.9110 46.1350 -5.1760 C 0 0 0 0 0 0 0 0 0 0 0 0\n 36.4130 44.8880 -5.1370 F 0 0 0 0 0 0 0 0 0 0 0 0\n 36.7390 47.1990 -4.9010 C 0 0 0 0 0 0 0 0 0 0 0 0\n 36.2050 48.4770 -4.9290 C 0 0 0 0 0 0 0 0 0 0 0 0\n 34.8750 48.6740 -5.2290 C 0 0 0 0 0 0 0 0 0 0 0 0\n 34.0450 47.5930 -5.4920 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 2 0\n 3 2 1 0\n 4 2 1 0\n 4 5 1 6\n 6 4 1 0\n 7 6 1 0\n 8 7 2 0\n 9 8 1 0\n 10 8 1 0\n 11 10 2 0\n 12 11 1 0\n 13 7 1 0\n 13 12 2 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":184.05,"logp":1.68,"tpsa":46.53,"ha":13,"hacc":2,"hdon":1,"rots":3,"rings":1,"velec":70,"number":465},{"id":37522,"smiles":"Cc1nc(C)n(CCC(=O)O)n1","cmpd_id":3957,"prot_id":37433,"protein_code":"Mac1-DLS-X0628A:Z274553586","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-X0628_0A_apo_Bf8kIem.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 12 12 0 0 0 0 0 0 0 0999 V2000\n 33.2610 46.1450 -8.1090 O 0 0 0 0 0 0 0 0 0 0 0 0\n 32.2540 45.5360 -7.7990 C 0 0 0 0 0 0 0 0 0 0 0 0\n 31.1190 45.7120 -8.3910 O 0 0 0 0 0 0 0 0 0 0 0 0\n 32.1750 44.5390 -6.6790 C 0 0 0 0 0 0 0 0 0 0 0 0\n 32.2490 45.2050 -5.3160 C 0 0 0 0 0 0 0 0 0 0 0 0\n 33.4700 45.9960 -5.1680 N 0 0 0 0 0 0 0 0 0 0 0 0\n 33.6940 47.3020 -5.3710 C 0 0 0 0 0 0 0 0 0 0 0 0\n 32.6210 48.2860 -5.6690 C 0 0 0 0 0 0 0 0 0 0 0 0\n 34.9690 47.5840 -5.2430 N 0 0 0 0 0 0 0 0 0 0 0 0\n 34.6420 45.3600 -4.8600 N 0 0 0 0 0 0 0 0 0 0 0 0\n 35.4990 46.3590 -4.9150 C 0 0 0 0 0 0 0 0 0 0 0 0\n 36.9410 46.1820 -4.6000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 2 0\n 3 2 1 0\n 4 2 1 0\n 5 4 1 0\n 6 5 1 0\n 7 6 1 0\n 8 7 1 0\n 9 7 2 0\n 10 6 1 0\n 11 10 2 0\n 11 9 1 0\n 12 11 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":169.09,"logp":0.37,"tpsa":68.01,"ha":12,"hacc":4,"hdon":1,"rots":3,"rings":1,"velec":66,"number":628},{"id":37529,"smiles":"OS(O)(O)CCNC1CCCCC1","cmpd_id":5066,"prot_id":37440,"protein_code":"Mac1-DLS-X0685_1A:CHES","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-X0685_1A_apo_jAKFvnd.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 13 13 0 0 0 0 0 0 0 0999 V2000\n 30.7330 46.4950 -7.9750 O 0 0 0 0 0 0 0 0 0 0 0 0\n 32.0340 45.9200 -7.6600 S 0 0 0 0 0 0 0 0 0 0 0 0\n 33.1760 46.5280 -8.2850 O 0 0 0 0 0 0 0 0 0 0 0 0\n 31.9900 44.4600 -7.9080 O 0 0 0 0 0 0 0 0 0 0 0 0\n 32.2820 46.0950 -5.9140 C 0 0 0 0 0 0 0 0 0 0 0 0\n 33.0710 47.3510 -5.5530 C 0 0 0 0 0 0 0 0 0 0 0 0\n 34.5110 47.2060 -5.8040 N 0 0 0 0 0 0 0 0 0 0 0 0\n 35.2610 46.2090 -5.0140 C 0 0 0 0 0 0 0 0 0 0 0 0\n 36.6650 46.0080 -5.5740 C 0 0 0 0 0 0 0 0 0 0 0 0\n 37.4920 45.0850 -4.6850 C 0 0 0 0 0 0 0 0 0 0 0 0\n 37.5540 45.5950 -3.2530 C 0 0 0 0 0 0 0 0 0 0 0 0\n 36.1590 45.7970 -2.7010 C 0 0 0 0 0 0 0 0 0 0 0 0\n 35.3350 46.7280 -3.5910 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 1 0\n 4 2 1 0\n 5 2 1 0\n 6 5 1 0\n 7 6 1 0\n 8 7 1 0\n 9 8 1 0\n 10 9 1 0\n 11 10 1 0\n 12 11 1 0\n 13 12 1 0\n 13 8 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":209.11,"logp":2.13,"tpsa":72.72,"ha":13,"hacc":4,"hdon":4,"rots":4,"rings":1,"velec":80,"number":685},{"id":37534,"smiles":"C[C@H](NC(=O)C1CCCC1)C(=O)O","cmpd_id":3960,"prot_id":37445,"protein_code":"Mac1-DLS-X0727A:Z1238477790","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-X0727_0A_apo_egvveNs.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 13 13 0 0 0 0 0 0 0 0999 V2000\n 33.4560 46.4330 -8.0420 O 0 0 0 0 0 0 0 0 0 0 0 0\n 32.6060 45.7160 -7.5700 C 0 0 0 0 0 0 0 0 0 0 0 0\n 31.4400 45.5150 -8.1540 O 0 0 0 0 0 0 0 0 0 0 0 0\n 32.8100 44.9740 -6.2500 C 0 0 2 0 0 0 0 0 0 0 0 0\n 31.6530 45.2510 -5.2970 C 0 0 0 0 0 0 0 0 0 0 0 0\n 34.0900 45.3070 -5.6280 N 0 0 0 0 0 0 0 0 0 0 0 0\n 34.7380 44.5030 -4.7600 C 0 0 0 0 0 0 0 0 0 0 0 0\n 34.2180 43.4920 -4.2650 O 0 0 0 0 0 0 0 0 0 0 0 0\n 36.1930 44.8940 -4.4320 C 0 0 0 0 0 0 0 0 0 0 0 0\n 36.9980 45.5250 -5.5980 C 0 0 0 0 0 0 0 0 0 0 0 0\n 37.1000 46.9960 -5.2590 C 0 0 0 0 0 0 0 0 0 0 0 0\n 37.1030 47.0770 -3.7960 C 0 0 0 0 0 0 0 0 0 0 0 0\n 36.3260 45.8810 -3.2530 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 2 0\n 3 2 1 0\n 4 2 1 0\n 4 5 1 1\n 6 4 1 0\n 7 6 1 0\n 8 7 2 0\n 9 7 1 0\n 10 9 1 0\n 11 10 1 0\n 12 11 1 0\n 13 12 1 0\n 13 9 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":185.11,"logp":0.77,"tpsa":66.4,"ha":13,"hacc":2,"hdon":2,"rots":3,"rings":1,"velec":74,"number":727},{"id":37552,"smiles":"O=C(O)Cn1cc(Br)cn1","cmpd_id":3975,"prot_id":37463,"protein_code":"Mac1-DLS-X0855A:NCL-00024890","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-X0855_0A_apo_Ct1wMP8.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 10 10 0 0 0 0 0 0 0 0999 V2000\n 33.4580 45.8560 -8.1150 O 0 0 0 0 0 0 0 0 0 0 0 0\n 32.4590 45.5170 -7.5070 C 0 0 0 0 0 0 0 0 0 0 0 0\n 31.2930 45.3960 -8.0710 O 0 0 0 0 0 0 0 0 0 0 0 0\n 32.4830 45.2590 -6.0160 C 0 0 0 0 0 0 0 0 0 0 0 0\n 33.5190 46.1590 -5.5390 N 0 0 0 0 0 0 0 0 0 0 0 0\n 34.8000 45.8590 -5.2820 C 0 0 0 0 0 0 0 0 0 0 0 0\n 33.2600 47.4850 -5.3880 N 0 0 0 0 0 0 0 0 0 0 0 0\n 34.4380 48.0240 -5.1040 C 0 0 0 0 0 0 0 0 0 0 0 0\n 35.4230 47.0450 -5.0260 C 0 0 0 0 0 0 0 0 0 0 0 0\n 37.2550 47.2850 -4.6450 Br 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 2 0\n 4 2 1 0\n 5 4 1 0\n 6 5 1 0\n 7 5 1 0\n 8 7 2 0\n 9 8 1 0\n 9 6 2 0\n 10 9 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":203.95,"logp":0.73,"tpsa":55.12,"ha":10,"hacc":3,"hdon":1,"rots":2,"rings":1,"velec":54,"number":855},{"id":37553,"smiles":"O=C(O)Cn1ccc(Br)cc1=O","cmpd_id":3976,"prot_id":37464,"protein_code":"Mac1-DLS-X0864A:NCL-00024773","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-X0864_0A_apo_L8UgeMg.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 12 12 0 0 0 0 0 0 0 0999 V2000\n 37.8710 47.1360 -4.4300 Br 0 0 0 0 0 0 0 0 0 0 0 0\n 36.0960 46.6550 -4.7690 C 0 0 0 0 0 0 0 0 0 0 0 0\n 35.7330 45.3650 -4.6140 C 0 0 0 0 0 0 0 0 0 0 0 0\n 34.4300 44.9660 -4.9540 C 0 0 0 0 0 0 0 0 0 0 0 0\n 33.9880 43.8470 -4.7110 O 0 0 0 0 0 0 0 0 0 0 0 0\n 35.2030 47.6600 -5.2270 C 0 0 0 0 0 0 0 0 0 0 0 0\n 33.9710 47.2500 -5.5580 C 0 0 0 0 0 0 0 0 0 0 0 0\n 33.6020 45.9360 -5.4890 N 0 0 0 0 0 0 0 0 0 0 0 0\n 32.3080 45.5320 -6.0190 C 0 0 0 0 0 0 0 0 0 0 0 0\n 32.2560 45.7180 -7.5180 C 0 0 0 0 0 0 0 0 0 0 0 0\n 31.2280 45.5810 -8.1310 O 0 0 0 0 0 0 0 0 0 0 0 0\n 33.3800 46.0340 -8.1040 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 2 0\n 4 3 1 0\n 5 4 2 0\n 6 2 1 0\n 7 6 2 0\n 8 7 1 0\n 8 4 1 0\n 9 8 1 0\n 10 9 1 0\n 11 10 1 0\n 12 10 2 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":230.95,"logp":0.7,"tpsa":59.3,"ha":12,"hacc":3,"hdon":1,"rots":2,"rings":1,"velec":64,"number":864},{"id":37574,"smiles":"C[C@@H](O)C(=O)O","cmpd_id":4029,"prot_id":37485,"protein_code":"Mac1-DLS-X0950A:Z1741982441","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-X0950_0A_apo_N7VbkiQ.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 6 5 0 0 0 0 0 0 0 0999 V2000\n 33.3810 46.1080 -7.9780 O 0 0 0 0 0 0 0 0 0 0 0 0\n 32.2920 45.6500 -7.6790 C 0 0 0 0 0 0 0 0 0 0 0 0\n 31.1970 45.8650 -8.3480 O 0 0 0 0 0 0 0 0 0 0 0 0\n 32.0830 44.7330 -6.4920 C 0 0 2 0 0 0 0 0 0 0 0 0\n 33.1170 44.9460 -5.5420 O 0 0 0 0 0 0 0 0 0 0 0 0\n 32.0820 43.2940 -6.9540 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 2 0\n 3 2 1 0\n 4 2 1 0\n 5 4 1 0\n 4 6 1 6\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":90.03,"logp":-0.55,"tpsa":57.53,"ha":6,"hacc":2,"hdon":2,"rots":1,"rings":0,"velec":36,"number":950},{"id":37575,"smiles":"C[C@H](O)C(=O)O","cmpd_id":3983,"prot_id":37486,"protein_code":"Mac1-DLS-X0950_1A:Z1741982441","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-X0950_1A_apo_QWLFQ7b.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 6 5 0 0 0 0 0 0 0 0999 V2000\n 33.1670 46.4350 -8.0580 O 0 0 0 0 0 0 0 0 0 0 0 0\n 32.3140 45.6510 -7.6970 C 0 0 0 0 0 0 0 0 0 0 0 0\n 31.1740 45.4810 -8.3190 O 0 0 0 0 0 0 0 0 0 0 0 0\n 32.5390 44.7420 -6.5040 C 0 0 1 0 0 0 0 0 0 0 0 0\n 33.7070 45.1590 -5.8100 O 0 0 0 0 0 0 0 0 0 0 0 0\n 31.3600 44.7710 -5.5600 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 2 0\n 3 2 1 0\n 4 2 1 0\n 5 4 1 0\n 4 6 1 1\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":90.03,"logp":-0.55,"tpsa":57.53,"ha":6,"hacc":2,"hdon":2,"rots":1,"rings":0,"velec":36,"number":950},{"id":37582,"smiles":"NC(=O)N1CCC(C(=O)O)CC1","cmpd_id":3987,"prot_id":37493,"protein_code":"Mac1-DLS-X1012A:SF048","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-X1012_0A_apo_eD4PRRC.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 12 12 0 0 0 0 0 0 0 0999 V2000\n 30.9400 45.9530 -8.6900 O 0 0 0 0 0 0 0 0 0 0 0 0\n 31.7660 46.1640 -7.8270 C 0 0 0 0 0 0 0 0 0 0 0 0\n 33.0290 46.4760 -8.0600 O 0 0 0 0 0 0 0 0 0 0 0 0\n 31.4030 46.1160 -6.3680 C 0 0 0 0 0 0 0 0 0 0 0 0\n 31.1780 47.5350 -5.8180 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.7700 47.4610 -4.3480 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.1330 45.2760 -6.1710 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.7860 45.2130 -4.7000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.6190 46.5620 -4.1530 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.5040 46.9380 -3.4090 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.5330 48.0440 -2.8580 O 0 0 0 0 0 0 0 0 0 0 0 0\n 27.4590 46.1130 -3.2980 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 2 0\n 4 2 1 0\n 5 4 1 0\n 6 5 1 0\n 7 4 1 0\n 8 7 1 0\n 9 8 1 0\n 9 6 1 0\n 10 9 1 0\n 11 10 2 0\n 12 10 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":172.08,"logp":-0.14,"tpsa":83.63,"ha":12,"hacc":2,"hdon":2,"rots":1,"rings":1,"velec":68,"number":1012},{"id":37583,"smiles":"C[C@H]1C(=O)NC(=O)N1c1ccc(Cl)cc1","cmpd_id":3988,"prot_id":37494,"protein_code":"Mac1-DLS-X1015A:SF051","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-X1015_0A_apo_3sbc6Mv.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 15 16 0 0 0 0 0 0 0 0999 V2000\n 37.6400 46.5850 -3.4320 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 36.1710 46.4960 -4.3420 C 0 0 0 0 0 0 0 0 0 0 0 0\n 35.3080 45.4560 -4.1160 C 0 0 0 0 0 0 0 0 0 0 0 0\n 34.1010 45.4200 -4.7880 C 0 0 0 0 0 0 0 0 0 0 0 0\n 35.8650 47.4980 -5.2270 C 0 0 0 0 0 0 0 0 0 0 0 0\n 34.6460 47.4740 -5.8760 C 0 0 0 0 0 0 0 0 0 0 0 0\n 33.7630 46.4280 -5.6640 C 0 0 0 0 0 0 0 0 0 0 0 0\n 32.5690 46.3430 -6.4150 N 0 0 0 0 0 0 0 0 0 0 0 0\n 32.5140 46.4250 -7.7650 C 0 0 0 0 0 0 0 0 0 0 0 0\n 33.4670 46.5150 -8.4950 O 0 0 0 0 0 0 0 0 0 0 0 0\n 31.1920 46.3280 -8.1360 N 0 0 0 0 0 0 0 0 0 0 0 0\n 30.3600 46.1600 -7.0650 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.1480 46.0050 -7.1220 O 0 0 0 0 0 0 0 0 0 0 0 0\n 31.2370 46.1670 -5.8270 C 0 0 2 0 0 0 0 0 0 0 0 0\n 30.8490 47.2750 -4.8590 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 2 0\n 4 3 1 0\n 5 2 1 0\n 6 5 2 0\n 7 6 1 0\n 7 4 2 0\n 8 7 1 0\n 9 8 1 0\n 10 9 2 0\n 11 9 1 0\n 12 11 1 0\n 13 12 2 0\n 14 12 1 0\n 14 8 1 0\n 14 15 1 1\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":224.04,"logp":1.78,"tpsa":49.41,"ha":15,"hacc":2,"hdon":1,"rots":1,"rings":2,"velec":78,"number":1015}],"238508":[{"id":37616,"smiles":"NS(=O)(=O)c1ccc(C(=O)O)cc1","cmpd_id":6438,"prot_id":37527,"protein_code":"Mac1-UCSF-P0178A:ZINC000000001099","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-UCSF-P0178_0A_apo_XPAe8xT.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 13 13 0 0 0 0 0 0 0 0999 V2000\n 28.4390 45.3440 -1.7360 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.9160 46.8120 -2.3270 S 0 0 0 0 0 0 0 0 0 0 0 0\n 29.7020 47.4120 -1.3570 O 0 0 0 0 0 0 0 0 0 0 0 0\n 27.7400 47.5950 -2.5940 O 0 0 0 0 0 0 0 0 0 0 0 0\n 29.7300 46.5920 -3.8880 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.8990 47.2330 -4.0970 C 0 0 0 0 0 0 0 0 0 0 0 0\n 31.5360 47.1300 -5.2980 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.9410 46.3520 -6.2720 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.7430 45.6720 -6.0440 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.1040 45.8250 -4.8300 C 0 0 0 0 0 0 0 0 0 0 0 0\n 31.5660 46.2150 -7.6100 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.8670 45.8720 -8.5970 O 0 0 0 0 0 0 0 0 0 0 0 0\n 32.7440 46.4820 -7.6800 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 2 0\n 4 2 2 0\n 5 2 1 0\n 6 5 2 0\n 7 6 1 0\n 8 7 2 0\n 9 8 1 0\n 10 9 2 0\n 10 5 1 0\n 11 8 1 0\n 12 11 2 0\n 13 11 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":201.01,"logp":0.03,"tpsa":97.46,"ha":13,"hacc":3,"hdon":2,"rots":2,"rings":1,"velec":70,"number":0},{"id":37617,"smiles":"O=C(O)CN1C(=O)c2ccccc2C1=O","cmpd_id":6439,"prot_id":37528,"protein_code":"Mac1-UCSF-P0179A:ZINC000000064576","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-UCSF-P0179_0A_apo_MlTF2CM.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 15 16 0 0 0 0 0 0 0 0999 V2000\n 31.2710 45.5420 -8.1150 O 0 0 0 0 0 0 0 0 0 0 0 0\n 32.3060 45.6090 -7.4690 C 0 0 0 0 0 0 0 0 0 0 0 0\n 33.4360 45.7050 -8.0260 O 0 0 0 0 0 0 0 0 0 0 0 0\n 32.1870 45.3820 -5.9630 C 0 0 0 0 0 0 0 0 0 0 0 0\n 33.4730 45.6040 -5.3920 N 0 0 0 0 0 0 0 0 0 0 0 0\n 34.3070 44.6610 -4.8610 C 0 0 0 0 0 0 0 0 0 0 0 0\n 34.0670 43.5340 -4.7550 O 0 0 0 0 0 0 0 0 0 0 0 0\n 35.6580 45.3110 -4.4960 C 0 0 0 0 0 0 0 0 0 0 0 0\n 36.7500 44.9040 -3.9280 C 0 0 0 0 0 0 0 0 0 0 0 0\n 37.8430 45.7900 -3.7340 C 0 0 0 0 0 0 0 0 0 0 0 0\n 37.7520 47.1160 -4.1440 C 0 0 0 0 0 0 0 0 0 0 0 0\n 36.5380 47.6000 -4.6780 C 0 0 0 0 0 0 0 0 0 0 0 0\n 35.5050 46.7000 -4.8780 C 0 0 0 0 0 0 0 0 0 0 0 0\n 34.0900 46.7800 -5.4320 C 0 0 0 0 0 0 0 0 0 0 0 0\n 33.6000 47.6930 -5.8530 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 2 0\n 4 2 1 0\n 5 4 1 0\n 6 5 1 0\n 7 6 2 0\n 8 6 1 0\n 9 8 2 0\n 10 9 1 0\n 11 10 2 0\n 12 11 1 0\n 13 12 2 0\n 13 8 1 0\n 14 13 1 0\n 14 5 1 0\n 15 14 2 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":205.04,"logp":0.37,"tpsa":74.68,"ha":15,"hacc":3,"hdon":1,"rots":2,"rings":2,"velec":76,"number":0},{"id":37619,"smiles":"O=C1NS(=O)(=O)c2ccccc21","cmpd_id":6441,"prot_id":37530,"protein_code":"Mac1-UCSF-P0182A:ZINC000002560357","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-UCSF-P0182_0A_apo_Qoe08RE.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 12 13 0 0 0 0 0 0 0 0999 V2000\n 34.1020 43.5260 -4.4390 O 0 0 0 0 0 0 0 0 0 0 0 0\n 34.1300 44.6020 -4.9320 C 0 0 0 0 0 0 0 0 0 0 0 0\n 33.1360 45.3370 -5.8260 N 0 0 0 0 0 0 0 0 0 0 0 0\n 33.7630 46.7400 -6.2100 S 0 0 0 0 0 0 0 0 0 0 0 0\n 32.8090 47.7240 -5.7490 O 0 0 0 0 0 0 0 0 0 0 0 0\n 34.0060 46.7530 -7.6240 O 0 0 0 0 0 0 0 0 0 0 0 0\n 35.2320 46.8090 -5.3510 C 0 0 0 0 0 0 0 0 0 0 0 0\n 36.1940 47.8070 -5.2750 C 0 0 0 0 0 0 0 0 0 0 0 0\n 37.3490 47.6030 -4.5190 C 0 0 0 0 0 0 0 0 0 0 0 0\n 37.5450 46.3990 -3.8330 C 0 0 0 0 0 0 0 0 0 0 0 0\n 36.5830 45.3910 -3.8980 C 0 0 0 0 0 0 0 0 0 0 0 0\n 35.4490 45.5990 -4.6710 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 2 0\n 3 2 1 0\n 4 3 1 0\n 5 4 2 0\n 6 4 2 0\n 7 4 1 0\n 8 7 2 0\n 9 8 1 0\n 10 9 2 0\n 11 10 1 0\n 12 11 2 0\n 12 7 1 0\n 12 2 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":183,"logp":0.12,"tpsa":63.24,"ha":12,"hacc":3,"hdon":1,"rots":0,"rings":2,"velec":62,"number":0},{"id":37620,"smiles":"Cc1onc(-c2ccccc2)c1C(=O)O","cmpd_id":6442,"prot_id":37531,"protein_code":"Mac1-UCSF-P0188A:ZINC000000158490","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-UCSF-P0188_0A_apo_YvBaNCs.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 15 16 0 0 0 0 0 0 0 0999 V2000\n 32.0710 44.6200 -5.8620 C 0 0 0 0 0 0 0 0 0 0 0 0\n 31.7100 46.0100 -5.4810 C 0 0 0 0 0 0 0 0 0 0 0 0\n 32.0530 46.6750 -4.4400 O 0 0 0 0 0 0 0 0 0 0 0 0\n 31.5740 47.8760 -4.4420 N 0 0 0 0 0 0 0 0 0 0 0 0\n 30.7740 47.9970 -5.4730 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.8730 46.7920 -6.1810 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.1870 46.3150 -7.4100 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.0170 45.8940 -7.3130 O 0 0 0 0 0 0 0 0 0 0 0 0\n 30.8140 46.3370 -8.4870 O 0 0 0 0 0 0 0 0 0 0 0 0\n 29.9560 49.2080 -5.7810 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.7600 50.1300 -4.8060 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.0270 51.2540 -5.0540 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.4810 51.3930 -6.2970 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.7080 50.4670 -7.2920 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.4390 49.3520 -7.0240 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 1 0\n 4 3 1 0\n 5 4 2 0\n 6 5 1 0\n 6 2 2 0\n 7 6 1 0\n 8 7 2 0\n 9 7 1 0\n 10 5 1 0\n 11 10 2 0\n 12 11 1 0\n 13 12 2 0\n 14 13 1 0\n 15 14 2 0\n 15 10 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":203.06,"logp":2.35,"tpsa":63.33,"ha":15,"hacc":3,"hdon":1,"rots":2,"rings":2,"velec":76,"number":0},{"id":37622,"smiles":"O=C(O)CNC(=O)NC1CCCCC1","cmpd_id":6444,"prot_id":37533,"protein_code":"Mac1-UCSF-P0193A:ZINC000006691828","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-UCSF-P0193_0A_apo_0qIQs0s.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 14 14 0 0 0 0 0 0 0 0999 V2000\n 33.5680 46.2470 -7.9150 O 0 0 0 0 0 0 0 0 0 0 0 0\n 32.5760 45.6480 -7.4430 C 0 0 0 0 0 0 0 0 0 0 0 0\n 31.5340 45.6030 -8.0700 O 0 0 0 0 0 0 0 0 0 0 0 0\n 32.6430 44.9980 -6.0850 C 0 0 0 0 0 0 0 0 0 0 0 0\n 33.9490 45.2510 -5.5150 N 0 0 0 0 0 0 0 0 0 0 0 0\n 34.5740 44.2940 -4.7050 C 0 0 0 0 0 0 0 0 0 0 0 0\n 34.0270 43.3160 -4.4310 O 0 0 0 0 0 0 0 0 0 0 0 0\n 35.8760 44.6210 -4.2340 N 0 0 0 0 0 0 0 0 0 0 0 0\n 36.6100 43.6800 -3.4490 C 0 0 0 0 0 0 0 0 0 0 0 0\n 37.2830 44.2660 -2.2350 C 0 0 0 0 0 0 0 0 0 0 0 0\n 38.2560 43.3130 -1.5950 C 0 0 0 0 0 0 0 0 0 0 0 0\n 39.2130 42.7650 -2.6070 C 0 0 0 0 0 0 0 0 0 0 0 0\n 38.5880 42.2860 -3.9000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 37.6250 43.2460 -4.4870 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 2 0\n 4 2 1 0\n 5 4 1 0\n 6 5 1 0\n 7 6 2 0\n 8 6 1 0\n 9 8 1 0\n 10 9 1 0\n 11 10 1 0\n 12 11 1 0\n 13 12 1 0\n 14 9 1 0\n 14 13 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":200.12,"logp":0.7,"tpsa":78.43,"ha":14,"hacc":2,"hdon":3,"rots":3,"rings":1,"velec":80,"number":0},{"id":37623,"smiles":"O=C(O)c1cncc(O)c1","cmpd_id":6445,"prot_id":37534,"protein_code":"Mac1-UCSF-P0204A:ZINC000000332673","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-UCSF-P0204_0A_apo_ssoF7y3.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 10 10 0 0 0 0 0 0 0 0999 V2000\n 31.0250 46.2930 -7.8190 O 0 0 0 0 0 0 0 0 0 0 0 0\n 30.3350 46.3170 -6.7800 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.2050 45.7560 -6.7880 O 0 0 0 0 0 0 0 0 0 0 0 0\n 30.8930 47.0210 -5.5140 C 0 0 0 0 0 0 0 0 0 0 0 0\n 32.1590 47.6180 -5.5150 C 0 0 0 0 0 0 0 0 0 0 0 0\n 32.6690 48.2080 -4.4430 N 0 0 0 0 0 0 0 0 0 0 0 0\n 31.9470 48.2860 -3.3330 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.6720 47.7120 -3.2830 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.8700 47.7300 -2.1340 O 0 0 0 0 0 0 0 0 0 0 0 0\n 30.1370 47.0630 -4.3670 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 2 0\n 4 2 1 0\n 5 4 2 0\n 6 5 1 0\n 7 6 2 0\n 8 7 1 0\n 9 8 1 0\n 10 4 1 0\n 10 8 2 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":139.03,"logp":0.49,"tpsa":70.42,"ha":10,"hacc":3,"hdon":2,"rots":1,"rings":1,"velec":52,"number":0},{"id":37626,"smiles":"O=C(O)C1Cc2ccccc2C1","cmpd_id":685,"prot_id":37537,"protein_code":"Mac1-UCSF-P0213A:ZINC000000337835","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-UCSF-P0213_0A_apo_5FGDcIg.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 12 13 0 0 0 0 0 0 0 0999 V2000\n 32.7610 46.7540 -7.5220 O 0 0 0 0 0 0 0 0 0 0 0 0\n 31.6400 46.2940 -7.2910 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.7940 46.1640 -8.2220 O 0 0 0 0 0 0 0 0 0 0 0 0\n 31.3050 45.9520 -5.8580 C 0 0 0 0 0 0 0 0 0 0 0 0\n 31.0000 47.2760 -5.1570 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.9010 46.8820 -4.1520 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.4730 47.5450 -3.0190 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.4700 46.9880 -2.2350 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.9030 45.7590 -2.5740 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.3640 45.0850 -3.6890 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.3570 45.6540 -4.4790 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.0320 45.1120 -5.7510 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 2 0\n 4 2 1 0\n 5 4 1 0\n 6 5 1 0\n 7 6 2 0\n 8 7 1 0\n 9 8 2 0\n 10 9 1 0\n 11 10 2 0\n 11 6 1 0\n 12 4 1 0\n 12 11 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":162.07,"logp":1.49,"tpsa":37.3,"ha":12,"hacc":1,"hdon":1,"rots":1,"rings":2,"velec":62,"number":0},{"id":37627,"smiles":"COc1cc(CC(=O)O)ccc1O","cmpd_id":6448,"prot_id":37538,"protein_code":"Mac1-UCSF-P0223A:ZINC000000388262","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-UCSF-P0223_0A_apo_d9A4ukJ.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 13 13 0 0 0 0 0 0 0 0999 V2000\n 27.4780 43.8720 -3.4620 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.5470 45.2560 -3.2720 O 0 0 0 0 0 0 0 0 0 0 0 0\n 28.7150 45.8710 -3.6970 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.5810 45.2260 -4.5780 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.6830 45.9410 -4.9910 C 0 0 0 0 0 0 0 0 0 0 0 0\n 31.7290 45.3370 -5.9410 C 0 0 0 0 0 0 0 0 0 0 0 0\n 31.7950 46.0820 -7.2670 C 0 0 0 0 0 0 0 0 0 0 0 0\n 32.8600 46.7110 -7.4880 O 0 0 0 0 0 0 0 0 0 0 0 0\n 30.8700 46.0250 -8.0740 O 0 0 0 0 0 0 0 0 0 0 0 0\n 30.9020 47.1690 -4.5590 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.0110 47.8120 -3.6740 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.9600 47.1420 -3.2450 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.0620 47.7620 -2.4680 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 1 0\n 4 3 2 0\n 5 4 1 0\n 6 5 1 0\n 7 6 1 0\n 8 7 2 0\n 9 7 1 0\n 10 5 2 0\n 11 10 1 0\n 12 11 2 0\n 12 3 1 0\n 13 12 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":182.06,"logp":1.03,"tpsa":66.76,"ha":13,"hacc":3,"hdon":2,"rots":3,"rings":1,"velec":70,"number":0},{"id":37629,"smiles":"O=C(O)c1cnn(-c2ccccc2)c1","cmpd_id":6450,"prot_id":37540,"protein_code":"Mac1-UCSF-P0226A:ZINC000004218283","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-UCSF-P0226_0A_apo_2nYOMXP.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 14 15 0 0 0 0 0 0 0 0999 V2000\n 31.4250 46.0300 -8.3120 O 0 0 0 0 0 0 0 0 0 0 0 0\n 32.5930 46.2150 -7.8750 C 0 0 0 0 0 0 0 0 0 0 0 0\n 33.3140 47.0180 -8.4830 O 0 0 0 0 0 0 0 0 0 0 0 0\n 33.1130 45.4770 -6.6590 C 0 0 0 0 0 0 0 0 0 0 0 0\n 32.5410 44.3860 -6.0200 C 0 0 0 0 0 0 0 0 0 0 0 0\n 33.3330 44.0160 -5.0540 N 0 0 0 0 0 0 0 0 0 0 0 0\n 34.3230 44.8260 -5.0180 N 0 0 0 0 0 0 0 0 0 0 0 0\n 34.2980 45.6930 -5.9570 C 0 0 0 0 0 0 0 0 0 0 0 0\n 35.3490 44.7560 -4.0660 C 0 0 0 0 0 0 0 0 0 0 0 0\n 36.1500 45.8510 -3.9040 C 0 0 0 0 0 0 0 0 0 0 0 0\n 37.1470 45.8090 -2.9690 C 0 0 0 0 0 0 0 0 0 0 0 0\n 37.3000 44.6620 -2.2200 C 0 0 0 0 0 0 0 0 0 0 0 0\n 36.4640 43.5870 -2.3910 C 0 0 0 0 0 0 0 0 0 0 0 0\n 35.4870 43.6260 -3.3210 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 2 0\n 4 2 1 0\n 5 4 1 0\n 6 5 2 0\n 7 6 1 0\n 8 4 2 0\n 8 7 1 0\n 9 7 1 0\n 10 9 2 0\n 11 10 1 0\n 12 11 2 0\n 13 12 1 0\n 14 13 2 0\n 14 9 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":188.06,"logp":1.57,"tpsa":55.12,"ha":14,"hacc":3,"hdon":1,"rots":2,"rings":2,"velec":70,"number":0},{"id":37632,"smiles":"O=C(O)Cc1n[nH]c(=O)c2ccccc12","cmpd_id":6451,"prot_id":37543,"protein_code":"Mac1-UCSF-P0231A:ZINC000008652361","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-UCSF-P0231_0A_apo_dhCr0E6.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 15 16 0 0 0 0 0 0 0 0999 V2000\n 33.6140 45.8420 -8.1530 O 0 0 0 0 0 0 0 0 0 0 0 0\n 32.5170 45.4370 -7.7830 C 0 0 0 0 0 0 0 0 0 0 0 0\n 31.4450 45.7260 -8.3550 O 0 0 0 0 0 0 0 0 0 0 0 0\n 32.5690 44.5470 -6.5630 C 0 0 0 0 0 0 0 0 0 0 0 0\n 31.3090 44.7450 -5.7720 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.2690 43.7960 -5.8400 N 0 0 0 0 0 0 0 0 0 0 0 0\n 29.1180 44.0670 -5.0950 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.9340 45.2250 -4.2380 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.9640 45.3230 -3.6330 O 0 0 0 0 0 0 0 0 0 0 0 0\n 30.0820 46.2300 -4.1380 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.0160 47.3900 -3.3650 C 0 0 0 0 0 0 0 0 0 0 0 0\n 31.0900 48.2750 -3.3230 C 0 0 0 0 0 0 0 0 0 0 0 0\n 32.2280 48.0280 -4.0840 C 0 0 0 0 0 0 0 0 0 0 0 0\n 32.2680 46.8740 -4.8620 C 0 0 0 0 0 0 0 0 0 0 0 0\n 31.1890 45.9800 -4.8840 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 2 0\n 4 2 1 0\n 5 4 1 0\n 6 5 2 0\n 7 6 1 0\n 8 7 1 0\n 9 8 2 0\n 10 8 1 0\n 11 10 2 0\n 12 11 1 0\n 13 12 2 0\n 14 13 1 0\n 15 5 1 0\n 15 14 2 0\n 15 10 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":204.05,"logp":0.55,"tpsa":83.05,"ha":15,"hacc":3,"hdon":2,"rots":2,"rings":2,"velec":76,"number":0},{"id":37633,"smiles":"O=C(O)Cc1cc2ccccc2s1","cmpd_id":6452,"prot_id":37544,"protein_code":"Mac1-UCSF-P0255A:ZINC000039281982","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-UCSF-P0255_0A_apo_duwnK9U.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 13 14 0 0 0 0 0 0 0 0999 V2000\n 31.0870 45.9890 -8.3910 O 0 0 0 0 0 0 0 0 0 0 0 0\n 31.9510 45.8830 -7.6770 C 0 0 0 0 0 0 0 0 0 0 0 0\n 33.0140 46.4410 -7.9430 O 0 0 0 0 0 0 0 0 0 0 0 0\n 32.0560 45.0220 -6.4690 C 0 0 0 0 0 0 0 0 0 0 0 0\n 31.0680 45.3630 -5.4370 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.9570 44.6240 -5.0470 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.2700 45.4130 -4.0330 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.1300 44.9740 -3.3670 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.6020 45.8160 -2.4290 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.2430 46.9870 -2.1060 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.3310 47.4660 -2.7700 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.8530 46.6390 -3.6850 C 0 0 0 0 0 0 0 0 0 0 0 0\n 31.2210 46.8600 -4.6620 S 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 2 0\n 4 2 1 0\n 5 4 1 0\n 6 5 2 0\n 7 6 1 0\n 8 7 2 0\n 9 8 1 0\n 10 9 2 0\n 11 10 1 0\n 12 11 2 0\n 12 7 1 0\n 13 12 1 0\n 13 5 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":192.02,"logp":2.53,"tpsa":37.3,"ha":13,"hacc":2,"hdon":1,"rots":2,"rings":2,"velec":66,"number":0},{"id":37636,"smiles":"O=C(O)Cc1ccc(Cl)c(Cl)c1","cmpd_id":6455,"prot_id":37547,"protein_code":"Mac1-UCSF-P0277A:ZINC000000156509","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-UCSF-P0277_0A_apo_d4zCmxW.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 12 12 0 0 0 0 0 0 0 0999 V2000\n 27.6890 46.5020 -2.5190 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 30.2640 48.1040 -2.8390 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 33.0210 46.4500 -7.6740 O 0 0 0 0 0 0 0 0 0 0 0 0\n 31.9340 45.8730 -7.5500 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.9500 45.9240 -8.3180 O 0 0 0 0 0 0 0 0 0 0 0 0\n 31.8660 44.8940 -6.3480 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.8300 45.2350 -5.3620 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.6170 44.5040 -5.2750 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.7350 44.9520 -4.3270 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.8970 46.0250 -3.6480 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.9900 46.7440 -3.7540 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.9410 46.3830 -4.6300 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4 3 1 0\n 5 4 2 0\n 6 4 1 0\n 7 6 1 0\n 8 7 2 0\n 9 8 1 0\n 10 9 2 0\n 10 1 1 0\n 11 10 1 0\n 11 2 1 0\n 12 11 2 0\n 12 7 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":203.97,"logp":2.62,"tpsa":37.3,"ha":12,"hacc":1,"hdon":1,"rots":2,"rings":1,"velec":64,"number":0},{"id":37643,"smiles":"O=C(O)c1ncccc1O","cmpd_id":6461,"prot_id":37554,"protein_code":"Mac1-UCSF-P0305A:ZINC000000157108","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-UCSF-P0305_0A_apo_nxul50Z.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 10 10 0 0 0 0 0 0 0 0999 V2000\n 30.3330 47.0770 -8.8580 O 0 0 0 0 0 0 0 0 0 0 0 0\n 29.9700 47.2920 -7.6310 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.0920 46.4540 -6.7020 O 0 0 0 0 0 0 0 0 0 0 0 0\n 29.3730 48.6510 -7.3000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.6130 49.1320 -6.1040 N 0 0 0 0 0 0 0 0 0 0 0 0\n 29.1720 50.2990 -5.7150 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.4180 51.0260 -6.5660 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.1190 50.5430 -7.8290 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.6050 49.3240 -8.2380 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.3080 48.8480 -9.5540 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 2 0\n 4 2 1 0\n 5 4 2 0\n 6 5 1 0\n 7 6 2 0\n 8 7 1 0\n 9 4 1 0\n 9 8 2 0\n 10 9 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":139.03,"logp":0.49,"tpsa":70.42,"ha":10,"hacc":3,"hdon":2,"rots":1,"rings":1,"velec":52,"number":0},{"id":37647,"smiles":"O=C(O)Cc1cccc(O)c1","cmpd_id":6464,"prot_id":37558,"protein_code":"Mac1-UCSF-P0319A:ZINC000000395673","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-UCSF-P0319_0A_apo_qsip54Q.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 11 11 0 0 0 0 0 0 0 0999 V2000\n 33.5060 46.0810 -8.4750 O 0 0 0 0 0 0 0 0 0 0 0 0\n 32.4200 45.7610 -7.9890 C 0 0 0 0 0 0 0 0 0 0 0 0\n 31.3180 46.0030 -8.5470 O 0 0 0 0 0 0 0 0 0 0 0 0\n 32.4720 45.0360 -6.7090 C 0 0 0 0 0 0 0 0 0 0 0 0\n 31.3680 45.4980 -5.8100 C 0 0 0 0 0 0 0 0 0 0 0 0\n 31.4280 46.7420 -5.1700 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.3790 47.1550 -4.3530 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.3000 46.3050 -4.1820 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.2600 45.0740 -4.8610 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.2370 44.1510 -4.7770 O 0 0 0 0 0 0 0 0 0 0 0 0\n 30.2760 44.6740 -5.6740 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 2 0\n 4 2 1 0\n 5 4 1 0\n 6 5 2 0\n 7 6 1 0\n 8 7 2 0\n 9 8 1 0\n 10 9 1 0\n 11 5 1 0\n 11 9 2 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":152.05,"logp":1.02,"tpsa":57.53,"ha":11,"hacc":2,"hdon":2,"rots":2,"rings":1,"velec":58,"number":0},{"id":37649,"smiles":"O=C(O)CCc1nc2cc(Cl)ccc2s1","cmpd_id":6466,"prot_id":37560,"protein_code":"Mac1-UCSF-P0326A:ZINC000004219237","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-UCSF-P0326_0A_apo_29wd8kk.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 15 16 0 0 0 0 0 0 0 0999 V2000\n 29.0280 52.5780 -4.8520 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 33.2640 46.2610 -7.6740 O 0 0 0 0 0 0 0 0 0 0 0 0\n 32.2560 45.6240 -7.5270 C 0 0 0 0 0 0 0 0 0 0 0 0\n 31.5270 45.2820 -8.4550 O 0 0 0 0 0 0 0 0 0 0 0 0\n 32.0160 45.1930 -6.0870 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.5740 45.1970 -5.7260 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.0730 46.6160 -6.0320 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.1610 47.6110 -5.1930 N 0 0 0 0 0 0 0 0 0 0 0 0\n 29.6440 48.7290 -5.6140 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.6930 49.8960 -4.9730 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.1200 50.9930 -5.6240 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.6070 50.9270 -6.8610 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.5990 49.7660 -7.5320 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.1260 48.6800 -6.9030 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.2690 47.0760 -7.5080 S 0 0 0 0 0 0 0 0 0 0 0 0\n 3 2 1 0\n 4 3 2 0\n 5 3 1 0\n 6 5 1 0\n 7 6 1 0\n 8 7 2 0\n 9 8 1 0\n 10 9 2 0\n 11 10 1 0\n 11 1 1 0\n 12 11 2 0\n 13 12 1 0\n 14 9 1 0\n 14 13 2 0\n 15 14 1 0\n 15 7 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":241,"logp":2.97,"tpsa":50.19,"ha":15,"hacc":3,"hdon":1,"rots":3,"rings":2,"velec":78,"number":0},{"id":37657,"smiles":"O=C(O)C(=O)Nc1ccccc1","cmpd_id":6472,"prot_id":37568,"protein_code":"Mac1-UCSF-P0344A:ZINC000001679336","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-UCSF-P0344_0A_apo_GUu6qo8.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 12 12 0 0 0 0 0 0 0 0999 V2000\n 31.3830 44.3330 -5.9870 O 0 0 0 0 0 0 0 0 0 0 0 0\n 31.7880 45.1070 -6.8830 C 0 0 0 0 0 0 0 0 0 0 0 0\n 31.0850 45.2440 -7.9020 O 0 0 0 0 0 0 0 0 0 0 0 0\n 33.1090 45.8650 -6.6600 C 0 0 0 0 0 0 0 0 0 0 0 0\n 33.6410 46.5270 -7.4700 O 0 0 0 0 0 0 0 0 0 0 0 0\n 33.7310 45.7120 -5.3830 N 0 0 0 0 0 0 0 0 0 0 0 0\n 34.9510 46.3850 -5.0240 C 0 0 0 0 0 0 0 0 0 0 0 0\n 35.1100 47.7500 -5.2310 C 0 0 0 0 0 0 0 0 0 0 0 0\n 36.2540 48.4090 -4.8310 C 0 0 0 0 0 0 0 0 0 0 0 0\n 37.2710 47.7160 -4.2030 C 0 0 0 0 0 0 0 0 0 0 0 0\n 37.1250 46.3760 -4.0040 C 0 0 0 0 0 0 0 0 0 0 0 0\n 35.9680 45.7120 -4.3910 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 2 0\n 4 2 1 0\n 5 4 2 0\n 6 4 1 0\n 7 6 1 0\n 8 7 2 0\n 9 8 1 0\n 10 9 2 0\n 11 10 1 0\n 12 11 2 0\n 12 7 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":165.04,"logp":0.71,"tpsa":66.4,"ha":12,"hacc":2,"hdon":2,"rots":1,"rings":1,"velec":62,"number":0},{"id":37661,"smiles":"Cn1cc(CCC(=O)O)c2ccccc21","cmpd_id":6475,"prot_id":37572,"protein_code":"Mac1-UCSF-P0348A:ZINC000000873830","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-UCSF-P0348_0A_apo_6nsstVs.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 15 16 0 0 0 0 0 0 0 0999 V2000\n 27.3840 44.3740 -2.5540 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.3360 45.2950 -3.0820 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.7230 44.9950 -4.2600 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.5830 45.9240 -4.7310 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.1380 45.8690 -6.1600 C 0 0 0 0 0 0 0 0 0 0 0 0\n 31.6070 45.6940 -6.3220 C 0 0 0 0 0 0 0 0 0 0 0 0\n 31.9290 46.0090 -7.7560 C 0 0 0 0 0 0 0 0 0 0 0 0\n 31.1670 45.8120 -8.6900 O 0 0 0 0 0 0 0 0 0 0 0 0\n 33.0670 46.3970 -7.9080 O 0 0 0 0 0 0 0 0 0 0 0 0\n 29.7640 46.8480 -3.6980 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.5180 48.0080 -3.5370 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.4700 48.7980 -2.4020 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.6440 48.3640 -1.3140 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.9350 47.1480 -1.4440 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.9470 46.4260 -2.6700 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 1 0\n 4 3 2 0\n 5 4 1 0\n 6 5 1 0\n 7 6 1 0\n 8 7 2 0\n 9 7 1 0\n 10 4 1 0\n 11 10 2 0\n 12 11 1 0\n 13 12 2 0\n 14 13 1 0\n 15 14 2 0\n 15 10 1 0\n 15 2 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":203.09,"logp":2.2,"tpsa":42.23,"ha":15,"hacc":2,"hdon":1,"rots":3,"rings":2,"velec":78,"number":0},{"id":37662,"smiles":"Cn1ncc(C(=O)O)c1-c1ccccc1","cmpd_id":6476,"prot_id":37573,"protein_code":"Mac1-UCSF-P0354A:ZINC000000159056","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-UCSF-P0354_0A_apo_xz7fPQP.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 15 16 0 0 0 0 0 0 0 0999 V2000\n 35.1870 43.9020 -3.3500 C 0 0 0 0 0 0 0 0 0 0 0 0\n 34.3050 44.0590 -4.4950 N 0 0 0 0 0 0 0 0 0 0 0 0\n 33.3730 43.1850 -4.8160 N 0 0 0 0 0 0 0 0 0 0 0 0\n 32.7650 43.5890 -5.8970 C 0 0 0 0 0 0 0 0 0 0 0 0\n 33.3640 44.8020 -6.3040 C 0 0 0 0 0 0 0 0 0 0 0 0\n 33.0020 45.6340 -7.5310 C 0 0 0 0 0 0 0 0 0 0 0 0\n 31.8850 45.4870 -8.0880 O 0 0 0 0 0 0 0 0 0 0 0 0\n 33.8190 46.4510 -8.0180 O 0 0 0 0 0 0 0 0 0 0 0 0\n 34.3660 45.0570 -5.3480 C 0 0 0 0 0 0 0 0 0 0 0 0\n 35.3420 46.2300 -5.2920 C 0 0 0 0 0 0 0 0 0 0 0 0\n 36.7140 46.0160 -5.3190 C 0 0 0 0 0 0 0 0 0 0 0 0\n 37.5840 47.0900 -5.2490 C 0 0 0 0 0 0 0 0 0 0 0 0\n 37.0890 48.3700 -5.1390 C 0 0 0 0 0 0 0 0 0 0 0 0\n 35.7350 48.5870 -5.0950 C 0 0 0 0 0 0 0 0 0 0 0 0\n 34.8680 47.5180 -5.1670 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 1 0\n 4 3 2 0\n 5 4 1 0\n 6 5 1 0\n 7 6 2 0\n 8 6 1 0\n 9 5 2 0\n 9 2 1 0\n 10 9 1 0\n 11 10 2 0\n 12 11 1 0\n 13 12 2 0\n 14 13 1 0\n 15 14 2 0\n 15 10 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":202.07,"logp":1.79,"tpsa":55.12,"ha":15,"hacc":3,"hdon":1,"rots":2,"rings":2,"velec":76,"number":0},{"id":37663,"smiles":"Cc1c(O)cccc1C(=O)O","cmpd_id":6477,"prot_id":37574,"protein_code":"Mac1-UCSF-P0357A:ZINC000001698894","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-UCSF-P0357_0A_apo_B19Ij6i.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 11 11 0 0 0 0 0 0 0 0999 V2000\n 31.8710 43.7140 -6.3160 C 0 0 0 0 0 0 0 0 0 0 0 0\n 32.7030 44.9300 -5.9010 C 0 0 0 0 0 0 0 0 0 0 0 0\n 33.8050 44.7330 -5.1010 C 0 0 0 0 0 0 0 0 0 0 0 0\n 34.1040 43.4430 -4.6880 O 0 0 0 0 0 0 0 0 0 0 0 0\n 34.5850 45.7760 -4.6650 C 0 0 0 0 0 0 0 0 0 0 0 0\n 34.2700 47.0450 -5.0990 C 0 0 0 0 0 0 0 0 0 0 0 0\n 33.1550 47.2390 -5.9250 C 0 0 0 0 0 0 0 0 0 0 0 0\n 32.3600 46.1960 -6.3310 C 0 0 0 0 0 0 0 0 0 0 0 0\n 31.1120 46.4390 -7.2180 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.1400 47.0720 -6.7770 O 0 0 0 0 0 0 0 0 0 0 0 0\n 30.9890 46.0110 -8.3620 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 2 0\n 4 3 1 0\n 5 3 1 0\n 6 5 2 0\n 7 6 1 0\n 8 7 2 0\n 8 2 1 0\n 9 8 1 0\n 10 9 2 0\n 11 9 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":152.05,"logp":1.4,"tpsa":57.53,"ha":11,"hacc":2,"hdon":2,"rots":1,"rings":1,"velec":58,"number":0},{"id":37664,"smiles":"Cc1c(O)cccc1C(=O)O","cmpd_id":6477,"prot_id":37575,"protein_code":"Mac1-UCSF-P0357_1A:ZINC000001698894","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-UCSF-P0357_1A_apo_twShBN0.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 11 11 0 0 0 0 0 0 0 0999 V2000\n 28.4550 47.3920 -9.1950 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.6770 48.4750 -8.1410 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.2340 49.7700 -8.3110 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.5660 50.1780 -9.4650 O 0 0 0 0 0 0 0 0 0 0 0 0\n 28.4190 50.7250 -7.3240 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.0680 50.4130 -6.1670 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.5030 49.1300 -5.9920 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.3380 48.1830 -6.9670 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.9040 46.8270 -6.6170 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.8830 46.3830 -7.2810 O 0 0 0 0 0 0 0 0 0 0 0 0\n 29.3820 46.2270 -5.6040 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 2 0\n 4 3 1 0\n 5 3 1 0\n 6 5 2 0\n 7 6 1 0\n 8 2 1 0\n 8 7 2 0\n 9 8 1 0\n 10 9 2 0\n 11 9 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":152.05,"logp":1.4,"tpsa":57.53,"ha":11,"hacc":2,"hdon":2,"rots":1,"rings":1,"velec":58,"number":0},{"id":37665,"smiles":"O=C(O)Cc1ccccc1O","cmpd_id":6478,"prot_id":37576,"protein_code":"Mac1-UCSF-P0358A:ZINC000000164777","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-UCSF-P0358_0A_apo_R2ELOf0.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 11 11 0 0 0 0 0 0 0 0999 V2000\n 31.1880 45.6530 -8.3200 O 0 0 0 0 0 0 0 0 0 0 0 0\n 32.0590 45.8060 -7.5000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 33.0700 46.4120 -7.7960 O 0 0 0 0 0 0 0 0 0 0 0 0\n 31.9960 45.2400 -6.1050 C 0 0 0 0 0 0 0 0 0 0 0 0\n 31.8590 46.3030 -5.0400 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.7120 46.3660 -4.2980 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.5850 47.3130 -3.3090 C 0 0 0 0 0 0 0 0 0 0 0 0\n 31.6130 48.2050 -3.0620 C 0 0 0 0 0 0 0 0 0 0 0 0\n 32.7420 48.1440 -3.8320 C 0 0 0 0 0 0 0 0 0 0 0 0\n 32.8600 47.1830 -4.8190 C 0 0 0 0 0 0 0 0 0 0 0 0\n 34.0290 47.0880 -5.5830 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 2 0\n 4 2 1 0\n 5 4 1 0\n 6 5 2 0\n 7 6 1 0\n 8 7 2 0\n 9 8 1 0\n 10 5 1 0\n 10 9 2 0\n 11 10 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":152.05,"logp":1.02,"tpsa":57.53,"ha":11,"hacc":2,"hdon":2,"rots":2,"rings":1,"velec":58,"number":0},{"id":37670,"smiles":"O=C(O)Cc1c(Cl)cccc1Cl","cmpd_id":6481,"prot_id":37581,"protein_code":"Mac1-UCSF-P0371A:ZINC000000388514","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-UCSF-P0371_0A_apo_cIDHI4b.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 12 12 0 0 0 0 0 0 0 0999 V2000\n 32.0840 43.1980 -6.8520 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 31.1000 48.1700 -4.8340 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 31.7530 46.5830 -8.4420 O 0 0 0 0 0 0 0 0 0 0 0 0\n 32.8070 46.6010 -7.7730 C 0 0 0 0 0 0 0 0 0 0 0 0\n 33.9030 46.9990 -8.2720 O 0 0 0 0 0 0 0 0 0 0 0 0\n 32.7900 46.1470 -6.3110 C 0 0 0 0 0 0 0 0 0 0 0 0\n 31.4520 45.6370 -5.7650 C 0 0 0 0 0 0 0 0 0 0 0 0\n 31.0510 44.3210 -5.9490 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.8500 43.8810 -5.4710 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.0560 44.7430 -4.7570 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.4360 46.0450 -4.5600 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.6260 46.4850 -5.0680 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4 3 1 0\n 5 4 2 0\n 6 4 1 0\n 7 6 1 0\n 8 1 1 0\n 8 7 2 0\n 9 8 1 0\n 10 9 2 0\n 11 10 1 0\n 12 7 1 0\n 12 11 2 0\n 12 2 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":203.97,"logp":2.62,"tpsa":37.3,"ha":12,"hacc":1,"hdon":1,"rots":2,"rings":1,"velec":64,"number":0},{"id":37672,"smiles":"O=C(O)C(c1ccccc1)c1ccccc1","cmpd_id":6482,"prot_id":37583,"protein_code":"Mac1-UCSF-P0373A:ZINC000000034687","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-UCSF-P0373_0A_apo_LzV18gK.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 16 17 0 0 0 0 0 0 0 0999 V2000\n 30.8450 46.7290 -8.1980 O 0 0 0 0 0 0 0 0 0 0 0 0\n 30.0130 46.7350 -7.2390 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.0510 45.9480 -7.2840 O 0 0 0 0 0 0 0 0 0 0 0 0\n 30.1560 47.7010 -6.0500 C 0 0 0 0 0 0 0 0 0 0 0 0\n 31.6550 47.8770 -5.7530 C 0 0 0 0 0 0 0 0 0 0 0 0\n 32.3480 46.8570 -5.1240 C 0 0 0 0 0 0 0 0 0 0 0 0\n 33.7090 46.9830 -4.8690 C 0 0 0 0 0 0 0 0 0 0 0 0\n 34.3910 48.1240 -5.2650 C 0 0 0 0 0 0 0 0 0 0 0 0\n 33.7060 49.1480 -5.8910 C 0 0 0 0 0 0 0 0 0 0 0 0\n 32.3490 49.0080 -6.1490 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.4270 49.0320 -6.2940 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.2140 49.9000 -5.2350 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.5500 51.0990 -5.4070 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.1140 51.4430 -6.6650 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.3290 50.5830 -7.7310 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.9730 49.3740 -7.5510 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 2 0\n 4 2 1 0\n 5 4 1 0\n 6 5 2 0\n 7 6 1 0\n 8 7 2 0\n 9 8 1 0\n 10 5 1 0\n 10 9 2 0\n 11 4 1 0\n 12 11 2 0\n 13 12 1 0\n 14 13 2 0\n 15 14 1 0\n 16 11 1 0\n 16 15 2 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":212.08,"logp":2.9,"tpsa":37.3,"ha":16,"hacc":1,"hdon":1,"rots":3,"rings":2,"velec":80,"number":0},{"id":37673,"smiles":"O=C(O)COc1ccccc1","cmpd_id":6483,"prot_id":37584,"protein_code":"Mac1-UCSF-P0375A:ZINC000000331715","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-UCSF-P0375_0A_apo_eyDLOLo.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 11 11 0 0 0 0 0 0 0 0999 V2000\n 31.4560 45.4640 -7.9420 O 0 0 0 0 0 0 0 0 0 0 0 0\n 32.5250 45.4170 -7.3480 C 0 0 0 0 0 0 0 0 0 0 0 0\n 33.5890 45.6110 -7.9650 O 0 0 0 0 0 0 0 0 0 0 0 0\n 32.5710 45.1370 -5.8550 C 0 0 0 0 0 0 0 0 0 0 0 0\n 33.9010 44.9050 -5.3910 O 0 0 0 0 0 0 0 0 0 0 0 0\n 34.7060 46.0340 -5.2100 C 0 0 0 0 0 0 0 0 0 0 0 0\n 34.2310 47.3220 -5.1390 C 0 0 0 0 0 0 0 0 0 0 0 0\n 35.1030 48.3990 -4.9340 C 0 0 0 0 0 0 0 0 0 0 0 0\n 36.4270 48.1800 -4.7630 C 0 0 0 0 0 0 0 0 0 0 0 0\n 36.8900 46.9170 -4.8560 C 0 0 0 0 0 0 0 0 0 0 0 0\n 36.0350 45.8500 -5.0790 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 2 0\n 4 2 1 0\n 5 4 1 0\n 6 5 1 0\n 7 6 2 0\n 8 7 1 0\n 9 8 2 0\n 10 9 1 0\n 11 10 2 0\n 11 6 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":152.05,"logp":1.15,"tpsa":46.53,"ha":11,"hacc":2,"hdon":1,"rots":3,"rings":1,"velec":58,"number":0},{"id":37682,"smiles":"O=C(O)Cc1cc(Cl)cc(Cl)c1","cmpd_id":6490,"prot_id":37593,"protein_code":"Mac1-UCSF-P0394A:ZINC000033986325","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-UCSF-P0394_0A_apo_pgFIBTw.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 12 12 0 0 0 0 0 0 0 0999 V2000\n 27.3110 44.3320 -3.7130 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 30.3990 48.4690 -2.7180 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 33.0200 46.4510 -7.5340 O 0 0 0 0 0 0 0 0 0 0 0 0\n 31.8600 45.9460 -7.4130 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.8970 46.0910 -8.1850 O 0 0 0 0 0 0 0 0 0 0 0 0\n 31.7550 44.9610 -6.2400 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.7860 45.4090 -5.1770 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.6080 44.6960 -4.9780 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.7630 45.2030 -4.0620 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.9880 46.3010 -3.3520 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.0810 46.9980 -3.5890 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.9690 46.5700 -4.5410 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4 3 1 0\n 5 4 2 0\n 6 4 1 0\n 7 6 1 0\n 8 7 2 0\n 9 8 1 0\n 9 1 1 0\n 10 9 2 0\n 11 10 1 0\n 11 2 1 0\n 12 11 2 0\n 12 7 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":203.97,"logp":2.62,"tpsa":37.3,"ha":12,"hacc":1,"hdon":1,"rots":2,"rings":1,"velec":64,"number":0},{"id":37688,"smiles":"O=C(O)COc1cccc2ccccc12","cmpd_id":6495,"prot_id":37599,"protein_code":"Mac1-UCSF-P0404A:ZINC000000038389","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-UCSF-P0404_0A_apo_6vVDb0Y.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 15 16 0 0 0 0 0 0 0 0999 V2000\n 31.2240 46.0190 -8.2750 O 0 0 0 0 0 0 0 0 0 0 0 0\n 32.1760 45.6920 -7.6640 C 0 0 0 0 0 0 0 0 0 0 0 0\n 33.3050 46.0420 -8.0230 O 0 0 0 0 0 0 0 0 0 0 0 0\n 32.1700 44.7370 -6.4720 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.9450 44.7410 -5.7920 O 0 0 0 0 0 0 0 0 0 0 0 0\n 30.8020 45.7340 -4.8570 C 0 0 0 0 0 0 0 0 0 0 0 0\n 31.7030 46.7960 -4.7580 C 0 0 0 0 0 0 0 0 0 0 0 0\n 31.5010 47.7820 -3.7490 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.3280 47.7100 -3.0730 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.4650 46.6600 -3.1550 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.3790 46.5440 -2.3320 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.4480 45.5590 -2.4690 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.6770 44.5400 -3.3820 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.8060 44.6320 -4.2040 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.6320 45.6990 -4.0700 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 2 0\n 4 2 1 0\n 5 4 1 0\n 6 5 1 0\n 7 6 2 0\n 8 7 1 0\n 9 8 2 0\n 10 9 1 0\n 11 10 2 0\n 12 11 1 0\n 13 12 2 0\n 14 13 1 0\n 15 14 2 0\n 15 10 1 0\n 15 6 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":202.06,"logp":2.3,"tpsa":46.53,"ha":15,"hacc":2,"hdon":1,"rots":3,"rings":2,"velec":76,"number":0},{"id":37689,"smiles":"O=C(O)COc1c(Cl)cccc1Cl","cmpd_id":6496,"prot_id":37600,"protein_code":"Mac1-UCSF-P0411A:ZINC000000123600","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-UCSF-P0411_0A_apo_RDsUrRj.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 13 13 0 0 0 0 0 0 0 0999 V2000\n 36.9810 44.4680 -5.2300 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 32.5560 47.6590 -5.1190 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 31.6520 45.4490 -7.8700 O 0 0 0 0 0 0 0 0 0 0 0 0\n 32.7690 45.4010 -7.2980 C 0 0 0 0 0 0 0 0 0 0 0 0\n 33.8110 45.7400 -7.8620 O 0 0 0 0 0 0 0 0 0 0 0 0\n 32.8430 44.8890 -5.8860 C 0 0 0 0 0 0 0 0 0 0 0 0\n 34.1400 44.9080 -5.3400 O 0 0 0 0 0 0 0 0 0 0 0 0\n 34.8520 46.1070 -5.1630 C 0 0 0 0 0 0 0 0 0 0 0 0\n 36.2220 46.0230 -5.1040 C 0 0 0 0 0 0 0 0 0 0 0 0\n 37.0220 47.1300 -4.9660 C 0 0 0 0 0 0 0 0 0 0 0 0\n 36.4580 48.3500 -4.8580 C 0 0 0 0 0 0 0 0 0 0 0 0\n 35.0980 48.4650 -4.9200 C 0 0 0 0 0 0 0 0 0 0 0 0\n 34.3070 47.3610 -5.0650 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4 3 1 0\n 5 4 2 0\n 6 4 1 0\n 7 6 1 0\n 8 7 1 0\n 9 8 2 0\n 9 1 1 0\n 10 9 1 0\n 11 10 2 0\n 12 11 1 0\n 13 2 1 0\n 13 12 2 0\n 13 8 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":219.97,"logp":2.46,"tpsa":46.53,"ha":13,"hacc":2,"hdon":1,"rots":3,"rings":1,"velec":70,"number":0},{"id":37691,"smiles":"O=C(O)Cc1c[nH]c2ccc(Br)cc12","cmpd_id":6498,"prot_id":37602,"protein_code":"Mac1-UCSF-P0415A:ZINC000000404314","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-UCSF-P0415_0A_apo_I8KjqNz.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 14 15 0 0 0 0 0 0 0 0999 V2000\n 33.0950 46.5480 -7.7750 O 0 0 0 0 0 0 0 0 0 0 0 0\n 32.0840 45.9400 -7.5150 C 0 0 0 0 0 0 0 0 0 0 0 0\n 31.1420 45.9550 -8.2740 O 0 0 0 0 0 0 0 0 0 0 0 0\n 32.1290 45.0910 -6.2510 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.8350 44.9230 -5.5140 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.9150 43.9180 -5.6690 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.9300 44.1400 -4.8650 N 0 0 0 0 0 0 0 0 0 0 0 0\n 29.0740 45.2320 -4.1400 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.3250 45.8780 -3.1280 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.8620 47.0510 -2.6180 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.0590 47.5660 -3.0280 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.7620 46.9410 -3.9860 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.2910 45.7780 -4.5170 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.6570 49.1930 -2.1400 Br 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 2 0\n 4 2 1 0\n 5 4 1 0\n 6 5 2 0\n 7 6 1 0\n 8 7 1 0\n 9 8 2 0\n 10 9 1 0\n 11 10 2 0\n 12 11 1 0\n 13 5 1 0\n 13 12 2 0\n 13 8 1 0\n 14 11 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":252.97,"logp":2.56,"tpsa":53.09,"ha":14,"hacc":1,"hdon":2,"rots":2,"rings":2,"velec":72,"number":0},{"id":37692,"smiles":"O=C(O)Cc1noc2ccccc12","cmpd_id":6499,"prot_id":37603,"protein_code":"Mac1-UCSF-P0417A:ZINC000000161692","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-UCSF-P0417_0A_apo_yxXLboM.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 13 14 0 0 0 0 0 0 0 0999 V2000\n 31.4580 45.6530 -8.0370 O 0 0 0 0 0 0 0 0 0 0 0 0\n 32.4850 45.6910 -7.3650 C 0 0 0 0 0 0 0 0 0 0 0 0\n 33.6160 45.7560 -7.9550 O 0 0 0 0 0 0 0 0 0 0 0 0\n 32.4530 45.6450 -5.8470 C 0 0 0 0 0 0 0 0 0 0 0 0\n 33.8020 45.3900 -5.2290 C 0 0 0 0 0 0 0 0 0 0 0 0\n 34.2320 44.2500 -4.7560 N 0 0 0 0 0 0 0 0 0 0 0 0\n 35.4460 44.3600 -4.2380 O 0 0 0 0 0 0 0 0 0 0 0 0\n 35.9060 45.5540 -4.4510 C 0 0 0 0 0 0 0 0 0 0 0 0\n 37.1220 46.1980 -4.0820 C 0 0 0 0 0 0 0 0 0 0 0 0\n 37.2860 47.5680 -4.3550 C 0 0 0 0 0 0 0 0 0 0 0 0\n 36.2520 48.2460 -4.8700 C 0 0 0 0 0 0 0 0 0 0 0 0\n 35.1020 47.6280 -5.1990 C 0 0 0 0 0 0 0 0 0 0 0 0\n 34.9050 46.3040 -5.0220 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 2 0\n 4 2 1 0\n 5 4 1 0\n 6 5 2 0\n 7 6 1 0\n 8 7 1 0\n 9 8 2 0\n 10 9 1 0\n 11 10 2 0\n 12 11 1 0\n 13 12 2 0\n 13 8 1 0\n 13 5 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":177.04,"logp":1.45,"tpsa":63.33,"ha":13,"hacc":3,"hdon":1,"rots":2,"rings":2,"velec":66,"number":0},{"id":37694,"smiles":"O=C(O)CCc1nc2ccccc2[nH]c1=O","cmpd_id":6501,"prot_id":37605,"protein_code":"Mac1-UCSF-P0436A:ZINC000008861082","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-UCSF-P0436_0A_apo_isEasef.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 16 17 0 0 0 0 0 0 0 0999 V2000\n 33.2410 45.9010 -8.1610 O 0 0 0 0 0 0 0 0 0 0 0 0\n 32.1710 45.4860 -7.7710 C 0 0 0 0 0 0 0 0 0 0 0 0\n 31.1390 45.6630 -8.4500 O 0 0 0 0 0 0 0 0 0 0 0 0\n 32.1220 44.6500 -6.4810 C 0 0 0 0 0 0 0 0 0 0 0 0\n 32.1200 45.4560 -5.2440 C 0 0 0 0 0 0 0 0 0 0 0 0\n 33.4480 46.1460 -5.1210 C 0 0 0 0 0 0 0 0 0 0 0 0\n 34.5430 45.3690 -4.7470 N 0 0 0 0 0 0 0 0 0 0 0 0\n 35.8530 45.9800 -4.6640 C 0 0 0 0 0 0 0 0 0 0 0 0\n 36.9260 45.2250 -4.2650 C 0 0 0 0 0 0 0 0 0 0 0 0\n 38.1950 45.8360 -4.1430 C 0 0 0 0 0 0 0 0 0 0 0 0\n 38.3190 47.1760 -4.4250 C 0 0 0 0 0 0 0 0 0 0 0 0\n 37.2500 47.9460 -4.8410 C 0 0 0 0 0 0 0 0 0 0 0 0\n 35.9890 47.3510 -4.9350 C 0 0 0 0 0 0 0 0 0 0 0 0\n 34.8740 48.1570 -5.3650 N 0 0 0 0 0 0 0 0 0 0 0 0\n 33.5940 47.5360 -5.4680 C 0 0 0 0 0 0 0 0 0 0 0 0\n 32.6770 48.1650 -5.7890 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 2 0\n 4 2 1 0\n 5 4 1 0\n 6 5 1 0\n 7 6 2 0\n 8 7 1 0\n 9 8 2 0\n 10 9 1 0\n 11 10 2 0\n 12 11 1 0\n 13 12 2 0\n 13 8 1 0\n 14 13 1 0\n 15 14 1 0\n 15 6 1 0\n 16 15 2 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":218.07,"logp":0.94,"tpsa":83.05,"ha":16,"hacc":3,"hdon":2,"rots":3,"rings":2,"velec":82,"number":0},{"id":37695,"smiles":"O=C(O)CCn1cnc2ccccc21","cmpd_id":6502,"prot_id":37606,"protein_code":"Mac1-UCSF-P0437A:ZINC000000194295","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-UCSF-P0437_0A_apo_mD0eRic.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 14 15 0 0 0 0 0 0 0 0999 V2000\n 31.2830 45.6420 -8.2420 O 0 0 0 0 0 0 0 0 0 0 0 0\n 32.3460 45.3360 -7.6380 C 0 0 0 0 0 0 0 0 0 0 0 0\n 33.4530 45.6830 -8.1220 O 0 0 0 0 0 0 0 0 0 0 0 0\n 32.2730 44.5420 -6.3190 C 0 0 0 0 0 0 0 0 0 0 0 0\n 32.3020 45.3630 -5.0190 C 0 0 0 0 0 0 0 0 0 0 0 0\n 33.5050 46.1740 -4.9850 N 0 0 0 0 0 0 0 0 0 0 0 0\n 33.5690 47.4450 -5.2810 C 0 0 0 0 0 0 0 0 0 0 0 0\n 34.8110 47.8720 -5.1840 N 0 0 0 0 0 0 0 0 0 0 0 0\n 35.5720 46.8560 -4.8320 C 0 0 0 0 0 0 0 0 0 0 0 0\n 36.9500 46.7670 -4.5940 C 0 0 0 0 0 0 0 0 0 0 0 0\n 37.4770 45.5590 -4.2050 C 0 0 0 0 0 0 0 0 0 0 0 0\n 36.6530 44.4450 -4.0660 C 0 0 0 0 0 0 0 0 0 0 0 0\n 35.2970 44.5380 -4.3180 C 0 0 0 0 0 0 0 0 0 0 0 0\n 34.7510 45.7580 -4.7020 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 2 0\n 4 2 1 0\n 5 4 1 0\n 6 5 1 0\n 7 6 1 0\n 8 7 2 0\n 9 8 1 0\n 10 9 2 0\n 11 10 1 0\n 12 11 2 0\n 13 12 1 0\n 14 13 2 0\n 14 9 1 0\n 14 6 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":190.07,"logp":1.51,"tpsa":55.12,"ha":14,"hacc":3,"hdon":1,"rots":3,"rings":2,"velec":72,"number":0},{"id":37696,"smiles":"O=C(O)c1cc2c(Cl)cccc2[nH]1","cmpd_id":6503,"prot_id":37607,"protein_code":"Mac1-UCSF-P0439A:ZINC000001683100","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-UCSF-P0439_0A_apo_9NowOHZ.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 13 14 0 0 0 0 0 0 0 0999 V2000\n 30.2090 48.3440 -2.6670 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 30.0250 43.7520 -7.7920 O 0 0 0 0 0 0 0 0 0 0 0 0\n 30.2140 44.8930 -7.3810 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.7580 45.7610 -8.0740 O 0 0 0 0 0 0 0 0 0 0 0 0\n 29.7080 45.2270 -5.9960 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.0510 46.3180 -5.2060 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.3170 46.1690 -4.0320 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.2120 46.9070 -2.8710 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.3780 46.5260 -1.8530 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.5990 45.4290 -2.0080 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.7070 44.6390 -3.1450 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.5790 45.0330 -4.1750 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.8440 44.4890 -5.3870 N 0 0 0 0 0 0 0 0 0 0 0 0\n 3 2 1 0\n 4 3 2 0\n 5 3 1 0\n 6 5 2 0\n 7 6 1 0\n 8 7 2 0\n 8 1 1 0\n 9 8 1 0\n 10 9 2 0\n 11 10 1 0\n 12 11 2 0\n 12 7 1 0\n 13 5 1 0\n 13 12 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":195.01,"logp":2.52,"tpsa":53.09,"ha":13,"hacc":1,"hdon":2,"rots":1,"rings":2,"velec":66,"number":0},{"id":37697,"smiles":"O=C(O)Cn1nc(C(F)(F)F)c2c1CCCC2","cmpd_id":6504,"prot_id":37608,"protein_code":"Mac1-UCSF-P0441A:ZINC000004976927","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-UCSF-P0441_0A_apo_WBuIxeV.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 17 18 0 0 0 0 0 0 0 0999 V2000\n 33.6450 45.7720 -7.7630 O 0 0 0 0 0 0 0 0 0 0 0 0\n 32.5180 45.6900 -7.2360 C 0 0 0 0 0 0 0 0 0 0 0 0\n 31.4860 45.5860 -7.9330 O 0 0 0 0 0 0 0 0 0 0 0 0\n 32.4400 45.6580 -5.7260 C 0 0 0 0 0 0 0 0 0 0 0 0\n 33.7380 45.4110 -5.1020 N 0 0 0 0 0 0 0 0 0 0 0 0\n 34.0910 44.3150 -4.5380 N 0 0 0 0 0 0 0 0 0 0 0 0\n 35.2520 44.3540 -4.0710 C 0 0 0 0 0 0 0 0 0 0 0 0\n 35.7530 45.6380 -4.3200 C 0 0 0 0 0 0 0 0 0 0 0 0\n 37.0850 46.2860 -3.9840 C 0 0 0 0 0 0 0 0 0 0 0 0\n 37.1770 47.6620 -4.6490 C 0 0 0 0 0 0 0 0 0 0 0 0\n 35.8730 48.4520 -4.6200 C 0 0 0 0 0 0 0 0 0 0 0 0\n 34.7940 47.7230 -5.4450 C 0 0 0 0 0 0 0 0 0 0 0 0\n 34.7030 46.2710 -4.9720 C 0 0 0 0 0 0 0 0 0 0 0 0\n 35.9340 43.2260 -3.3480 C 0 0 0 0 0 0 0 0 0 0 0 0\n 36.9650 42.7730 -4.0400 F 0 0 0 0 0 0 0 0 0 0 0 0\n 36.3580 43.6750 -2.1670 F 0 0 0 0 0 0 0 0 0 0 0 0\n 35.0620 42.2170 -3.0630 F 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 2 0\n 4 2 1 0\n 5 4 1 0\n 6 5 1 0\n 7 6 2 0\n 8 7 1 0\n 9 8 1 0\n 10 9 1 0\n 11 10 1 0\n 12 11 1 0\n 13 12 1 0\n 13 8 2 0\n 13 5 1 0\n 14 7 1 0\n 14 15 1 0\n 16 14 1 0\n 17 14 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":248.08,"logp":1.87,"tpsa":55.12,"ha":17,"hacc":3,"hdon":1,"rots":2,"rings":2,"velec":94,"number":0},{"id":37701,"smiles":"C[C@@](O)(C(=O)O)c1ccccc1","cmpd_id":6508,"prot_id":37612,"protein_code":"Mac1-UCSF-P0455A:ZINC000000161958","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-UCSF-P0455_0A_apo_jBSDM2z.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 12 12 0 0 0 0 0 0 0 0999 V2000\n 30.1590 48.6080 -6.0580 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.6450 47.2050 -5.7600 C 0 0 1 0 0 0 0 0 0 0 0 0\n 29.8780 46.8320 -4.6960 O 0 0 0 0 0 0 0 0 0 0 0 0\n 30.2500 46.4380 -7.0020 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.1390 45.8800 -7.0990 O 0 0 0 0 0 0 0 0 0 0 0 0\n 30.9860 46.3240 -7.9800 O 0 0 0 0 0 0 0 0 0 0 0 0\n 32.1370 47.0130 -5.4590 C 0 0 0 0 0 0 0 0 0 0 0 0\n 32.6280 45.7600 -5.2950 C 0 0 0 0 0 0 0 0 0 0 0 0\n 33.9820 45.5710 -5.0360 C 0 0 0 0 0 0 0 0 0 0 0 0\n 34.8450 46.6490 -4.9730 C 0 0 0 0 0 0 0 0 0 0 0 0\n 34.3570 47.9150 -5.1560 C 0 0 0 0 0 0 0 0 0 0 0 0\n 32.9700 48.0750 -5.3870 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 6\n 3 2 1 0\n 4 2 1 0\n 5 4 2 0\n 6 4 1 0\n 7 2 1 0\n 8 7 2 0\n 9 8 1 0\n 10 9 2 0\n 11 10 1 0\n 12 7 1 0\n 12 11 2 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":166.06,"logp":0.98,"tpsa":57.53,"ha":12,"hacc":2,"hdon":2,"rots":2,"rings":1,"velec":64,"number":0},{"id":37710,"smiles":"O=C([O-])C(F)(F)F","cmpd_id":6620,"prot_id":37621,"protein_code":"Mac1-UCSF-P0524A:TFA","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-UCSF-P0524_0A_apo_AO2nFg5.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 7 6 0 0 0 0 0 0 0 0999 V2000\n 33.4020 45.9580 -7.7660 O 0 0 0 0 0 0 0 0 0 0 0 0\n 32.3520 45.4380 -7.5780 C 0 0 0 0 0 0 0 0 0 0 0 0\n 31.3250 45.5170 -8.2450 O 0 0 0 0 0 0 0 0 0 0 0 0\n 32.3300 44.4250 -6.3870 C 0 0 0 0 0 0 0 0 0 0 0 0\n 32.1790 43.2250 -6.8070 F 0 0 0 0 0 0 0 0 0 0 0 0\n 33.3630 44.4090 -5.6950 F 0 0 0 0 0 0 0 0 0 0 0 0\n 31.4120 44.6420 -5.5820 F 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 2 0\n 4 2 1 0\n 4 5 1 0\n 6 4 1 0\n 7 4 1 0\nM CHG 1 1 -1\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":113.99,"logp":0.63,"tpsa":37.3,"ha":7,"hacc":1,"hdon":1,"rots":0,"rings":0,"velec":42,"number":0},{"id":37712,"smiles":"COc1ccc2[nH]cc(CC(=O)O)c2c1","cmpd_id":6517,"prot_id":37623,"protein_code":"Mac1-UCSF-P0546A:ZINC000000057162","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-UCSF-P0546_0A_apo_8ddUTMW.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 15 16 0 0 0 0 0 0 0 0999 V2000\n 30.7740 49.5660 -2.1890 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.5590 48.8490 -2.2220 O 0 0 0 0 0 0 0 0 0 0 0 0\n 29.4900 47.6050 -2.8710 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.4290 46.7630 -2.6160 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.2880 45.5400 -3.2250 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.2430 45.1260 -4.1520 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.3580 44.0130 -4.8800 N 0 0 0 0 0 0 0 0 0 0 0 0\n 30.4350 44.0430 -5.6040 C 0 0 0 0 0 0 0 0 0 0 0 0\n 31.0770 45.2250 -5.3560 C 0 0 0 0 0 0 0 0 0 0 0 0\n 32.3600 45.6710 -6.0010 C 0 0 0 0 0 0 0 0 0 0 0 0\n 32.2560 46.1890 -7.4230 C 0 0 0 0 0 0 0 0 0 0 0 0\n 31.2710 46.1180 -8.1820 O 0 0 0 0 0 0 0 0 0 0 0 0\n 33.2840 46.6980 -7.8420 O 0 0 0 0 0 0 0 0 0 0 0 0\n 30.3090 45.9420 -4.3920 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.4200 47.1830 -3.7700 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 1 0\n 4 3 2 0\n 5 4 1 0\n 6 5 2 0\n 7 6 1 0\n 8 7 1 0\n 9 8 2 0\n 10 9 1 0\n 11 10 1 0\n 12 11 2 0\n 13 11 1 0\n 14 9 1 0\n 14 6 1 0\n 15 14 2 0\n 15 3 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":205.07,"logp":1.8,"tpsa":62.32,"ha":15,"hacc":2,"hdon":2,"rots":3,"rings":2,"velec":78,"number":0},{"id":37725,"smiles":"C[C@H](SCC(=O)O)C(=O)N1CCNC1=O","cmpd_id":6528,"prot_id":37636,"protein_code":"Mac1-UCSF-P0587A:ZINC000736709772","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-UCSF-P0587_0A_apo_OfbR8t0.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 15 15 0 0 0 0 0 0 0 0999 V2000\n 29.2260 45.6900 -4.7870 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.2170 46.7280 -5.3450 C 0 0 2 0 0 0 0 0 0 0 0 0\n 31.9850 46.2390 -5.0570 S 0 0 0 0 0 0 0 0 0 0 0 0\n 33.0820 46.6080 -6.4180 C 0 0 0 0 0 0 0 0 0 0 0 0\n 32.6910 45.9420 -7.7230 C 0 0 0 0 0 0 0 0 0 0 0 0\n 33.7290 45.8460 -8.3440 O 0 0 0 0 0 0 0 0 0 0 0 0\n 31.5480 45.6230 -8.2200 O 0 0 0 0 0 0 0 0 0 0 0 0\n 29.9960 48.1830 -4.9650 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.2790 48.6990 -3.9700 O 0 0 0 0 0 0 0 0 0 0 0 0\n 29.5160 49.0800 -5.9050 N 0 0 0 0 0 0 0 0 0 0 0 0\n 29.3200 50.4740 -5.7060 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.7420 50.9880 -6.9820 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.5940 49.8680 -7.8550 N 0 0 0 0 0 0 0 0 0 0 0 0\n 29.0610 48.7130 -7.1960 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.0470 47.6370 -7.6150 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 1\n 3 2 1 0\n 4 3 1 0\n 5 4 1 0\n 6 5 2 0\n 7 5 1 0\n 8 2 1 0\n 9 8 2 0\n 10 8 1 0\n 11 10 1 0\n 12 11 1 0\n 13 12 1 0\n 14 13 1 0\n 14 10 1 0\n 15 14 2 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":232.05,"logp":-0.26,"tpsa":86.71,"ha":15,"hacc":4,"hdon":2,"rots":4,"rings":1,"velec":84,"number":0}],"238509":[{"id":37492,"smiles":"COc1ccc(C)cc1NC(=O)Nn1cnnc1","cmpd_id":589,"prot_id":37403,"protein_code":"Mac1-DLS-X0228B:Z2234920345","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-X0228_0B_apo_d4xlgQq.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 18 19 0 0 0 0 0 0 0 0999 V2000\n 26.0080 49.0200 8.9500 O 0 0 0 0 0 0 0 0 0 0 0 0\n 25.2020 48.4480 9.6790 C 0 0 0 0 0 0 0 0 0 0 0 0\n 24.9770 48.7980 10.9570 N 0 0 0 0 0 0 0 0 0 0 0 0\n 25.6270 49.8500 11.6010 N 0 0 0 0 0 0 0 0 0 0 0 0\n 25.0590 51.0350 11.9330 C 0 0 0 0 0 0 0 0 0 0 0 0\n 25.9180 51.7800 12.5710 N 0 0 0 0 0 0 0 0 0 0 0 0\n 27.1040 51.0550 12.6570 N 0 0 0 0 0 0 0 0 0 0 0 0\n 26.8980 49.9110 12.0680 C 0 0 0 0 0 0 0 0 0 0 0 0\n 24.4230 47.3880 9.2870 N 0 0 0 0 0 0 0 0 0 0 0 0\n 24.4790 46.6630 8.0720 C 0 0 0 0 0 0 0 0 0 0 0 0\n 24.2870 45.2830 8.1690 C 0 0 0 0 0 0 0 0 0 0 0 0\n 24.1300 44.8220 9.4490 O 0 0 0 0 0 0 0 0 0 0 0 0\n 23.9910 43.4200 9.6450 C 0 0 0 0 0 0 0 0 0 0 0 0\n 24.6880 47.2350 6.8200 C 0 0 0 0 0 0 0 0 0 0 0 0\n 24.6990 46.4570 5.6700 C 0 0 0 0 0 0 0 0 0 0 0 0\n 24.9300 47.0870 4.3190 C 0 0 0 0 0 0 0 0 0 0 0 0\n 24.4920 45.0850 5.7930 C 0 0 0 0 0 0 0 0 0 0 0 0\n 24.2900 44.4910 7.0280 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 2 0\n 3 2 1 0\n 4 3 1 0\n 5 4 1 0\n 6 5 2 0\n 7 6 1 0\n 8 7 2 0\n 8 4 1 0\n 9 2 1 0\n 10 9 1 0\n 11 10 2 0\n 12 11 1 0\n 13 12 1 0\n 14 10 1 0\n 15 14 2 0\n 16 15 1 0\n 17 15 1 0\n 18 17 2 0\n 18 11 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":247.11,"logp":1.37,"tpsa":81.07,"ha":18,"hacc":5,"hdon":2,"rots":3,"rings":2,"velec":94,"number":228},{"id":37501,"smiles":"Cc1c(Cl)cccc1NC(=O)CN","cmpd_id":139,"prot_id":37412,"protein_code":"Mac1-DLS-X0380B:Z85956652","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-X0380_0B_apo_49LoDiW.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 13 13 0 0 0 0 0 0 0 0999 V2000\n 19.4390 44.5790 12.4640 O 0 0 0 0 0 0 0 0 0 0 0 0\n 20.4990 44.1820 11.9930 C 0 0 0 0 0 0 0 0 0 0 0 0\n 20.9310 42.7150 12.1660 C 0 0 0 0 0 0 0 0 0 0 0 0\n 20.6440 42.3320 13.5630 N 0 0 0 0 0 0 0 0 0 0 0 0\n 21.3750 44.9670 11.3330 N 0 0 0 0 0 0 0 0 0 0 0 0\n 21.3070 46.3690 11.1720 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.0080 46.9050 9.9090 C 0 0 0 0 0 0 0 0 0 0 0 0\n 20.6380 46.0120 8.7490 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.5860 47.2000 12.2580 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.5660 48.5750 12.1000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.2870 49.1270 10.8660 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.0420 48.2910 9.7970 C 0 0 0 0 0 0 0 0 0 0 0 0\n 20.9160 49.0190 8.2380 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 2 0\n 3 2 1 0\n 4 3 1 0\n 5 2 1 0\n 6 5 1 0\n 7 6 2 0\n 8 7 1 0\n 9 6 1 0\n 10 9 2 0\n 11 10 1 0\n 12 7 1 0\n 12 11 2 0\n 13 12 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":198.06,"logp":1.55,"tpsa":55.12,"ha":13,"hacc":2,"hdon":2,"rots":2,"rings":1,"velec":70,"number":380},{"id":37502,"smiles":"CN[C@@H]1CCN(c2ccccc2F)C1=O","cmpd_id":3950,"prot_id":37413,"protein_code":"Mac1-DLS-X0417B:Z1186029914","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-X0417_0B_apo_k2n04kz.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 15 16 0 0 0 0 0 0 0 0999 V2000\n 20.3310 45.7200 8.3180 F 0 0 0 0 0 0 0 0 0 0 0 0\n 20.6500 46.6640 9.2190 C 0 0 0 0 0 0 0 0 0 0 0 0\n 20.6230 47.9800 8.8310 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.0170 48.9440 9.7430 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.4310 48.5790 11.0160 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.4510 47.2440 11.3990 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.0510 46.2580 10.5030 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.1400 44.8720 10.8670 N 0 0 0 0 0 0 0 0 0 0 0 0\n 22.2730 44.0370 10.4350 C 0 0 0 0 0 0 0 0 0 0 0 0\n 22.3160 42.9540 11.5040 C 0 0 0 0 0 0 0 0 0 0 0 0\n 20.2620 44.1950 11.6720 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.2040 44.6230 12.0870 O 0 0 0 0 0 0 0 0 0 0 0 0\n 20.8580 42.8250 11.9740 C 0 0 2 0 0 0 0 0 0 0 0 0\n 20.6920 42.4710 13.3910 N 0 0 0 0 0 0 0 0 0 0 0 0\n 20.8790 41.0630 13.7420 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 2 0\n 4 3 1 0\n 5 4 2 0\n 6 5 1 0\n 7 2 1 0\n 7 6 2 0\n 8 7 1 0\n 9 8 1 0\n 10 9 1 0\n 11 8 1 0\n 12 11 2 0\n 13 11 1 0\n 13 10 1 0\n 13 14 1 1\n 15 14 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":208.1,"logp":1.15,"tpsa":32.34,"ha":15,"hacc":2,"hdon":1,"rots":2,"rings":2,"velec":80,"number":417},{"id":37505,"smiles":"C[C@@H](Oc1ccc(Cl)cc1)C(N)=O","cmpd_id":3951,"prot_id":37416,"protein_code":"Mac1-DLS-X0436B:Z19727416","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-X0436_0B_apo_DkH1j8a.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 13 13 0 0 0 0 0 0 0 0999 V2000\n 21.7400 49.2490 15.0980 O 0 0 0 0 0 0 0 0 0 0 0 0\n 22.1650 49.9130 14.1510 C 0 0 0 0 0 0 0 0 0 0 0 0\n 23.4520 50.0910 13.9050 N 0 0 0 0 0 0 0 0 0 0 0 0\n 21.1760 50.5540 13.1890 C 0 0 1 0 0 0 0 0 0 0 0 0\n 20.8920 51.9800 13.6020 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.8010 50.6180 11.9090 O 0 0 0 0 0 0 0 0 0 0 0 0\n 21.6300 49.5600 11.0420 C 0 0 0 0 0 0 0 0 0 0 0 0\n 20.8970 49.7770 9.8860 C 0 0 0 0 0 0 0 0 0 0 0 0\n 20.5860 48.7130 9.0600 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.0080 47.4470 9.4050 C 0 0 0 0 0 0 0 0 0 0 0 0\n 20.3990 46.0800 8.5210 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 21.8010 47.2310 10.5120 C 0 0 0 0 0 0 0 0 0 0 0 0\n 22.1110 48.2950 11.3380 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 2 0\n 3 2 1 0\n 4 2 1 0\n 4 5 1 1\n 6 4 1 0\n 7 6 1 0\n 8 7 2 0\n 9 8 1 0\n 10 9 2 0\n 11 10 1 0\n 12 10 1 0\n 13 7 1 0\n 13 12 2 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":199.04,"logp":1.59,"tpsa":52.32,"ha":13,"hacc":2,"hdon":1,"rots":3,"rings":1,"velec":70,"number":436},{"id":37541,"smiles":"O=C(O)[C@@H]1CCC[C@@H]1c1ccsc1","cmpd_id":3964,"prot_id":37452,"protein_code":"Mac1-DLS-X0766B:POB0128","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-X0766_0B_apo_PDs9Wrh.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 13 14 0 0 0 0 0 0 0 0999 V2000\n 23.8020 49.2410 11.0370 O 0 0 0 0 0 0 0 0 0 0 0 0\n 23.9270 48.2350 10.2090 C 0 0 0 0 0 0 0 0 0 0 0 0\n 24.5040 47.2340 10.4920 O 0 0 0 0 0 0 0 0 0 0 0 0\n 23.2230 48.3700 8.8790 C 0 0 2 0 0 0 0 0 0 0 0 0\n 21.2790 47.1920 11.3320 C 0 0 0 0 0 0 0 0 0 0 0 0\n 20.9860 46.0410 12.0070 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.1170 45.7230 9.5730 C 0 0 0 0 0 0 0 0 0 0 0 0\n 23.3290 49.7500 8.2030 C 0 0 0 0 0 0 0 0 0 0 0 0\n 22.0170 50.4640 8.5150 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.3650 47.0170 9.9200 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.7140 48.0920 8.9280 C 0 0 1 0 0 0 0 0 0 0 0 0\n 20.8020 44.7510 10.9240 S 0 0 0 0 0 0 0 0 0 0 0 0\n 21.1150 49.4700 9.2340 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 2 0\n 3 2 1 0\n 4 2 1 1\n 6 5 2 0\n 8 4 1 0\n 9 8 1 0\n 10 7 2 0\n 10 5 1 0\n 11 10 1 1\n 11 4 1 0\n 12 7 1 0\n 12 6 1 0\n 13 11 1 0\n 13 9 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":196.06,"logp":2.72,"tpsa":37.3,"ha":13,"hacc":2,"hdon":1,"rots":2,"rings":2,"velec":70,"number":766},{"id":37544,"smiles":"Cc1ccccc1[C@@H]1COC[C@@H]1C(=O)O","cmpd_id":3967,"prot_id":37455,"protein_code":"Mac1-DLS-X0797B:POB0135","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-X0797_0B_apo_diJ1Gpj.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 15 16 0 0 0 0 0 0 0 0999 V2000\n 24.8410 47.7180 9.4830 O 0 0 0 0 0 0 0 0 0 0 0 0\n 24.4440 48.6460 10.1680 C 0 0 0 0 0 0 0 0 0 0 0 0\n 24.6840 48.7870 11.4400 O 0 0 0 0 0 0 0 0 0 0 0 0\n 23.5880 49.7660 9.6360 C 0 0 1 0 0 0 0 0 0 0 0 0\n 23.8000 49.9570 8.1330 C 0 0 0 0 0 0 0 0 0 0 0 0\n 22.5000 50.0190 7.5590 O 0 0 0 0 0 0 0 0 0 0 0 0\n 21.4810 50.1280 8.5550 C 0 0 0 0 0 0 0 0 0 0 0 0\n 22.0680 49.5280 9.8330 C 0 0 1 0 0 0 0 0 0 0 0 0\n 21.6460 48.0910 10.0880 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.4210 47.6280 11.3990 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.4480 48.5490 12.5920 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.5000 47.2070 9.0210 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.1570 45.8820 9.2330 C 0 0 0 0 0 0 0 0 0 0 0 0\n 20.9590 45.4200 10.5090 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.0930 46.2820 11.5820 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 2 0\n 4 2 1 6\n 5 4 1 0\n 6 5 1 0\n 7 6 1 0\n 8 7 1 0\n 8 4 1 0\n 8 9 1 6\n 10 9 2 0\n 11 10 1 0\n 12 9 1 0\n 13 12 2 0\n 14 13 1 0\n 15 14 2 0\n 15 10 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":206.09,"logp":1.81,"tpsa":46.53,"ha":15,"hacc":2,"hdon":1,"rots":2,"rings":2,"velec":80,"number":797},{"id":37566,"smiles":"Nc1ccncc1","cmpd_id":3980,"prot_id":37477,"protein_code":"Mac1-DLS-X0918_1B:Z955123498","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-X0918_1B_apo_3oLfYbP.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 7 7 0 0 0 0 0 0 0 0999 V2000\n 21.3350 44.1330 10.9820 N 0 0 0 0 0 0 0 0 0 0 0 0\n 21.2550 45.4160 10.5340 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.2850 46.4960 11.4160 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.2430 47.7830 10.9140 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.1830 48.0620 9.6010 N 0 0 0 0 0 0 0 0 0 0 0 0\n 21.1500 47.0210 8.7550 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.1770 45.7010 9.1700 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 2 0\n 4 3 1 0\n 5 4 2 0\n 6 5 1 0\n 7 6 2 0\n 7 2 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":94.05,"logp":0.66,"tpsa":38.91,"ha":7,"hacc":2,"hdon":1,"rots":0,"rings":1,"velec":36,"number":918},{"id":37567,"smiles":"Nc1ccncc1","cmpd_id":3980,"prot_id":37478,"protein_code":"Mac1-DLS-X0918_2B:Z955123498","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-X0918_2B_apo_yDTuwtw.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 7 7 0 0 0 0 0 0 0 0999 V2000\n 24.3100 44.3320 5.6430 N 0 0 0 0 0 0 0 0 0 0 0 0\n 24.3870 44.6680 6.9910 C 0 0 0 0 0 0 0 0 0 0 0 0\n 24.6060 45.9850 7.4030 C 0 0 0 0 0 0 0 0 0 0 0 0\n 24.7370 46.2620 8.7530 C 0 0 0 0 0 0 0 0 0 0 0 0\n 24.6580 45.3210 9.7120 N 0 0 0 0 0 0 0 0 0 0 0 0\n 24.4330 44.0580 9.3170 C 0 0 0 0 0 0 0 0 0 0 0 0\n 24.2920 43.6900 7.9890 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 2 0\n 4 3 1 0\n 5 4 2 0\n 6 5 1 0\n 7 6 2 0\n 7 2 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":94.05,"logp":0.66,"tpsa":38.91,"ha":7,"hacc":2,"hdon":1,"rots":0,"rings":1,"velec":36,"number":918}],"238510":[{"id":37671,"smiles":"O=C(O)Cc1c(Cl)cccc1Cl","cmpd_id":6481,"prot_id":37582,"protein_code":"Mac1-UCSF-P0371B:ZINC000000388514","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-UCSF-P0371_0B_apo_wV1m9sG.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 12 12 0 0 0 0 0 0 0 0999 V2000\n 21.0180 48.1130 12.7190 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 22.2040 46.1530 8.0770 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 23.8820 45.5310 10.5530 O 0 0 0 0 0 0 0 0 0 0 0 0\n 22.7460 45.0460 10.8780 C 0 0 0 0 0 0 0 0 0 0 0 0\n 22.5930 43.7990 11.1470 O 0 0 0 0 0 0 0 0 0 0 0 0\n 21.5320 45.9850 10.9910 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.5800 47.3620 10.3070 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.3340 48.4620 11.0430 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.3410 49.7270 10.5390 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.5980 49.9120 9.2000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.8880 48.8160 8.4270 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.8510 47.5680 9.0080 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4 3 1 0\n 5 4 2 0\n 6 4 1 0\n 7 6 1 0\n 8 7 2 0\n 8 1 1 0\n 9 8 1 0\n 10 9 2 0\n 11 10 1 0\n 12 7 1 0\n 12 11 2 0\n 12 2 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":203.97,"logp":2.62,"tpsa":37.3,"ha":12,"hacc":1,"hdon":1,"rots":2,"rings":1,"velec":64,"number":0}],"238511":[{"id":37479,"smiles":"Cn1cc(C(=O)Nc2ccc(O)cc2)cn1","cmpd_id":5088,"prot_id":37390,"protein_code":"Mac1-DLS-EU0860A:Z1263529624","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-EU0860_0A_apo_R5CADbV.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 16 17 0 0 0 0 0 0 0 0999 V2000\n 38.9600 42.2100 -3.3520 O 0 0 0 0 0 0 0 0 0 0 0 0\n 37.8440 42.4550 -2.8930 C 0 0 0 0 0 0 0 0 0 0 0 0\n 37.0610 43.6350 -3.3730 C 0 0 0 0 0 0 0 0 0 0 0 0\n 35.6960 43.9400 -3.2790 C 0 0 0 0 0 0 0 0 0 0 0 0\n 35.4130 45.1250 -3.8000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 37.6040 44.7330 -4.0090 C 0 0 0 0 0 0 0 0 0 0 0 0\n 36.6030 45.5910 -4.2440 N 0 0 0 0 0 0 0 0 0 0 0 0\n 36.6930 46.9170 -4.8410 C 0 0 0 0 0 0 0 0 0 0 0 0\n 37.2330 41.7400 -1.9090 N 0 0 0 0 0 0 0 0 0 0 0 0\n 37.7070 40.5920 -1.2270 C 0 0 0 0 0 0 0 0 0 0 0 0\n 37.2090 40.2570 0.0260 C 0 0 0 0 0 0 0 0 0 0 0 0\n 37.5680 39.0660 0.6250 C 0 0 0 0 0 0 0 0 0 0 0 0\n 38.4370 38.2000 -0.0200 C 0 0 0 0 0 0 0 0 0 0 0 0\n 38.7530 36.9920 0.5270 O 0 0 0 0 0 0 0 0 0 0 0 0\n 38.9660 38.5450 -1.2520 C 0 0 0 0 0 0 0 0 0 0 0 0\n 38.6020 39.7350 -1.8510 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 2 0\n 3 2 1 0\n 4 3 1 0\n 5 4 2 0\n 6 3 2 0\n 7 6 1 0\n 7 5 1 0\n 8 7 1 0\n 9 2 1 0\n 10 9 1 0\n 11 10 2 0\n 12 11 1 0\n 13 12 2 0\n 14 13 1 0\n 15 13 1 0\n 16 10 1 0\n 16 15 2 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":217.09,"logp":1.38,"tpsa":67.15,"ha":16,"hacc":4,"hdon":2,"rots":2,"rings":2,"velec":82,"number":0},{"id":37480,"smiles":"CCn1cc(NC(=O)c2ccc(F)cc2)cn1","cmpd_id":5089,"prot_id":37391,"protein_code":"Mac1-DLS-EU0906A:Z373769142","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-EU0906_0A_apo_c4dWpMN.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 17 18 0 0 0 0 0 0 0 0999 V2000\n 37.6900 45.8090 -6.1930 C 0 0 0 0 0 0 0 0 0 0 0 0\n 37.3760 46.5230 -4.9380 C 0 0 0 0 0 0 0 0 0 0 0 0\n 37.0380 45.5600 -3.9040 N 0 0 0 0 0 0 0 0 0 0 0 0\n 36.1710 45.8900 -2.9260 N 0 0 0 0 0 0 0 0 0 0 0 0\n 36.0230 44.7960 -2.1960 C 0 0 0 0 0 0 0 0 0 0 0 0\n 36.8240 43.7650 -2.6840 C 0 0 0 0 0 0 0 0 0 0 0 0\n 36.8810 42.4510 -2.1960 N 0 0 0 0 0 0 0 0 0 0 0 0\n 37.8860 41.5490 -2.3770 C 0 0 0 0 0 0 0 0 0 0 0 0\n 37.9890 40.4810 -1.3480 C 0 0 0 0 0 0 0 0 0 0 0 0\n 37.1760 40.5100 -0.2200 C 0 0 0 0 0 0 0 0 0 0 0 0\n 37.2390 39.5040 0.7260 C 0 0 0 0 0 0 0 0 0 0 0 0\n 38.8640 39.4150 -1.5220 C 0 0 0 0 0 0 0 0 0 0 0 0\n 38.9310 38.3980 -0.5860 C 0 0 0 0 0 0 0 0 0 0 0 0\n 38.1120 38.4740 0.5090 C 0 0 0 0 0 0 0 0 0 0 0 0\n 38.1710 37.4750 1.4320 F 0 0 0 0 0 0 0 0 0 0 0 0\n 38.6640 41.5990 -3.3170 O 0 0 0 0 0 0 0 0 0 0 0 0\n 37.4220 44.2690 -3.8100 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 1 0\n 4 3 1 0\n 5 4 2 0\n 6 5 1 0\n 7 6 1 0\n 8 7 1 0\n 9 8 1 0\n 10 9 2 0\n 11 10 1 0\n 12 9 1 0\n 13 12 2 0\n 14 11 2 0\n 14 13 1 0\n 15 14 1 0\n 16 8 2 0\n 17 6 2 0\n 17 3 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":233.1,"logp":2.29,"tpsa":46.92,"ha":17,"hacc":3,"hdon":1,"rots":3,"rings":2,"velec":88,"number":0},{"id":37481,"smiles":"Cc1c(NS(C)(=O)=O)c(=O)n(-c2ccccc2)n1C","cmpd_id":5090,"prot_id":37392,"protein_code":"Mac1-DLS-EU0960A:Z45612755","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-EU0960_0A_apo_2ABhv2s.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 19 20 0 0 0 0 0 0 0 0999 V2000\n 35.2510 48.2620 -5.4860 C 0 0 0 0 0 0 0 0 0 0 0 0\n 35.2790 46.8330 -5.0690 C 0 0 0 0 0 0 0 0 0 0 0 0\n 36.4280 46.2390 -4.6230 N 0 0 0 0 0 0 0 0 0 0 0 0\n 37.6390 46.9050 -4.1470 C 0 0 0 0 0 0 0 0 0 0 0 0\n 36.0730 44.9510 -4.1700 N 0 0 0 0 0 0 0 0 0 0 0 0\n 34.8010 44.6450 -4.6450 C 0 0 0 0 0 0 0 0 0 0 0 0\n 34.2580 43.5400 -4.4850 O 0 0 0 0 0 0 0 0 0 0 0 0\n 37.0460 43.9730 -3.7890 C 0 0 0 0 0 0 0 0 0 0 0 0\n 36.6780 42.9540 -2.9180 C 0 0 0 0 0 0 0 0 0 0 0 0\n 37.5950 41.9640 -2.6040 C 0 0 0 0 0 0 0 0 0 0 0 0\n 38.8060 41.8990 -3.2630 C 0 0 0 0 0 0 0 0 0 0 0 0\n 39.1220 42.8510 -4.2100 C 0 0 0 0 0 0 0 0 0 0 0 0\n 38.2250 43.8640 -4.5160 C 0 0 0 0 0 0 0 0 0 0 0 0\n 34.3060 45.8840 -5.2030 C 0 0 0 0 0 0 0 0 0 0 0 0\n 33.0420 46.1080 -5.7780 N 0 0 0 0 0 0 0 0 0 0 0 0\n 32.6470 45.6240 -7.3030 S 0 0 0 0 0 0 0 0 0 0 0 0\n 32.1190 43.9480 -7.1690 C 0 0 0 0 0 0 0 0 0 0 0 0\n 33.8280 45.6800 -8.0960 O 0 0 0 0 0 0 0 0 0 0 0 0\n 31.5290 46.4020 -7.7200 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 1 0\n 4 3 1 0\n 5 3 1 0\n 6 5 1 0\n 7 6 2 0\n 8 5 1 0\n 9 8 2 0\n 10 9 1 0\n 11 10 2 0\n 12 11 1 0\n 13 8 1 0\n 13 12 2 0\n 14 6 1 0\n 14 2 2 0\n 15 14 1 0\n 16 15 1 0\n 16 17 1 0\n 18 16 2 0\n 19 16 2 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":281.08,"logp":0.86,"tpsa":73.1,"ha":19,"hacc":5,"hdon":1,"rots":3,"rings":2,"velec":102,"number":0},{"id":37485,"smiles":"O=C(Nc1ccccc1)Nc1cccnc1","cmpd_id":3840,"prot_id":37396,"protein_code":"Mac1-DLS-X0128_1A:Z44592329","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-X0128_1A_apo_mCVh9Vt.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 16 17 0 0 0 0 0 0 0 0999 V2000\n 38.9500 41.7200 -3.0400 O 0 0 0 0 0 0 0 0 0 0 0 0\n 37.8330 41.8790 -2.5560 C 0 0 0 0 0 0 0 0 0 0 0 0\n 36.9930 42.9100 -2.8840 N 0 0 0 0 0 0 0 0 0 0 0 0\n 37.2800 44.0620 -3.6480 C 0 0 0 0 0 0 0 0 0 0 0 0\n 38.0890 44.0550 -4.7830 C 0 0 0 0 0 0 0 0 0 0 0 0\n 38.3070 45.1380 -5.5390 N 0 0 0 0 0 0 0 0 0 0 0 0\n 37.7080 46.2770 -5.1700 C 0 0 0 0 0 0 0 0 0 0 0 0\n 36.8910 46.3840 -4.0670 C 0 0 0 0 0 0 0 0 0 0 0 0\n 36.6740 45.2600 -3.2940 C 0 0 0 0 0 0 0 0 0 0 0 0\n 37.3000 41.0810 -1.5800 N 0 0 0 0 0 0 0 0 0 0 0 0\n 37.9190 39.9910 -0.9310 C 0 0 0 0 0 0 0 0 0 0 0 0\n 38.6770 39.0660 -1.6430 C 0 0 0 0 0 0 0 0 0 0 0 0\n 39.2660 38.0000 -0.9820 C 0 0 0 0 0 0 0 0 0 0 0 0\n 39.1020 37.8470 0.3810 C 0 0 0 0 0 0 0 0 0 0 0 0\n 38.3470 38.7610 1.0900 C 0 0 0 0 0 0 0 0 0 0 0 0\n 37.7560 39.8340 0.4420 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 2 0\n 3 2 1 0\n 4 3 1 0\n 5 4 2 0\n 6 5 1 0\n 7 6 2 0\n 8 7 1 0\n 9 8 2 0\n 9 4 1 0\n 10 2 1 0\n 11 10 1 0\n 12 11 2 0\n 13 12 1 0\n 14 13 2 0\n 15 14 1 0\n 16 11 1 0\n 16 15 2 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":213.09,"logp":2.73,"tpsa":54.02,"ha":16,"hacc":2,"hdon":2,"rots":2,"rings":2,"velec":80,"number":128},{"id":37488,"smiles":"c1ccc(CCNc2nc3ccccc3[nH]2)cc1","cmpd_id":451,"prot_id":37399,"protein_code":"Mac1-DLS-X0159B:Z57299529","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-X0159_0B_apo_6ZVn7Q5.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 18 20 0 0 0 0 0 0 0 0999 V2000\n 38.7480 40.6360 -2.6580 N 0 0 0 0 0 0 0 0 0 0 0 0\n 38.5510 39.7740 -1.5860 C 0 0 0 0 0 0 0 0 0 0 0 0\n 39.1090 38.5420 -1.2520 C 0 0 0 0 0 0 0 0 0 0 0 0\n 38.6350 37.8980 -0.1130 C 0 0 0 0 0 0 0 0 0 0 0 0\n 37.6350 38.4750 0.6690 C 0 0 0 0 0 0 0 0 0 0 0 0\n 37.0860 39.7060 0.3300 C 0 0 0 0 0 0 0 0 0 0 0 0\n 37.5430 40.3550 -0.8190 C 0 0 0 0 0 0 0 0 0 0 0 0\n 37.1250 41.5440 -1.4210 N 0 0 0 0 0 0 0 0 0 0 0 0\n 37.8660 41.6550 -2.5150 C 0 0 0 0 0 0 0 0 0 0 0 0\n 37.6900 42.6340 -3.4140 N 0 0 0 0 0 0 0 0 0 0 0 0\n 38.4270 42.7450 -4.6670 C 0 0 0 0 0 0 0 0 0 0 0 0\n 39.6170 43.6960 -4.5490 C 0 0 0 0 0 0 0 0 0 0 0 0\n 40.3640 43.8940 -5.8480 C 0 0 0 0 0 0 0 0 0 0 0 0\n 40.0280 44.9340 -6.7080 C 0 0 0 0 0 0 0 0 0 0 0 0\n 40.7210 45.1270 -7.8920 C 0 0 0 0 0 0 0 0 0 0 0 0\n 41.7680 44.2860 -8.2310 C 0 0 0 0 0 0 0 0 0 0 0 0\n 42.1100 43.2460 -7.3890 C 0 0 0 0 0 0 0 0 0 0 0 0\n 41.4120 43.0500 -6.2050 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 2 0\n 4 3 1 0\n 5 4 2 0\n 6 5 1 0\n 7 6 2 0\n 7 2 1 0\n 8 7 1 0\n 9 8 2 0\n 9 1 1 0\n 10 9 1 0\n 11 10 1 0\n 12 11 1 0\n 13 12 1 0\n 14 13 2 0\n 15 14 1 0\n 16 15 2 0\n 17 16 1 0\n 18 17 2 0\n 18 13 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":237.13,"logp":3.22,"tpsa":40.71,"ha":18,"hacc":2,"hdon":2,"rots":4,"rings":3,"velec":90,"number":159},{"id":37512,"smiles":"CC(=O)Nc1ccc(Nc2ccccc2)cc1","cmpd_id":500,"prot_id":37423,"protein_code":"Mac1-DLS-X0524A:Z68404778","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-X0524_0A_apo_BykC2Ey.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 17 18 0 0 0 0 0 0 0 0999 V2000\n 35.4280 45.5140 -4.2550 O 0 0 0 0 0 0 0 0 0 0 0 0\n 36.5040 46.0730 -4.4290 C 0 0 0 0 0 0 0 0 0 0 0 0\n 36.5960 47.5310 -4.7350 C 0 0 0 0 0 0 0 0 0 0 0 0\n 37.6830 45.4240 -4.3740 N 0 0 0 0 0 0 0 0 0 0 0 0\n 37.9290 44.1060 -3.9380 C 0 0 0 0 0 0 0 0 0 0 0 0\n 38.3800 43.1310 -4.8230 C 0 0 0 0 0 0 0 0 0 0 0 0\n 38.6090 41.8410 -4.3800 C 0 0 0 0 0 0 0 0 0 0 0 0\n 38.4000 41.5080 -3.0470 C 0 0 0 0 0 0 0 0 0 0 0 0\n 37.9580 42.4860 -2.1590 C 0 0 0 0 0 0 0 0 0 0 0 0\n 37.7250 43.7760 -2.6030 C 0 0 0 0 0 0 0 0 0 0 0 0\n 38.6840 40.1930 -2.6430 N 0 0 0 0 0 0 0 0 0 0 0 0\n 38.3940 39.5280 -1.4400 C 0 0 0 0 0 0 0 0 0 0 0 0\n 39.0690 38.3340 -1.1930 C 0 0 0 0 0 0 0 0 0 0 0 0\n 38.7950 37.6120 -0.0440 C 0 0 0 0 0 0 0 0 0 0 0 0\n 37.8610 38.0730 0.8680 C 0 0 0 0 0 0 0 0 0 0 0 0\n 37.1970 39.2610 0.6300 C 0 0 0 0 0 0 0 0 0 0 0 0\n 37.4540 39.9890 -0.5200 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 2 0\n 3 2 1 0\n 4 2 1 0\n 5 4 1 0\n 6 5 2 0\n 7 6 1 0\n 8 7 2 0\n 9 8 1 0\n 10 9 2 0\n 10 5 1 0\n 11 8 1 0\n 12 11 1 0\n 13 12 2 0\n 14 13 1 0\n 15 14 2 0\n 16 15 1 0\n 17 16 2 0\n 17 12 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":226.11,"logp":3.39,"tpsa":41.13,"ha":17,"hacc":2,"hdon":2,"rots":3,"rings":2,"velec":86,"number":524},{"id":37523,"smiles":"CCCN1NN[C@H](NC(O)[C@H]2CCCO2)N1","cmpd_id":4026,"prot_id":37434,"protein_code":"Mac1-DLS-X0631A:Z57446103","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-X0631_0A_apo_25LRXod.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 16 17 0 0 0 0 0 0 0 0999 V2000\n 38.4640 41.3090 -3.1570 O 0 0 0 0 0 0 0 0 0 0 0 0\n 37.6290 41.3710 -2.2510 C 0 0 0 0 0 0 0 0 0 0 0 0\n 37.6980 40.4830 -1.0760 C 0 0 2 0 0 0 0 0 0 0 0 0\n 38.4890 39.3750 -1.1690 O 0 0 0 0 0 0 0 0 0 0 0 0\n 38.2390 38.6370 -0.0420 C 0 0 0 0 0 0 0 0 0 0 0 0\n 37.3470 39.2400 0.7240 C 0 0 0 0 0 0 0 0 0 0 0 0\n 36.9890 40.4360 0.0740 C 0 0 0 0 0 0 0 0 0 0 0 0\n 37.1160 43.8520 -3.9310 N 0 0 0 0 0 0 0 0 0 0 0 0\n 36.2330 43.1760 -3.2160 C 0 0 1 0 0 0 0 0 0 0 0 0\n 36.5720 42.2500 -2.2540 N 0 0 0 0 0 0 0 0 0 0 0 0\n 34.9550 43.5430 -3.4680 N 0 0 0 0 0 0 0 0 0 0 0 0\n 35.0330 44.5110 -4.3510 N 0 0 0 0 0 0 0 0 0 0 0 0\n 36.3190 44.6650 -4.6170 N 0 0 0 0 0 0 0 0 0 0 0 0\n 36.8160 45.6260 -5.5990 C 0 0 0 0 0 0 0 0 0 0 0 0\n 37.7250 46.6390 -4.9730 C 0 0 0 0 0 0 0 0 0 0 0 0\n 37.0390 47.3650 -3.9170 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 1 6\n 4 3 1 0\n 5 4 1 0\n 6 5 1 0\n 7 6 1 0\n 7 3 1 0\n 9 8 1 0\n 9 10 1 1\n 10 2 1 0\n 11 9 1 0\n 12 11 1 0\n 13 12 1 0\n 13 8 1 0\n 14 13 1 0\n 15 14 1 0\n 16 15 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":231.17,"logp":-1.4,"tpsa":80.82,"ha":16,"hacc":7,"hdon":5,"rots":5,"rings":2,"velec":94,"number":631},{"id":37525,"smiles":"Cn1ccc(C(=O)Nc2cccc(C(=O)[O-])c2)n1","cmpd_id":84,"prot_id":37436,"protein_code":"Mac1-DLS-X0662A:Z2856434892","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-X0662_0A_apo_PzNHmDn.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 18 19 0 0 0 0 0 0 0 0999 V2000\n 33.1490 44.4590 -5.1620 O 0 0 0 0 0 0 0 0 0 0 0 0\n 34.0120 45.3650 -5.1570 C 0 0 0 0 0 0 0 0 0 0 0 0\n 33.8620 46.4980 -5.6900 O 0 0 0 0 0 0 0 0 0 0 0 0\n 35.3150 45.0900 -4.4520 C 0 0 0 0 0 0 0 0 0 0 0 0\n 36.3390 46.0310 -4.4790 C 0 0 0 0 0 0 0 0 0 0 0 0\n 37.4960 45.8230 -3.7550 C 0 0 0 0 0 0 0 0 0 0 0 0\n 37.6530 44.6700 -3.0050 C 0 0 0 0 0 0 0 0 0 0 0 0\n 35.4760 43.9170 -3.7130 C 0 0 0 0 0 0 0 0 0 0 0 0\n 36.6470 43.7050 -2.9900 C 0 0 0 0 0 0 0 0 0 0 0 0\n 36.8720 42.5120 -2.2520 N 0 0 0 0 0 0 0 0 0 0 0 0\n 37.9850 41.7100 -2.2920 C 0 0 0 0 0 0 0 0 0 0 0 0\n 38.8740 41.8360 -3.1360 O 0 0 0 0 0 0 0 0 0 0 0 0\n 38.0280 40.5970 -1.3140 C 0 0 0 0 0 0 0 0 0 0 0 0\n 37.1360 40.3500 -0.2050 C 0 0 0 0 0 0 0 0 0 0 0 0\n 37.5310 39.1540 0.3020 C 0 0 0 0 0 0 0 0 0 0 0 0\n 38.9160 39.5950 -1.4680 N 0 0 0 0 0 0 0 0 0 0 0 0\n 38.5920 38.7240 -0.4770 N 0 0 0 0 0 0 0 0 0 0 0 0\n 39.3350 37.4770 -0.3550 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 2 0\n 3 2 1 0\n 4 2 1 0\n 5 4 2 0\n 6 5 1 0\n 7 6 2 0\n 8 4 1 0\n 9 8 2 0\n 9 7 1 0\n 10 9 1 0\n 11 10 1 0\n 12 11 2 0\n 13 11 1 0\n 14 13 1 0\n 15 14 2 0\n 16 13 2 0\n 17 15 1 0\n 17 16 1 0\n 18 17 1 0\nM CHG 1 3 -1\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":245.08,"logp":1.37,"tpsa":84.22,"ha":18,"hacc":4,"hdon":2,"rots":3,"rings":2,"velec":92,"number":662},{"id":37526,"smiles":"CC1=NN(c2ccccc2)C(=O)C1","cmpd_id":85,"prot_id":37437,"protein_code":"Mac1-DLS-X0676B:Z50145861","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-X0676_0B_apo_AR3yRPz.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 13 14 0 0 0 0 0 0 0 0999 V2000\n 38.7160 42.5220 -2.7710 O 0 0 0 0 0 0 0 0 0 0 0 0\n 38.9340 41.5210 -3.4460 C 0 0 0 0 0 0 0 0 0 0 0 0\n 39.3400 41.4710 -4.8950 C 0 0 0 0 0 0 0 0 0 0 0 0\n 39.3580 39.9940 -5.0850 C 0 0 0 0 0 0 0 0 0 0 0 0\n 39.5960 39.3290 -6.4000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 38.8320 40.2250 -3.0120 N 0 0 0 0 0 0 0 0 0 0 0 0\n 39.0990 39.3230 -4.0290 N 0 0 0 0 0 0 0 0 0 0 0 0\n 38.4690 39.7310 -1.7190 C 0 0 0 0 0 0 0 0 0 0 0 0\n 38.9510 38.4980 -1.2850 C 0 0 0 0 0 0 0 0 0 0 0 0\n 38.5470 37.9980 -0.0560 C 0 0 0 0 0 0 0 0 0 0 0 0\n 37.6620 38.7100 0.7340 C 0 0 0 0 0 0 0 0 0 0 0 0\n 37.1840 39.9320 0.3050 C 0 0 0 0 0 0 0 0 0 0 0 0\n 37.5860 40.4550 -0.9150 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 2 0\n 3 2 1 0\n 4 3 1 0\n 5 4 1 0\n 6 2 1 0\n 7 6 1 0\n 7 4 2 0\n 8 6 1 0\n 9 8 2 0\n 10 9 1 0\n 11 10 2 0\n 12 11 1 0\n 13 12 2 0\n 13 8 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":174.08,"logp":1.8,"tpsa":32.67,"ha":13,"hacc":2,"hdon":0,"rots":1,"rings":2,"velec":66,"number":676},{"id":37557,"smiles":"O=C1CCCN1","cmpd_id":3978,"prot_id":37468,"protein_code":"Mac1-DLS-X0900_1A:Z940713508","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-X0900_1A_apo_IQnqMde.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 6 6 0 0 0 0 0 0 0 0999 V2000\n 37.0380 45.2060 -2.2380 O 0 0 0 0 0 0 0 0 0 0 0 0\n 37.0800 45.6200 -3.3920 C 0 0 0 0 0 0 0 0 0 0 0 0\n 37.3190 44.8690 -4.4550 N 0 0 0 0 0 0 0 0 0 0 0 0\n 37.2170 45.5900 -5.7100 C 0 0 0 0 0 0 0 0 0 0 0 0\n 37.2840 47.0370 -5.2820 C 0 0 0 0 0 0 0 0 0 0 0 0\n 36.8820 47.0390 -3.8290 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 2 0\n 3 2 1 0\n 4 3 1 0\n 5 4 1 0\n 6 5 1 0\n 6 2 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":85.05,"logp":-0.1,"tpsa":29.1,"ha":6,"hacc":1,"hdon":1,"rots":0,"rings":1,"velec":34,"number":900},{"id":37579,"smiles":"N#Cc1c[nH]cn1","cmpd_id":3984,"prot_id":37490,"protein_code":"Mac1-DLS-X0962_2A:Z2301685688","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-X0962_2A_apo_7BNZNfc.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 7 7 0 0 0 0 0 0 0 0999 V2000\n 34.5590 42.8740 -3.8370 N 0 0 0 0 0 0 0 0 0 0 0 0\n 35.2990 43.7280 -4.0150 C 0 0 0 0 0 0 0 0 0 0 0 0\n 36.2720 44.7670 -4.2370 C 0 0 0 0 0 0 0 0 0 0 0 0\n 35.9450 46.1080 -4.4450 C 0 0 0 0 0 0 0 0 0 0 0 0\n 37.0250 46.8650 -4.6090 N 0 0 0 0 0 0 0 0 0 0 0 0\n 38.1340 45.9000 -4.5290 C 0 0 0 0 0 0 0 0 0 0 0 0\n 37.5420 44.5630 -4.2740 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 3 0\n 3 2 1 0\n 4 3 2 0\n 5 4 1 0\n 6 5 1 0\n 7 6 2 0\n 7 3 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":93.03,"logp":0.28,"tpsa":52.47,"ha":7,"hacc":2,"hdon":1,"rots":0,"rings":1,"velec":34,"number":962}],"238512":[{"id":37705,"smiles":"O=C1Cc2ccccc2N1","cmpd_id":6512,"prot_id":37616,"protein_code":"Mac1-UCSF-P0509A:ZINC000002020050","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-UCSF-P0509_0A_apo_ZZWqaoP.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 10 11 0 0 0 0 0 0 0 0999 V2000\n 37.4380 48.0700 -6.0790 O 0 0 0 0 0 0 0 0 0 0 0 0\n 37.4210 47.0990 -5.4330 C 0 0 0 0 0 0 0 0 0 0 0 0\n 36.9170 46.9300 -4.0550 C 0 0 0 0 0 0 0 0 0 0 0 0\n 37.1520 45.4900 -3.6800 C 0 0 0 0 0 0 0 0 0 0 0 0\n 36.8910 44.7690 -2.5280 C 0 0 0 0 0 0 0 0 0 0 0 0\n 37.2190 43.4100 -2.4870 C 0 0 0 0 0 0 0 0 0 0 0 0\n 37.8140 42.7600 -3.5920 C 0 0 0 0 0 0 0 0 0 0 0 0\n 38.0690 43.4880 -4.7370 C 0 0 0 0 0 0 0 0 0 0 0 0\n 37.7540 44.8420 -4.7830 C 0 0 0 0 0 0 0 0 0 0 0 0\n 37.9190 45.8440 -5.9020 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 2 0\n 3 2 1 0\n 4 3 1 0\n 5 4 2 0\n 6 5 1 0\n 7 6 2 0\n 8 7 1 0\n 9 8 2 0\n 9 4 1 0\n 10 9 1 0\n 10 2 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":133.05,"logp":1.18,"tpsa":29.1,"ha":10,"hacc":1,"hdon":1,"rots":0,"rings":2,"velec":50,"number":0},{"id":37709,"smiles":"O=C(Nc1nccs1)c1ccccc1","cmpd_id":6515,"prot_id":37620,"protein_code":"Mac1-UCSF-P0522A:ZINC000000039994","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-UCSF-P0522_0A_apo_aEnpNHp.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 14 15 0 0 0 0 0 0 0 0999 V2000\n 37.9970 42.3210 -2.4490 O 0 0 0 0 0 0 0 0 0 0 0 0\n 38.4680 41.2590 -2.6060 C 0 0 0 0 0 0 0 0 0 0 0 0\n 39.2360 40.9350 -3.7890 N 0 0 0 0 0 0 0 0 0 0 0 0\n 39.4610 41.9430 -4.8070 C 0 0 0 0 0 0 0 0 0 0 0 0\n 40.1720 41.8410 -5.9090 N 0 0 0 0 0 0 0 0 0 0 0 0\n 40.2710 42.9060 -6.6880 C 0 0 0 0 0 0 0 0 0 0 0 0\n 39.6100 44.0400 -6.2580 C 0 0 0 0 0 0 0 0 0 0 0 0\n 38.9030 43.5560 -4.7750 S 0 0 0 0 0 0 0 0 0 0 0 0\n 38.2610 40.2300 -1.5130 C 0 0 0 0 0 0 0 0 0 0 0 0\n 39.0020 39.0690 -1.5390 C 0 0 0 0 0 0 0 0 0 0 0 0\n 38.8460 38.1230 -0.5480 C 0 0 0 0 0 0 0 0 0 0 0 0\n 37.9550 38.3520 0.4830 C 0 0 0 0 0 0 0 0 0 0 0 0\n 37.2130 39.5290 0.5160 C 0 0 0 0 0 0 0 0 0 0 0 0\n 37.3740 40.4780 -0.4820 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 2 0\n 3 2 1 0\n 4 3 1 0\n 5 4 2 0\n 6 5 1 0\n 7 6 2 0\n 8 4 1 0\n 8 7 1 0\n 9 2 1 0\n 10 9 2 0\n 11 10 1 0\n 12 11 2 0\n 13 12 1 0\n 14 13 2 0\n 14 9 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":204.04,"logp":2.4,"tpsa":41.99,"ha":14,"hacc":3,"hdon":1,"rots":2,"rings":2,"velec":70,"number":0}],"238513":[{"id":37733,"smiles":"O=c1[nH]c2cc(Cl)ccc2o1","cmpd_id":6532,"prot_id":37644,"protein_code":"Mac1-UCSF-P1494B:ZINC000084843283","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-UCSF-P1494_0B_apo_D4Qr7WO.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 11 12 0 0 0 0 0 0 0 0999 V2000\n 29.6150 53.8320 4.3050 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 29.2870 52.5330 3.1650 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.1790 52.3210 2.0990 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.9410 51.2980 1.2100 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.8000 50.5270 1.4070 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.2750 49.4540 0.6520 O 0 0 0 0 0 0 0 0 0 0 0 0\n 27.0990 49.0000 1.2640 C 0 0 0 0 0 0 0 0 0 0 0 0\n 26.4460 48.1080 0.8850 O 0 0 0 0 0 0 0 0 0 0 0 0\n 26.8520 49.8110 2.4020 N 0 0 0 0 0 0 0 0 0 0 0 0\n 27.9270 50.7580 2.4680 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.1610 51.7930 3.3680 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 2 0\n 4 3 1 0\n 5 4 2 0\n 6 5 1 0\n 7 6 1 0\n 8 7 2 0\n 9 7 1 0\n 10 9 1 0\n 10 5 1 0\n 11 10 2 0\n 11 2 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":168.99,"logp":1.77,"tpsa":46,"ha":11,"hacc":2,"hdon":1,"rots":0,"rings":2,"velec":56,"number":0}],"238514":[{"id":37656,"smiles":"C1CCN(C2CCNCC2)CC1","cmpd_id":6471,"prot_id":37567,"protein_code":"Mac1-UCSF-P0343B:ZINC000000388302","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-UCSF-P0343_0B_apo_JfvDr46.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 12 13 0 0 0 0 0 0 0 0999 V2000\n 3.5640 46.2920 -2.1340 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9930 46.4460 -2.1720 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6140 46.1110 -3.5390 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8680 46.4890 -4.7120 N 0 0 0 0 0 0 0 0 0 0 0 0\n 3.4510 46.3010 -4.5850 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9020 46.8660 -3.2720 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3650 46.0710 -5.7590 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6470 47.3720 -6.4080 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.2370 47.2280 -7.8080 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5710 46.1990 -8.6410 N 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3700 44.9010 -7.9680 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.6180 45.1470 -6.6520 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 1 0\n 4 3 1 0\n 5 4 1 0\n 6 5 1 0\n 6 1 1 0\n 7 4 1 0\n 8 7 1 0\n 9 8 1 0\n 10 9 1 0\n 11 10 1 0\n 12 11 1 0\n 12 7 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":168.16,"logp":1.22,"tpsa":15.27,"ha":12,"hacc":2,"hdon":1,"rots":1,"rings":2,"velec":70,"number":0},{"id":37698,"smiles":"NC(=O)c1cccc2[nH]ccc12","cmpd_id":6505,"prot_id":37609,"protein_code":"Mac1-UCSF-P0444A:ZINC000032199226","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-UCSF-P0444_0A_apo_C3Eh0JV.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 12 13 0 0 0 0 0 0 0 0999 V2000\n 12.7350 29.8280 -13.9550 N 0 0 0 0 0 0 0 0 0 0 0 0\n 13.7940 28.8650 -13.9870 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.0230 28.2360 -13.0170 O 0 0 0 0 0 0 0 0 0 0 0 0\n 14.5900 28.6980 -15.2950 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.8430 29.8100 -16.1040 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.5680 29.6710 -17.2920 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.0300 28.4210 -17.6630 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.7770 27.2910 -16.8490 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.1090 25.9720 -16.9850 N 0 0 0 0 0 0 0 0 0 0 0 0\n 15.6440 25.2700 -15.9670 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.9790 26.1380 -15.1210 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.0670 27.4250 -15.6810 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 2 0\n 4 2 1 0\n 5 4 2 0\n 6 5 1 0\n 7 6 2 0\n 8 7 1 0\n 9 8 1 0\n 10 9 1 0\n 11 10 2 0\n 12 11 1 0\n 12 8 2 0\n 12 4 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":160.06,"logp":1.27,"tpsa":58.88,"ha":12,"hacc":1,"hdon":2,"rots":1,"rings":2,"velec":60,"number":0},{"id":37707,"smiles":"c1cc(C2CCNCC2)n[nH]1","cmpd_id":6514,"prot_id":37618,"protein_code":"Mac1-UCSF-P0511B:ZINC000019685960","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-UCSF-P0511_0B_apo_b5stejr.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 11 12 0 0 0 0 0 0 0 0999 V2000\n 6.0460 45.5990 -1.4730 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0390 45.0280 -0.7360 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.2540 43.6510 -0.7790 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3060 42.6840 -0.0440 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0590 41.7550 0.8280 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.0390 40.9920 1.6660 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9720 40.3160 0.8890 N 0 0 0 0 0 0 0 0 0 0 0 0\n 3.0740 40.5580 -0.5860 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.3940 41.9990 -0.9950 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3260 43.4060 -1.5150 N 0 0 0 0 0 0 0 0 0 0 0 0\n 6.8010 44.6030 -1.9460 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 2 0\n 3 2 1 0\n 4 3 1 0\n 5 4 1 0\n 6 5 1 0\n 7 6 1 0\n 8 7 1 0\n 9 8 1 0\n 9 4 1 0\n 10 3 2 0\n 11 10 1 0\n 11 1 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":151.11,"logp":0.88,"tpsa":40.71,"ha":11,"hacc":2,"hdon":2,"rots":1,"rings":2,"velec":60,"number":0},{"id":37708,"smiles":"c1cc(C2CCNCC2)n[nH]1","cmpd_id":6514,"prot_id":37619,"protein_code":"Mac1-UCSF-P0511_1B:ZINC000019685960","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-UCSF-P0511_1B_apo_WxTAYBN.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 11 12 0 0 0 0 0 0 0 0999 V2000\n 0.7610 38.2700 2.2640 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.9890 39.5740 1.8720 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.3090 39.6010 1.3880 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9650 40.8890 0.8640 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.0830 40.8800 -0.6100 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.4580 42.3180 -0.9770 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8220 42.6800 -0.5000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 5.2420 42.0430 0.8000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2730 41.0840 1.5150 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8360 38.3690 1.4910 N 0 0 0 0 0 0 0 0 0 0 0 0\n 1.8830 37.5650 2.0220 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 2 0\n 3 2 1 0\n 4 3 1 0\n 5 4 1 0\n 6 5 1 0\n 7 6 1 0\n 8 7 1 0\n 9 8 1 0\n 9 4 1 0\n 10 3 2 0\n 11 10 1 0\n 11 1 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":151.11,"logp":0.88,"tpsa":40.71,"ha":11,"hacc":2,"hdon":2,"rots":1,"rings":2,"velec":60,"number":0},{"id":37719,"smiles":"CC(C)(C)c1ccc(O)c(O)c1","cmpd_id":6523,"prot_id":37630,"protein_code":"Mac1-UCSF-P0570A:ZINC000000388150","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-UCSF-P0570_0A_apo_0KUfF4F.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 12 12 0 0 0 0 0 0 0 0999 V2000\n 9.4410 39.6520 2.1270 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.3270 39.5810 1.0930 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0450 39.1990 1.8190 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6600 38.5100 0.0630 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1240 40.9160 0.3680 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.1420 41.8380 0.2450 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9300 43.0220 -0.4310 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.7040 43.3010 -1.0010 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4700 44.5130 -1.6830 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6980 42.3700 -0.8710 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4530 42.6240 -1.4210 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.9060 41.1930 -0.1980 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 1 0\n 4 2 1 0\n 5 2 1 0\n 6 5 2 0\n 7 6 1 0\n 8 7 2 0\n 9 8 1 0\n 10 8 1 0\n 11 10 1 0\n 12 10 2 0\n 12 5 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":166.1,"logp":2.4,"tpsa":40.46,"ha":12,"hacc":2,"hdon":2,"rots":0,"rings":1,"velec":66,"number":0},{"id":37720,"smiles":"CC(C)(C)c1ccc(O)c(O)c1","cmpd_id":6523,"prot_id":37631,"protein_code":"Mac1-UCSF-P0570B:ZINC000000388150","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-UCSF-P0570_0B_apo_LtIimv5.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 12 12 0 0 0 0 0 0 0 0999 V2000\n 9.1220 39.6850 1.8820 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1240 39.5990 0.7550 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7920 39.1290 1.3120 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6560 38.5420 -0.2150 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9410 40.9520 0.0520 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9560 41.8960 0.0200 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.7820 43.1150 -0.6310 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.5810 43.4060 -1.2460 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.3830 44.6400 -1.9000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5650 42.4580 -1.2050 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3510 42.7240 -1.8320 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7520 41.2470 -0.5610 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 1 0\n 4 2 1 0\n 5 2 1 0\n 6 5 2 0\n 7 6 1 0\n 8 7 2 0\n 9 8 1 0\n 10 8 1 0\n 11 10 1 0\n 12 10 2 0\n 12 5 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":166.1,"logp":2.4,"tpsa":40.46,"ha":12,"hacc":2,"hdon":2,"rots":0,"rings":1,"velec":66,"number":0}],"238515":[{"id":37491,"smiles":"COc1ccc(C)cc1NC(=O)Nn1cnnc1","cmpd_id":589,"prot_id":37402,"protein_code":"Mac1-DLS-X0228A:Z2234920345","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-X0228_0A_apo_kQMP22i.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 18 19 0 0 0 0 0 0 0 0999 V2000\n 10.4170 49.3730 -19.9670 O 0 0 0 0 0 0 0 0 0 0 0 0\n 11.2000 48.9030 -19.1420 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.9720 47.8140 -19.3810 N 0 0 0 0 0 0 0 0 0 0 0 0\n 12.0010 46.9940 -20.5380 N 0 0 0 0 0 0 0 0 0 0 0 0\n 12.7250 45.8520 -20.6380 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.5480 45.3110 -21.8120 N 0 0 0 0 0 0 0 0 0 0 0 0\n 11.6650 46.1280 -22.5110 N 0 0 0 0 0 0 0 0 0 0 0 0\n 11.3580 47.1220 -21.7250 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.3370 49.3870 -17.8620 N 0 0 0 0 0 0 0 0 0 0 0 0\n 10.4050 50.2340 -17.2080 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.8970 51.3290 -16.4770 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.2300 51.5870 -16.6550 O 0 0 0 0 0 0 0 0 0 0 0 0\n 12.7650 52.7770 -16.0690 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.0380 49.9690 -17.1940 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1640 50.7480 -16.4460 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6790 50.4780 -16.4710 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6850 51.7960 -15.6940 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.0360 52.0960 -15.7060 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 2 0\n 3 2 1 0\n 4 3 1 0\n 5 4 1 0\n 6 5 2 0\n 7 6 1 0\n 8 7 2 0\n 8 4 1 0\n 9 2 1 0\n 10 9 1 0\n 11 10 2 0\n 12 11 1 0\n 13 12 1 0\n 14 10 1 0\n 15 14 2 0\n 16 15 1 0\n 17 15 1 0\n 18 11 1 0\n 18 17 2 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":247.11,"logp":1.37,"tpsa":81.07,"ha":18,"hacc":5,"hdon":2,"rots":3,"rings":2,"velec":94,"number":228},{"id":37499,"smiles":"CC(C)NCc1ccc(N(C)C)cc1","cmpd_id":509,"prot_id":37410,"protein_code":"Mac1-DLS-X0334A:Z2856434894","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-X0334_0A_apo_BzQpOZX.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 14 14 0 0 0 0 0 0 0 0999 V2000\n 12.6810 54.0950 -15.5490 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.8990 53.8880 -16.7580 N 0 0 0 0 0 0 0 0 0 0 0 0\n 11.3210 55.0710 -17.3780 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.7410 52.6250 -17.3080 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.3190 51.5020 -16.7140 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.1560 50.2450 -17.2660 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.9770 52.4290 -18.4680 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.8170 51.1620 -19.0030 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.4200 50.0570 -18.4260 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.3640 48.7030 -19.0920 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.3750 48.6040 -20.1540 N 0 0 0 0 0 0 0 0 0 0 0 0\n 12.5200 47.2760 -20.7840 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.2830 46.9300 -21.5770 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.7580 47.2480 -21.6520 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 1 0\n 4 2 1 0\n 5 4 2 0\n 6 5 1 0\n 7 4 1 0\n 8 7 2 0\n 9 8 1 0\n 9 6 2 0\n 10 9 1 0\n 11 10 1 0\n 12 11 1 0\n 12 13 1 0\n 14 12 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":192.16,"logp":2.25,"tpsa":15.27,"ha":14,"hacc":2,"hdon":1,"rots":4,"rings":1,"velec":78,"number":334},{"id":37511,"smiles":"C[C@H](O)CNCc1ccc2c(c1)OCO2","cmpd_id":175,"prot_id":37422,"protein_code":"Mac1-DLS-X0516A:Z2856434941","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-X0516_0A_apo_evQOpJI.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 15 16 0 0 0 0 0 0 0 0999 V2000\n 13.8290 47.3700 -21.7740 O 0 0 0 0 0 0 0 0 0 0 0 0\n 12.4520 47.0110 -21.6180 C 0 0 1 0 0 0 0 0 0 0 0 0\n 12.2420 45.5910 -22.0920 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.0520 47.1270 -20.1360 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.9660 48.5210 -19.6880 N 0 0 0 0 0 0 0 0 0 0 0 0\n 11.4330 48.6870 -18.3250 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.4520 50.1230 -17.8560 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.4640 50.5750 -17.0100 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.5170 51.9170 -16.6910 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.4610 52.5860 -15.9440 O 0 0 0 0 0 0 0 0 0 0 0 0\n 12.9650 53.9220 -15.8210 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.8800 54.0760 -16.7390 O 0 0 0 0 0 0 0 0 0 0 0 0\n 11.5860 52.8000 -17.1720 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.5540 52.3780 -17.9910 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.5000 51.0310 -18.3240 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 2 3 1 1\n 4 2 1 0\n 5 4 1 0\n 6 5 1 0\n 7 6 1 0\n 8 7 2 0\n 9 8 1 0\n 10 9 1 0\n 11 10 1 0\n 12 11 1 0\n 13 12 1 0\n 13 9 2 0\n 14 13 1 0\n 15 14 2 0\n 15 7 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":209.11,"logp":0.89,"tpsa":50.72,"ha":15,"hacc":4,"hdon":2,"rots":4,"rings":2,"velec":82,"number":516},{"id":37519,"smiles":"CS(=O)(=O)NCC1CCNCC1","cmpd_id":3955,"prot_id":37430,"protein_code":"Mac1-DLS-X0598A:Z1741966151","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-X0598_0A_apo_eLRfpyh.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 12 12 0 0 0 0 0 0 0 0999 V2000\n 15.4290 43.7750 -18.6750 O 0 0 0 0 0 0 0 0 0 0 0 0\n 15.0240 43.6430 -20.0400 S 0 0 0 0 0 0 0 0 0 0 0 0\n 14.6310 42.3550 -20.5220 O 0 0 0 0 0 0 0 0 0 0 0 0\n 16.3270 44.2280 -21.0540 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.7560 44.6250 -20.2570 N 0 0 0 0 0 0 0 0 0 0 0 0\n 12.9680 44.5500 -21.4960 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.7400 45.8420 -22.2660 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.0410 46.5360 -22.6800 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.6800 47.4300 -21.6330 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.6900 48.3600 -21.0670 N 0 0 0 0 0 0 0 0 0 0 0 0\n 12.5490 47.6390 -20.4770 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.8270 46.8180 -21.5270 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 2 0\n 3 2 2 0\n 2 4 1 0\n 5 2 1 0\n 6 5 1 0\n 7 6 1 0\n 8 7 1 0\n 9 8 1 0\n 10 9 1 0\n 11 10 1 0\n 12 7 1 0\n 12 11 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":192.09,"logp":-0.46,"tpsa":58.2,"ha":12,"hacc":3,"hdon":2,"rots":3,"rings":1,"velec":72,"number":598},{"id":37542,"smiles":"C[C@H]1CNC[C@H](CO)C1","cmpd_id":3965,"prot_id":37453,"protein_code":"Mac1-DLS-X0792A:POB0041","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-X0792_0A_apo_5VXLKMu.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 9 9 0 0 0 0 0 0 0 0999 V2000\n 15.9920 44.4800 -23.1300 O 0 0 0 0 0 0 0 0 0 0 0 0\n 15.1890 45.6010 -23.4550 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.2750 45.9910 -22.3120 C 0 0 2 0 0 0 0 0 0 0 0 0\n 12.8410 46.2060 -22.7900 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.9260 46.5290 -21.6050 C 0 0 1 0 0 0 0 0 0 0 0 0\n 11.1400 45.3010 -21.1760 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.6720 47.1270 -20.4150 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.7990 47.9790 -20.8110 N 0 0 0 0 0 0 0 0 0 0 0 0\n 14.7840 47.2640 -21.6330 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 1 6\n 4 3 1 0\n 5 4 1 0\n 5 6 1 1\n 7 5 1 0\n 8 7 1 0\n 9 3 1 0\n 9 8 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":129.12,"logp":0.22,"tpsa":32.26,"ha":9,"hacc":2,"hdon":2,"rots":1,"rings":1,"velec":54,"number":792},{"id":37547,"smiles":"COc1cccc([C@@H]2CCOC[C@@H]2N)c1","cmpd_id":3970,"prot_id":37458,"protein_code":"Mac1-DLS-X0822A:POB0140","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-X0822_0A_apo_N8gpqHm.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 15 16 0 0 0 0 0 0 0 0999 V2000\n 12.2900 49.8740 -20.2610 N 0 0 0 0 0 0 0 0 0 0 0 0\n 11.0770 49.0560 -20.3960 C 0 0 2 0 0 0 0 0 0 0 0 0\n 10.5520 48.5340 -19.0310 C 0 0 1 0 0 0 0 0 0 0 0 0\n 11.4000 47.3520 -18.5360 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.6630 46.3630 -19.6510 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.3080 46.9880 -20.7630 O 0 0 0 0 0 0 0 0 0 0 0 0\n 11.4270 47.9410 -21.3750 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.3530 49.6010 -17.9700 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.4450 50.1930 -17.3420 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.2610 51.2930 -16.5120 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.4170 51.8870 -16.0700 O 0 0 0 0 0 0 0 0 0 0 0 0\n 12.3240 53.0720 -15.2730 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.9860 51.7600 -16.2280 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.8950 51.1370 -16.8110 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.0790 50.0750 -17.6850 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 1\n 3 2 1 0\n 4 3 1 0\n 5 4 1 0\n 6 5 1 0\n 7 6 1 0\n 7 2 1 0\n 3 8 1 1\n 9 8 2 0\n 10 9 1 0\n 11 10 1 0\n 12 11 1 0\n 13 10 2 0\n 14 13 1 0\n 15 14 2 0\n 15 8 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":207.13,"logp":1.53,"tpsa":44.48,"ha":15,"hacc":3,"hdon":1,"rots":2,"rings":2,"velec":82,"number":822},{"id":37571,"smiles":"NC1NCCCN1","cmpd_id":3982,"prot_id":37482,"protein_code":"Mac1-DLS-X0933_1A:Z1954800348","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-X0933_1A_apo_5URRYza.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 7 7 0 0 0 0 0 0 0 0999 V2000\n 15.4490 48.9240 -22.3720 N 0 0 0 0 0 0 0 0 0 0 0 0\n 14.5340 48.1420 -21.9130 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.2490 48.0170 -20.6060 N 0 0 0 0 0 0 0 0 0 0 0 0\n 13.1840 47.1500 -20.0980 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.0050 45.9650 -21.0310 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.7980 46.4390 -22.4480 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.8380 47.4110 -22.8110 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 1 0\n 4 3 1 0\n 5 4 1 0\n 6 5 1 0\n 7 6 1 0\n 7 2 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":101.1,"logp":-1.19,"tpsa":50.08,"ha":7,"hacc":3,"hdon":3,"rots":0,"rings":1,"velec":42,"number":933}],"238516":[{"id":37589,"smiles":"NC(=O)c1ccc(O)cc1","cmpd_id":4018,"prot_id":37500,"protein_code":"Mac1-UCSF-C137A:ZINC000000157088","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-UCSF-C137_0A_apo_9WjyCoA.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 10 10 0 0 0 0 0 0 0 0999 V2000\n 12.6640 50.1330 -17.3120 N 0 0 0 0 0 0 0 0 0 0 0 0\n 11.2210 50.2050 -17.1820 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.6940 51.1150 -16.6250 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.3850 49.0740 -17.7640 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.9600 47.8250 -17.9280 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.2100 46.7830 -18.4460 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.8920 46.9990 -18.8040 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1320 45.9510 -19.3300 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.3160 48.2470 -18.6390 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.0630 49.2880 -18.1170 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 2 0\n 4 2 1 0\n 5 4 2 0\n 6 5 1 0\n 7 6 2 0\n 8 7 1 0\n 9 7 1 0\n 10 9 2 0\n 10 4 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":137.05,"logp":0.49,"tpsa":63.32,"ha":10,"hacc":2,"hdon":2,"rots":1,"rings":1,"velec":52,"number":0},{"id":37590,"smiles":"COc1ccc(C(=O)O)cc1","cmpd_id":3941,"prot_id":37501,"protein_code":"Mac1-UCSF-C189A:ZINC000000332748","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-UCSF-C189_0A_apo_6IhYp78.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 11 11 0 0 0 0 0 0 0 0999 V2000\n 13.2710 52.4720 -17.2420 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.0470 51.2310 -16.6410 O 0 0 0 0 0 0 0 0 0 0 0 0\n 11.9260 50.5180 -17.0880 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.6500 51.0260 -16.8930 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.5450 50.3120 -17.3360 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.7140 49.0920 -17.9710 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.9910 48.5810 -18.1590 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.0950 49.2960 -17.7190 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.4890 48.3110 -18.4490 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6250 47.2660 -19.1430 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.3370 48.7080 -18.1320 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 1 0\n 4 3 2 0\n 5 4 1 0\n 6 5 2 0\n 7 6 1 0\n 8 7 2 0\n 8 3 1 0\n 9 6 1 0\n 10 9 2 0\n 11 9 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":152.05,"logp":1.39,"tpsa":46.53,"ha":11,"hacc":2,"hdon":1,"rots":2,"rings":1,"velec":58,"number":0},{"id":37593,"smiles":"Cc1ccc2[nH]c(C(=O)O)cc2c1","cmpd_id":4021,"prot_id":37504,"protein_code":"Mac1-UCSF-C257A:ZINC000002508153","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-UCSF-C257_0A_apo_whch6YV.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 13 14 0 0 0 0 0 0 0 0999 V2000\n 13.3210 52.2430 -16.4930 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.1830 51.2640 -16.8080 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.8710 51.6170 -16.4770 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.8220 50.7560 -16.7610 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.0930 49.5300 -17.3910 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.2680 48.5410 -17.7620 N 0 0 0 0 0 0 0 0 0 0 0 0\n 9.9460 47.5550 -18.3150 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.3010 47.8860 -18.3180 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.3930 49.1640 -17.7170 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.4670 50.0330 -17.4230 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.2980 46.2820 -18.8380 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.8830 45.1750 -18.7280 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1490 46.3420 -19.3540 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 2 0\n 4 3 1 0\n 5 4 2 0\n 6 5 1 0\n 7 6 1 0\n 8 7 2 0\n 9 5 1 0\n 9 8 1 0\n 10 9 2 0\n 10 2 1 0\n 11 7 1 0\n 12 11 2 0\n 13 11 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":175.06,"logp":2.17,"tpsa":53.09,"ha":13,"hacc":1,"hdon":2,"rots":1,"rings":2,"velec":66,"number":0},{"id":37595,"smiles":"O=C(O)c1cncc(-c2ccccc2)c1","cmpd_id":4022,"prot_id":37506,"protein_code":"Mac1-UCSF-C295A:ZINC000000159004","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-UCSF-C295_0A_apo_jYoHddy.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 15 16 0 0 0 0 0 0 0 0999 V2000\n 6.5840 48.7590 -18.5140 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2750 47.7380 -18.7540 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7280 46.6520 -19.0720 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.7960 47.8190 -18.6290 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.5670 46.6690 -18.7080 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.8820 46.7180 -18.5980 N 0 0 0 0 0 0 0 0 0 0 0 0\n 11.5070 47.8690 -18.4040 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.8070 49.0650 -18.3140 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.4190 49.0470 -18.4300 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.5580 50.3790 -18.0880 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.6370 50.4060 -17.2280 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.3140 51.6030 -17.0110 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.9150 52.7610 -17.6610 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.8390 52.7290 -18.5310 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.1600 51.5390 -18.7400 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 2 0\n 4 2 1 0\n 5 4 2 0\n 6 5 1 0\n 7 6 2 0\n 8 7 1 0\n 9 4 1 0\n 9 8 2 0\n 10 8 1 0\n 11 10 2 0\n 12 11 1 0\n 13 12 2 0\n 14 13 1 0\n 15 14 2 0\n 15 10 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":199.06,"logp":2.45,"tpsa":50.19,"ha":15,"hacc":2,"hdon":1,"rots":2,"rings":2,"velec":74,"number":0},{"id":37596,"smiles":"Cc1ccc2cc(C(=O)O)[nH]c2c1","cmpd_id":4023,"prot_id":37507,"protein_code":"Mac1-UCSF-C309A:ZINC000002582714","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-UCSF-C309_0A_apo_5SUm1LG.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 13 14 0 0 0 0 0 0 0 0999 V2000\n 11.9320 52.9860 -15.5270 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.5710 51.7090 -16.3020 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.5680 50.9260 -16.8890 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.2480 49.7570 -17.5810 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.9010 49.3760 -17.6960 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.2530 48.2850 -18.3160 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.8980 48.4700 -18.0740 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.7270 49.5710 -17.3660 N 0 0 0 0 0 0 0 0 0 0 0 0\n 9.9130 50.1460 -17.1160 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.2420 51.3150 -16.4110 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.7820 47.5380 -18.5450 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5770 47.9060 -18.4580 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.0670 46.4000 -19.0090 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 2 0\n 4 3 1 0\n 5 4 2 0\n 6 5 1 0\n 7 6 2 0\n 8 7 1 0\n 9 8 1 0\n 9 5 1 0\n 10 9 2 0\n 10 2 1 0\n 11 7 1 0\n 12 11 2 0\n 13 11 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":175.06,"logp":2.17,"tpsa":53.09,"ha":13,"hacc":1,"hdon":2,"rots":1,"rings":2,"velec":66,"number":0},{"id":37597,"smiles":"O=C(O)c1ccc(-c2ccccc2)nc1","cmpd_id":4024,"prot_id":37508,"protein_code":"Mac1-UCSF-C327A:ZINC000002506130","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-UCSF-C327_0A_apo_Jms8VVN.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 15 16 0 0 0 0 0 0 0 0999 V2000\n 9.8730 44.7890 -19.0410 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.2240 45.8690 -19.1090 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.0480 45.8700 -19.5580 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.8270 47.1640 -18.5740 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9690 48.1860 -18.2130 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.5250 49.3510 -17.7100 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.8990 49.4670 -17.5900 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.6830 48.4560 -17.9420 N 0 0 0 0 0 0 0 0 0 0 0 0\n 11.1970 47.3220 -18.4260 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.4850 50.7550 -16.9990 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.7960 51.1340 -17.2420 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.2980 52.2960 -16.6670 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.4930 53.0650 -15.8260 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.1960 52.6760 -15.5590 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.6930 51.5170 -16.1420 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 2 0\n 4 2 1 0\n 5 4 2 0\n 6 5 1 0\n 7 6 2 0\n 8 7 1 0\n 9 4 1 0\n 9 8 2 0\n 10 7 1 0\n 11 10 2 0\n 12 11 1 0\n 13 12 2 0\n 14 13 1 0\n 15 10 1 0\n 15 14 2 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":199.06,"logp":2.45,"tpsa":50.19,"ha":15,"hacc":2,"hdon":1,"rots":2,"rings":2,"velec":74,"number":0},{"id":37598,"smiles":"Cc1ccc2c(C(=O)O)c[nH]c2c1","cmpd_id":3946,"prot_id":37509,"protein_code":"Mac1-UCSF-C362A:ZINC000020269197","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-UCSF-C362_0A_apo_997KGC8.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 13 14 0 0 0 0 0 0 0 0999 V2000\n 12.8040 52.8960 -15.9020 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.9350 51.7910 -16.4880 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.5570 51.8830 -16.3750 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.7470 50.8840 -16.8930 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.3180 49.7780 -17.5420 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.7900 48.6240 -18.1590 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.8830 47.9090 -18.6080 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.9910 48.5600 -18.2880 N 0 0 0 0 0 0 0 0 0 0 0 0\n 11.6950 49.6940 -17.6530 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.5100 50.6940 -17.1260 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.3310 48.2250 -18.3300 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4300 48.9760 -17.8650 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.0500 47.1610 -18.9470 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 2 0\n 4 3 1 0\n 5 4 2 0\n 6 5 1 0\n 7 6 2 0\n 8 7 1 0\n 9 5 1 0\n 9 8 1 0\n 10 9 2 0\n 10 2 1 0\n 11 6 1 0\n 12 11 2 0\n 13 11 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":175.06,"logp":2.17,"tpsa":53.09,"ha":13,"hacc":1,"hdon":2,"rots":1,"rings":2,"velec":66,"number":0}],"238517":[{"id":37630,"smiles":"Cc1ccc2cc(C(=O)O)[nH]c2c1","cmpd_id":4023,"prot_id":37541,"protein_code":"Mac1-UCSF-P0227A:ZINC000002582714","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-UCSF-P0227_0A_apo_Qjf5TW2.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 13 14 0 0 0 0 0 0 0 0999 V2000\n 33.8040 49.7810 -18.9750 C 0 0 0 0 0 0 0 0 0 0 0 0\n 33.3010 49.7150 -20.4230 C 0 0 0 0 0 0 0 0 0 0 0 0\n 33.1660 50.9070 -21.0970 C 0 0 0 0 0 0 0 0 0 0 0 0\n 32.7170 50.9320 -22.4020 C 0 0 0 0 0 0 0 0 0 0 0 0\n 32.3840 49.7430 -23.0370 C 0 0 0 0 0 0 0 0 0 0 0 0\n 31.9180 49.4840 -24.3270 C 0 0 0 0 0 0 0 0 0 0 0 0\n 31.7310 48.1350 -24.4020 C 0 0 0 0 0 0 0 0 0 0 0 0\n 32.1090 47.5930 -23.2590 N 0 0 0 0 0 0 0 0 0 0 0 0\n 32.4990 48.5400 -22.3920 C 0 0 0 0 0 0 0 0 0 0 0 0\n 32.9700 48.5080 -21.0520 C 0 0 0 0 0 0 0 0 0 0 0 0\n 31.3280 47.4280 -25.6810 C 0 0 0 0 0 0 0 0 0 0 0 0\n 31.7000 46.2580 -25.8250 O 0 0 0 0 0 0 0 0 0 0 0 0\n 30.7940 47.9920 -26.6610 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 2 0\n 4 3 1 0\n 5 4 2 0\n 6 5 1 0\n 7 6 2 0\n 8 7 1 0\n 9 8 1 0\n 9 5 1 0\n 10 9 2 0\n 10 2 1 0\n 11 7 1 0\n 12 11 2 0\n 13 11 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":175.06,"logp":2.17,"tpsa":53.09,"ha":13,"hacc":1,"hdon":2,"rots":1,"rings":2,"velec":66,"number":0},{"id":37646,"smiles":"O=C1Nc2ccccc2C1=O","cmpd_id":6463,"prot_id":37557,"protein_code":"Mac1-UCSF-P0309B:ZINC000002047514","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-UCSF-P0309_0B_apo_25q3yEY.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 11 12 0 0 0 0 0 0 0 0999 V2000\n 21.1660 50.9760 -26.8700 O 0 0 0 0 0 0 0 0 0 0 0 0\n 21.2350 49.9470 -27.4340 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.3660 48.6300 -26.8430 N 0 0 0 0 0 0 0 0 0 0 0 0\n 21.4440 47.6320 -28.0020 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.5530 46.2330 -28.0320 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.5770 45.5540 -29.2550 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.4660 46.2860 -30.4660 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.3400 47.6840 -30.4460 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.3330 48.3640 -29.2290 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.2220 49.8200 -28.8820 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.0930 50.7430 -29.6040 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 2 0\n 3 2 1 0\n 4 3 1 0\n 5 4 2 0\n 6 5 1 0\n 7 6 2 0\n 8 7 1 0\n 9 8 2 0\n 9 4 1 0\n 10 9 1 0\n 10 2 1 0\n 11 10 2 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":147.03,"logp":0.82,"tpsa":46.17,"ha":11,"hacc":2,"hdon":1,"rots":0,"rings":2,"velec":54,"number":0},{"id":37674,"smiles":"N#Cc1ccc(O)cc1F","cmpd_id":6484,"prot_id":37585,"protein_code":"Mac1-UCSF-P0378B:ZINC000000161696","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-UCSF-P0378_0B_apo_c3vNLx9.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 10 10 0 0 0 0 0 0 0 0999 V2000\n 30.7830 25.8110 -0.4610 O 0 0 0 0 0 0 0 0 0 0 0 0\n 29.8840 26.1240 -1.4990 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.8000 25.3600 -2.6470 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.9120 25.7110 -3.6510 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.0820 26.8050 -3.5200 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.0980 27.1960 -4.6250 C 0 0 0 0 0 0 0 0 0 0 0 0\n 26.3780 27.4620 -5.4280 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.1760 27.5460 -2.3690 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.0600 27.2070 -1.3740 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.3840 28.6370 -2.1870 F 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 2 0\n 4 3 1 0\n 5 4 2 0\n 6 5 1 0\n 7 6 3 0\n 8 5 1 0\n 9 2 1 0\n 9 8 2 0\n 10 8 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":137.03,"logp":1.4,"tpsa":44.02,"ha":10,"hacc":2,"hdon":1,"rots":0,"rings":1,"velec":50,"number":0},{"id":37703,"smiles":"c1ccc(N2CCCNCC2)nc1","cmpd_id":6510,"prot_id":37614,"protein_code":"Mac1-UCSF-P0482B:ZINC000019015194","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-UCSF-P0482_0B_apo_NxxXIiC.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 13 14 0 0 0 0 0 0 0 0999 V2000\n 9.7790 46.9960 12.8190 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.7640 47.5690 12.0600 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.7620 46.7570 11.6500 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.7740 45.4360 11.9330 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6840 44.5470 11.4210 N 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6830 45.1290 10.6380 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5090 45.6220 11.4710 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6550 44.5210 12.1480 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2820 43.4240 12.8410 N 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6650 43.2290 13.0720 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6210 43.2010 11.9520 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.7760 44.9210 12.6280 N 0 0 0 0 0 0 0 0 0 0 0 0\n 9.7290 45.6170 13.0580 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 2 0\n 3 2 1 0\n 4 3 2 0\n 5 4 1 0\n 6 5 1 0\n 7 6 1 0\n 8 7 1 0\n 9 8 1 0\n 10 9 1 0\n 11 10 1 0\n 11 5 1 0\n 12 4 1 0\n 13 12 2 0\n 13 1 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":177.13,"logp":0.88,"tpsa":28.16,"ha":13,"hacc":3,"hdon":1,"rots":1,"rings":2,"velec":70,"number":0},{"id":37723,"smiles":"CN(C(=O)[C@@]12CCC[C@@H]1C2)c1cn[nH]c1","cmpd_id":6526,"prot_id":37634,"protein_code":"Mac1-UCSF-P0582A:ZINC000933940912","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-UCSF-P0582_0A_apo_gxAJWAw.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 15 17 0 0 0 0 0 0 0 0999 V2000\n 7.6730 47.7810 11.8400 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5930 48.6970 12.2500 N 0 0 0 0 0 0 0 0 0 0 0 0\n 5.2570 48.1190 12.5110 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.1670 46.9390 12.4350 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.9720 48.8370 12.9970 C 0 0 1 0 0 0 0 0 0 0 0 0\n 3.2220 48.5870 11.7640 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.1380 49.9130 12.3720 C 0 0 1 0 0 0 0 0 0 0 0 0\n 3.0310 51.0850 13.4950 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.3040 50.4910 14.7830 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3980 49.3350 14.4450 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.9440 50.1140 12.2740 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2500 50.5870 12.1760 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1840 51.9290 12.2060 N 0 0 0 0 0 0 0 0 0 0 0 0\n 6.8660 52.2930 12.3120 N 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1200 51.2110 12.3500 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 1 0\n 4 3 2 0\n 5 3 1 6\n 6 5 1 0\n 7 6 1 1\n 7 5 1 0\n 8 7 1 0\n 9 8 1 0\n 10 5 1 0\n 10 9 1 0\n 11 2 1 0\n 12 11 1 0\n 13 12 2 0\n 14 13 1 0\n 15 14 1 0\n 15 11 2 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":205.12,"logp":1.56,"tpsa":48.99,"ha":15,"hacc":2,"hdon":1,"rots":2,"rings":3,"velec":80,"number":0}],"238518":[{"id":37482,"smiles":"Cc1cc(CN(C)C(=O)NC2CC2)no1","cmpd_id":527,"prot_id":37393,"protein_code":"Mac1-DLS-X0091B:Z369936976","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-X0091_0B_apo_bLJzNWI.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 15 16 0 0 0 0 0 0 0 0999 V2000\n 17.1620 37.8380 -21.2950 O 0 0 0 0 0 0 0 0 0 0 0 0\n 16.1830 38.5000 -21.6090 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.9350 38.0780 -21.3430 N 0 0 0 0 0 0 0 0 0 0 0 0\n 14.6530 36.7850 -20.7250 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.3660 36.1280 -21.0390 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.6330 35.5820 -21.5850 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.2990 39.7140 -22.2510 N 0 0 0 0 0 0 0 0 0 0 0 0\n 15.1610 40.4600 -22.7720 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.6160 40.2870 -22.4870 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.2290 39.8320 -23.7760 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.7790 40.7020 -24.5740 N 0 0 0 0 0 0 0 0 0 0 0 0\n 19.2660 39.9490 -25.6680 O 0 0 0 0 0 0 0 0 0 0 0 0\n 18.9790 38.6540 -25.4500 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.4690 37.6970 -26.4750 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.3240 38.5280 -24.2890 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 2 0\n 3 2 1 0\n 4 3 1 0\n 5 4 1 0\n 6 5 1 0\n 6 4 1 0\n 7 2 1 0\n 8 7 1 0\n 9 7 1 0\n 10 9 1 0\n 11 10 2 0\n 12 11 1 0\n 13 12 1 0\n 14 13 1 0\n 15 13 2 0\n 15 10 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":209.12,"logp":1.29,"tpsa":58.37,"ha":15,"hacc":3,"hdon":1,"rots":3,"rings":2,"velec":82,"number":91},{"id":37487,"smiles":"CCOC(=O)CN1CCS(=O)(=O)CC1","cmpd_id":629,"prot_id":37398,"protein_code":"Mac1-DLS-X0158B:Z2856434920","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-X0158_0B_apo_C5bJrgf.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 14 14 0 0 0 0 0 0 0 0999 V2000\n 25.5390 41.4590 -24.3620 O 0 0 0 0 0 0 0 0 0 0 0 0\n 24.9720 41.3250 -25.6770 S 0 0 0 0 0 0 0 0 0 0 0 0\n 25.1150 42.4310 -26.5860 O 0 0 0 0 0 0 0 0 0 0 0 0\n 23.2550 40.9320 -25.5220 C 0 0 0 0 0 0 0 0 0 0 0 0\n 23.0760 39.5320 -24.9400 C 0 0 0 0 0 0 0 0 0 0 0 0\n 25.6260 39.8720 -26.4400 C 0 0 0 0 0 0 0 0 0 0 0 0\n 25.1370 38.6190 -25.7260 C 0 0 0 0 0 0 0 0 0 0 0 0\n 23.6820 38.4570 -25.7370 N 0 0 0 0 0 0 0 0 0 0 0 0\n 23.2970 37.1410 -25.2380 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.8220 36.9070 -24.9970 C 0 0 0 0 0 0 0 0 0 0 0 0\n 20.9490 37.0820 -25.8080 O 0 0 0 0 0 0 0 0 0 0 0 0\n 21.6260 36.4600 -23.7470 O 0 0 0 0 0 0 0 0 0 0 0 0\n 20.2490 36.1880 -23.3490 C 0 0 0 0 0 0 0 0 0 0 0 0\n 20.1550 34.7830 -22.9430 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 2 0\n 3 2 2 0\n 2 4 1 0\n 5 4 1 0\n 6 2 1 0\n 7 6 1 0\n 8 7 1 0\n 8 5 1 0\n 9 8 1 0\n 10 9 1 0\n 11 10 2 0\n 12 10 1 0\n 13 12 1 0\n 14 13 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":221.07,"logp":-0.72,"tpsa":63.68,"ha":14,"hacc":5,"hdon":0,"rots":3,"rings":1,"velec":82,"number":158},{"id":37494,"smiles":"CN(C[C@@H]1CCOC1)c1ncncc1Cl","cmpd_id":508,"prot_id":37405,"protein_code":"Mac1-DLS-X0259A:Z1787627869","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-X0259_0A_apo_vq8o1fH.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 15 16 0 0 0 0 0 0 0 0999 V2000\n 11.8390 27.1600 -16.3800 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 12.8450 28.0200 -15.2550 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.7340 27.3240 -14.4580 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.4850 27.9190 -13.5320 N 0 0 0 0 0 0 0 0 0 0 0 0\n 14.3460 29.2370 -13.4520 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.5510 30.0280 -14.1830 N 0 0 0 0 0 0 0 0 0 0 0 0\n 12.7860 29.4060 -15.0990 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.9910 30.2180 -15.8760 N 0 0 0 0 0 0 0 0 0 0 0 0\n 11.2490 29.7320 -17.0360 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.8840 31.6580 -15.6480 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.7920 32.0590 -14.6670 C 0 0 1 0 0 0 0 0 0 0 0 0\n 11.1250 33.3040 -13.8660 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.8700 33.7460 -13.3740 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9590 33.6070 -14.4620 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.4820 32.4810 -15.3400 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 2 0\n 4 3 1 0\n 5 4 2 0\n 6 5 1 0\n 7 6 2 0\n 7 2 1 0\n 8 7 1 0\n 9 8 1 0\n 10 8 1 0\n 11 10 1 6\n 12 11 1 0\n 13 12 1 0\n 14 13 1 0\n 15 11 1 0\n 15 14 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":227.08,"logp":1.6,"tpsa":38.25,"ha":15,"hacc":4,"hdon":0,"rots":3,"rings":2,"velec":82,"number":259},{"id":37498,"smiles":"CC(C)C(=O)Nc1nnn(C)n1","cmpd_id":567,"prot_id":37409,"protein_code":"Mac1-DLS-X0301B:Z57292369","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-X0301_0B_apo_cX7lalz.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 12 12 0 0 0 0 0 0 0 0999 V2000\n 13.7620 29.0780 -13.6250 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.2990 29.7750 -14.5250 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.7790 29.6270 -15.9800 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.2940 29.4280 -16.0070 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.1090 28.4160 -16.5870 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.3400 30.7480 -14.3200 N 0 0 0 0 0 0 0 0 0 0 0 0\n 11.6580 31.0840 -13.1540 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.7490 32.0480 -13.1040 N 0 0 0 0 0 0 0 0 0 0 0 0\n 10.2630 31.8670 -11.8740 N 0 0 0 0 0 0 0 0 0 0 0 0\n 9.1910 32.6830 -11.3190 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.8330 30.8900 -11.1990 N 0 0 0 0 0 0 0 0 0 0 0 0\n 11.7450 30.3720 -11.9990 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 2 0\n 3 2 1 0\n 3 4 1 0\n 5 3 1 0\n 6 2 1 0\n 7 6 1 0\n 8 7 2 0\n 9 8 1 0\n 10 9 1 0\n 11 9 1 0\n 12 11 2 0\n 12 7 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":169.1,"logp":-0.2,"tpsa":72.7,"ha":12,"hacc":5,"hdon":1,"rots":2,"rings":1,"velec":66,"number":301},{"id":37504,"smiles":"CN[C@@H]1CCCN(c2cccnn2)C1","cmpd_id":725,"prot_id":37415,"protein_code":"Mac1-DLS-X0423B:Z1139246057","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-X0423_0B_apo_EvKB8hD.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 14 15 0 0 0 0 0 0 0 0999 V2000\n 10.3410 39.6050 -21.5120 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.0520 38.3270 -21.4970 N 0 0 0 0 0 0 0 0 0 0 0 0\n 12.2930 38.3260 -22.2930 C 0 0 1 0 0 0 0 0 0 0 0 0\n 13.3750 39.1070 -21.5470 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.6250 38.3440 -21.4990 N 0 0 0 0 0 0 0 0 0 0 0 0\n 14.5030 37.0770 -20.7640 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.3420 36.2510 -21.2970 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.7460 36.8880 -22.5530 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.8360 38.9240 -21.8150 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.9220 38.1660 -21.6410 N 0 0 0 0 0 0 0 0 0 0 0 0\n 18.1420 38.6680 -21.9320 N 0 0 0 0 0 0 0 0 0 0 0 0\n 18.2520 39.9090 -22.3900 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.1680 40.7310 -22.5890 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.9120 40.2360 -22.2970 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 1 1\n 4 3 1 0\n 5 4 1 0\n 6 5 1 0\n 7 6 1 0\n 8 7 1 0\n 8 3 1 0\n 9 5 1 0\n 10 9 2 0\n 11 10 1 0\n 12 11 2 0\n 13 12 1 0\n 14 9 1 0\n 14 13 2 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":192.14,"logp":0.66,"tpsa":41.05,"ha":14,"hacc":4,"hdon":1,"rots":2,"rings":2,"velec":76,"number":423},{"id":37508,"smiles":"COc1cc(CN)cc(OC)c1OC","cmpd_id":726,"prot_id":37419,"protein_code":"Mac1-DLS-X0469B:Z1741959530","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-X0469_0B_apo_MS7cFOd.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 14 14 0 0 0 0 0 0 0 0999 V2000\n 3.2360 52.6080 -1.4760 N 0 0 0 0 0 0 0 0 0 0 0 0\n 4.6580 52.3320 -1.6960 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4800 53.5880 -1.9020 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7160 54.4560 -0.8430 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0140 53.8820 -3.1520 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7850 55.0150 -3.3460 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4340 55.3290 -4.5110 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4050 54.3700 -5.5700 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.9850 55.9070 -2.2880 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.6160 57.1140 -2.5070 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.0400 57.1000 -2.4710 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4440 55.6200 -1.0340 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5950 56.6060 -0.0990 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7590 56.5560 1.0540 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 1 0\n 4 3 2 0\n 5 3 1 0\n 6 5 2 0\n 7 6 1 0\n 8 7 1 0\n 9 6 1 0\n 10 9 1 0\n 11 10 1 0\n 12 4 1 0\n 12 9 2 0\n 13 12 1 0\n 14 13 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":197.11,"logp":1.17,"tpsa":53.71,"ha":14,"hacc":4,"hdon":1,"rots":4,"rings":1,"velec":78,"number":469},{"id":37513,"smiles":"COc1ccc2[nH]cc(CN(C)C)c2c1","cmpd_id":65,"prot_id":37424,"protein_code":"Mac1-DLS-X0548A:Z2856434938","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-X0548_0A_apo_KGmSmVF.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 15 16 0 0 0 0 0 0 0 0999 V2000\n 4.4930 45.8900 12.0090 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5920 46.7370 11.5790 N 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7270 45.9110 11.2120 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.9660 47.6590 12.6470 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6620 48.9090 12.1730 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.0020 49.0880 11.9860 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2900 50.4220 11.8620 N 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0700 50.2170 12.0990 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1190 51.1380 11.9290 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.8840 52.5020 11.8160 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5770 52.9530 11.8560 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.7600 50.6900 12.1440 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5300 52.0540 12.0030 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.3010 52.6590 11.8990 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1330 51.8350 11.8770 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 1 0\n 4 2 1 0\n 5 4 1 0\n 6 5 2 0\n 7 6 1 0\n 8 5 1 0\n 9 8 2 0\n 9 7 1 0\n 10 9 1 0\n 11 10 2 0\n 12 8 1 0\n 13 12 2 0\n 13 11 1 0\n 14 13 1 0\n 15 14 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":204.13,"logp":2.24,"tpsa":28.26,"ha":15,"hacc":2,"hdon":1,"rots":3,"rings":2,"velec":80,"number":548},{"id":37514,"smiles":"COc1ccc2[nH]cc(CN(C)C)c2c1","cmpd_id":65,"prot_id":37425,"protein_code":"Mac1-DLS-X0548B:Z2856434938","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-X0548_0B_apo_IjG7s4M.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 15 16 0 0 0 0 0 0 0 0999 V2000\n 3.0410 52.0870 -2.1290 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.8140 53.3240 -2.0320 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9130 54.4710 -2.0210 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.6540 53.3070 -0.8310 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5120 54.5290 -0.6520 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6680 55.2690 0.4840 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5780 56.2700 0.2780 N 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3780 55.1200 -1.6360 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0260 56.2040 -1.0160 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9280 57.0080 -1.7030 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1890 56.7230 -3.0320 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6460 54.8480 -2.9740 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.5510 55.6540 -3.6570 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9390 55.4780 -4.9590 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4380 54.3420 -5.6620 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 1 0\n 4 2 1 0\n 5 4 1 0\n 6 5 2 0\n 7 6 1 0\n 8 5 1 0\n 9 8 2 0\n 9 7 1 0\n 10 9 1 0\n 11 10 2 0\n 12 8 1 0\n 13 12 2 0\n 13 11 1 0\n 14 13 1 0\n 15 14 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":204.13,"logp":2.24,"tpsa":28.26,"ha":15,"hacc":2,"hdon":1,"rots":3,"rings":2,"velec":80,"number":548},{"id":37520,"smiles":"CC(=O)c1ccc(OCC(=O)O)cc1","cmpd_id":3956,"prot_id":37431,"protein_code":"Mac1-DLS-X0600A:Z2856434937","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-X0600_0A_apo_N27eGoI.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 14 14 0 0 0 0 0 0 0 0999 V2000\n 10.6600 57.8560 -7.8620 O 0 0 0 0 0 0 0 0 0 0 0 0\n 11.3160 58.8540 -8.0500 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.8190 60.0650 -7.9380 O 0 0 0 0 0 0 0 0 0 0 0 0\n 12.7780 58.8100 -8.4160 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.3250 60.0950 -8.7480 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.0930 60.6530 -9.9870 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.3360 59.9990 -10.9520 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.0720 60.6230 -12.1560 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.6060 61.9230 -10.2400 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.3370 62.5440 -11.4480 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.5590 61.9060 -12.4190 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.2130 62.5650 -13.7100 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.5130 61.9830 -14.5310 O 0 0 0 0 0 0 0 0 0 0 0 0\n 12.7220 63.9420 -13.9880 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 2 0\n 3 2 1 0\n 4 2 1 0\n 5 4 1 0\n 6 5 1 0\n 7 6 2 0\n 8 7 1 0\n 9 6 1 0\n 10 9 2 0\n 11 10 1 0\n 11 8 2 0\n 12 11 1 0\n 13 12 2 0\n 14 12 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":194.06,"logp":1.35,"tpsa":63.6,"ha":14,"hacc":3,"hdon":1,"rots":4,"rings":1,"velec":74,"number":600},{"id":37536,"smiles":"C[C@@H]1[C@H](C#N)CCCN1S(C)(=O)=O","cmpd_id":3961,"prot_id":37447,"protein_code":"Mac1-DLS-X0729B:POB0013","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-X0729_0B_apo_ztXvw6O.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 13 13 0 0 0 0 0 0 0 0999 V2000\n 23.8800 60.1080 0.2500 N 0 0 0 0 0 0 0 0 0 0 0 0\n 23.0210 60.8530 0.2150 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.9180 61.8120 0.1160 C 0 0 1 0 0 0 0 0 0 0 0 0\n 20.9570 61.3760 -1.0110 C 0 0 1 0 0 0 0 0 0 0 0 0\n 20.4390 59.9640 -0.8180 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.1610 61.9140 1.4490 C 0 0 0 0 0 0 0 0 0 0 0 0\n 20.0090 62.9150 1.3430 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.0760 62.5660 0.1870 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.8480 62.3650 -1.0720 N 0 0 0 0 0 0 0 0 0 0 0 0\n 19.1890 62.7350 -2.5090 S 0 0 0 0 0 0 0 0 0 0 0 0\n 17.8840 63.2510 -2.2410 O 0 0 0 0 0 0 0 0 0 0 0 0\n 19.3180 61.5780 -3.3330 O 0 0 0 0 0 0 0 0 0 0 0 0\n 20.1540 64.0190 -3.2100 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 3 0\n 3 2 1 1\n 4 3 1 0\n 4 5 1 1\n 6 3 1 0\n 7 6 1 0\n 8 7 1 0\n 9 8 1 0\n 9 4 1 0\n 10 9 1 0\n 11 10 2 0\n 12 10 2 0\n 10 13 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":202.08,"logp":0.57,"tpsa":61.17,"ha":13,"hacc":3,"hdon":0,"rots":1,"rings":1,"velec":74,"number":729},{"id":37538,"smiles":"CNC(=O)[C@H]1CCCN(S(C)(=O)=O)[C@H]1C","cmpd_id":3962,"prot_id":37449,"protein_code":"Mac1-DLS-X0737B:POB0014","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-X0737_0B_apo_R22pr32.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 15 15 0 0 0 0 0 0 0 0999 V2000\n 24.4420 41.7920 -26.3430 O 0 0 0 0 0 0 0 0 0 0 0 0\n 24.1710 41.4380 -24.9830 S 0 0 0 0 0 0 0 0 0 0 0 0\n 22.8510 41.6350 -24.4690 O 0 0 0 0 0 0 0 0 0 0 0 0\n 25.3080 42.2750 -23.9570 C 0 0 0 0 0 0 0 0 0 0 0 0\n 24.5070 39.8620 -24.8310 N 0 0 0 0 0 0 0 0 0 0 0 0\n 25.8930 39.4070 -25.1220 C 0 0 0 0 0 0 0 0 0 0 0 0\n 26.2470 38.2010 -24.2640 C 0 0 0 0 0 0 0 0 0 0 0 0\n 25.1760 37.1160 -24.3840 C 0 0 0 0 0 0 0 0 0 0 0 0\n 23.4310 38.8550 -24.9690 C 0 0 1 0 0 0 0 0 0 0 0 0\n 23.1820 38.4750 -26.4200 C 0 0 0 0 0 0 0 0 0 0 0 0\n 23.7650 37.6480 -24.0700 C 0 0 1 0 0 0 0 0 0 0 0 0\n 22.7250 36.5540 -24.2070 C 0 0 0 0 0 0 0 0 0 0 0 0\n 22.9810 35.5040 -24.7950 O 0 0 0 0 0 0 0 0 0 0 0 0\n 21.5460 36.8050 -23.6420 N 0 0 0 0 0 0 0 0 0 0 0 0\n 20.4210 35.8960 -23.7600 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 2 0\n 3 2 2 0\n 2 4 1 0\n 5 2 1 0\n 6 5 1 0\n 7 6 1 0\n 8 7 1 0\n 9 5 1 0\n 9 10 1 6\n 11 8 1 0\n 11 9 1 0\n 11 12 1 6\n 13 12 2 0\n 14 12 1 0\n 15 14 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":234.1,"logp":-0.21,"tpsa":66.48,"ha":15,"hacc":3,"hdon":1,"rots":2,"rings":1,"velec":88,"number":737},{"id":37543,"smiles":"O=C1Nc2ccccc2C[C@]12CCCN2","cmpd_id":3966,"prot_id":37454,"protein_code":"Mac1-DLS-X0796B:POB0120","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-X0796_0B_apo_vjdSyEG.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 15 17 0 0 0 0 0 0 0 0999 V2000\n 25.7360 41.9190 -24.0710 O 0 0 0 0 0 0 0 0 0 0 0 0\n 25.6620 40.8230 -24.6120 C 0 0 0 0 0 0 0 0 0 0 0 0\n 24.5390 40.5380 -25.5860 C 0 0 2 0 0 0 0 0 0 0 0 0\n 25.1450 40.7760 -26.9850 C 0 0 0 0 0 0 0 0 0 0 0 0\n 24.5050 42.0470 -27.4750 C 0 0 0 0 0 0 0 0 0 0 0 0\n 23.1440 41.9950 -26.8210 C 0 0 0 0 0 0 0 0 0 0 0 0\n 23.4140 41.4750 -25.4720 N 0 0 0 0 0 0 0 0 0 0 0 0\n 24.0560 39.0880 -25.4110 C 0 0 0 0 0 0 0 0 0 0 0 0\n 25.2410 38.1580 -25.4890 C 0 0 0 0 0 0 0 0 0 0 0 0\n 25.1870 36.9290 -26.1430 C 0 0 0 0 0 0 0 0 0 0 0 0\n 26.3090 36.1240 -26.2250 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.4930 36.5250 -25.6510 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.5750 37.7320 -24.9740 C 0 0 0 0 0 0 0 0 0 0 0 0\n 26.4510 38.5550 -24.9020 C 0 0 0 0 0 0 0 0 0 0 0 0\n 26.5640 39.8500 -24.3960 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 2 0\n 3 2 1 0\n 3 4 1 6\n 5 4 1 0\n 6 5 1 0\n 7 6 1 0\n 7 3 1 0\n 8 3 1 0\n 9 8 1 0\n 10 9 1 0\n 11 10 2 0\n 12 11 1 0\n 13 12 2 0\n 14 9 2 0\n 14 13 1 0\n 15 14 1 0\n 15 2 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":202.11,"logp":1.3,"tpsa":41.13,"ha":15,"hacc":2,"hdon":2,"rots":0,"rings":3,"velec":78,"number":796},{"id":37546,"smiles":"C[C@H]1[C@@H](C(N)=O)CCCN1S(C)(=O)=O","cmpd_id":3969,"prot_id":37457,"protein_code":"Mac1-DLS-X0814B:POB0012","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-X0814_0B_apo_KHptd0u.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 14 14 0 0 0 0 0 0 0 0999 V2000\n 21.7080 36.8110 -23.8240 O 0 0 0 0 0 0 0 0 0 0 0 0\n 22.8730 36.5640 -24.1490 C 0 0 0 0 0 0 0 0 0 0 0 0\n 23.2520 35.3770 -24.6040 N 0 0 0 0 0 0 0 0 0 0 0 0\n 23.9490 37.6240 -24.0310 C 0 0 1 0 0 0 0 0 0 0 0 0\n 25.3780 37.1470 -24.3420 C 0 0 0 0 0 0 0 0 0 0 0 0\n 26.3980 38.2810 -24.2390 C 0 0 0 0 0 0 0 0 0 0 0 0\n 25.9910 39.4490 -25.1210 C 0 0 0 0 0 0 0 0 0 0 0 0\n 24.5970 39.8580 -24.8210 N 0 0 0 0 0 0 0 0 0 0 0 0\n 24.2250 41.4330 -24.9020 S 0 0 0 0 0 0 0 0 0 0 0 0\n 22.8640 41.5550 -24.4830 O 0 0 0 0 0 0 0 0 0 0 0 0\n 25.2390 42.1320 -24.1790 O 0 0 0 0 0 0 0 0 0 0 0 0\n 24.3180 41.9020 -26.5900 C 0 0 0 0 0 0 0 0 0 0 0 0\n 23.5510 38.8030 -24.9390 C 0 0 1 0 0 0 0 0 0 0 0 0\n 23.3070 38.3810 -26.3810 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 2 0\n 3 2 1 0\n 4 2 1 6\n 5 4 1 0\n 6 5 1 0\n 7 6 1 0\n 8 7 1 0\n 9 8 1 0\n 10 9 2 0\n 11 9 2 0\n 9 12 1 0\n 13 4 1 0\n 13 8 1 0\n 13 14 1 6\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":220.09,"logp":-0.47,"tpsa":80.47,"ha":14,"hacc":3,"hdon":1,"rots":2,"rings":1,"velec":82,"number":814},{"id":37559,"smiles":"Oc1ccccn1","cmpd_id":1605,"prot_id":37470,"protein_code":"Mac1-DLS-X0905B:Z1741982125","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-X0905_0B_apo_KOp4BUz.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 7 7 0 0 0 0 0 0 0 0999 V2000\n 18.5470 38.0780 -21.6350 O 0 0 0 0 0 0 0 0 0 0 0 0\n 17.5880 38.9190 -21.9700 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.9600 40.1320 -22.5000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 16.9640 40.9470 -22.8880 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.6180 40.6350 -22.7700 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.2710 39.4180 -22.2130 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.2570 38.5310 -21.8060 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 2 0\n 4 3 1 0\n 5 4 2 0\n 6 5 1 0\n 7 6 2 0\n 7 2 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":95.04,"logp":0.79,"tpsa":33.12,"ha":7,"hacc":2,"hdon":1,"rots":0,"rings":1,"velec":36,"number":905},{"id":37564,"smiles":"Nc1ccncc1","cmpd_id":3980,"prot_id":37475,"protein_code":"Mac1-DLS-X0918B:Z955123498","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-X0918_0B_apo_2od9q2z.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 7 7 0 0 0 0 0 0 0 0999 V2000\n 14.3380 38.5580 -21.7410 N 0 0 0 0 0 0 0 0 0 0 0 0\n 15.6780 38.9130 -21.8510 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.0590 40.2220 -22.1600 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.4000 40.5120 -22.3430 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.3760 39.5920 -22.2410 N 0 0 0 0 0 0 0 0 0 0 0 0\n 18.0070 38.3340 -21.9440 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.6900 37.9570 -21.7350 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 2 0\n 4 3 1 0\n 5 4 2 0\n 6 5 1 0\n 7 2 1 0\n 7 6 2 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":94.05,"logp":0.66,"tpsa":38.91,"ha":7,"hacc":2,"hdon":1,"rots":0,"rings":1,"velec":36,"number":918},{"id":37570,"smiles":"NC1NCCCN1","cmpd_id":3982,"prot_id":37481,"protein_code":"Mac1-DLS-X0933B:Z1954800348","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-X0933_0B_apo_eb29pHk.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 7 7 0 0 0 0 0 0 0 0999 V2000\n 7.2820 49.2170 -10.0050 N 0 0 0 0 0 0 0 0 0 0 0 0\n 6.8370 48.7280 -8.8920 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2890 47.6050 -8.2940 N 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7860 47.0300 -7.0470 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1590 48.1120 -6.2050 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.2100 48.9910 -7.0220 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8370 49.4040 -8.2940 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 1 0\n 4 3 1 0\n 5 4 1 0\n 6 5 1 0\n 7 6 1 0\n 7 2 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":101.1,"logp":-1.19,"tpsa":50.08,"ha":7,"hacc":3,"hdon":3,"rots":0,"rings":1,"velec":42,"number":933},{"id":37573,"smiles":"NC1NCCCN1","cmpd_id":3982,"prot_id":37484,"protein_code":"Mac1-DLS-X0933_2A:Z1954800348","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-X0933_2A_apo_XWVQ4ER.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 7 7 0 0 0 0 0 0 0 0999 V2000\n 31.3160 27.2920 -12.4450 N 0 0 0 0 0 0 0 0 0 0 0 0\n 30.5320 27.1050 -13.4440 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.3260 26.5150 -13.3650 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.4120 26.2750 -14.4850 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.7820 27.1340 -15.6920 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.2730 27.3450 -15.9200 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.9750 27.5180 -14.6480 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 1 0\n 4 3 1 0\n 5 4 1 0\n 6 5 1 0\n 7 2 1 0\n 7 6 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":101.1,"logp":-1.19,"tpsa":50.08,"ha":7,"hacc":3,"hdon":3,"rots":0,"rings":1,"velec":42,"number":933},{"id":37585,"smiles":"Cn1c2c(c3ccccc31)C[C@@H]1C[C@H]2[C@@H](O)CN1","cmpd_id":3990,"prot_id":37496,"protein_code":"Mac1-DLS-X1092B:FMOOA000509a","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-X1092_0B_apo_fn1w5UV.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 18 21 0 0 0 0 0 0 0 0999 V2000\n 7.2990 58.1720 -6.5480 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6690 57.1490 -5.7810 C 0 0 2 0 0 0 0 0 0 0 0 0\n 7.7310 56.1300 -5.3370 C 0 0 2 0 0 0 0 0 0 0 0 0\n 5.5980 56.5430 -6.6790 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.1510 55.2110 -6.2320 N 0 0 0 0 0 0 0 0 0 0 0 0\n 6.2050 54.2410 -5.8920 C 0 0 1 0 0 0 0 0 0 0 0 0\n 7.6040 54.8240 -6.1390 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1010 53.7440 -4.4480 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6030 54.7910 -3.4980 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4410 55.7880 -3.9010 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4210 54.9350 -2.0790 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1980 56.0280 -1.6770 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8670 56.5220 -2.8000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9450 57.5050 -2.7550 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2030 56.4740 -0.3640 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4230 55.8000 0.5650 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6650 54.7030 0.1880 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6600 54.2620 -1.1270 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 6\n 3 2 1 0\n 4 2 1 0\n 5 4 1 0\n 6 5 1 0\n 7 6 1 0\n 7 3 1 0\n 6 8 1 1\n 9 8 1 0\n 10 9 2 0\n 3 10 1 1\n 11 9 1 0\n 12 11 2 0\n 13 12 1 0\n 13 10 1 0\n 14 13 1 0\n 15 12 1 0\n 16 15 2 0\n 17 16 1 0\n 18 17 2 0\n 18 11 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":242.14,"logp":1.54,"tpsa":37.19,"ha":18,"hacc":3,"hdon":2,"rots":0,"rings":4,"velec":94,"number":1092}],"238519":[{"id":37586,"smiles":"Nc1ccc2oc(=O)ccc2c1","cmpd_id":4015,"prot_id":37497,"protein_code":"Mac1-UCSF-C058A:ZINC000001612349","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-UCSF-C058_0A_apo_oRCIAHW.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 12 13 0 0 0 0 0 0 0 0999 V2000\n 24.9080 35.5260 -27.0690 N 0 0 0 0 0 0 0 0 0 0 0 0\n 25.1460 36.7890 -26.4020 C 0 0 0 0 0 0 0 0 0 0 0 0\n 26.4290 37.0320 -25.8460 C 0 0 0 0 0 0 0 0 0 0 0 0\n 26.6810 38.2470 -25.1940 C 0 0 0 0 0 0 0 0 0 0 0 0\n 25.6590 39.2120 -25.1030 C 0 0 0 0 0 0 0 0 0 0 0 0\n 25.9330 40.4980 -24.4110 O 0 0 0 0 0 0 0 0 0 0 0 0\n 25.0330 41.6070 -24.5510 C 0 0 0 0 0 0 0 0 0 0 0 0\n 25.4000 42.6650 -24.1690 O 0 0 0 0 0 0 0 0 0 0 0 0\n 23.6820 41.3760 -25.1440 C 0 0 0 0 0 0 0 0 0 0 0 0\n 23.3140 40.0230 -25.5420 C 0 0 0 0 0 0 0 0 0 0 0 0\n 24.3910 38.9650 -25.6560 C 0 0 0 0 0 0 0 0 0 0 0 0\n 24.1550 37.7350 -26.3050 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 2 0\n 4 3 1 0\n 5 4 2 0\n 6 5 1 0\n 7 6 1 0\n 8 7 2 0\n 9 7 1 0\n 10 9 2 0\n 11 10 1 0\n 11 5 1 0\n 12 2 1 0\n 12 11 2 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":161.05,"logp":1.38,"tpsa":56.23,"ha":12,"hacc":3,"hdon":1,"rots":0,"rings":2,"velec":60,"number":0},{"id":37587,"smiles":"Cc1cc(Br)c2c(c1)C(=O)C(=O)N2","cmpd_id":4016,"prot_id":37498,"protein_code":"Mac1-UCSF-C102A:ZINC000002977810","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-UCSF-C102_0A_apo_FeN8LnG.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 13 14 0 0 0 0 0 0 0 0999 V2000\n 41.5790 33.8100 -20.9870 C 0 0 0 0 0 0 0 0 0 0 0 0\n 40.9060 35.1750 -20.8690 C 0 0 0 0 0 0 0 0 0 0 0 0\n 40.0130 35.5650 -21.8660 C 0 0 0 0 0 0 0 0 0 0 0 0\n 39.3820 36.8050 -21.7900 C 0 0 0 0 0 0 0 0 0 0 0 0\n 38.3870 37.4850 -22.7050 C 0 0 0 0 0 0 0 0 0 0 0 0\n 37.9310 37.0580 -23.7180 O 0 0 0 0 0 0 0 0 0 0 0 0\n 38.0770 38.7880 -22.1090 C 0 0 0 0 0 0 0 0 0 0 0 0\n 37.3290 39.5830 -22.5450 O 0 0 0 0 0 0 0 0 0 0 0 0\n 38.8400 38.9300 -20.8860 N 0 0 0 0 0 0 0 0 0 0 0 0\n 39.6580 37.6720 -20.6950 C 0 0 0 0 0 0 0 0 0 0 0 0\n 40.5520 37.2890 -19.6900 C 0 0 0 0 0 0 0 0 0 0 0 0\n 41.1800 36.0400 -19.7770 C 0 0 0 0 0 0 0 0 0 0 0 0\n 40.9100 38.4910 -18.1950 Br 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 2 0\n 4 3 1 0\n 5 4 1 0\n 6 5 2 0\n 7 5 1 0\n 8 7 2 0\n 9 7 1 0\n 10 4 2 0\n 10 9 1 0\n 11 10 1 0\n 12 11 2 0\n 12 2 1 0\n 13 11 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":238.96,"logp":1.89,"tpsa":46.17,"ha":13,"hacc":2,"hdon":1,"rots":0,"rings":2,"velec":66,"number":0},{"id":37594,"smiles":"c1ccc2[nH]ncc2c1","cmpd_id":3944,"prot_id":37505,"protein_code":"Mac1-UCSF-C279A:ZINC000016052862","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-UCSF-C279_0A_apo_2K34KK5.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 9 10 0 0 0 0 0 0 0 0999 V2000\n 7.7250 43.2780 13.1750 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.8330 43.8270 12.7000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 8.4390 44.9320 12.0070 N 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0870 45.1140 12.0110 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1780 46.0590 11.4200 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8160 45.9690 11.6320 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3100 44.9040 12.3810 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.1840 43.9630 12.9340 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5800 44.0630 12.7480 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 2 0\n 3 2 1 0\n 4 3 1 0\n 5 4 2 0\n 6 5 1 0\n 7 6 2 0\n 8 7 1 0\n 9 8 2 0\n 9 1 1 0\n 9 4 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":118.05,"logp":1.56,"tpsa":28.68,"ha":9,"hacc":1,"hdon":1,"rots":0,"rings":2,"velec":44,"number":0}],"238520":[{"id":37459,"smiles":"Cc1n[nH]c(N)c1C#N","cmpd_id":5068,"prot_id":37370,"protein_code":"Mac1-DLS-EU0046B:EN300-43406","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-EU0046_0B_apo_wSxVnsC.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 9 9 0 0 0 0 0 0 0 0999 V2000\n 23.9840 61.3960 0.6750 N 0 0 0 0 0 0 0 0 0 0 0 0\n 23.4340 60.3890 0.6110 C 0 0 0 0 0 0 0 0 0 0 0 0\n 22.7020 59.1630 0.4970 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.4260 58.9180 -0.0790 C 0 0 0 0 0 0 0 0 0 0 0 0\n 20.4660 59.9080 -0.6550 C 0 0 0 0 0 0 0 0 0 0 0 0\n 23.1710 57.8720 0.8770 C 0 0 0 0 0 0 0 0 0 0 0 0\n 24.3110 57.5560 1.4830 N 0 0 0 0 0 0 0 0 0 0 0 0\n 22.1970 56.9500 0.5070 N 0 0 0 0 0 0 0 0 0 0 0 0\n 21.1430 57.6060 -0.0730 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 3 0\n 3 2 1 0\n 4 3 1 0\n 5 4 1 0\n 6 3 2 0\n 7 6 1 0\n 8 6 1 0\n 9 4 2 0\n 9 8 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":122.06,"logp":0.17,"tpsa":78.49,"ha":9,"hacc":3,"hdon":2,"rots":0,"rings":1,"velec":46,"number":0},{"id":37472,"smiles":"N[C@@H]1CCCc2c(O)cccc21","cmpd_id":5081,"prot_id":37383,"protein_code":"Mac1-DLS-EU0526A:PB1827975385","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-EU0526_0A_apo_C5JzWI1.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 12 13 0 0 0 0 0 0 0 0999 V2000\n 14.4870 48.6000 -21.7290 N 0 0 0 0 0 0 0 0 0 0 0 0\n 13.7260 47.3410 -21.9880 C 0 0 1 0 0 0 0 0 0 0 0 0\n 14.4340 46.1830 -21.3140 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.8230 46.1090 -21.3770 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.5040 45.0730 -20.7680 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.8210 44.0810 -20.0890 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.4420 44.1200 -20.0410 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.7750 43.1190 -19.3920 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.7210 45.1530 -20.6790 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.2080 45.1810 -20.6090 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.5620 46.1680 -21.5610 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.2880 47.4870 -21.4840 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 1\n 3 2 1 0\n 4 3 2 0\n 5 4 1 0\n 6 5 2 0\n 7 6 1 0\n 8 7 1 0\n 9 7 2 0\n 9 3 1 0\n 10 9 1 0\n 11 10 1 0\n 12 2 1 0\n 12 11 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":163.1,"logp":1.73,"tpsa":46.25,"ha":12,"hacc":2,"hdon":2,"rots":0,"rings":2,"velec":64,"number":0},{"id":37476,"smiles":"NCCCN1C(=O)COc2ccccc21","cmpd_id":5085,"prot_id":37387,"protein_code":"Mac1-DLS-EU0744B:Z1262398530","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-EU0744_0B_apo_Od3h3vN.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 15 16 0 0 0 0 0 0 0 0999 V2000\n 3.4430 42.5480 11.6930 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9740 43.9160 11.4640 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.0980 44.9400 11.4270 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.2680 44.5310 10.5530 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4200 44.0290 11.3470 N 0 0 0 0 0 0 0 0 0 0 0 0\n 7.5020 44.8920 11.6810 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.5080 46.2530 11.3570 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6220 47.0400 11.6360 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.7280 46.4850 12.2630 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.7160 45.1610 12.6480 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6260 44.3650 12.3240 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.7080 43.0470 12.6700 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.5300 42.2570 12.6200 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4290 42.7100 11.7060 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5720 41.9340 11.3370 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 1 0\n 4 3 1 0\n 5 4 1 0\n 6 5 1 0\n 7 6 2 0\n 8 7 1 0\n 9 8 2 0\n 10 9 1 0\n 11 10 2 0\n 11 6 1 0\n 12 11 1 0\n 13 12 1 0\n 14 13 1 0\n 14 5 1 0\n 15 14 2 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":206.11,"logp":0.76,"tpsa":55.56,"ha":15,"hacc":3,"hdon":1,"rots":3,"rings":2,"velec":80,"number":0},{"id":37489,"smiles":"N#Cc1ccc(CNC(=O)N2CCOCC2)cc1","cmpd_id":3855,"prot_id":37400,"protein_code":"Mac1-DLS-X0173B:Z509756472","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-X0173_0B_apo_zAqQLai.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 18 19 0 0 0 0 0 0 0 0999 V2000\n 26.4370 27.5980 -5.3620 N 0 0 0 0 0 0 0 0 0 0 0 0\n 27.0870 27.3600 -4.4590 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.9380 27.0400 -3.3430 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.8250 27.7460 -2.1490 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.6840 27.4710 -1.0990 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.9070 26.0480 -3.4600 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.7620 25.7910 -2.4050 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.6630 26.4950 -1.2110 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.5670 26.1670 -0.0460 C 0 0 0 0 0 0 0 0 0 0 0 0\n 31.3730 27.2960 0.4030 N 0 0 0 0 0 0 0 0 0 0 0 0\n 32.5960 27.5520 -0.1130 C 0 0 0 0 0 0 0 0 0 0 0 0\n 33.0760 26.8350 -0.9830 O 0 0 0 0 0 0 0 0 0 0 0 0\n 33.2670 28.6470 0.3660 N 0 0 0 0 0 0 0 0 0 0 0 0\n 34.3350 29.1980 -0.4840 C 0 0 0 0 0 0 0 0 0 0 0 0\n 35.2710 30.0330 0.3440 C 0 0 0 0 0 0 0 0 0 0 0 0\n 34.5700 31.0590 1.0430 O 0 0 0 0 0 0 0 0 0 0 0 0\n 33.6250 30.4840 1.9420 C 0 0 0 0 0 0 0 0 0 0 0 0\n 32.6020 29.6530 1.2110 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 3 0\n 3 2 1 0\n 4 3 2 0\n 5 4 1 0\n 6 3 1 0\n 7 6 2 0\n 8 7 1 0\n 8 5 2 0\n 9 8 1 0\n 10 9 1 0\n 11 10 1 0\n 12 11 2 0\n 13 11 1 0\n 14 13 1 0\n 15 14 1 0\n 16 15 1 0\n 17 16 1 0\n 18 17 1 0\n 18 13 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":245.12,"logp":1.1,"tpsa":65.36,"ha":18,"hacc":3,"hdon":1,"rots":2,"rings":2,"velec":94,"number":173},{"id":37490,"smiles":"CC(C)NC(=O)N(C)[C@H]1CCS(=O)(=O)C1","cmpd_id":126,"prot_id":37401,"protein_code":"Mac1-DLS-X0216A:Z445856640","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-X0216_0A_apo_avC8fGx.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 15 15 0 0 0 0 0 0 0 0999 V2000\n 14.9800 27.2050 -13.8640 O 0 0 0 0 0 0 0 0 0 0 0 0\n 14.4940 26.8130 -15.1590 S 0 0 0 0 0 0 0 0 0 0 0 0\n 14.5250 25.4140 -15.4910 O 0 0 0 0 0 0 0 0 0 0 0 0\n 15.2380 27.7140 -16.3600 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.6590 29.1160 -16.2030 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.8630 27.4870 -15.4250 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.1920 28.9500 -15.7570 C 0 0 1 0 0 0 0 0 0 0 0 0\n 12.7490 29.8950 -14.7100 N 0 0 0 0 0 0 0 0 0 0 0 0\n 13.5260 29.8080 -13.4780 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.1650 31.0740 -15.1010 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.5130 31.6580 -16.1170 O 0 0 0 0 0 0 0 0 0 0 0 0\n 11.1760 31.5530 -14.3080 N 0 0 0 0 0 0 0 0 0 0 0 0\n 10.4300 32.7720 -14.6370 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.2760 32.4420 -15.5590 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.9520 33.4450 -13.3720 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 2 0\n 3 2 2 0\n 2 4 1 0\n 5 4 1 0\n 6 2 1 0\n 7 6 1 0\n 7 5 1 0\n 7 8 1 1\n 9 8 1 0\n 10 8 1 0\n 11 10 2 0\n 12 10 1 0\n 13 12 1 0\n 13 14 1 0\n 15 13 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":234.1,"logp":0.22,"tpsa":66.48,"ha":15,"hacc":3,"hdon":1,"rots":2,"rings":1,"velec":88,"number":216},{"id":37510,"smiles":"CC(C)c1ncc(Cl)c(C(N)=O)n1","cmpd_id":418,"prot_id":37421,"protein_code":"Mac1-DLS-X0496A:Z906021418","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-X0496_0A_apo_FihnDZV.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 13 13 0 0 0 0 0 0 0 0999 V2000\n 8.1240 41.5520 -2.8480 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4700 42.2210 -2.0410 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.3990 43.5590 -2.0720 N 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6710 41.5410 -0.9600 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1300 40.4400 -0.2360 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6890 39.7100 -0.4890 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 6.2720 39.9180 0.7210 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0510 40.4250 0.9510 N 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4510 42.0630 -0.7460 N 0 0 0 0 0 0 0 0 0 0 0 0\n 4.6960 41.4820 0.1970 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.3530 42.1260 0.4690 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2850 41.1080 0.8660 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5020 43.2000 1.5360 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 2 0\n 3 2 1 0\n 4 2 1 0\n 5 4 2 0\n 6 5 1 0\n 7 5 1 0\n 8 7 2 0\n 9 4 1 0\n 10 8 1 0\n 10 9 2 0\n 11 10 1 0\n 11 12 1 0\n 13 11 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":199.05,"logp":1.35,"tpsa":68.87,"ha":13,"hacc":3,"hdon":1,"rots":2,"rings":1,"velec":70,"number":496},{"id":37524,"smiles":"CC(=O)NCC1(c2ccccc2)CCOCC1","cmpd_id":211,"prot_id":37435,"protein_code":"Mac1-DLS-X0655B:Z384468096","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-X0655_0B_apo_TOhIyc9.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 17 18 0 0 0 0 0 0 0 0999 V2000\n 22.1190 25.7170 9.1870 O 0 0 0 0 0 0 0 0 0 0 0 0\n 20.9090 25.6200 9.0120 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.9440 25.5670 10.1610 C 0 0 0 0 0 0 0 0 0 0 0 0\n 20.3780 25.5470 7.7880 N 0 0 0 0 0 0 0 0 0 0 0 0\n 21.1690 25.3980 6.5780 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.2510 26.6580 5.7000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 22.3290 26.4080 4.6160 C 0 0 0 0 0 0 0 0 0 0 0 0\n 22.2680 27.4500 3.5160 C 0 0 0 0 0 0 0 0 0 0 0 0\n 20.9670 27.5280 2.9280 O 0 0 0 0 0 0 0 0 0 0 0 0\n 19.9960 27.9190 3.8940 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.8850 26.9090 5.0160 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.6400 27.8570 6.5820 C 0 0 0 0 0 0 0 0 0 0 0 0\n 20.6650 28.6690 7.1620 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.0180 29.6910 8.0300 C 0 0 0 0 0 0 0 0 0 0 0 0\n 22.3490 29.9240 8.3230 C 0 0 0 0 0 0 0 0 0 0 0 0\n 23.3250 29.1340 7.7510 C 0 0 0 0 0 0 0 0 0 0 0 0\n 22.9770 28.1070 6.8890 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 2 0\n 3 2 1 0\n 4 2 1 0\n 5 4 1 0\n 6 5 1 0\n 7 6 1 0\n 8 7 1 0\n 9 8 1 0\n 10 9 1 0\n 11 6 1 0\n 11 10 1 0\n 12 6 1 0\n 13 12 2 0\n 14 13 1 0\n 15 14 2 0\n 16 15 1 0\n 17 12 1 0\n 17 16 2 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":233.14,"logp":1.87,"tpsa":38.33,"ha":17,"hacc":2,"hdon":1,"rots":3,"rings":2,"velec":92,"number":655},{"id":37535,"smiles":"C[C@@H]1[C@H](C#N)CCCN1S(C)(=O)=O","cmpd_id":3961,"prot_id":37446,"protein_code":"Mac1-DLS-X0729A:POB0013","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-X0729_0A_apo_mNWA0e5.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 13 13 0 0 0 0 0 0 0 0999 V2000\n 14.6240 28.2930 -12.7380 N 0 0 0 0 0 0 0 0 0 0 0 0\n 13.8910 28.5200 -13.5720 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.9420 28.7550 -14.6580 C 0 0 1 0 0 0 0 0 0 0 0 0\n 13.5650 29.7640 -15.6480 C 0 0 1 0 0 0 0 0 0 0 0 0\n 14.9900 29.4010 -16.0330 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.6210 27.4180 -15.3430 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.7150 27.6270 -16.5540 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.3410 28.6050 -17.5350 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.6790 29.8790 -16.8440 N 0 0 0 0 0 0 0 0 0 0 0 0\n 12.4790 31.2900 -17.6320 S 0 0 0 0 0 0 0 0 0 0 0 0\n 13.2350 32.2700 -16.9200 O 0 0 0 0 0 0 0 0 0 0 0 0\n 11.0730 31.4820 -17.7850 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.1850 31.0960 -19.2260 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 3 0\n 3 2 1 1\n 4 3 1 0\n 4 5 1 6\n 6 3 1 0\n 7 6 1 0\n 8 7 1 0\n 9 8 1 0\n 9 4 1 0\n 10 9 1 0\n 11 10 2 0\n 12 10 2 0\n 10 13 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":202.08,"logp":0.57,"tpsa":61.17,"ha":13,"hacc":3,"hdon":0,"rots":1,"rings":1,"velec":74,"number":729},{"id":37537,"smiles":"C[C@@H]1[C@H](C#N)CCCN1S(C)(=O)=O","cmpd_id":3961,"prot_id":37448,"protein_code":"Mac1-DLS-X0729_1B:POB0013","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-X0729_1B_apo_vWR0fSX.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 13 13 0 0 0 0 0 0 0 0999 V2000\n 15.0800 28.5030 -13.3720 N 0 0 0 0 0 0 0 0 0 0 0 0\n 14.3790 28.8080 -14.2130 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.4350 29.1830 -15.2680 C 0 0 1 0 0 0 0 0 0 0 0 0\n 14.0610 30.1960 -16.2540 C 0 0 1 0 0 0 0 0 0 0 0 0\n 15.3930 29.7270 -16.8120 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.9140 27.9320 -15.9910 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.9370 28.3110 -17.1020 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.5740 29.2930 -18.0720 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.0690 30.4750 -17.3290 N 0 0 0 0 0 0 0 0 0 0 0 0\n 12.1580 31.8190 -17.3630 S 0 0 0 0 0 0 0 0 0 0 0 0\n 10.8920 31.4450 -17.9070 O 0 0 0 0 0 0 0 0 0 0 0 0\n 12.9270 32.8180 -18.0330 O 0 0 0 0 0 0 0 0 0 0 0 0\n 11.9070 32.3330 -15.7060 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 3 0\n 3 2 1 1\n 4 3 1 0\n 4 5 1 6\n 6 3 1 0\n 7 6 1 0\n 8 7 1 0\n 9 8 1 0\n 9 4 1 0\n 10 9 1 0\n 11 10 2 0\n 12 10 2 0\n 10 13 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":202.08,"logp":0.57,"tpsa":61.17,"ha":13,"hacc":3,"hdon":0,"rots":1,"rings":1,"velec":74,"number":729},{"id":37561,"smiles":"Nc1nnc[nH]1","cmpd_id":3979,"prot_id":37472,"protein_code":"Mac1-DLS-X0910B:Z56866006","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-X0910_0B_apo_RfkKqM4.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 6 6 0 0 0 0 0 0 0 0999 V2000\n 24.7880 57.6920 0.8180 N 0 0 0 0 0 0 0 0 0 0 0 0\n 23.4920 57.8070 0.5470 C 0 0 0 0 0 0 0 0 0 0 0 0\n 22.9180 58.9900 0.2140 N 0 0 0 0 0 0 0 0 0 0 0 0\n 21.6240 58.7310 -0.0490 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.3990 57.3950 0.1220 N 0 0 0 0 0 0 0 0 0 0 0 0\n 22.6000 56.8270 0.5090 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 1 0\n 4 3 1 0\n 5 4 2 0\n 6 5 1 0\n 6 2 2 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":84.04,"logp":-0.61,"tpsa":67.59,"ha":6,"hacc":3,"hdon":2,"rots":0,"rings":1,"velec":32,"number":910},{"id":37572,"smiles":"NC1NCCCN1","cmpd_id":3982,"prot_id":37483,"protein_code":"Mac1-DLS-X0933_1B:Z1954800348","mol_type":"PR","molecule_protein":"/media/pdbs/Mac1-DLS-X0933_1B_apo_Tgu11qB.pdb","lig_id":"LIG","chain_id":"Z","sdf_info":"\n RDKit 3D\n\n 7 7 0 0 0 0 0 0 0 0999 V2000\n 7.5410 31.9230 -13.8680 N 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6810 32.4350 -14.2300 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.0590 32.6380 -15.5060 N 0 0 0 0 0 0 0 0 0 0 0 0\n 10.2890 33.3210 -15.9030 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.3520 33.2120 -14.8190 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.8200 33.4850 -13.4490 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.5250 32.8340 -13.2520 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 2 1 0\n 4 3 1 0\n 5 4 1 0\n 6 5 1 0\n 7 2 1 0\n 7 6 1 0\nM END\n","x_com":null,"y_com":null,"z_com":null,"mw":101.1,"logp":-1.19,"tpsa":50.08,"ha":7,"hacc":3,"hdon":3,"rots":0,"rings":1,"velec":42,"number":933}]},"duck_yank_data":{},"pandda_event_list":[],"pandda_site_list":[],"mol_group_on":238505,"target_on":67,"target_on_name":"Mac1","isFetching":false,"app_on":"PREVIEW","group_type":"MC","hotspot_list":[],"savingState":"UNSET","seshListSaving":false,"targetUnrecognised":false,"uuid":"UNSET","sessionIdList":[],"direct_access":{},"direct_access_processed":false},"nglReducers":{"objectsInView":{"PROTEIN_67":{"name":"PROTEIN_67","prot_url":"https://fragalysis.apps.xchem.diamond.ac.uk/media/pdbs/Mac1-DLS-X0681_0A_apo_YaUy11d.pdb","OBJECT_TYPE":"PROTEIN","nglProtStyle":"cartoon","display_div":"summary_view","representations":[{"lastKnownID":"3A8C2CE9-5B70-485E-995E-874E7FC3F5E9","uuid":"3A8C2CE9-5B70-485E-995E-874E7FC3F5E9","type":"cartoon","params":{"lazy":false,"visible":true,"quality":"medium","aspectRatio":5,"subdiv":6,"radialSegments":10,"tension":null,"capped":true,"smoothSheet":false,"radiusType":"sstruc","radiusData":{},"radiusSize":1,"radiusScale":0.7,"assembly":"default","defaultAssembly":"","clipNear":0,"clipRadius":0,"clipCenter":{"x":0,"y":0,"z":0},"flatShaded":false,"opacity":1,"depthWrite":true,"side":"double","wireframe":false,"colorScheme":"chainname","colorScale":"RdYlBu","colorReverse":false,"colorValue":9474192,"colorMode":"hcl","roughness":0.4,"metalness":0,"diffuse":16777215,"diffuseInterior":false,"useInteriorColor":true,"interiorColor":2236962,"interiorDarkening":0,"matrix":{"elements":[1,0,0,0,0,1,0,0,0,0,1,0,0,0,0,1]},"disablePicking":false,"sele":""},"templateParams":{"aspectRatio":{"type":"number","precision":1,"max":10,"min":1,"rebuild":true},"subdiv":{"type":"integer","max":50,"min":1,"rebuild":true},"radialSegments":{"type":"integer","max":50,"min":1,"rebuild":true},"tension":{"type":"number","precision":1,"max":1,"min":0.1},"capped":{"type":"boolean","rebuild":true},"smoothSheet":{"type":"boolean","rebuild":true},"radiusType":{"type":"select","options":{"":"","vdw":"by vdW radius","covalent":"by covalent radius","sstruc":"by secondary structure","bfactor":"by bfactor","size":"size","data":"data","explicit":"explicit"}},"radiusData":{"type":"hidden"},"radiusSize":{"type":"number","precision":3,"max":10,"min":0.001},"radiusScale":{"type":"number","precision":3,"max":10,"min":0.001},"assembly":{"type":"select","options":{"default":"default","":"AU","UNITCELL":"UNITCELL","SUPERCELL":"SUPERCELL"},"rebuild":true},"defaultAssembly":{"type":"hidden"},"lazy":{"type":"boolean"},"clipNear":{"type":"range","step":1,"max":100,"min":0,"buffer":true},"clipRadius":{"type":"number","precision":1,"max":1000,"min":0,"buffer":true},"clipCenter":{"type":"vector3","precision":1,"buffer":true},"flatShaded":{"type":"boolean","buffer":true},"opacity":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"depthWrite":{"type":"boolean","buffer":true},"side":{"type":"select","buffer":true,"options":{"front":"front","back":"back","double":"double"}},"wireframe":{"type":"boolean","buffer":true},"colorScheme":{"type":"select","update":"color","options":{"atomindex":"atomindex","bfactor":"bfactor","chainid":"chainid","chainindex":"chainindex","chainname":"chainname","densityfit":"densityfit","electrostatic":"electrostatic","element":"element","entityindex":"entityindex","entitytype":"entitytype","geoquality":"geoquality","hydrophobicity":"hydrophobicity","modelindex":"modelindex","moleculetype":"moleculetype","occupancy":"occupancy","partialcharge":"partialcharge","random":"random","randomcoilindex":"randomcoilindex","residueindex":"residueindex","resname":"resname","sstruc":"sstruc","uniform":"uniform","value":"value","volume":"volume"}},"colorScale":{"type":"select","update":"color","options":{"":"","OrRd":"[S] Orange-Red","PuBu":"[S] Purple-Blue","BuPu":"[S] Blue-Purple","Oranges":"[S] Oranges","BuGn":"[S] Blue-Green","YlOrBr":"[S] Yellow-Orange-Brown","YlGn":"[S] Yellow-Green","Reds":"[S] Reds","RdPu":"[S] Red-Purple","Greens":"[S] Greens","YlGnBu":"[S] Yellow-Green-Blue","Purples":"[S] Purples","GnBu":"[S] Green-Blue","Greys":"[S] Greys","YlOrRd":"[S] Yellow-Orange-Red","PuRd":"[S] Purple-Red","Blues":"[S] Blues","PuBuGn":"[S] Purple-Blue-Green","Viridis":"[D] Viridis","Spectral":"[D] Spectral","RdYlGn":"[D] Red-Yellow-Green","RdBu":"[D] Red-Blue","PiYG":"[D] Pink-Yellowgreen","PRGn":"[D] Purplered-Green","RdYlBu":"[D] Red-Yellow-Blue","BrBG":"[D] Brown-Bluegreen","RdGy":"[D] Red-Grey","PuOr":"[D] Purple-Orange","Set1":"[Q] Set1","Set2":"[Q] Set2","Set3":"[Q] Set3","Dark2":"[Q] Dark2","Paired":"[Q] Paired","Pastel1":"[Q] Pastel1","Pastel2":"[Q] Pastel2","Accent":"[Q] Accent","rainbow":"[?] Rainbow","rwb":"[?] Red-White-Blue"}},"colorReverse":{"type":"boolean","update":"color"},"colorValue":{"type":"color","update":"color"},"colorDomain":{"type":"hidden","update":"color"},"colorMode":{"type":"select","update":"color","options":{"":"","rgb":"Red Green Blue","hsv":"Hue Saturation Value","hsl":"Hue Saturation Lightness","hsi":"Hue Saturation Intensity","lab":"CIE L*a*b*","hcl":"Hue Chroma Lightness"}},"roughness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"metalness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"diffuse":{"type":"color","buffer":true},"diffuseInterior":{"type":"boolean","buffer":true},"useInteriorColor":{"type":"boolean","buffer":true},"interiorColor":{"type":"color","buffer":true},"interiorDarkening":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"matrix":{"type":"hidden","buffer":true},"disablePicking":{"type":"boolean","rebuild":true}}}]},"PROTEIN_67_MAIN":{"name":"PROTEIN_67_MAIN","prot_url":"https://fragalysis.apps.xchem.diamond.ac.uk/media/pdbs/Mac1-DLS-X0681_0A_apo_YaUy11d.pdb","OBJECT_TYPE":"PROTEIN","nglProtStyle":"cartoon","display_div":"major_view","representations":[{"lastKnownID":"74B42708-0A81-4F33-918D-80C35FB87EAC","uuid":"74B42708-0A81-4F33-918D-80C35FB87EAC","type":"cartoon","params":{"lazy":false,"visible":true,"quality":"medium","aspectRatio":5,"subdiv":6,"radialSegments":10,"tension":null,"capped":true,"smoothSheet":false,"radiusType":"sstruc","radiusData":{},"radiusSize":1,"radiusScale":0.7,"assembly":"default","defaultAssembly":"","clipNear":0,"clipRadius":0,"clipCenter":{"x":0,"y":0,"z":0},"flatShaded":false,"opacity":1,"depthWrite":true,"side":"double","wireframe":false,"colorScheme":"chainname","colorScale":"RdYlBu","colorReverse":false,"colorValue":9474192,"colorMode":"hcl","roughness":0.4,"metalness":0,"diffuse":16777215,"diffuseInterior":false,"useInteriorColor":true,"interiorColor":2236962,"interiorDarkening":0,"matrix":{"elements":[1,0,0,0,0,1,0,0,0,0,1,0,0,0,0,1]},"disablePicking":false,"sele":""},"templateParams":{"aspectRatio":{"type":"number","precision":1,"max":10,"min":1,"rebuild":true},"subdiv":{"type":"integer","max":50,"min":1,"rebuild":true},"radialSegments":{"type":"integer","max":50,"min":1,"rebuild":true},"tension":{"type":"number","precision":1,"max":1,"min":0.1},"capped":{"type":"boolean","rebuild":true},"smoothSheet":{"type":"boolean","rebuild":true},"radiusType":{"type":"select","options":{"":"","vdw":"by vdW radius","covalent":"by covalent radius","sstruc":"by secondary structure","bfactor":"by bfactor","size":"size","data":"data","explicit":"explicit"}},"radiusData":{"type":"hidden"},"radiusSize":{"type":"number","precision":3,"max":10,"min":0.001},"radiusScale":{"type":"number","precision":3,"max":10,"min":0.001},"assembly":{"type":"select","options":{"default":"default","":"AU","UNITCELL":"UNITCELL","SUPERCELL":"SUPERCELL"},"rebuild":true},"defaultAssembly":{"type":"hidden"},"lazy":{"type":"boolean"},"clipNear":{"type":"range","step":1,"max":100,"min":0,"buffer":true},"clipRadius":{"type":"number","precision":1,"max":1000,"min":0,"buffer":true},"clipCenter":{"type":"vector3","precision":1,"buffer":true},"flatShaded":{"type":"boolean","buffer":true},"opacity":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"depthWrite":{"type":"boolean","buffer":true},"side":{"type":"select","buffer":true,"options":{"front":"front","back":"back","double":"double"}},"wireframe":{"type":"boolean","buffer":true},"colorScheme":{"type":"select","update":"color","options":{"atomindex":"atomindex","bfactor":"bfactor","chainid":"chainid","chainindex":"chainindex","chainname":"chainname","densityfit":"densityfit","electrostatic":"electrostatic","element":"element","entityindex":"entityindex","entitytype":"entitytype","geoquality":"geoquality","hydrophobicity":"hydrophobicity","modelindex":"modelindex","moleculetype":"moleculetype","occupancy":"occupancy","partialcharge":"partialcharge","random":"random","randomcoilindex":"randomcoilindex","residueindex":"residueindex","resname":"resname","sstruc":"sstruc","uniform":"uniform","value":"value","volume":"volume"}},"colorScale":{"type":"select","update":"color","options":{"":"","OrRd":"[S] Orange-Red","PuBu":"[S] Purple-Blue","BuPu":"[S] Blue-Purple","Oranges":"[S] Oranges","BuGn":"[S] Blue-Green","YlOrBr":"[S] Yellow-Orange-Brown","YlGn":"[S] Yellow-Green","Reds":"[S] Reds","RdPu":"[S] Red-Purple","Greens":"[S] Greens","YlGnBu":"[S] Yellow-Green-Blue","Purples":"[S] Purples","GnBu":"[S] Green-Blue","Greys":"[S] Greys","YlOrRd":"[S] Yellow-Orange-Red","PuRd":"[S] Purple-Red","Blues":"[S] Blues","PuBuGn":"[S] Purple-Blue-Green","Viridis":"[D] Viridis","Spectral":"[D] Spectral","RdYlGn":"[D] Red-Yellow-Green","RdBu":"[D] Red-Blue","PiYG":"[D] Pink-Yellowgreen","PRGn":"[D] Purplered-Green","RdYlBu":"[D] Red-Yellow-Blue","BrBG":"[D] Brown-Bluegreen","RdGy":"[D] Red-Grey","PuOr":"[D] Purple-Orange","Set1":"[Q] Set1","Set2":"[Q] Set2","Set3":"[Q] Set3","Dark2":"[Q] Dark2","Paired":"[Q] Paired","Pastel1":"[Q] Pastel1","Pastel2":"[Q] Pastel2","Accent":"[Q] Accent","rainbow":"[?] Rainbow","rwb":"[?] Red-White-Blue"}},"colorReverse":{"type":"boolean","update":"color"},"colorValue":{"type":"color","update":"color"},"colorDomain":{"type":"hidden","update":"color"},"colorMode":{"type":"select","update":"color","options":{"":"","rgb":"Red Green Blue","hsv":"Hue Saturation Value","hsl":"Hue Saturation Lightness","hsi":"Hue Saturation Intensity","lab":"CIE L*a*b*","hcl":"Hue Chroma Lightness"}},"roughness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"metalness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"diffuse":{"type":"color","buffer":true},"diffuseInterior":{"type":"boolean","buffer":true},"useInteriorColor":{"type":"boolean","buffer":true},"interiorColor":{"type":"color","buffer":true},"interiorDarkening":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"matrix":{"type":"hidden","buffer":true},"disablePicking":{"type":"boolean","rebuild":true}}}]},"MOLECULE-GROUP_238506":{"display_div":"summary_view","OBJECT_TYPE":"SPHERE","name":"MOLECULE-GROUP_238506","radius":6,"colour":[0,0,1],"coords":[27.726189840367525,48.088785194747636,-6.333846525371354],"representations":[{"lastKnownID":"2D6C61FF-8EBC-43A1-B0BD-C27A8BE79036","uuid":"2D6C61FF-8EBC-43A1-B0BD-C27A8BE79036","type":"buffer","params":{"lazy":false,"visible":true,"quality":"medium","clipNear":0,"clipRadius":0,"clipCenter":{"x":0,"y":0,"z":0},"flatShaded":false,"opacity":1,"depthWrite":true,"side":"double","wireframe":false,"colorReverse":false,"roughness":0.4,"metalness":0,"diffuse":16777215,"diffuseInterior":false,"useInteriorColor":false,"interiorColor":2236962,"interiorDarkening":0,"matrix":{"elements":[1,0,0,0,0,1,0,0,0,0,1,0,0,0,0,1]},"disablePicking":false},"templateParams":{"lazy":{"type":"boolean"},"clipNear":{"type":"range","step":1,"max":100,"min":0,"buffer":true},"clipRadius":{"type":"number","precision":1,"max":1000,"min":0,"buffer":true},"clipCenter":{"type":"vector3","precision":1,"buffer":true},"flatShaded":{"type":"boolean","buffer":true},"opacity":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"depthWrite":{"type":"boolean","buffer":true},"side":{"type":"select","buffer":true,"options":{"front":"front","back":"back","double":"double"}},"wireframe":{"type":"boolean","buffer":true},"colorScheme":null,"colorScale":null,"colorReverse":{"type":"boolean","update":"color"},"colorValue":null,"colorDomain":null,"colorMode":null,"roughness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"metalness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"diffuse":{"type":"color","buffer":true},"diffuseInterior":{"type":"boolean","buffer":true},"useInteriorColor":{"type":"boolean","buffer":true},"interiorColor":{"type":"color","buffer":true},"interiorDarkening":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"matrix":{"type":"hidden","buffer":true},"disablePicking":{"type":"boolean","rebuild":true}}}]},"MOLECULE-GROUP_238507":{"display_div":"summary_view","OBJECT_TYPE":"SPHERE","name":"MOLECULE-GROUP_238507","radius":6,"colour":[0,0,1],"coords":[31.65100795413972,43.278296929879644,-5.619644133695017],"representations":[{"lastKnownID":"F18B82AE-EEFD-4CC2-AEF3-261F0CD311A7","uuid":"F18B82AE-EEFD-4CC2-AEF3-261F0CD311A7","type":"buffer","params":{"lazy":false,"visible":true,"quality":"medium","clipNear":0,"clipRadius":0,"clipCenter":{"x":0,"y":0,"z":0},"flatShaded":false,"opacity":1,"depthWrite":true,"side":"double","wireframe":false,"colorReverse":false,"roughness":0.4,"metalness":0,"diffuse":16777215,"diffuseInterior":false,"useInteriorColor":false,"interiorColor":2236962,"interiorDarkening":0,"matrix":{"elements":[1,0,0,0,0,1,0,0,0,0,1,0,0,0,0,1]},"disablePicking":false},"templateParams":{"lazy":{"type":"boolean"},"clipNear":{"type":"range","step":1,"max":100,"min":0,"buffer":true},"clipRadius":{"type":"number","precision":1,"max":1000,"min":0,"buffer":true},"clipCenter":{"type":"vector3","precision":1,"buffer":true},"flatShaded":{"type":"boolean","buffer":true},"opacity":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"depthWrite":{"type":"boolean","buffer":true},"side":{"type":"select","buffer":true,"options":{"front":"front","back":"back","double":"double"}},"wireframe":{"type":"boolean","buffer":true},"colorScheme":null,"colorScale":null,"colorReverse":{"type":"boolean","update":"color"},"colorValue":null,"colorDomain":null,"colorMode":null,"roughness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"metalness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"diffuse":{"type":"color","buffer":true},"diffuseInterior":{"type":"boolean","buffer":true},"useInteriorColor":{"type":"boolean","buffer":true},"interiorColor":{"type":"color","buffer":true},"interiorDarkening":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"matrix":{"type":"hidden","buffer":true},"disablePicking":{"type":"boolean","rebuild":true}}}]},"MOLECULE-GROUP_238508":{"display_div":"summary_view","OBJECT_TYPE":"SPHERE","name":"MOLECULE-GROUP_238508","radius":6,"colour":[0,0,1],"coords":[30.4582845424678,44.33355534090772,-5.312019470354383],"representations":[{"lastKnownID":"B4379D13-9EBE-49AD-9637-2670341942C8","uuid":"B4379D13-9EBE-49AD-9637-2670341942C8","type":"buffer","params":{"lazy":false,"visible":true,"quality":"medium","clipNear":0,"clipRadius":0,"clipCenter":{"x":0,"y":0,"z":0},"flatShaded":false,"opacity":1,"depthWrite":true,"side":"double","wireframe":false,"colorReverse":false,"roughness":0.4,"metalness":0,"diffuse":16777215,"diffuseInterior":false,"useInteriorColor":false,"interiorColor":2236962,"interiorDarkening":0,"matrix":{"elements":[1,0,0,0,0,1,0,0,0,0,1,0,0,0,0,1]},"disablePicking":false},"templateParams":{"lazy":{"type":"boolean"},"clipNear":{"type":"range","step":1,"max":100,"min":0,"buffer":true},"clipRadius":{"type":"number","precision":1,"max":1000,"min":0,"buffer":true},"clipCenter":{"type":"vector3","precision":1,"buffer":true},"flatShaded":{"type":"boolean","buffer":true},"opacity":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"depthWrite":{"type":"boolean","buffer":true},"side":{"type":"select","buffer":true,"options":{"front":"front","back":"back","double":"double"}},"wireframe":{"type":"boolean","buffer":true},"colorScheme":null,"colorScale":null,"colorReverse":{"type":"boolean","update":"color"},"colorValue":null,"colorDomain":null,"colorMode":null,"roughness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"metalness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"diffuse":{"type":"color","buffer":true},"diffuseInterior":{"type":"boolean","buffer":true},"useInteriorColor":{"type":"boolean","buffer":true},"interiorColor":{"type":"color","buffer":true},"interiorDarkening":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"matrix":{"type":"hidden","buffer":true},"disablePicking":{"type":"boolean","rebuild":true}}}]},"MOLECULE-GROUP_238509":{"display_div":"summary_view","OBJECT_TYPE":"SPHERE","name":"MOLECULE-GROUP_238509","radius":4,"colour":[0,0,1],"coords":[20.998018064109196,44.09051650025461,9.46426046740865],"representations":[{"lastKnownID":"16CE161E-932F-4D05-AC95-4F2B70F92815","uuid":"16CE161E-932F-4D05-AC95-4F2B70F92815","type":"buffer","params":{"lazy":false,"visible":true,"quality":"medium","clipNear":0,"clipRadius":0,"clipCenter":{"x":0,"y":0,"z":0},"flatShaded":false,"opacity":1,"depthWrite":true,"side":"double","wireframe":false,"colorReverse":false,"roughness":0.4,"metalness":0,"diffuse":16777215,"diffuseInterior":false,"useInteriorColor":false,"interiorColor":2236962,"interiorDarkening":0,"matrix":{"elements":[1,0,0,0,0,1,0,0,0,0,1,0,0,0,0,1]},"disablePicking":false},"templateParams":{"lazy":{"type":"boolean"},"clipNear":{"type":"range","step":1,"max":100,"min":0,"buffer":true},"clipRadius":{"type":"number","precision":1,"max":1000,"min":0,"buffer":true},"clipCenter":{"type":"vector3","precision":1,"buffer":true},"flatShaded":{"type":"boolean","buffer":true},"opacity":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"depthWrite":{"type":"boolean","buffer":true},"side":{"type":"select","buffer":true,"options":{"front":"front","back":"back","double":"double"}},"wireframe":{"type":"boolean","buffer":true},"colorScheme":null,"colorScale":null,"colorReverse":{"type":"boolean","update":"color"},"colorValue":null,"colorDomain":null,"colorMode":null,"roughness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"metalness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"diffuse":{"type":"color","buffer":true},"diffuseInterior":{"type":"boolean","buffer":true},"useInteriorColor":{"type":"boolean","buffer":true},"interiorColor":{"type":"color","buffer":true},"interiorDarkening":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"matrix":{"type":"hidden","buffer":true},"disablePicking":{"type":"boolean","rebuild":true}}}]},"MOLECULE-GROUP_238510":{"display_div":"summary_view","OBJECT_TYPE":"SPHERE","name":"MOLECULE-GROUP_238510","radius":2,"colour":[0,0,1],"coords":[21.284898853882172,45.698160485758876,9.998337938938745],"representations":[{"lastKnownID":"B8094071-3ECB-4421-B473-534EE00374E7","uuid":"B8094071-3ECB-4421-B473-534EE00374E7","type":"buffer","params":{"lazy":false,"visible":true,"quality":"medium","clipNear":0,"clipRadius":0,"clipCenter":{"x":0,"y":0,"z":0},"flatShaded":false,"opacity":1,"depthWrite":true,"side":"double","wireframe":false,"colorReverse":false,"roughness":0.4,"metalness":0,"diffuse":16777215,"diffuseInterior":false,"useInteriorColor":false,"interiorColor":2236962,"interiorDarkening":0,"matrix":{"elements":[1,0,0,0,0,1,0,0,0,0,1,0,0,0,0,1]},"disablePicking":false},"templateParams":{"lazy":{"type":"boolean"},"clipNear":{"type":"range","step":1,"max":100,"min":0,"buffer":true},"clipRadius":{"type":"number","precision":1,"max":1000,"min":0,"buffer":true},"clipCenter":{"type":"vector3","precision":1,"buffer":true},"flatShaded":{"type":"boolean","buffer":true},"opacity":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"depthWrite":{"type":"boolean","buffer":true},"side":{"type":"select","buffer":true,"options":{"front":"front","back":"back","double":"double"}},"wireframe":{"type":"boolean","buffer":true},"colorScheme":null,"colorScale":null,"colorReverse":{"type":"boolean","update":"color"},"colorValue":null,"colorDomain":null,"colorMode":null,"roughness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"metalness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"diffuse":{"type":"color","buffer":true},"diffuseInterior":{"type":"boolean","buffer":true},"useInteriorColor":{"type":"boolean","buffer":true},"interiorColor":{"type":"color","buffer":true},"interiorDarkening":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"matrix":{"type":"hidden","buffer":true},"disablePicking":{"type":"boolean","rebuild":true}}}]},"MOLECULE-GROUP_238511":{"display_div":"summary_view","OBJECT_TYPE":"SPHERE","name":"MOLECULE-GROUP_238511","radius":6,"colour":[0,0,1],"coords":[35.1959499106428,40.31313119348975,-2.94943982944573],"representations":[{"lastKnownID":"3F8A4F50-0EF1-43D4-B2A4-5D08BE7FFF35","uuid":"3F8A4F50-0EF1-43D4-B2A4-5D08BE7FFF35","type":"buffer","params":{"lazy":false,"visible":true,"quality":"medium","clipNear":0,"clipRadius":0,"clipCenter":{"x":0,"y":0,"z":0},"flatShaded":false,"opacity":1,"depthWrite":true,"side":"double","wireframe":false,"colorReverse":false,"roughness":0.4,"metalness":0,"diffuse":16777215,"diffuseInterior":false,"useInteriorColor":false,"interiorColor":2236962,"interiorDarkening":0,"matrix":{"elements":[1,0,0,0,0,1,0,0,0,0,1,0,0,0,0,1]},"disablePicking":false},"templateParams":{"lazy":{"type":"boolean"},"clipNear":{"type":"range","step":1,"max":100,"min":0,"buffer":true},"clipRadius":{"type":"number","precision":1,"max":1000,"min":0,"buffer":true},"clipCenter":{"type":"vector3","precision":1,"buffer":true},"flatShaded":{"type":"boolean","buffer":true},"opacity":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"depthWrite":{"type":"boolean","buffer":true},"side":{"type":"select","buffer":true,"options":{"front":"front","back":"back","double":"double"}},"wireframe":{"type":"boolean","buffer":true},"colorScheme":null,"colorScale":null,"colorReverse":{"type":"boolean","update":"color"},"colorValue":null,"colorDomain":null,"colorMode":null,"roughness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"metalness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"diffuse":{"type":"color","buffer":true},"diffuseInterior":{"type":"boolean","buffer":true},"useInteriorColor":{"type":"boolean","buffer":true},"interiorColor":{"type":"color","buffer":true},"interiorDarkening":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"matrix":{"type":"hidden","buffer":true},"disablePicking":{"type":"boolean","rebuild":true}}}]},"MOLECULE-GROUP_238512":{"display_div":"summary_view","OBJECT_TYPE":"SPHERE","name":"MOLECULE-GROUP_238512","radius":2,"colour":[0,0,1],"coords":[36.3677463490233,41.33177382856768,-3.5796752218781913],"representations":[{"lastKnownID":"4698C7ED-CA4B-49B1-A362-8D508B58FC34","uuid":"4698C7ED-CA4B-49B1-A362-8D508B58FC34","type":"buffer","params":{"lazy":false,"visible":true,"quality":"medium","clipNear":0,"clipRadius":0,"clipCenter":{"x":0,"y":0,"z":0},"flatShaded":false,"opacity":1,"depthWrite":true,"side":"double","wireframe":false,"colorReverse":false,"roughness":0.4,"metalness":0,"diffuse":16777215,"diffuseInterior":false,"useInteriorColor":false,"interiorColor":2236962,"interiorDarkening":0,"matrix":{"elements":[1,0,0,0,0,1,0,0,0,0,1,0,0,0,0,1]},"disablePicking":false},"templateParams":{"lazy":{"type":"boolean"},"clipNear":{"type":"range","step":1,"max":100,"min":0,"buffer":true},"clipRadius":{"type":"number","precision":1,"max":1000,"min":0,"buffer":true},"clipCenter":{"type":"vector3","precision":1,"buffer":true},"flatShaded":{"type":"boolean","buffer":true},"opacity":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"depthWrite":{"type":"boolean","buffer":true},"side":{"type":"select","buffer":true,"options":{"front":"front","back":"back","double":"double"}},"wireframe":{"type":"boolean","buffer":true},"colorScheme":null,"colorScale":null,"colorReverse":{"type":"boolean","update":"color"},"colorValue":null,"colorDomain":null,"colorMode":null,"roughness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"metalness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"diffuse":{"type":"color","buffer":true},"diffuseInterior":{"type":"boolean","buffer":true},"useInteriorColor":{"type":"boolean","buffer":true},"interiorColor":{"type":"color","buffer":true},"interiorDarkening":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"matrix":{"type":"hidden","buffer":true},"disablePicking":{"type":"boolean","rebuild":true}}}]},"MOLECULE-GROUP_238513":{"display_div":"summary_view","OBJECT_TYPE":"SPHERE","name":"MOLECULE-GROUP_238513","radius":2,"colour":[0,0,1],"coords":[27.838442456374175,49.94959833576108,2.3046774018529543],"representations":[{"lastKnownID":"E13FEA31-8A7A-454C-8F1F-2313D3B84BCF","uuid":"E13FEA31-8A7A-454C-8F1F-2313D3B84BCF","type":"buffer","params":{"lazy":false,"visible":true,"quality":"medium","clipNear":0,"clipRadius":0,"clipCenter":{"x":0,"y":0,"z":0},"flatShaded":false,"opacity":1,"depthWrite":true,"side":"double","wireframe":false,"colorReverse":false,"roughness":0.4,"metalness":0,"diffuse":16777215,"diffuseInterior":false,"useInteriorColor":false,"interiorColor":2236962,"interiorDarkening":0,"matrix":{"elements":[1,0,0,0,0,1,0,0,0,0,1,0,0,0,0,1]},"disablePicking":false},"templateParams":{"lazy":{"type":"boolean"},"clipNear":{"type":"range","step":1,"max":100,"min":0,"buffer":true},"clipRadius":{"type":"number","precision":1,"max":1000,"min":0,"buffer":true},"clipCenter":{"type":"vector3","precision":1,"buffer":true},"flatShaded":{"type":"boolean","buffer":true},"opacity":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"depthWrite":{"type":"boolean","buffer":true},"side":{"type":"select","buffer":true,"options":{"front":"front","back":"back","double":"double"}},"wireframe":{"type":"boolean","buffer":true},"colorScheme":null,"colorScale":null,"colorReverse":{"type":"boolean","update":"color"},"colorValue":null,"colorDomain":null,"colorMode":null,"roughness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"metalness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"diffuse":{"type":"color","buffer":true},"diffuseInterior":{"type":"boolean","buffer":true},"useInteriorColor":{"type":"boolean","buffer":true},"interiorColor":{"type":"color","buffer":true},"interiorDarkening":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"matrix":{"type":"hidden","buffer":true},"disablePicking":{"type":"boolean","rebuild":true}}}]},"MOLECULE-GROUP_238514":{"display_div":"summary_view","OBJECT_TYPE":"SPHERE","name":"MOLECULE-GROUP_238514","radius":4,"colour":[0,0,1],"coords":[6.59239776235854,36.529496855505464,-3.246374871271202],"representations":[{"lastKnownID":"84C4F147-1D90-47C9-86B2-C00545F17B73","uuid":"84C4F147-1D90-47C9-86B2-C00545F17B73","type":"buffer","params":{"lazy":false,"visible":true,"quality":"medium","clipNear":0,"clipRadius":0,"clipCenter":{"x":0,"y":0,"z":0},"flatShaded":false,"opacity":1,"depthWrite":true,"side":"double","wireframe":false,"colorReverse":false,"roughness":0.4,"metalness":0,"diffuse":16777215,"diffuseInterior":false,"useInteriorColor":false,"interiorColor":2236962,"interiorDarkening":0,"matrix":{"elements":[1,0,0,0,0,1,0,0,0,0,1,0,0,0,0,1]},"disablePicking":false},"templateParams":{"lazy":{"type":"boolean"},"clipNear":{"type":"range","step":1,"max":100,"min":0,"buffer":true},"clipRadius":{"type":"number","precision":1,"max":1000,"min":0,"buffer":true},"clipCenter":{"type":"vector3","precision":1,"buffer":true},"flatShaded":{"type":"boolean","buffer":true},"opacity":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"depthWrite":{"type":"boolean","buffer":true},"side":{"type":"select","buffer":true,"options":{"front":"front","back":"back","double":"double"}},"wireframe":{"type":"boolean","buffer":true},"colorScheme":null,"colorScale":null,"colorReverse":{"type":"boolean","update":"color"},"colorValue":null,"colorDomain":null,"colorMode":null,"roughness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"metalness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"diffuse":{"type":"color","buffer":true},"diffuseInterior":{"type":"boolean","buffer":true},"useInteriorColor":{"type":"boolean","buffer":true},"interiorColor":{"type":"color","buffer":true},"interiorDarkening":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"matrix":{"type":"hidden","buffer":true},"disablePicking":{"type":"boolean","rebuild":true}}}]},"MOLECULE-GROUP_238515":{"display_div":"summary_view","OBJECT_TYPE":"SPHERE","name":"MOLECULE-GROUP_238515","radius":4,"colour":[0,0,1],"coords":[11.41205112673282,44.112625007100824,-17.965020610280543],"representations":[{"lastKnownID":"2CE77ECE-E09B-46A1-8778-7210FA9DB9E0","uuid":"2CE77ECE-E09B-46A1-8778-7210FA9DB9E0","type":"buffer","params":{"lazy":false,"visible":true,"quality":"medium","clipNear":0,"clipRadius":0,"clipCenter":{"x":0,"y":0,"z":0},"flatShaded":false,"opacity":1,"depthWrite":true,"side":"double","wireframe":false,"colorReverse":false,"roughness":0.4,"metalness":0,"diffuse":16777215,"diffuseInterior":false,"useInteriorColor":false,"interiorColor":2236962,"interiorDarkening":0,"matrix":{"elements":[1,0,0,0,0,1,0,0,0,0,1,0,0,0,0,1]},"disablePicking":false},"templateParams":{"lazy":{"type":"boolean"},"clipNear":{"type":"range","step":1,"max":100,"min":0,"buffer":true},"clipRadius":{"type":"number","precision":1,"max":1000,"min":0,"buffer":true},"clipCenter":{"type":"vector3","precision":1,"buffer":true},"flatShaded":{"type":"boolean","buffer":true},"opacity":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"depthWrite":{"type":"boolean","buffer":true},"side":{"type":"select","buffer":true,"options":{"front":"front","back":"back","double":"double"}},"wireframe":{"type":"boolean","buffer":true},"colorScheme":null,"colorScale":null,"colorReverse":{"type":"boolean","update":"color"},"colorValue":null,"colorDomain":null,"colorMode":null,"roughness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"metalness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"diffuse":{"type":"color","buffer":true},"diffuseInterior":{"type":"boolean","buffer":true},"useInteriorColor":{"type":"boolean","buffer":true},"interiorColor":{"type":"color","buffer":true},"interiorDarkening":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"matrix":{"type":"hidden","buffer":true},"disablePicking":{"type":"boolean","rebuild":true}}}]},"MOLECULE-GROUP_238516":{"display_div":"summary_view","OBJECT_TYPE":"SPHERE","name":"MOLECULE-GROUP_238516","radius":4,"colour":[0,0,1],"coords":[9.780446439600953,46.73529399938116,-16.922835940982644],"representations":[{"lastKnownID":"19BD6257-EDDE-4E7E-AA05-886659B9A19C","uuid":"19BD6257-EDDE-4E7E-AA05-886659B9A19C","type":"buffer","params":{"lazy":false,"visible":true,"quality":"medium","clipNear":0,"clipRadius":0,"clipCenter":{"x":0,"y":0,"z":0},"flatShaded":false,"opacity":1,"depthWrite":true,"side":"double","wireframe":false,"colorReverse":false,"roughness":0.4,"metalness":0,"diffuse":16777215,"diffuseInterior":false,"useInteriorColor":false,"interiorColor":2236962,"interiorDarkening":0,"matrix":{"elements":[1,0,0,0,0,1,0,0,0,0,1,0,0,0,0,1]},"disablePicking":false},"templateParams":{"lazy":{"type":"boolean"},"clipNear":{"type":"range","step":1,"max":100,"min":0,"buffer":true},"clipRadius":{"type":"number","precision":1,"max":1000,"min":0,"buffer":true},"clipCenter":{"type":"vector3","precision":1,"buffer":true},"flatShaded":{"type":"boolean","buffer":true},"opacity":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"depthWrite":{"type":"boolean","buffer":true},"side":{"type":"select","buffer":true,"options":{"front":"front","back":"back","double":"double"}},"wireframe":{"type":"boolean","buffer":true},"colorScheme":null,"colorScale":null,"colorReverse":{"type":"boolean","update":"color"},"colorValue":null,"colorDomain":null,"colorMode":null,"roughness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"metalness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"diffuse":{"type":"color","buffer":true},"diffuseInterior":{"type":"boolean","buffer":true},"useInteriorColor":{"type":"boolean","buffer":true},"interiorColor":{"type":"color","buffer":true},"interiorDarkening":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"matrix":{"type":"hidden","buffer":true},"disablePicking":{"type":"boolean","rebuild":true}}}]},"MOLECULE-GROUP_238517":{"display_div":"summary_view","OBJECT_TYPE":"SPHERE","name":"MOLECULE-GROUP_238517","radius":2,"colour":[0,0,1],"coords":[18.064064408695742,41.290467751815086,-5.883202868377023],"representations":[{"lastKnownID":"2B9FDF98-21E4-4B56-92CE-BE635CA0F11E","uuid":"2B9FDF98-21E4-4B56-92CE-BE635CA0F11E","type":"buffer","params":{"lazy":false,"visible":true,"quality":"medium","clipNear":0,"clipRadius":0,"clipCenter":{"x":0,"y":0,"z":0},"flatShaded":false,"opacity":1,"depthWrite":true,"side":"double","wireframe":false,"colorReverse":false,"roughness":0.4,"metalness":0,"diffuse":16777215,"diffuseInterior":false,"useInteriorColor":false,"interiorColor":2236962,"interiorDarkening":0,"matrix":{"elements":[1,0,0,0,0,1,0,0,0,0,1,0,0,0,0,1]},"disablePicking":false},"templateParams":{"lazy":{"type":"boolean"},"clipNear":{"type":"range","step":1,"max":100,"min":0,"buffer":true},"clipRadius":{"type":"number","precision":1,"max":1000,"min":0,"buffer":true},"clipCenter":{"type":"vector3","precision":1,"buffer":true},"flatShaded":{"type":"boolean","buffer":true},"opacity":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"depthWrite":{"type":"boolean","buffer":true},"side":{"type":"select","buffer":true,"options":{"front":"front","back":"back","double":"double"}},"wireframe":{"type":"boolean","buffer":true},"colorScheme":null,"colorScale":null,"colorReverse":{"type":"boolean","update":"color"},"colorValue":null,"colorDomain":null,"colorMode":null,"roughness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"metalness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"diffuse":{"type":"color","buffer":true},"diffuseInterior":{"type":"boolean","buffer":true},"useInteriorColor":{"type":"boolean","buffer":true},"interiorColor":{"type":"color","buffer":true},"interiorDarkening":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"matrix":{"type":"hidden","buffer":true},"disablePicking":{"type":"boolean","rebuild":true}}}]},"MOLECULE-GROUP_238518":{"display_div":"summary_view","OBJECT_TYPE":"SPHERE","name":"MOLECULE-GROUP_238518","radius":6,"colour":[0,0,1],"coords":[14.38901707971803,40.50514141903764,-12.77409756223947],"representations":[{"lastKnownID":"23C7AF3B-3E22-4D55-BBD2-D72992406906","uuid":"23C7AF3B-3E22-4D55-BBD2-D72992406906","type":"buffer","params":{"lazy":false,"visible":true,"quality":"medium","clipNear":0,"clipRadius":0,"clipCenter":{"x":0,"y":0,"z":0},"flatShaded":false,"opacity":1,"depthWrite":true,"side":"double","wireframe":false,"colorReverse":false,"roughness":0.4,"metalness":0,"diffuse":16777215,"diffuseInterior":false,"useInteriorColor":false,"interiorColor":2236962,"interiorDarkening":0,"matrix":{"elements":[1,0,0,0,0,1,0,0,0,0,1,0,0,0,0,1]},"disablePicking":false},"templateParams":{"lazy":{"type":"boolean"},"clipNear":{"type":"range","step":1,"max":100,"min":0,"buffer":true},"clipRadius":{"type":"number","precision":1,"max":1000,"min":0,"buffer":true},"clipCenter":{"type":"vector3","precision":1,"buffer":true},"flatShaded":{"type":"boolean","buffer":true},"opacity":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"depthWrite":{"type":"boolean","buffer":true},"side":{"type":"select","buffer":true,"options":{"front":"front","back":"back","double":"double"}},"wireframe":{"type":"boolean","buffer":true},"colorScheme":null,"colorScale":null,"colorReverse":{"type":"boolean","update":"color"},"colorValue":null,"colorDomain":null,"colorMode":null,"roughness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"metalness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"diffuse":{"type":"color","buffer":true},"diffuseInterior":{"type":"boolean","buffer":true},"useInteriorColor":{"type":"boolean","buffer":true},"interiorColor":{"type":"color","buffer":true},"interiorDarkening":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"matrix":{"type":"hidden","buffer":true},"disablePicking":{"type":"boolean","rebuild":true}}}]},"MOLECULE-GROUP_238519":{"display_div":"summary_view","OBJECT_TYPE":"SPHERE","name":"MOLECULE-GROUP_238519","radius":2,"colour":[0,0,1],"coords":[23.065233312370676,38.83915549847696,-10.827840363258138],"representations":[{"lastKnownID":"B85155AD-085E-472B-B19F-8D515B08FE21","uuid":"B85155AD-085E-472B-B19F-8D515B08FE21","type":"buffer","params":{"lazy":false,"visible":true,"quality":"medium","clipNear":0,"clipRadius":0,"clipCenter":{"x":0,"y":0,"z":0},"flatShaded":false,"opacity":1,"depthWrite":true,"side":"double","wireframe":false,"colorReverse":false,"roughness":0.4,"metalness":0,"diffuse":16777215,"diffuseInterior":false,"useInteriorColor":false,"interiorColor":2236962,"interiorDarkening":0,"matrix":{"elements":[1,0,0,0,0,1,0,0,0,0,1,0,0,0,0,1]},"disablePicking":false},"templateParams":{"lazy":{"type":"boolean"},"clipNear":{"type":"range","step":1,"max":100,"min":0,"buffer":true},"clipRadius":{"type":"number","precision":1,"max":1000,"min":0,"buffer":true},"clipCenter":{"type":"vector3","precision":1,"buffer":true},"flatShaded":{"type":"boolean","buffer":true},"opacity":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"depthWrite":{"type":"boolean","buffer":true},"side":{"type":"select","buffer":true,"options":{"front":"front","back":"back","double":"double"}},"wireframe":{"type":"boolean","buffer":true},"colorScheme":null,"colorScale":null,"colorReverse":{"type":"boolean","update":"color"},"colorValue":null,"colorDomain":null,"colorMode":null,"roughness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"metalness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"diffuse":{"type":"color","buffer":true},"diffuseInterior":{"type":"boolean","buffer":true},"useInteriorColor":{"type":"boolean","buffer":true},"interiorColor":{"type":"color","buffer":true},"interiorDarkening":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"matrix":{"type":"hidden","buffer":true},"disablePicking":{"type":"boolean","rebuild":true}}}]},"MOLECULE-GROUP_238520":{"display_div":"summary_view","OBJECT_TYPE":"SPHERE","name":"MOLECULE-GROUP_238520","radius":6,"colour":[0,0,1],"coords":[14.703284696109689,36.083419530772645,-5.466467746407585],"representations":[{"lastKnownID":"E6F383FF-77B7-4477-BA0A-0EBDE301803B","uuid":"E6F383FF-77B7-4477-BA0A-0EBDE301803B","type":"buffer","params":{"lazy":false,"visible":true,"quality":"medium","clipNear":0,"clipRadius":0,"clipCenter":{"x":0,"y":0,"z":0},"flatShaded":false,"opacity":1,"depthWrite":true,"side":"double","wireframe":false,"colorReverse":false,"roughness":0.4,"metalness":0,"diffuse":16777215,"diffuseInterior":false,"useInteriorColor":false,"interiorColor":2236962,"interiorDarkening":0,"matrix":{"elements":[1,0,0,0,0,1,0,0,0,0,1,0,0,0,0,1]},"disablePicking":false},"templateParams":{"lazy":{"type":"boolean"},"clipNear":{"type":"range","step":1,"max":100,"min":0,"buffer":true},"clipRadius":{"type":"number","precision":1,"max":1000,"min":0,"buffer":true},"clipCenter":{"type":"vector3","precision":1,"buffer":true},"flatShaded":{"type":"boolean","buffer":true},"opacity":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"depthWrite":{"type":"boolean","buffer":true},"side":{"type":"select","buffer":true,"options":{"front":"front","back":"back","double":"double"}},"wireframe":{"type":"boolean","buffer":true},"colorScheme":null,"colorScale":null,"colorReverse":{"type":"boolean","update":"color"},"colorValue":null,"colorDomain":null,"colorMode":null,"roughness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"metalness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"diffuse":{"type":"color","buffer":true},"diffuseInterior":{"type":"boolean","buffer":true},"useInteriorColor":{"type":"boolean","buffer":true},"interiorColor":{"type":"color","buffer":true},"interiorDarkening":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"matrix":{"type":"hidden","buffer":true},"disablePicking":{"type":"boolean","rebuild":true}}}]},"MOLECULE-GROUP_238505":{"display_div":"summary_view","OBJECT_TYPE":"SPHERE","name":"MOLECULE-GROUP_238505","radius":6,"colour":[0,1,0],"coords":[27.238283583303307,49.21699084151727,-7.016167950826643],"representations":[{"lastKnownID":"28F80102-5074-41A0-92E8-FB0AFE5F9D47","uuid":"28F80102-5074-41A0-92E8-FB0AFE5F9D47","type":"buffer","params":{"lazy":false,"visible":true,"quality":"medium","clipNear":0,"clipRadius":0,"clipCenter":{"x":0,"y":0,"z":0},"flatShaded":false,"opacity":1,"depthWrite":true,"side":"double","wireframe":false,"colorReverse":false,"roughness":0.4,"metalness":0,"diffuse":16777215,"diffuseInterior":false,"useInteriorColor":false,"interiorColor":2236962,"interiorDarkening":0,"matrix":{"elements":[1,0,0,0,0,1,0,0,0,0,1,0,0,0,0,1]},"disablePicking":false},"templateParams":{"lazy":{"type":"boolean"},"clipNear":{"type":"range","step":1,"max":100,"min":0,"buffer":true},"clipRadius":{"type":"number","precision":1,"max":1000,"min":0,"buffer":true},"clipCenter":{"type":"vector3","precision":1,"buffer":true},"flatShaded":{"type":"boolean","buffer":true},"opacity":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"depthWrite":{"type":"boolean","buffer":true},"side":{"type":"select","buffer":true,"options":{"front":"front","back":"back","double":"double"}},"wireframe":{"type":"boolean","buffer":true},"colorScheme":null,"colorScale":null,"colorReverse":{"type":"boolean","update":"color"},"colorValue":null,"colorDomain":null,"colorMode":null,"roughness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"metalness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"diffuse":{"type":"color","buffer":true},"diffuseInterior":{"type":"boolean","buffer":true},"useInteriorColor":{"type":"boolean","buffer":true},"interiorColor":{"type":"color","buffer":true},"interiorDarkening":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"matrix":{"type":"hidden","buffer":true},"disablePicking":{"type":"boolean","rebuild":true}}}]},"Mac1-DLS-EU0034A:EN300-321461_LIGAND":{"display_div":"major_view","name":"Mac1-DLS-EU0034A:EN300-321461_LIGAND","OBJECT_TYPE":"LIGAND","colour":"#FAE7B5","sdf_info":"\n RDKit 3D\n\n 9 10 0 0 0 0 0 0 0 0999 V2000\n 28.6950 51.7270 -7.5540 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.1600 50.5930 -6.6460 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.0190 51.0140 -8.6300 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.3620 49.6890 -8.6990 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.0360 49.3690 -7.5170 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.1020 48.8400 -9.7140 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.5190 47.5900 -9.4780 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.1810 47.1340 -8.4130 N 0 0 0 0 0 0 0 0 0 0 0 0\n 29.4220 48.0420 -7.4580 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 1 1 0\n 4 3 1 0\n 5 4 2 0\n 5 2 1 0\n 6 4 1 0\n 7 6 2 0\n 8 7 1 0\n 9 8 2 0\n 9 5 1 0\nM END\n","moleculeId":37457,"selectionType":"LIGAND","representations":[{"lastKnownID":"CFB813A5-E48F-4BC2-BA6C-BCA74E4E7133","uuid":"CFB813A5-E48F-4BC2-BA6C-BCA74E4E7133","type":"ball+stick","params":{"lazy":false,"visible":true,"quality":"medium","sphereDetail":1,"radialSegments":10,"openEnded":true,"disableImpostor":false,"aspectRatio":2,"lineOnly":false,"cylinderOnly":false,"multipleBond":true,"bondScale":0.4,"bondSpacing":1,"linewidth":2,"radiusType":"size","radiusData":{},"radiusSize":0.15,"radiusScale":1,"assembly":"default","defaultAssembly":"","clipNear":0,"clipRadius":0,"clipCenter":{"x":0,"y":0,"z":0},"flatShaded":false,"opacity":1,"depthWrite":true,"side":"double","wireframe":false,"colorScheme":"element","colorScale":"","colorReverse":false,"colorValue":"#FAE7B5","colorMode":"hcl","roughness":0.4,"metalness":0,"diffuse":16777215,"diffuseInterior":false,"useInteriorColor":true,"interiorColor":2236962,"interiorDarkening":0,"matrix":{"elements":[1,0,0,0,0,1,0,0,0,0,1,0,0,0,0,1]},"disablePicking":false,"sele":""},"templateParams":{"sphereDetail":{"type":"integer","max":3,"min":0,"rebuild":"impostor"},"radialSegments":{"type":"integer","max":25,"min":5,"rebuild":"impostor"},"openEnded":{"type":"boolean","rebuild":"impostor","buffer":true},"disableImpostor":{"type":"boolean","rebuild":true},"aspectRatio":{"type":"number","precision":1,"max":10,"min":1},"lineOnly":{"type":"boolean","rebuild":true},"cylinderOnly":{"type":"boolean","rebuild":true},"multipleBond":{"type":"select","rebuild":true,"options":{"off":"off","symmetric":"symmetric","offset":"offset"}},"bondScale":{"type":"number","precision":2,"max":1,"min":0.01},"bondSpacing":{"type":"number","precision":2,"max":2,"min":0.5},"linewidth":{"type":"integer","max":50,"min":1,"buffer":true},"radiusType":{"type":"select","options":{"":"","vdw":"by vdW radius","covalent":"by covalent radius","sstruc":"by secondary structure","bfactor":"by bfactor","size":"size","data":"data","explicit":"explicit"}},"radiusData":{"type":"hidden"},"radiusSize":{"type":"number","precision":3,"max":10,"min":0.001},"radiusScale":{"type":"number","precision":3,"max":10,"min":0.001},"assembly":{"type":"select","options":{"default":"default","":"FULL"},"rebuild":true},"defaultAssembly":{"type":"hidden"},"lazy":{"type":"boolean"},"clipNear":{"type":"range","step":1,"max":100,"min":0,"buffer":true},"clipRadius":{"type":"number","precision":1,"max":1000,"min":0,"buffer":true},"clipCenter":{"type":"vector3","precision":1,"buffer":true},"flatShaded":{"type":"boolean","buffer":true},"opacity":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"depthWrite":{"type":"boolean","buffer":true},"side":{"type":"select","buffer":true,"options":{"front":"front","back":"back","double":"double"}},"wireframe":{"type":"boolean","buffer":true},"colorScheme":{"type":"select","update":"color","options":{"atomindex":"atomindex","bfactor":"bfactor","chainid":"chainid","chainindex":"chainindex","chainname":"chainname","densityfit":"densityfit","electrostatic":"electrostatic","element":"element","entityindex":"entityindex","entitytype":"entitytype","geoquality":"geoquality","hydrophobicity":"hydrophobicity","modelindex":"modelindex","moleculetype":"moleculetype","occupancy":"occupancy","partialcharge":"partialcharge","random":"random","randomcoilindex":"randomcoilindex","residueindex":"residueindex","resname":"resname","sstruc":"sstruc","uniform":"uniform","value":"value","volume":"volume"}},"colorScale":{"type":"select","update":"color","options":{"":"","OrRd":"[S] Orange-Red","PuBu":"[S] Purple-Blue","BuPu":"[S] Blue-Purple","Oranges":"[S] Oranges","BuGn":"[S] Blue-Green","YlOrBr":"[S] Yellow-Orange-Brown","YlGn":"[S] Yellow-Green","Reds":"[S] Reds","RdPu":"[S] Red-Purple","Greens":"[S] Greens","YlGnBu":"[S] Yellow-Green-Blue","Purples":"[S] Purples","GnBu":"[S] Green-Blue","Greys":"[S] Greys","YlOrRd":"[S] Yellow-Orange-Red","PuRd":"[S] Purple-Red","Blues":"[S] Blues","PuBuGn":"[S] Purple-Blue-Green","Viridis":"[D] Viridis","Spectral":"[D] Spectral","RdYlGn":"[D] Red-Yellow-Green","RdBu":"[D] Red-Blue","PiYG":"[D] Pink-Yellowgreen","PRGn":"[D] Purplered-Green","RdYlBu":"[D] Red-Yellow-Blue","BrBG":"[D] Brown-Bluegreen","RdGy":"[D] Red-Grey","PuOr":"[D] Purple-Orange","Set1":"[Q] Set1","Set2":"[Q] Set2","Set3":"[Q] Set3","Dark2":"[Q] Dark2","Paired":"[Q] Paired","Pastel1":"[Q] Pastel1","Pastel2":"[Q] Pastel2","Accent":"[Q] Accent","rainbow":"[?] Rainbow","rwb":"[?] Red-White-Blue"}},"colorReverse":{"type":"boolean","update":"color"},"colorValue":{"type":"color","update":"color"},"colorDomain":{"type":"hidden","update":"color"},"colorMode":{"type":"select","update":"color","options":{"":"","rgb":"Red Green Blue","hsv":"Hue Saturation Value","hsl":"Hue Saturation Lightness","hsi":"Hue Saturation Intensity","lab":"CIE L*a*b*","hcl":"Hue Chroma Lightness"}},"roughness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"metalness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"diffuse":{"type":"color","buffer":true},"diffuseInterior":{"type":"boolean","buffer":true},"useInteriorColor":{"type":"boolean","buffer":true},"interiorColor":{"type":"color","buffer":true},"interiorDarkening":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"matrix":{"type":"hidden","buffer":true},"disablePicking":{"type":"boolean","rebuild":true}}}]},"Mac1-DLS-EU0034A:EN300-321461_HIT_PROTEIN":{"display_div":"major_view","name":"Mac1-DLS-EU0034A:EN300-321461_HIT_PROTEIN","OBJECT_TYPE":"HIT_PROTEIN","sdf_info":"\n RDKit 3D\n\n 9 10 0 0 0 0 0 0 0 0999 V2000\n 28.6950 51.7270 -7.5540 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.1600 50.5930 -6.6460 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.0190 51.0140 -8.6300 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.3620 49.6890 -8.6990 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.0360 49.3690 -7.5170 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.1020 48.8400 -9.7140 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.5190 47.5900 -9.4780 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.1810 47.1340 -8.4130 N 0 0 0 0 0 0 0 0 0 0 0 0\n 29.4220 48.0420 -7.4580 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0\n 3 1 1 0\n 4 3 1 0\n 5 4 2 0\n 5 2 1 0\n 6 4 1 0\n 7 6 2 0\n 8 7 1 0\n 9 8 2 0\n 9 5 1 0\nM END\n","colour":"#FAE7B5","prot_url":"https://fragalysis.apps.xchem.diamond.ac.uk/media/pdbs/Mac1-DLS-EU0034_0A_apo_VjNQ65L.pdb","moleculeId":37457,"selectionType":"PROTEIN"}},"nglOrientations":{"summary_view":{"elements":[77.62926523202331,0,0,0,0,77.62926523202331,0,0,0,0,77.62926523202331,0,-23.004000186920166,-44.762001037597656,6.7270002365112305,1]},"major_view":{"elements":[22.79032419467127,0,0,0,0,22.79032419467127,0,0,0,0,22.79032419467127,0,-28.720499992370605,-49.43050003051758,8.179999828338623,1]}},"viewParams":{"backgroundColor":"black","clipNear":42,"clipFar":100,"clipDist":10,"fogNear":50,"fogFar":62},"countOfRemainingMoleculeGroups":0,"proteinsHasLoaded":true,"countOfPendingNglObjects":{"major_view":0,"summary_view":0},"moleculeOrientations":{"37457":{"elements":[22.79032419467127,0,0,0,0,22.79032419467127,0,0,0,0,22.79032419467127,0,-28.720499992370605,-49.43050003051758,8.179999828338623,1]}},"pdbCache":{"Mac1-DLS-EU0034_0A_apo_VjNQ65L.pdb":{}}},"selectionReducers":{"to_buy_list":[],"vector_list":[],"fragmentDisplayList":[37457],"proteinList":[37457],"complexList":[],"surfaceList":[],"densityList":[],"vectorOnList":[],"countOfPendingVectorLoadRequests":0,"mol_group_selection":[238505],"filter":{"active":false,"predefined":"none","filter":{"site":{"priority":0,"order":1,"minValue":1,"maxValue":1,"isFloat":false},"number":{"priority":0,"order":1,"minValue":0,"maxValue":1018,"isFloat":true},"MW":{"priority":0,"order":1,"minValue":84.04,"maxValue":249.06,"isFloat":true},"logP":{"priority":0,"order":1,"minValue":-1.19,"maxValue":2.8,"isFloat":true},"TPSA":{"priority":0,"order":1,"minValue":25.78,"maxValue":89.26,"isFloat":true},"HA":{"priority":0,"order":1,"minValue":6,"maxValue":18,"isFloat":false},"Hacc":{"priority":0,"order":1,"minValue":1,"maxValue":5,"isFloat":false},"Hdon":{"priority":0,"order":1,"minValue":0,"maxValue":3,"isFloat":false},"Rots":{"priority":0,"order":1,"minValue":0,"maxValue":4,"isFloat":false},"Rings":{"priority":0,"order":1,"minValue":1,"maxValue":3,"isFloat":false},"Velec":{"priority":0,"order":1,"minValue":32,"maxValue":92,"isFloat":false},"#cpd":{"priority":0,"order":1,"minValue":0,"maxValue":0,"isFloat":false}},"priorityOrder":["site","number","MW","logP","TPSA","HA","Hacc","Hdon","Rots","Rings","Velec","#cpd"]},"moleculeAllSelection":[],"moleculeAllTypeSelection":[],"compoundsOfVectors":null,"bondColorMapOfVectors":null,"currentVector":null},"targetReducers":{"oldUrl":"https://fragalysis.apps.xchem.diamond.ac.uk/api/targets/","isTargetLoading":false},"snapshotReducers":{"saveType":"","nextUuid":"","newSessionFlag":0,"openSavingDialog":false,"dialogCurrentStep":0,"isLoadingSnapshotDialog":false,"listOfSnapshots":[],"isLoadingListOfSnapshots":false,"sharedSnapshotURL":null,"sharedSnapshot":{"url":null,"title":null,"description":null,"disableRedirect":false},"isOpenModalSaveSnapshotBeforeExit":false,"selectedSnapshotToSwitch":null,"disableRedirect":false},"previewReducers":{"summary":{"oldUrl":"","compoundImage":"<svg xmlns=\"http://www.w3.org/2000/svg\" version=\"1.1\" width=\"150px\" height=\"150px\"/>","width":150,"height":150,"countOfPicked":0,"countOfExploredVectors":0,"countOfExploredSeries":0,"estimatedCost":0},"compounds":{"currentPage":-1,"compoundsPerPage":20,"currentCompounds":[],"currentCompoundClass":"blue","selectedCompoundsClass":{"blue":[],"red":[],"green":[],"purple":[],"apricot":[]},"highlightedCompoundId":null,"showedCompoundList":[],"configuration":{}},"molecule":{"sortDialogOpen":false,"imageCache":{"37457":"<?xml version='1.0' encoding='iso-8859-1'?>\n<svg version='1.1' baseProfile='full'\n xmlns='http://www.w3.org/2000/svg'\n xmlns:rdkit='http://www.rdkit.org/xml'\n xmlns:xlink='http://www.w3.org/1999/xlink'\n xml:space='preserve'\nwidth='150px' height='34px' viewBox='0 0 150 34'>\n<!-- END OF HEADER -->\n<path class='bond-0' d='M 51.6924,22.4363 L 51.6924,16.5604' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-0' d='M 51.6924,16.5604 L 51.6924,10.6846' style='fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-0' d='M 54.6395,20.6736 L 54.6395,16.5604' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-0' d='M 54.6395,16.5604 L 54.6395,12.4473' style='fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-8' d='M 51.6924,22.4363 L 56.8707,25.426' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-8' d='M 56.8707,25.426 L 62.0489,28.4156' style='fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-1' d='M 54.0972,6.31261 L 59.2754,3.32297' style='fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-1' d='M 59.2754,3.32297 L 64.4536,0.333333' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-2' d='M 64.4536,0.333333 L 77.2148,7.701' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-2' d='M 64.8943,3.99072 L 73.8271,9.14808' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-3' d='M 77.2148,7.701 L 77.2148,22.4363' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-9' d='M 77.2148,7.701 L 91.2289,3.14753' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-4' d='M 77.2148,22.4363 L 72.0366,25.426' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-4' d='M 72.0366,25.426 L 66.8584,28.4156' style='fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-4' d='M 74.1878,20.781 L 70.563,22.8737' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-4' d='M 70.563,22.8737 L 66.9383,24.9665' style='fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-5' d='M 77.2148,22.4363 L 82.9986,24.3156' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-5' d='M 82.9986,24.3156 L 88.7824,26.1949' style='fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-6' d='M 93.3284,24.1 L 96.6093,19.5844' style='fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-6' d='M 96.6093,19.5844 L 99.8901,15.0687' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-7' d='M 99.8901,15.0687 L 91.2289,3.14753' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='atom-1' d='M 50.7534 5.577\nL 52.1454 7.827\nQ 52.2834 8.049, 52.5054 8.451\nQ 52.7274 8.853, 52.7394 8.877\nL 52.7394 5.577\nL 53.3034 5.577\nL 53.3034 9.825\nL 52.7214 9.825\nL 51.2274 7.365\nQ 51.0534 7.077, 50.8674 6.747\nQ 50.6874 6.417, 50.6334 6.315\nL 50.6334 9.825\nL 50.0814 9.825\nL 50.0814 5.577\nL 50.7534 5.577\n' fill='#0000FF'/>\n<path class='atom-5' d='M 63.5146 27.68\nL 64.9066 29.93\nQ 65.0446 30.152, 65.2666 30.554\nQ 65.4886 30.956, 65.5006 30.98\nL 65.5006 27.68\nL 66.0646 27.68\nL 66.0646 31.928\nL 65.4826 31.928\nL 63.9886 29.468\nQ 63.8146 29.18, 63.6286 28.85\nQ 63.4486 28.52, 63.3946 28.418\nL 63.3946 31.928\nL 62.8426 31.928\nL 62.8426 27.68\nL 63.5146 27.68\n' fill='#0000FF'/>\n<path class='atom-6' d='M 90.2899 24.8658\nL 91.6819 27.1158\nQ 91.8199 27.3378, 92.0419 27.7398\nQ 92.2639 28.1418, 92.2759 28.1658\nL 92.2759 24.8658\nL 92.8399 24.8658\nL 92.8399 29.1138\nL 92.2579 29.1138\nL 90.7639 26.6538\nQ 90.5899 26.3658, 90.4039 26.0358\nQ 90.2239 25.7058, 90.1699 25.6038\nL 90.1699 29.1138\nL 89.6179 29.1138\nL 89.6179 24.8658\nL 90.2899 24.8658\n' fill='#0000FF'/>\n<path class='atom-6' d='M 89.5669 29.5386\nL 90.1429 29.5386\nL 90.1429 31.3446\nL 92.3149 31.3446\nL 92.3149 29.5386\nL 92.8909 29.5386\nL 92.8909 33.7866\nL 92.3149 33.7866\nL 92.3149 31.8246\nL 90.1429 31.8246\nL 90.1429 33.7866\nL 89.5669 33.7866\nL 89.5669 29.5386\n' fill='#0000FF'/>\n</svg>\n","37458":"<?xml version='1.0' encoding='iso-8859-1'?>\n<svg version='1.1' baseProfile='full'\n xmlns='http://www.w3.org/2000/svg'\n xmlns:rdkit='http://www.rdkit.org/xml'\n xmlns:xlink='http://www.w3.org/1999/xlink'\n xml:space='preserve'\nwidth='150px' height='34px' viewBox='0 0 150 34'>\n<!-- END OF HEADER -->\n<path class='bond-0' d='M 77.6504,33.6667 L 80.3945,25.2214' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-1' d='M 80.3945,25.2214 L 83.5599,24.1929' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-1' d='M 83.5599,24.1929 L 86.7253,23.1644' style='fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-1' d='M 80.7953,23.2238 L 83.0111,22.5038' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-1' d='M 83.0111,22.5038 L 85.2268,21.7839' style='fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-8' d='M 80.3945,25.2214 L 75.175,18.0374' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-2' d='M 88.8398,19.8353 L 88.8398,16.1734' style='fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-3' d='M 86.7253,12.9104 L 83.5599,11.8819' style='fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-3' d='M 83.5599,11.8819 L 80.3945,10.8534' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-4' d='M 80.3945,10.8534 L 79.4493,7.94447' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-4' d='M 79.4493,7.94447 L 78.5042,5.03557' style='fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-5' d='M 80.3945,10.8534 L 75.175,18.0374' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-5' d='M 81.0483,12.9749 L 77.3947,18.0037' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-6' d='M 75.175,18.0374 L 66.2951,18.0374' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-7' d='M 66.2951,18.0374 L 62.9196,18.0374' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-7' d='M 62.9196,18.0374 L 59.5442,18.0374' style='fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-7' d='M 65.2824,16.2614 L 62.4133,16.2614' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-7' d='M 62.4133,16.2614 L 59.5442,16.2614' style='fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-7' d='M 65.2824,19.8133 L 62.4133,19.8133' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-7' d='M 62.4133,19.8133 L 59.5442,19.8133' style='fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='atom-2' d='M 87.9008 20.3533\nL 89.2928 22.6033\nQ 89.4308 22.8253, 89.6528 23.2273\nQ 89.8748 23.6293, 89.8868 23.6533\nL 89.8868 20.3533\nL 90.4508 20.3533\nL 90.4508 24.6013\nL 89.8688 24.6013\nL 88.3748 22.1413\nQ 88.2008 21.8533, 88.0148 21.5233\nQ 87.8348 21.1933, 87.7808 21.0913\nL 87.7808 24.6013\nL 87.2288 24.6013\nL 87.2288 20.3533\nL 87.9008 20.3533\n' fill='#0000FF'/>\n<path class='atom-3' d='M 87.9008 11.4734\nL 89.2928 13.7234\nQ 89.4308 13.9454, 89.6528 14.3474\nQ 89.8748 14.7494, 89.8868 14.7734\nL 89.8868 11.4734\nL 90.4508 11.4734\nL 90.4508 15.7214\nL 89.8688 15.7214\nL 88.3748 13.2614\nQ 88.2008 12.9734, 88.0148 12.6434\nQ 87.8348 12.3134, 87.7808 12.2114\nL 87.7808 15.7214\nL 87.2288 15.7214\nL 87.2288 11.4734\nL 87.9008 11.4734\n' fill='#0000FF'/>\n<path class='atom-3' d='M 90.9608 11.4734\nL 91.5368 11.4734\nL 91.5368 13.2794\nL 93.7088 13.2794\nL 93.7088 11.4734\nL 94.2848 11.4734\nL 94.2848 15.7214\nL 93.7088 15.7214\nL 93.7088 13.7594\nL 91.5368 13.7594\nL 91.5368 15.7214\nL 90.9608 15.7214\nL 90.9608 11.4734\n' fill='#0000FF'/>\n<path class='atom-5' d='M 76.7114 0.284066\nL 78.1034 2.53407\nQ 78.2414 2.75607, 78.4634 3.15807\nQ 78.6854 3.56007, 78.6974 3.58407\nL 78.6974 0.284066\nL 79.2614 0.284066\nL 79.2614 4.53207\nL 78.6794 4.53207\nL 77.1854 2.07207\nQ 77.0114 1.78407, 76.8254 1.45407\nQ 76.6454 1.12407, 76.5914 1.02207\nL 76.5914 4.53207\nL 76.0394 4.53207\nL 76.0394 0.284066\nL 76.7114 0.284066\n' fill='#0000FF'/>\n<path class='atom-5' d='M 79.7714 0.284066\nL 80.3474 0.284066\nL 80.3474 2.09007\nL 82.5194 2.09007\nL 82.5194 0.284066\nL 83.0954 0.284066\nL 83.0954 4.53207\nL 82.5194 4.53207\nL 82.5194 2.57007\nL 80.3474 2.57007\nL 80.3474 4.53207\nL 79.7714 4.53207\nL 79.7714 0.284066\n' fill='#0000FF'/>\n<path class='atom-5' d='M 83.3013 4.38303\nQ 83.4043 4.11771, 83.6498 3.97119\nQ 83.8953 3.82071, 84.2359 3.82071\nQ 84.6596 3.82071, 84.8972 4.05039\nQ 85.1348 4.28007, 85.1348 4.68795\nQ 85.1348 5.10375, 84.8259 5.49183\nQ 84.521 5.87991, 83.8874 6.33927\nL 85.1823 6.33927\nL 85.1823 6.65607\nL 83.2934 6.65607\nL 83.2934 6.39075\nQ 83.8161 6.01851, 84.125 5.74131\nQ 84.4379 5.46411, 84.5883 5.21463\nQ 84.7388 4.96515, 84.7388 4.70775\nQ 84.7388 4.43847, 84.6042 4.28799\nQ 84.4695 4.13751, 84.2359 4.13751\nQ 84.0102 4.13751, 83.8597 4.22859\nQ 83.7092 4.31967, 83.6023 4.52163\nL 83.3013 4.38303\n' fill='#0000FF'/>\n<path class='atom-8' d='M 56.4762 15.9134\nL 57.8682 18.1634\nQ 58.0062 18.3854, 58.2282 18.7874\nQ 58.4502 19.1894, 58.4622 19.2134\nL 58.4622 15.9134\nL 59.0262 15.9134\nL 59.0262 20.1614\nL 58.4442 20.1614\nL 56.9502 17.7014\nQ 56.7762 17.4134, 56.5902 17.0834\nQ 56.4102 16.7534, 56.3562 16.6514\nL 56.3562 20.1614\nL 55.8042 20.1614\nL 55.8042 15.9134\nL 56.4762 15.9134\n' fill='#0000FF'/>\n</svg>\n","37460":"<?xml version='1.0' encoding='iso-8859-1'?>\n<svg version='1.1' baseProfile='full'\n xmlns='http://www.w3.org/2000/svg'\n xmlns:rdkit='http://www.rdkit.org/xml'\n xmlns:xlink='http://www.w3.org/1999/xlink'\n xml:space='preserve'\nwidth='150px' height='34px' viewBox='0 0 150 34'>\n<!-- END OF HEADER -->\n<path class='bond-0' d='M 49.2297,22.8406 L 53.8956,25.8886' style='fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-0' d='M 53.8956,25.8886 L 58.5615,28.9366' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-1' d='M 58.5615,28.9366 L 71.0102,22.6358' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-2' d='M 71.0102,22.6358 L 71.7779,8.70457' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-2' d='M 73.9116,20.6997 L 74.449,10.9478' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-8' d='M 71.0102,22.6358 L 82.6911,30.2664' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-3' d='M 71.7779,8.70457 L 76.8149,6.15518' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-3' d='M 76.8149,6.15518 L 81.8519,3.60579' style='fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-4' d='M 86.5758,3.93842 L 91.2417,6.9864' style='fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-4' d='M 91.2417,6.9864 L 95.9076,10.0344' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-4' d='M 86.4495,7.18901 L 89.7156,9.32259' style='fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-4' d='M 89.7156,9.32259 L 92.9817,11.4562' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-5' d='M 95.9076,10.0344 L 95.1398,23.9656' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-6' d='M 95.1398,23.9656 L 99.8897,27.0685' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-6' d='M 99.8897,27.0685 L 104.64,30.1713' style='fill:none;fill-rule:evenodd;stroke:#7F4C19;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-7' d='M 95.1398,23.9656 L 82.6911,30.2664' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-7' d='M 92.0124,22.421 L 83.2983,26.8315' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='atom-0' d='M 39.3606 19.182\nL 39.9366 19.182\nL 39.9366 20.988\nL 42.1086 20.988\nL 42.1086 19.182\nL 42.6846 19.182\nL 42.6846 23.43\nL 42.1086 23.43\nL 42.1086 21.468\nL 39.9366 21.468\nL 39.9366 23.43\nL 39.3606 23.43\nL 39.3606 19.182\n' fill='#0000FF'/>\n<path class='atom-0' d='M 42.8905 23.281\nQ 42.9935 23.0157, 43.239 22.8692\nQ 43.4845 22.7187, 43.8251 22.7187\nQ 44.2488 22.7187, 44.4864 22.9484\nQ 44.724 23.178, 44.724 23.5859\nQ 44.724 24.0017, 44.4151 24.3898\nQ 44.1102 24.7779, 43.4766 25.2372\nL 44.7715 25.2372\nL 44.7715 25.554\nL 42.8826 25.554\nL 42.8826 25.2887\nQ 43.4053 24.9165, 43.7142 24.6393\nQ 44.027 24.3621, 44.1775 24.1126\nQ 44.328 23.8631, 44.328 23.6057\nQ 44.328 23.3364, 44.1933 23.186\nQ 44.0587 23.0355, 43.8251 23.0355\nQ 43.5993 23.0355, 43.4489 23.1266\nQ 43.2984 23.2176, 43.1915 23.4196\nL 42.8905 23.281\n' fill='#0000FF'/>\n<path class='atom-0' d='M 45.9415 19.182\nL 47.3335 21.432\nQ 47.4715 21.654, 47.6935 22.056\nQ 47.9155 22.458, 47.9275 22.482\nL 47.9275 19.182\nL 48.4915 19.182\nL 48.4915 23.43\nL 47.9095 23.43\nL 46.4155 20.97\nQ 46.2415 20.682, 46.0555 20.352\nQ 45.8755 20.022, 45.8215 19.92\nL 45.8215 23.43\nL 45.2695 23.43\nL 45.2695 19.182\nL 45.9415 19.182\n' fill='#0000FF'/>\n<path class='atom-4' d='M 83.2876 0.279837\nL 84.6796 2.52984\nQ 84.8176 2.75184, 85.0396 3.15384\nQ 85.2616 3.55584, 85.2736 3.57984\nL 85.2736 0.279837\nL 85.8376 0.279837\nL 85.8376 4.52784\nL 85.2556 4.52784\nL 83.7616 2.06784\nQ 83.5876 1.77984, 83.4016 1.44984\nQ 83.2216 1.11984, 83.1676 1.01784\nL 83.1676 4.52784\nL 82.6156 4.52784\nL 82.6156 0.279837\nL 83.2876 0.279837\n' fill='#0000FF'/>\n<path class='atom-7' d='M 107.442 31.4882\nQ 107.85 31.6022, 108.054 31.8542\nQ 108.264 32.1002, 108.264 32.4662\nQ 108.264 33.0542, 107.886 33.3902\nQ 107.514 33.7202, 106.806 33.7202\nL 105.378 33.7202\nL 105.378 29.4722\nL 106.632 29.4722\nQ 107.358 29.4722, 107.724 29.7662\nQ 108.09 30.0602, 108.09 30.6002\nQ 108.09 31.2422, 107.442 31.4882\nM 105.948 29.9522\nL 105.948 31.2842\nL 106.632 31.2842\nQ 107.052 31.2842, 107.268 31.1162\nQ 107.49 30.9422, 107.49 30.6002\nQ 107.49 29.9522, 106.632 29.9522\nL 105.948 29.9522\nM 106.806 33.2402\nQ 107.22 33.2402, 107.442 33.0422\nQ 107.664 32.8442, 107.664 32.4662\nQ 107.664 32.1182, 107.418 31.9442\nQ 107.178 31.7642, 106.716 31.7642\nL 105.948 31.7642\nL 105.948 33.2402\nL 106.806 33.2402\n' fill='#7F4C19'/>\n<path class='atom-7' d='M 109.23 30.6362\nL 109.296 31.0622\nQ 109.62 30.5822, 110.148 30.5822\nQ 110.316 30.5822, 110.544 30.6422\nL 110.454 31.1462\nQ 110.196 31.0862, 110.052 31.0862\nQ 109.8 31.0862, 109.632 31.1882\nQ 109.47 31.2842, 109.338 31.5182\nL 109.338 33.7202\nL 108.774 33.7202\nL 108.774 30.6362\nL 109.23 30.6362\n' fill='#7F4C19'/>\n</svg>\n","37461":"<?xml version='1.0' encoding='iso-8859-1'?>\n<svg version='1.1' baseProfile='full'\n xmlns='http://www.w3.org/2000/svg'\n xmlns:rdkit='http://www.rdkit.org/xml'\n xmlns:xlink='http://www.w3.org/1999/xlink'\n xml:space='preserve'\nwidth='150px' height='34px' viewBox='0 0 150 34'>\n<!-- END OF HEADER -->\n<path class='bond-0' d='M 43.0253,22.4555 L 57.1045,17.2685' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-1' d='M 58.5832,17.5232 L 59.5914,11.6713' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-1' d='M 59.5914,11.6713 L 60.5996,5.81934' style='fill:none;fill-rule:evenodd;stroke:#FF0000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-1' d='M 55.6259,17.0137 L 56.6341,11.1618' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-1' d='M 56.6341,11.1618 L 57.6423,5.30984' style='fill:none;fill-rule:evenodd;stroke:#FF0000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-2' d='M 57.1045,17.2685 L 61.6849,21.0813' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-2' d='M 61.6849,21.0813 L 66.2653,24.8942' style='fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-3' d='M 71.0921,25.9631 L 76.9038,23.822' style='fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-3' d='M 76.9038,23.822 L 82.7155,21.6808' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-4' d='M 82.7155,21.6808 L 87.7503,25.0482' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-4' d='M 87.7503,25.0482 L 92.7852,28.4156' style='fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-4' d='M 85.8942,20.1967 L 89.4186,22.5538' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-4' d='M 89.4186,22.5538 L 92.943,24.911' style='fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-8' d='M 82.7155,21.6808 L 84.3187,16.0058' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-8' d='M 84.3187,16.0058 L 85.922,10.3307' style='fill:none;fill-rule:evenodd;stroke:#CCCC00;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-5' d='M 97.567,28.1482 L 102.271,24.4433' style='fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-5' d='M 102.271,24.4433 L 106.975,20.7384' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-6' d='M 106.975,20.7384 L 101.788,6.65915' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-6' d='M 103.381,19.6639 L 99.7499,9.80845' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-7' d='M 101.788,6.65915 L 95.4098,6.90693' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-7' d='M 95.4098,6.90693 L 89.0319,7.1547' style='fill:none;fill-rule:evenodd;stroke:#CCCC00;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='atom-2' d='M 57.7014 2.49396\nQ 57.7014 1.47366, 58.2056 0.903498\nQ 58.7097 0.333333, 59.652 0.333333\nQ 60.5943 0.333333, 61.0984 0.903498\nQ 61.6026 1.47366, 61.6026 2.49396\nQ 61.6026 3.52626, 61.0924 4.11443\nQ 60.5823 4.6966, 59.652 4.6966\nQ 58.7157 4.6966, 58.2056 4.11443\nQ 57.7014 3.53226, 57.7014 2.49396\nM 59.652 4.21646\nQ 60.3002 4.21646, 60.6483 3.78433\nQ 61.0024 3.34621, 61.0024 2.49396\nQ 61.0024 1.65972, 60.6483 1.2396\nQ 60.3002 0.813472, 59.652 0.813472\nQ 59.0038 0.813472, 58.6497 1.23359\nQ 58.3016 1.65372, 58.3016 2.49396\nQ 58.3016 3.35221, 58.6497 3.78433\nQ 59.0038 4.21646, 59.652 4.21646\n' fill='#FF0000'/>\n<path class='atom-3' d='M 67.697 24.7433\nL 69.0894 26.9939\nQ 69.2274 27.216, 69.4495 27.6181\nQ 69.6716 28.0202, 69.6836 28.0442\nL 69.6836 24.7433\nL 70.2477 24.7433\nL 70.2477 28.9925\nL 69.6655 28.9925\nL 68.1711 26.5318\nQ 67.9971 26.2437, 67.811 25.9136\nQ 67.631 25.5835, 67.5769 25.4815\nL 67.5769 28.9925\nL 67.0248 28.9925\nL 67.0248 24.7433\nL 67.697 24.7433\n' fill='#0000FF'/>\n<path class='atom-3' d='M 66.9738 29.4174\nL 67.5499 29.4174\nL 67.5499 31.224\nL 69.7226 31.224\nL 69.7226 29.4174\nL 70.2987 29.4174\nL 70.2987 33.6667\nL 69.7226 33.6667\nL 69.7226 31.7041\nL 67.5499 31.7041\nL 67.5499 33.6667\nL 66.9738 33.6667\nL 66.9738 29.4174\n' fill='#0000FF'/>\n<path class='atom-5' d='M 94.2482 27.8977\nL 95.6406 30.1483\nQ 95.7786 30.3704, 96.0007 30.7725\nQ 96.2228 31.1746, 96.2348 31.1986\nL 96.2348 27.8977\nL 96.7989 27.8977\nL 96.7989 32.1469\nL 96.2168 32.1469\nL 94.7223 29.6862\nQ 94.5483 29.3981, 94.3622 29.068\nQ 94.1822 28.7379, 94.1282 28.6359\nL 94.1282 32.1469\nL 93.576 32.1469\nL 93.576 27.8977\nL 94.2482 27.8977\n' fill='#0000FF'/>\n<path class='atom-8' d='M 85.5943 8.70004\nQ 85.6423 8.71805, 85.8403 8.80207\nQ 86.0384 8.8861, 86.2545 8.94011\nQ 86.4765 8.98813, 86.6926 8.98813\nQ 87.0947 8.98813, 87.3288 8.79607\nQ 87.5628 8.59801, 87.5628 8.25591\nQ 87.5628 8.02185, 87.4428 7.87781\nQ 87.3288 7.73376, 87.1487 7.65574\nQ 86.9687 7.57772, 86.6686 7.48769\nQ 86.2905 7.37366, 86.0624 7.26563\nQ 85.8403 7.1576, 85.6783 6.92953\nQ 85.5223 6.70146, 85.5223 6.31735\nQ 85.5223 5.7832, 85.8824 5.4531\nQ 86.2485 5.12301, 86.9687 5.12301\nQ 87.4608 5.12301, 88.019 5.35708\nL 87.8809 5.81921\nQ 87.3708 5.60915, 86.9867 5.60915\nQ 86.5726 5.60915, 86.3445 5.7832\nQ 86.1164 5.95125, 86.1224 6.24533\nQ 86.1224 6.4734, 86.2365 6.61144\nQ 86.3565 6.74948, 86.5245 6.8275\nQ 86.6986 6.90552, 86.9867 6.99555\nQ 87.3708 7.11558, 87.5989 7.23562\nQ 87.8269 7.35565, 87.989 7.60173\nQ 88.157 7.84179, 88.157 8.25591\nQ 88.157 8.84408, 87.7609 9.16218\nQ 87.3708 9.47427, 86.7166 9.47427\nQ 86.3385 9.47427, 86.0504 9.39024\nQ 85.7683 9.31222, 85.4322 9.17418\nL 85.5943 8.70004\n' fill='#CCCC00'/>\n</svg>\n","37462":"<?xml version='1.0' encoding='iso-8859-1'?>\n<svg version='1.1' baseProfile='full'\n xmlns='http://www.w3.org/2000/svg'\n xmlns:rdkit='http://www.rdkit.org/xml'\n xmlns:xlink='http://www.w3.org/1999/xlink'\n xml:space='preserve'\nwidth='150px' height='34px' viewBox='0 0 150 34'>\n<!-- END OF HEADER -->\n<path class='bond-0' d='M 69.8214,33.6667 L 66.4865,23.2471' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-1' d='M 66.4865,23.2471 L 55.7954,20.9255' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-1' d='M 65.3471,20.7607 L 57.8634,19.1356' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-8' d='M 66.4865,23.2471 L 73.8426,15.1492' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-2' d='M 55.7954,20.9255 L 52.4604,10.506' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-3' d='M 52.4604,10.506 L 55.0736,7.62927' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-3' d='M 55.0736,7.62927 L 57.6868,4.75254' style='fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-3' d='M 54.864,11.1142 L 56.6932,9.10049' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-3' d='M 56.6932,9.10049 L 58.5225,7.08678' style='fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-4' d='M 62.0574,2.89468 L 66.2825,3.81218' style='fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-4' d='M 66.2825,3.81218 L 70.5076,4.72968' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-5' d='M 70.5076,4.72968 L 73.8426,15.1492' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-5' d='M 68.9239,6.9596 L 71.2584,14.2533' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-6' d='M 73.8426,15.1492 L 84.5336,17.4708' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-7' d='M 84.5336,17.4708 L 86.9773,14.7807' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-7' d='M 86.9773,14.7807 L 89.421,12.0906' style='fill:none;fill-rule:evenodd;stroke:#FF0000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='atom-4' d='M 58.8775 0.284066\nL 60.2695 2.53407\nQ 60.4075 2.75607, 60.6295 3.15807\nQ 60.8515 3.56007, 60.8635 3.58407\nL 60.8635 0.284066\nL 61.4275 0.284066\nL 61.4275 4.53207\nL 60.8455 4.53207\nL 59.3515 2.07207\nQ 59.1775 1.78407, 58.9915 1.45407\nQ 58.8115 1.12407, 58.7575 1.02207\nL 58.7575 4.53207\nL 58.2055 4.53207\nL 58.2055 0.284066\nL 58.8775 0.284066\n' fill='#0000FF'/>\n<path class='atom-8' d='M 89.9397 9.3849\nQ 89.9397 8.3649, 90.4437 7.7949\nQ 90.9477 7.2249, 91.8897 7.2249\nQ 92.8317 7.2249, 93.3357 7.7949\nQ 93.8397 8.3649, 93.8397 9.3849\nQ 93.8397 10.4169, 93.3297 11.0049\nQ 92.8197 11.5869, 91.8897 11.5869\nQ 90.9537 11.5869, 90.4437 11.0049\nQ 89.9397 10.4229, 89.9397 9.3849\nM 91.8897 11.1069\nQ 92.5377 11.1069, 92.8857 10.6749\nQ 93.2397 10.2369, 93.2397 9.3849\nQ 93.2397 8.5509, 92.8857 8.1309\nQ 92.5377 7.7049, 91.8897 7.7049\nQ 91.2417 7.7049, 90.8877 8.1249\nQ 90.5397 8.5449, 90.5397 9.3849\nQ 90.5397 10.2429, 90.8877 10.6749\nQ 91.2417 11.1069, 91.8897 11.1069\n' fill='#FF0000'/>\n<path class='atom-8' d='M 94.3497 7.2729\nL 94.9257 7.2729\nL 94.9257 9.0789\nL 97.0977 9.0789\nL 97.0977 7.2729\nL 97.6737 7.2729\nL 97.6737 11.5209\nL 97.0977 11.5209\nL 97.0977 9.5589\nL 94.9257 9.5589\nL 94.9257 11.5209\nL 94.3497 11.5209\nL 94.3497 7.2729\n' fill='#FF0000'/>\n</svg>\n","37463":"<?xml version='1.0' encoding='iso-8859-1'?>\n<svg version='1.1' baseProfile='full'\n xmlns='http://www.w3.org/2000/svg'\n xmlns:rdkit='http://www.rdkit.org/xml'\n xmlns:xlink='http://www.w3.org/1999/xlink'\n xml:space='preserve'\nwidth='150px' height='34px' viewBox='0 0 150 34'>\n<!-- END OF HEADER -->\n<path class='bond-0' d='M 47.0331,29.4148 L 58.3391,25.0227' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-1' d='M 58.3391,25.0227 L 62.3115,27.5798' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-1' d='M 62.3115,27.5798 L 66.2838,30.1368' style='fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-1' d='M 60.8439,23.7501 L 63.6245,25.54' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-1' d='M 63.6245,25.54 L 66.4051,27.3299' style='fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-8' d='M 58.3391,25.0227 L 59.5019,20.6126' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-8' d='M 59.5019,20.6126 L 60.6646,16.2025' style='fill:none;fill-rule:evenodd;stroke:#FF0000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-2' d='M 70.7654,29.7693 L 74.3494,26.8431' style='fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-2' d='M 74.3494,26.8431 L 77.9334,23.917' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-3' d='M 77.9334,23.917 L 89.6618,27.0092' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-5' d='M 77.9334,23.917 L 73.5413,12.6109' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-5' d='M 75.0134,23.0995 L 71.9389,15.1853' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-4' d='M 89.6618,27.0092 L 94.3734,28.2515' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-4' d='M 94.3734,28.2515 L 99.085,29.4937' style='fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-4' d='M 90.4568,29.7276 L 94.4617,30.7835' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-4' d='M 94.4617,30.7835 L 98.4666,31.8394' style='fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-4' d='M 91.6937,25.0362 L 95.6986,26.0921' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-4' d='M 95.6986,26.0921 L 99.7035,27.148' style='fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-6' d='M 73.5413,12.6109 L 75.9332,8.89513' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-6' d='M 75.9332,8.89513 L 78.3252,5.17932' style='fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-7' d='M 73.5413,12.6109 L 68.8148,12.8777' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-7' d='M 68.8148,12.8777 L 64.0883,13.1444' style='fill:none;fill-rule:evenodd;stroke:#FF0000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='atom-2' d='M 67.599 29.4639\nL 68.991 31.7139\nQ 69.129 31.9359, 69.351 32.3379\nQ 69.573 32.7399, 69.585 32.7639\nL 69.585 29.4639\nL 70.149 29.4639\nL 70.149 33.7119\nL 69.567 33.7119\nL 68.073 31.2519\nQ 67.899 30.9639, 67.713 30.6339\nQ 67.533 30.3039, 67.479 30.2019\nL 67.479 33.7119\nL 66.927 33.7119\nL 66.927 29.4639\nL 67.599 29.4639\n' fill='#0000FF'/>\n<path class='atom-5' d='M 100.451 27.9775\nL 101.843 30.2275\nQ 101.981 30.4495, 102.203 30.8515\nQ 102.425 31.2535, 102.437 31.2775\nL 102.437 27.9775\nL 103.001 27.9775\nL 103.001 32.2255\nL 102.419 32.2255\nL 100.925 29.7655\nQ 100.751 29.4775, 100.565 29.1475\nQ 100.385 28.8175, 100.331 28.7155\nL 100.331 32.2255\nL 99.7792 32.2255\nL 99.7792 27.9775\nL 100.451 27.9775\n' fill='#0000FF'/>\n<path class='atom-7' d='M 79.1675 0.288131\nL 80.5595 2.53813\nQ 80.6975 2.76013, 80.9195 3.16213\nQ 81.1415 3.56413, 81.1535 3.58813\nL 81.1535 0.288131\nL 81.7175 0.288131\nL 81.7175 4.53613\nL 81.1355 4.53613\nL 79.6415 2.07613\nQ 79.4675 1.78813, 79.2815 1.45813\nQ 79.1015 1.12813, 79.0475 1.02613\nL 79.0475 4.53613\nL 78.4955 4.53613\nL 78.4955 0.288131\nL 79.1675 0.288131\n' fill='#0000FF'/>\n<path class='atom-7' d='M 82.2275 0.288131\nL 82.8035 0.288131\nL 82.8035 2.09413\nL 84.9755 2.09413\nL 84.9755 0.288131\nL 85.5515 0.288131\nL 85.5515 4.53613\nL 84.9755 4.53613\nL 84.9755 2.57413\nL 82.8035 2.57413\nL 82.8035 4.53613\nL 82.2275 4.53613\nL 82.2275 0.288131\n' fill='#0000FF'/>\n<path class='atom-7' d='M 85.7574 4.38709\nQ 85.8604 4.12177, 86.1059 3.97525\nQ 86.3514 3.82477, 86.692 3.82477\nQ 87.1157 3.82477, 87.3533 4.05445\nQ 87.5909 4.28413, 87.5909 4.69201\nQ 87.5909 5.10781, 87.282 5.49589\nQ 86.9771 5.88397, 86.3435 6.34333\nL 87.6384 6.34333\nL 87.6384 6.66013\nL 85.7495 6.66013\nL 85.7495 6.39481\nQ 86.2722 6.02257, 86.5811 5.74537\nQ 86.8939 5.46817, 87.0444 5.21869\nQ 87.1949 4.96921, 87.1949 4.71181\nQ 87.1949 4.44253, 87.0602 4.29205\nQ 86.9256 4.14157, 86.692 4.14157\nQ 86.4662 4.14157, 86.3158 4.23265\nQ 86.1653 4.32373, 86.0584 4.52569\nL 85.7574 4.38709\n' fill='#0000FF'/>\n<path class='atom-8' d='M 59.4814 13.3063\nQ 59.4814 12.2863, 59.9854 11.7163\nQ 60.4894 11.1463, 61.4314 11.1463\nQ 62.3734 11.1463, 62.8774 11.7163\nQ 63.3814 12.2863, 63.3814 13.3063\nQ 63.3814 14.3383, 62.8714 14.9263\nQ 62.3614 15.5083, 61.4314 15.5083\nQ 60.4954 15.5083, 59.9854 14.9263\nQ 59.4814 14.3443, 59.4814 13.3063\nM 61.4314 15.0283\nQ 62.0794 15.0283, 62.4274 14.5963\nQ 62.7814 14.1583, 62.7814 13.3063\nQ 62.7814 12.4723, 62.4274 12.0523\nQ 62.0794 11.6263, 61.4314 11.6263\nQ 60.7834 11.6263, 60.4294 12.0463\nQ 60.0814 12.4663, 60.0814 13.3063\nQ 60.0814 14.1643, 60.4294 14.5963\nQ 60.7834 15.0283, 61.4314 15.0283\n' fill='#FF0000'/>\n</svg>\n","37464":"<?xml version='1.0' encoding='iso-8859-1'?>\n<svg version='1.1' baseProfile='full'\n xmlns='http://www.w3.org/2000/svg'\n xmlns:rdkit='http://www.rdkit.org/xml'\n xmlns:xlink='http://www.w3.org/1999/xlink'\n xml:space='preserve'\nwidth='150px' height='34px' viewBox='0 0 150 34'>\n<!-- END OF HEADER -->\n<path class='bond-0' d='M 56.4853,11.6408 L 60.5112,10.4697' style='fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-0' d='M 60.5112,10.4697 L 64.537,9.29851' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-1' d='M 64.537,9.29851 L 72.2612,16.7006' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-2' d='M 72.2612,16.7006 L 76.2871,15.5294' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-2' d='M 76.2871,15.5294 L 80.3129,14.3583' style='fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-3' d='M 83.2052,10.9744 L 84.1436,7.14805' style='fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-3' d='M 84.1436,7.14805 L 85.082,3.32173' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-9' d='M 84.6697,15.759 L 87.4639,18.4366' style='fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-9' d='M 87.4639,18.4366 L 90.258,21.1142' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-4' d='M 85.082,3.32173 L 95.3545,0.333333' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-4' d='M 87.2205,4.92797 L 94.4113,2.83609' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-5' d='M 95.3545,0.333333 L 103.079,7.73539' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-6' d='M 103.079,7.73539 L 100.531,18.1258' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-6' d='M 100.618,8.78431 L 98.8347,16.0576' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-7' d='M 100.531,18.1258 L 90.258,21.1142' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-8' d='M 89.219,20.8594 L 88.2835,24.6737' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-8' d='M 88.2835,24.6737 L 87.3481,28.4881' style='fill:none;fill-rule:evenodd;stroke:#FF0000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-8' d='M 91.2971,21.3691 L 90.3616,25.1834' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-8' d='M 90.3616,25.1834 L 89.4262,28.9977' style='fill:none;fill-rule:evenodd;stroke:#FF0000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='atom-0' d='M 46.7445 10.1629\nL 47.3205 10.1629\nL 47.3205 11.9689\nL 49.4925 11.9689\nL 49.4925 10.1629\nL 50.0685 10.1629\nL 50.0685 14.4109\nL 49.4925 14.4109\nL 49.4925 12.4489\nL 47.3205 12.4489\nL 47.3205 14.4109\nL 46.7445 14.4109\nL 46.7445 10.1629\n' fill='#0000FF'/>\n<path class='atom-0' d='M 50.2745 14.2619\nQ 50.3774 13.9965, 50.6229 13.85\nQ 50.8685 13.6995, 51.209 13.6995\nQ 51.6327 13.6995, 51.8703 13.9292\nQ 52.1079 14.1589, 52.1079 14.5668\nQ 52.1079 14.9826, 51.7991 15.3707\nQ 51.4941 15.7587, 50.8605 16.2181\nL 52.1555 16.2181\nL 52.1555 16.5349\nL 50.2665 16.5349\nL 50.2665 16.2696\nQ 50.7893 15.8973, 51.0981 15.6201\nQ 51.411 15.3429, 51.5615 15.0935\nQ 51.7119 14.844, 51.7119 14.5866\nQ 51.7119 14.3173, 51.5773 14.1668\nQ 51.4427 14.0163, 51.209 14.0163\nQ 50.9833 14.0163, 50.8328 14.1074\nQ 50.6823 14.1985, 50.5754 14.4005\nL 50.2745 14.2619\n' fill='#0000FF'/>\n<path class='atom-0' d='M 53.3255 10.1629\nL 54.7175 12.4129\nQ 54.8555 12.6349, 55.0775 13.0369\nQ 55.2995 13.4389, 55.3115 13.4629\nL 55.3115 10.1629\nL 55.8755 10.1629\nL 55.8755 14.4109\nL 55.2935 14.4109\nL 53.7995 11.9509\nQ 53.6255 11.6629, 53.4395 11.3329\nQ 53.2595 11.0029, 53.2055 10.9009\nL 53.2055 14.4109\nL 52.6535 14.4109\nL 52.6535 10.1629\nL 53.3255 10.1629\n' fill='#0000FF'/>\n<path class='atom-3' d='M 81.5948 11.5882\nL 82.9868 13.8382\nQ 83.1248 14.0602, 83.3468 14.4622\nQ 83.5688 14.8642, 83.5808 14.8882\nL 83.5808 11.5882\nL 84.1448 11.5882\nL 84.1448 15.8362\nL 83.5628 15.8362\nL 82.0688 13.3762\nQ 81.8948 13.0882, 81.7088 12.7582\nQ 81.5288 12.4282, 81.4748 12.3262\nL 81.4748 15.8362\nL 80.9228 15.8362\nL 80.9228 11.5882\nL 81.5948 11.5882\n' fill='#0000FF'/>\n<path class='atom-9' d='M 85.7598 31.5167\nQ 85.7598 30.4967, 86.2638 29.9267\nQ 86.7678 29.3567, 87.7098 29.3567\nQ 88.6518 29.3567, 89.1558 29.9267\nQ 89.6598 30.4967, 89.6598 31.5167\nQ 89.6598 32.5487, 89.1498 33.1367\nQ 88.6398 33.7187, 87.7098 33.7187\nQ 86.7738 33.7187, 86.2638 33.1367\nQ 85.7598 32.5547, 85.7598 31.5167\nM 87.7098 33.2387\nQ 88.3578 33.2387, 88.7058 32.8067\nQ 89.0598 32.3687, 89.0598 31.5167\nQ 89.0598 30.6827, 88.7058 30.2627\nQ 88.3578 29.8367, 87.7098 29.8367\nQ 87.0618 29.8367, 86.7078 30.2567\nQ 86.3598 30.6767, 86.3598 31.5167\nQ 86.3598 32.3747, 86.7078 32.8067\nQ 87.0618 33.2387, 87.7098 33.2387\n' fill='#FF0000'/>\n</svg>\n","37465":"<?xml version='1.0' encoding='iso-8859-1'?>\n<svg version='1.1' baseProfile='full'\n xmlns='http://www.w3.org/2000/svg'\n xmlns:rdkit='http://www.rdkit.org/xml'\n xmlns:xlink='http://www.w3.org/1999/xlink'\n xml:space='preserve'\nwidth='150px' height='34px' viewBox='0 0 150 34'>\n<!-- END OF HEADER -->\n<path class='bond-0' d='M 42.9549,15.8736 L 47.7496,19.5783' style='fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-0' d='M 47.7496,19.5783 L 52.5443,23.2829' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-1' d='M 52.5443,23.2829 L 66.5699,17.5281' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-2' d='M 68.0723,17.731 L 68.8763,11.7778' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-2' d='M 68.8763,11.7778 L 69.6803,5.82464' style='fill:none;fill-rule:evenodd;stroke:#FF0000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-2' d='M 65.0675,17.3252 L 65.8715,11.372' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-2' d='M 65.8715,11.372 L 66.6755,5.41884' style='fill:none;fill-rule:evenodd;stroke:#FF0000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-3' d='M 66.5699,17.5281 L 71.3646,21.2328' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-3' d='M 71.3646,21.2328 L 76.1593,24.9374' style='fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-4' d='M 81.0412,25.7819 L 86.8166,23.4122' style='fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-4' d='M 86.8166,23.4122 L 92.592,21.0425' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-5' d='M 92.592,21.0425 L 97.8232,24.2723' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-5' d='M 97.8232,24.2723 L 103.054,27.5021' style='fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-5' d='M 95.7542,19.4315 L 99.4161,21.6923' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-5' d='M 99.4161,21.6923 L 103.078,23.9532' style='fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-9' d='M 92.592,21.0425 L 94.0054,15.2407' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-9' d='M 94.0054,15.2407 L 95.4188,9.43885' style='fill:none;fill-rule:evenodd;stroke:#CCCC00;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-6' d='M 107.884,26.9772 L 112.468,23.0884' style='fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-6' d='M 112.468,23.0884 L 117.052,19.1996' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-7' d='M 117.052,19.1996 L 111.298,5.17405' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-7' d='M 113.384,18.2467 L 109.356,8.42883' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-8' d='M 111.298,5.17405 L 104.869,5.65842' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-8' d='M 104.869,5.65842 L 98.4398,6.14278' style='fill:none;fill-rule:evenodd;stroke:#CCCC00;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='atom-0' d='M 32.9475 11.8671\nL 33.5297 11.8671\nL 33.5297 13.6924\nL 35.7249 13.6924\nL 35.7249 11.8671\nL 36.307 11.8671\nL 36.307 16.1605\nL 35.7249 16.1605\nL 35.7249 14.1775\nL 33.5297 14.1775\nL 33.5297 16.1605\nL 32.9475 16.1605\nL 32.9475 11.8671\n' fill='#0000FF'/>\n<path class='atom-0' d='M 36.5152 16.0099\nQ 36.6192 15.7417, 36.8674 15.5936\nQ 37.1155 15.4415, 37.4597 15.4415\nQ 37.888 15.4415, 38.1281 15.6737\nQ 38.3682 15.9058, 38.3682 16.318\nQ 38.3682 16.7383, 38.0561 17.1305\nQ 37.7479 17.5227, 37.1075 17.987\nL 38.4163 17.987\nL 38.4163 18.3072\nL 36.5072 18.3072\nL 36.5072 18.039\nQ 37.0355 17.6628, 37.3476 17.3827\nQ 37.6638 17.1025, 37.8159 16.8503\nQ 37.968 16.5982, 37.968 16.3381\nQ 37.968 16.0659, 37.8319 15.9138\nQ 37.6958 15.7617, 37.4597 15.7617\nQ 37.2316 15.7617, 37.0795 15.8538\nQ 36.9274 15.9458, 36.8193 16.1499\nL 36.5152 16.0099\n' fill='#0000FF'/>\n<path class='atom-0' d='M 39.5988 11.8671\nL 41.0056 14.1412\nQ 41.1451 14.3655, 41.3695 14.7718\nQ 41.5938 15.1781, 41.606 15.2024\nL 41.606 11.8671\nL 42.176 11.8671\nL 42.176 16.1605\nL 41.5878 16.1605\nL 40.0778 13.6742\nQ 39.902 13.3831, 39.714 13.0496\nQ 39.5321 12.7161, 39.4775 12.613\nL 39.4775 16.1605\nL 38.9196 16.1605\nL 38.9196 11.8671\nL 39.5988 11.8671\n' fill='#0000FF'/>\n<path class='atom-3' d='M 66.6281 2.51641\nQ 66.6281 1.48551, 67.1374 0.909423\nQ 67.6468 0.333333, 68.5989 0.333333\nQ 69.551 0.333333, 70.0603 0.909423\nQ 70.5697 1.48551, 70.5697 2.51641\nQ 70.5697 3.55944, 70.0543 4.15372\nQ 69.5388 4.74194, 68.5989 4.74194\nQ 67.6529 4.74194, 67.1374 4.15372\nQ 66.6281 3.5655, 66.6281 2.51641\nM 68.5989 4.25681\nQ 69.2538 4.25681, 69.6055 3.82019\nQ 69.9633 3.37751, 69.9633 2.51641\nQ 69.9633 1.6735, 69.6055 1.24901\nQ 69.2538 0.818462, 68.5989 0.818462\nQ 67.944 0.818462, 67.5862 1.24295\nQ 67.2345 1.66744, 67.2345 2.51641\nQ 67.2345 3.38358, 67.5862 3.82019\nQ 67.944 4.25681, 68.5989 4.25681\n' fill='#FF0000'/>\n<path class='atom-4' d='M 77.6174 24.6506\nL 79.0243 26.9246\nQ 79.1637 27.149, 79.3881 27.5553\nQ 79.6125 27.9616, 79.6246 27.9858\nL 79.6246 24.6506\nL 80.1946 24.6506\nL 80.1946 28.9439\nL 79.6064 28.9439\nL 78.0965 26.4577\nQ 77.9206 26.1666, 77.7326 25.8331\nQ 77.5507 25.4995, 77.4961 25.3964\nL 77.4961 28.9439\nL 76.9382 28.9439\nL 76.9382 24.6506\nL 77.6174 24.6506\n' fill='#0000FF'/>\n<path class='atom-4' d='M 76.8867 29.3733\nL 77.4688 29.3733\nL 77.4688 31.1986\nL 79.664 31.1986\nL 79.664 29.3733\nL 80.2462 29.3733\nL 80.2462 33.6667\nL 79.664 33.6667\nL 79.664 31.6837\nL 77.4688 31.6837\nL 77.4688 33.6667\nL 76.8867 33.6667\nL 76.8867 29.3733\n' fill='#0000FF'/>\n<path class='atom-6' d='M 104.543 26.8601\nL 105.95 29.1342\nQ 106.089 29.3586, 106.313 29.7648\nQ 106.538 30.1711, 106.55 30.1954\nL 106.55 26.8601\nL 107.12 26.8601\nL 107.12 31.1535\nL 106.532 31.1535\nL 105.022 28.6672\nQ 104.846 28.3762, 104.658 28.0426\nQ 104.476 27.7091, 104.421 27.606\nL 104.421 31.1535\nL 103.863 31.1535\nL 103.863 26.8601\nL 104.543 26.8601\n' fill='#0000FF'/>\n<path class='atom-9' d='M 94.9675 7.78659\nQ 95.016 7.80479, 95.2161 7.88968\nQ 95.4162 7.97458, 95.6345 8.02916\nQ 95.8589 8.07767, 96.0772 8.07767\nQ 96.4835 8.07767, 96.72 7.88362\nQ 96.9565 7.6835, 96.9565 7.33785\nQ 96.9565 7.10135, 96.8352 6.95581\nQ 96.72 6.81027, 96.5381 6.73144\nQ 96.3562 6.65261, 96.053 6.56164\nQ 95.6709 6.44643, 95.4405 6.33727\nQ 95.2161 6.22812, 95.0524 5.99768\nQ 94.8947 5.76725, 94.8947 5.37914\nQ 94.8947 4.83944, 95.2586 4.50591\nQ 95.6285 4.17239, 96.3562 4.17239\nQ 96.8534 4.17239, 97.4174 4.40889\nL 97.2779 4.87582\nQ 96.7625 4.66358, 96.3743 4.66358\nQ 95.9559 4.66358, 95.7255 4.83944\nQ 95.4951 5.00923, 95.5011 5.30638\nQ 95.5011 5.53681, 95.6163 5.67629\nQ 95.7376 5.81576, 95.9074 5.89459\nQ 96.0833 5.97343, 96.3743 6.06439\nQ 96.7625 6.18567, 96.9929 6.30695\nQ 97.2233 6.42823, 97.3871 6.67686\nQ 97.5568 6.91943, 97.5568 7.33785\nQ 97.5568 7.93213, 97.1566 8.25353\nQ 96.7625 8.56886, 96.1015 8.56886\nQ 95.7194 8.56886, 95.4283 8.48396\nQ 95.1433 8.40513, 94.8037 8.26566\nL 94.9675 7.78659\n' fill='#CCCC00'/>\n</svg>\n","37466":"<?xml version='1.0' encoding='iso-8859-1'?>\n<svg version='1.1' baseProfile='full'\n xmlns='http://www.w3.org/2000/svg'\n xmlns:rdkit='http://www.rdkit.org/xml'\n xmlns:xlink='http://www.w3.org/1999/xlink'\n xml:space='preserve'\nwidth='150px' height='34px' viewBox='0 0 150 34'>\n<!-- END OF HEADER -->\n<path class='bond-0' d='M 101.105,7.95883 L 95.3487,10.0025' style='fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-0' d='M 95.3487,10.0025 L 89.5924,12.0461' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-1' d='M 89.5924,12.0461 L 86.9047,26.6132' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-1' d='M 86.2758,13.6937 L 84.3945,23.8906' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-9' d='M 89.5924,12.0461 L 78.3208,2.43501' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-2' d='M 86.9047,26.6132 L 81.1484,28.6569' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-2' d='M 81.1484,28.6569 L 75.3921,30.7005' style='fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-3' d='M 70.5884,29.5593 L 66.1311,25.7587' style='fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-3' d='M 66.1311,25.7587 L 61.6738,21.958' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-3' d='M 71.1734,26.1648 L 68.0533,23.5044' style='fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-3' d='M 68.0533,23.5044 L 64.9332,20.8439' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-4' d='M 61.6738,21.958 L 55.5669,22.767' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-4' d='M 55.5669,22.767 L 49.46,23.576' style='fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-10' d='M 61.6738,21.958 L 64.3615,7.39094' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-5' d='M 45.584,20.9635 L 41.9674,13.3969' style='fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-6' d='M 42.9404,8.31514 L 47.1392,4.32424' style='fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-6' d='M 47.1392,4.32424 L 51.3379,0.333333' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-6' d='M 46.2411,9.26521 L 49.1802,6.47158' style='fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-6' d='M 49.1802,6.47158 L 52.1193,3.67794' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-7' d='M 51.3379,0.333333 L 64.3615,7.39094' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-8' d='M 64.3615,7.39094 L 78.3208,2.43501' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-8' d='M 67.4466,9.43941 L 77.2181,5.97026' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='atom-0' d='M 102.613 4.96621\nL 104.005 7.21621\nQ 104.143 7.43821, 104.365 7.84021\nQ 104.587 8.24221, 104.599 8.26621\nL 104.599 4.96621\nL 105.163 4.96621\nL 105.163 9.21421\nL 104.581 9.21421\nL 103.087 6.75421\nQ 102.913 6.46621, 102.727 6.13621\nQ 102.547 5.80621, 102.493 5.70421\nL 102.493 9.21421\nL 101.941 9.21421\nL 101.941 4.96621\nL 102.613 4.96621\n' fill='#0000FF'/>\n<path class='atom-0' d='M 105.673 4.96621\nL 106.249 4.96621\nL 106.249 6.77221\nL 108.421 6.77221\nL 108.421 4.96621\nL 108.997 4.96621\nL 108.997 9.21421\nL 108.421 9.21421\nL 108.421 7.25221\nL 106.249 7.25221\nL 106.249 9.21421\nL 105.673 9.21421\nL 105.673 4.96621\n' fill='#0000FF'/>\n<path class='atom-0' d='M 109.203 9.06517\nQ 109.306 8.79985, 109.551 8.65333\nQ 109.797 8.50285, 110.137 8.50285\nQ 110.561 8.50285, 110.798 8.73253\nQ 111.036 8.96221, 111.036 9.37009\nQ 111.036 9.78589, 110.727 10.174\nQ 110.422 10.562, 109.789 11.0214\nL 111.084 11.0214\nL 111.084 11.3382\nL 109.195 11.3382\nL 109.195 11.0729\nQ 109.717 10.7006, 110.026 10.4234\nQ 110.339 10.1462, 110.49 9.89677\nQ 110.64 9.64729, 110.64 9.38989\nQ 110.64 9.12061, 110.505 8.97013\nQ 110.371 8.81965, 110.137 8.81965\nQ 109.911 8.81965, 109.761 8.91073\nQ 109.61 9.00181, 109.504 9.20377\nL 109.203 9.06517\n' fill='#0000FF'/>\n<path class='atom-3' d='M 72.0064 29.4452\nL 73.3984 31.6952\nQ 73.5364 31.9172, 73.7584 32.3192\nQ 73.9804 32.7212, 73.9924 32.7452\nL 73.9924 29.4452\nL 74.5564 29.4452\nL 74.5564 33.6932\nL 73.9744 33.6932\nL 72.4804 31.2332\nQ 72.3064 30.9452, 72.1204 30.6152\nQ 71.9404 30.2852, 71.8864 30.1832\nL 71.8864 33.6932\nL 71.3344 33.6932\nL 71.3344 29.4452\nL 72.0064 29.4452\n' fill='#0000FF'/>\n<path class='atom-5' d='M 41.5562 21.7794\nL 42.1322 21.7794\nL 42.1322 23.5854\nL 44.3042 23.5854\nL 44.3042 21.7794\nL 44.8802 21.7794\nL 44.8802 26.0274\nL 44.3042 26.0274\nL 44.3042 24.0654\nL 42.1322 24.0654\nL 42.1322 26.0274\nL 41.5562 26.0274\nL 41.5562 21.7794\n' fill='#0000FF'/>\n<path class='atom-5' d='M 46.0502 21.7794\nL 47.4422 24.0294\nQ 47.5802 24.2514, 47.8022 24.6534\nQ 48.0242 25.0554, 48.0362 25.0794\nL 48.0362 21.7794\nL 48.6002 21.7794\nL 48.6002 26.0274\nL 48.0182 26.0274\nL 46.5242 23.5674\nQ 46.3502 23.2794, 46.1642 22.9494\nQ 45.9842 22.6194, 45.9302 22.5174\nL 45.9302 26.0274\nL 45.3782 26.0274\nL 45.3782 21.7794\nL 46.0502 21.7794\n' fill='#0000FF'/>\n<path class='atom-6' d='M 39.6622 8.41456\nL 41.0542 10.6646\nQ 41.1922 10.8866, 41.4142 11.2886\nQ 41.6362 11.6906, 41.6482 11.7146\nL 41.6482 8.41456\nL 42.2122 8.41456\nL 42.2122 12.6626\nL 41.6302 12.6626\nL 40.1362 10.2026\nQ 39.9622 9.91456, 39.7762 9.58456\nQ 39.5962 9.25456, 39.5422 9.15256\nL 39.5422 12.6626\nL 38.9902 12.6626\nL 38.9902 8.41456\nL 39.6622 8.41456\n' fill='#0000FF'/>\n</svg>\n","37467":"<?xml version='1.0' encoding='iso-8859-1'?>\n<svg version='1.1' baseProfile='full'\n xmlns='http://www.w3.org/2000/svg'\n xmlns:rdkit='http://www.rdkit.org/xml'\n xmlns:xlink='http://www.w3.org/1999/xlink'\n xml:space='preserve'\nwidth='150px' height='34px' viewBox='0 0 150 34'>\n<!-- END OF HEADER -->\n<path class='bond-0' d='M 64.4187,5.42017 L 65.2108,8.8933' style='fill:none;fill-rule:evenodd;stroke:#FF0000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-0' d='M 65.2108,8.8933 L 66.0028,12.3664' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-0' d='M 66.3656,4.97618 L 67.1577,8.44931' style='fill:none;fill-rule:evenodd;stroke:#FF0000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-0' d='M 67.1577,8.44931 L 67.9497,11.9224' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-1' d='M 66.9763,12.1444 L 64.3685,14.5632' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-1' d='M 64.3685,14.5632 L 61.7607,16.982' style='fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-10' d='M 66.9763,12.1444 L 76.5164,15.0891' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-2' d='M 60.2714,21.6322 L 61.0737,25.1503' style='fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-2' d='M 61.0737,25.1503 L 61.876,28.6685' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-3' d='M 61.876,28.6685 L 65.5568,29.8046' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-3' d='M 65.5568,29.8046 L 69.2375,30.9407' style='fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-3' d='M 63.5692,27.1013 L 66.1457,27.8965' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-3' d='M 66.1457,27.8965 L 68.7222,28.6918' style='fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-4' d='M 73.5208,29.661 L 76.1286,27.2422' style='fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-4' d='M 76.1286,27.2422 L 78.7364,24.8234' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-5' d='M 78.7364,24.8234 L 88.2765,27.7681' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-5' d='M 80.7563,23.3571 L 87.4344,25.4184' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-11' d='M 78.7364,24.8234 L 76.5164,15.0891' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-6' d='M 88.2765,27.7681 L 95.5967,20.9784' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-7' d='M 95.5967,20.9784 L 93.3768,11.2441' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-7' d='M 93.3169,19.9622 L 91.7629,13.1482' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-8' d='M 93.3768,11.2441 L 83.8367,8.2994' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-9' d='M 83.8367,8.2994 L 76.5164,15.0891' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-9' d='M 84.0966,10.7819 L 78.9724,15.5347' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='atom-0' d='M 62.8063 2.42209\nQ 62.8063 1.40209, 63.3103 0.832089\nQ 63.8143 0.262089, 64.7563 0.262089\nQ 65.6983 0.262089, 66.2023 0.832089\nQ 66.7063 1.40209, 66.7063 2.42209\nQ 66.7063 3.45409, 66.1963 4.04209\nQ 65.6863 4.62409, 64.7563 4.62409\nQ 63.8203 4.62409, 63.3103 4.04209\nQ 62.8063 3.46009, 62.8063 2.42209\nM 64.7563 4.14409\nQ 65.4043 4.14409, 65.7523 3.71209\nQ 66.1063 3.27409, 66.1063 2.42209\nQ 66.1063 1.58809, 65.7523 1.16809\nQ 65.4043 0.742089, 64.7563 0.742089\nQ 64.1083 0.742089, 63.7543 1.16209\nQ 63.4063 1.58209, 63.4063 2.42209\nQ 63.4063 3.28009, 63.7543 3.71209\nQ 64.1083 4.14409, 64.7563 4.14409\n' fill='#FF0000'/>\n<path class='atom-2' d='M 54.2231 16.8101\nL 54.7991 16.8101\nL 54.7991 18.6161\nL 56.9711 18.6161\nL 56.9711 16.8101\nL 57.5471 16.8101\nL 57.5471 21.0581\nL 56.9711 21.0581\nL 56.9711 19.0961\nL 54.7991 19.0961\nL 54.7991 21.0581\nL 54.2231 21.0581\nL 54.2231 16.8101\n' fill='#0000FF'/>\n<path class='atom-2' d='M 58.7171 16.8101\nL 60.1091 19.0601\nQ 60.2471 19.2821, 60.4691 19.6841\nQ 60.6911 20.0861, 60.7031 20.1101\nL 60.7031 16.8101\nL 61.2671 16.8101\nL 61.2671 21.0581\nL 60.6851 21.0581\nL 59.1911 18.5981\nQ 59.0171 18.3101, 58.8311 17.9801\nQ 58.6511 17.6501, 58.5971 17.5481\nL 58.5971 21.0581\nL 58.0451 21.0581\nL 58.0451 16.8101\nL 58.7171 16.8101\n' fill='#0000FF'/>\n<path class='atom-4' d='M 70.4771 29.4891\nL 71.8691 31.7391\nQ 72.0071 31.9611, 72.2291 32.3631\nQ 72.4511 32.7651, 72.4631 32.7891\nL 72.4631 29.4891\nL 73.0271 29.4891\nL 73.0271 33.7371\nL 72.4451 33.7371\nL 70.9511 31.2771\nQ 70.7771 30.9891, 70.5911 30.6591\nQ 70.4111 30.3291, 70.3571 30.2271\nL 70.3571 33.7371\nL 69.8051 33.7371\nL 69.8051 29.4891\nL 70.4771 29.4891\n' fill='#0000FF'/>\n</svg>\n","37468":"<?xml version='1.0' encoding='iso-8859-1'?>\n<svg version='1.1' baseProfile='full'\n xmlns='http://www.w3.org/2000/svg'\n xmlns:rdkit='http://www.rdkit.org/xml'\n xmlns:xlink='http://www.w3.org/1999/xlink'\n xml:space='preserve'\nwidth='150px' height='34px' viewBox='0 0 150 34'>\n<!-- END OF HEADER -->\n<path class='bond-0' d='M 49.6527,25.2837 L 54.9547,23.2369' style='fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-0' d='M 54.9547,23.2369 L 60.2567,21.1902' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-1' d='M 60.2567,21.1902 L 62.4101,7.42631' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-1' d='M 63.3325,19.5563 L 64.8398,9.92156' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-10' d='M 60.2567,21.1902 L 71.0999,29.937' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-2' d='M 62.4101,7.42631 L 67.7121,5.37956' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-2' d='M 67.7121,5.37956 L 73.0141,3.33282' style='fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-3' d='M 77.7273,4.28128 L 81.9885,7.71865' style='fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-3' d='M 81.9885,7.71865 L 86.2498,11.156' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-3' d='M 77.2563,7.48112 L 80.2392,9.88728' style='fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-3' d='M 80.2392,9.88728 L 83.222,12.2934' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-4' d='M 86.2498,11.156 L 84.0964,24.9199' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-11' d='M 86.2498,11.156 L 99.2463,6.13895' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-5' d='M 84.0964,24.9199 L 71.0999,29.937' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-5' d='M 81.1435,23.0731 L 72.0459,26.5851' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-6' d='M 84.0964,24.9199 L 94.9396,33.6667' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-7' d='M 94.9396,33.6667 L 100.072,31.6854' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-7' d='M 100.072,31.6854 L 105.205,29.704' style='fill:none;fill-rule:evenodd;stroke:#FF0000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-8' d='M 108.398,25.6945 L 109.244,20.2901' style='fill:none;fill-rule:evenodd;stroke:#FF0000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-8' d='M 109.244,20.2901 L 110.089,14.8857' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-9' d='M 110.089,14.8857 L 99.2463,6.13895' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='atom-0' d='M 39.7403 24.0832\nL 40.3163 24.0832\nL 40.3163 25.8892\nL 42.4883 25.8892\nL 42.4883 24.0832\nL 43.0643 24.0832\nL 43.0643 28.3312\nL 42.4883 28.3312\nL 42.4883 26.3692\nL 40.3163 26.3692\nL 40.3163 28.3312\nL 39.7403 28.3312\nL 39.7403 24.0832\n' fill='#0000FF'/>\n<path class='atom-0' d='M 43.2702 28.1822\nQ 43.3731 27.9169, 43.6187 27.7704\nQ 43.8642 27.6199, 44.2047 27.6199\nQ 44.6285 27.6199, 44.8661 27.8496\nQ 45.1037 28.0792, 45.1037 28.4871\nQ 45.1037 28.9029, 44.7948 29.291\nQ 44.4899 29.6791, 43.8563 30.1384\nL 45.1512 30.1384\nL 45.1512 30.4552\nL 43.2623 30.4552\nL 43.2623 30.1899\nQ 43.785 29.8177, 44.0939 29.5405\nQ 44.4067 29.2633, 44.5572 29.0138\nQ 44.7077 28.7643, 44.7077 28.5069\nQ 44.7077 28.2376, 44.573 28.0872\nQ 44.4384 27.9367, 44.2047 27.9367\nQ 43.979 27.9367, 43.8285 28.0278\nQ 43.6781 28.1188, 43.5711 28.3208\nL 43.2702 28.1822\n' fill='#0000FF'/>\n<path class='atom-0' d='M 46.3212 24.0832\nL 47.7132 26.3332\nQ 47.8512 26.5552, 48.0732 26.9572\nQ 48.2952 27.3592, 48.3072 27.3832\nL 48.3072 24.0832\nL 48.8712 24.0832\nL 48.8712 28.3312\nL 48.2892 28.3312\nL 46.7952 25.8712\nQ 46.6212 25.5832, 46.4352 25.2532\nQ 46.2552 24.9232, 46.2012 24.8212\nL 46.2012 28.3312\nL 45.6492 28.3312\nL 45.6492 24.0832\nL 46.3212 24.0832\n' fill='#0000FF'/>\n<path class='atom-3' d='M 74.4676 0.285237\nL 75.8596 2.53524\nQ 75.9976 2.75724, 76.2196 3.15924\nQ 76.4416 3.56124, 76.4536 3.58524\nL 76.4536 0.285237\nL 77.0176 0.285237\nL 77.0176 4.53324\nL 76.4356 4.53324\nL 74.9416 2.07324\nQ 74.7676 1.78524, 74.5816 1.45524\nQ 74.4016 1.12524, 74.3476 1.02324\nL 74.3476 4.53324\nL 73.7956 4.53324\nL 73.7956 0.285237\nL 74.4676 0.285237\n' fill='#0000FF'/>\n<path class='atom-8' d='M 105.986 28.6616\nQ 105.986 27.6416, 106.49 27.0716\nQ 106.994 26.5016, 107.936 26.5016\nQ 108.878 26.5016, 109.382 27.0716\nQ 109.886 27.6416, 109.886 28.6616\nQ 109.886 29.6936, 109.376 30.2816\nQ 108.866 30.8636, 107.936 30.8636\nQ 107 30.8636, 106.49 30.2816\nQ 105.986 29.6996, 105.986 28.6616\nM 107.936 30.3836\nQ 108.584 30.3836, 108.932 29.9516\nQ 109.286 29.5136, 109.286 28.6616\nQ 109.286 27.8276, 108.932 27.4076\nQ 108.584 26.9816, 107.936 26.9816\nQ 107.288 26.9816, 106.934 27.4016\nQ 106.586 27.8216, 106.586 28.6616\nQ 106.586 29.5196, 106.934 29.9516\nQ 107.288 30.3836, 107.936 30.3836\n' fill='#FF0000'/>\n</svg>\n","37469":"<?xml version='1.0' encoding='iso-8859-1'?>\n<svg version='1.1' baseProfile='full'\n xmlns='http://www.w3.org/2000/svg'\n xmlns:rdkit='http://www.rdkit.org/xml'\n xmlns:xlink='http://www.w3.org/1999/xlink'\n xml:space='preserve'\nwidth='150px' height='34px' viewBox='0 0 150 34'>\n<!-- END OF HEADER -->\n<path class='bond-0' d='M 31.1619,6.31503 L 37.5565,5.69171' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-0' d='M 37.5565,5.69171 L 43.951,5.06839' style='fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-1' d='M 48.6384,7.80553 L 52.0537,12.5817' style='fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-1' d='M 52.0537,12.5817 L 55.469,17.3579' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-2' d='M 54.0656,16.7203 L 51.573,22.2069' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-2' d='M 51.573,22.2069 L 49.0804,27.6936' style='fill:none;fill-rule:evenodd;stroke:#FF0000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-2' d='M 56.8723,17.9954 L 54.3797,23.4821' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-2' d='M 54.3797,23.4821 L 51.8871,28.9687' style='fill:none;fill-rule:evenodd;stroke:#FF0000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-3' d='M 55.469,17.3579 L 70.8103,15.8624' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-4' d='M 70.8103,15.8624 L 77.1859,1.82876' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-10' d='M 70.8103,15.8624 L 79.776,28.4007' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-10' d='M 74.6628,15.95 L 80.9388,24.7268' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-5' d='M 77.1859,1.82876 L 92.5272,0.333333' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-5' d='M 79.7862,4.67271 L 90.5251,3.62591' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-6' d='M 92.5272,0.333333 L 101.493,12.8716' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-7' d='M 101.642,14.4057 L 107.863,13.7994' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-7' d='M 107.863,13.7994 L 114.083,13.193' style='fill:none;fill-rule:evenodd;stroke:#FF0000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-7' d='M 101.343,11.3375 L 107.564,10.7311' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-7' d='M 107.564,10.7311 L 113.784,10.1248' style='fill:none;fill-rule:evenodd;stroke:#FF0000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-8' d='M 101.493,12.8716 L 98.9947,18.3706' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-8' d='M 98.9947,18.3706 L 96.4965,23.8695' style='fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-9' d='M 92.5652,27.1541 L 86.1706,27.7774' style='fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-9' d='M 86.1706,27.7774 L 79.776,28.4007' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='atom-1' d='M 45.5383 2.63698\nL 46.9687 4.94908\nQ 47.1105 5.17721, 47.3387 5.59031\nQ 47.5668 6.0034, 47.5791 6.02807\nL 47.5791 2.63698\nL 48.1587 2.63698\nL 48.1587 7.00223\nL 47.5606 7.00223\nL 46.0254 4.47433\nQ 45.8466 4.17838, 45.6555 3.83927\nQ 45.4705 3.50017, 45.415 3.39535\nL 45.415 7.00223\nL 44.8478 7.00223\nL 44.8478 2.63698\nL 45.5383 2.63698\n' fill='#0000FF'/>\n<path class='atom-1' d='M 48.6828 2.63698\nL 49.2747 2.63698\nL 49.2747 4.49283\nL 51.5066 4.49283\nL 51.5066 2.63698\nL 52.0985 2.63698\nL 52.0985 7.00223\nL 51.5066 7.00223\nL 51.5066 4.98608\nL 49.2747 4.98608\nL 49.2747 7.00223\nL 48.6828 7.00223\nL 48.6828 2.63698\n' fill='#0000FF'/>\n<path class='atom-3' d='M 47.0896 31.4039\nQ 47.0896 30.3557, 47.6075 29.77\nQ 48.1254 29.1843, 49.0934 29.1843\nQ 50.0614 29.1843, 50.5793 29.77\nQ 51.0972 30.3557, 51.0972 31.4039\nQ 51.0972 32.4644, 50.5731 33.0686\nQ 50.0491 33.6667, 49.0934 33.6667\nQ 48.1316 33.6667, 47.6075 33.0686\nQ 47.0896 32.4705, 47.0896 31.4039\nM 49.0934 33.1734\nQ 49.7593 33.1734, 50.1169 32.7295\nQ 50.4807 32.2794, 50.4807 31.4039\nQ 50.4807 30.5469, 50.1169 30.1153\nQ 49.7593 29.6775, 49.0934 29.6775\nQ 48.4275 29.6775, 48.0637 30.1091\nQ 47.7061 30.5407, 47.7061 31.4039\nQ 47.7061 32.2856, 48.0637 32.7295\nQ 48.4275 33.1734, 49.0934 33.1734\n' fill='#FF0000'/>\n<path class='atom-8' d='M 114.83 11.3885\nQ 114.83 10.3403, 115.348 9.75461\nQ 115.866 9.16888, 116.834 9.16888\nQ 117.802 9.16888, 118.32 9.75461\nQ 118.838 10.3403, 118.838 11.3885\nQ 118.838 12.449, 118.314 13.0532\nQ 117.79 13.6513, 116.834 13.6513\nQ 115.872 13.6513, 115.348 13.0532\nQ 114.83 12.4552, 114.83 11.3885\nM 116.834 13.158\nQ 117.5 13.158, 117.858 12.7141\nQ 118.222 12.264, 118.222 11.3885\nQ 118.222 10.5315, 117.858 10.0999\nQ 117.5 9.66213, 116.834 9.66213\nQ 116.168 9.66213, 115.805 10.0937\nQ 115.447 10.5253, 115.447 11.3885\nQ 115.447 12.2702, 115.805 12.7141\nQ 116.168 13.158, 116.834 13.158\n' fill='#FF0000'/>\n<path class='atom-9' d='M 94.1524 24.7227\nL 95.5829 27.0348\nQ 95.7247 27.2629, 95.9528 27.676\nQ 96.1809 28.0891, 96.1933 28.1137\nL 96.1933 24.7227\nL 96.7728 24.7227\nL 96.7728 29.0879\nL 96.1748 29.0879\nL 94.6395 26.56\nQ 94.4607 26.2641, 94.2696 25.9249\nQ 94.0846 25.5858, 94.0291 25.481\nL 94.0291 29.0879\nL 93.4619 29.0879\nL 93.4619 24.7227\nL 94.1524 24.7227\n' fill='#0000FF'/>\n<path class='atom-9' d='M 97.2969 24.7227\nL 97.8888 24.7227\nL 97.8888 26.5785\nL 100.121 26.5785\nL 100.121 24.7227\nL 100.713 24.7227\nL 100.713 29.0879\nL 100.121 29.0879\nL 100.121 27.0718\nL 97.8888 27.0718\nL 97.8888 29.0879\nL 97.2969 29.0879\nL 97.2969 24.7227\n' fill='#0000FF'/>\n</svg>\n","37470":"<?xml version='1.0' encoding='iso-8859-1'?>\n<svg version='1.1' baseProfile='full'\n xmlns='http://www.w3.org/2000/svg'\n xmlns:rdkit='http://www.rdkit.org/xml'\n xmlns:xlink='http://www.w3.org/1999/xlink'\n xml:space='preserve'\nwidth='150px' height='34px' viewBox='0 0 150 34'>\n<!-- END OF HEADER -->\n<path class='bond-0' d='M 55.9938,15.8987 L 63.5072,14.3418' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-1' d='M 64.2357,14.5827 L 65.0021,12.2644' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-1' d='M 65.0021,12.2644 L 65.7685,9.94613' style='fill:none;fill-rule:evenodd;stroke:#FF0000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-1' d='M 62.7787,14.101 L 63.5451,11.7827' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-1' d='M 63.5451,11.7827 L 64.3115,9.46444' style='fill:none;fill-rule:evenodd;stroke:#FF0000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-2' d='M 63.5072,14.3418 L 65.0732,16.0991' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-2' d='M 65.0732,16.0991 L 66.6392,17.8563' style='fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-3' d='M 70.6654,19.6448 L 73.3955,19.0791' style='fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-3' d='M 73.3955,19.0791 L 76.1256,18.5134' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-4' d='M 76.1256,18.5134 L 78.534,11.2281' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-4' d='M 77.9439,17.9023 L 79.6298,12.8026' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-11' d='M 76.1256,18.5134 L 81.2306,24.2417' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-5' d='M 78.534,11.2281 L 86.0474,9.67128' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-6' d='M 86.0474,9.67128 L 86.8287,7.308' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-6' d='M 86.8287,7.308 L 87.61,4.94472' style='fill:none;fill-rule:evenodd;stroke:#7F4C19;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-7' d='M 86.0474,9.67128 L 91.1524,15.3997' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-7' d='M 85.6675,11.5515 L 89.241,15.5614' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-8' d='M 91.1524,15.3997 L 90.3711,17.7629' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-8' d='M 90.3711,17.7629 L 89.5898,20.1262' style='fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-9' d='M 86.6907,23.1103 L 83.9606,23.676' style='fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-9' d='M 83.9606,23.676 L 81.2306,24.2417' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-10' d='M 80.502,24.0009 L 79.7247,26.3522' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-10' d='M 79.7247,26.3522 L 78.9474,28.7035' style='fill:none;fill-rule:evenodd;stroke:#FF0000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-10' d='M 81.9591,24.4826 L 81.1818,26.8339' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-10' d='M 81.1818,26.8339 L 80.4045,29.1851' style='fill:none;fill-rule:evenodd;stroke:#FF0000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='atom-2' d='M 63.9656 7.06862\nQ 63.9656 6.04862, 64.4696 5.47862\nQ 64.9736 4.90862, 65.9156 4.90862\nQ 66.8576 4.90862, 67.3616 5.47862\nQ 67.8656 6.04862, 67.8656 7.06862\nQ 67.8656 8.10062, 67.3556 8.68862\nQ 66.8456 9.27062, 65.9156 9.27062\nQ 64.9796 9.27062, 64.4696 8.68862\nQ 63.9656 8.10662, 63.9656 7.06862\nM 65.9156 8.79062\nQ 66.5636 8.79062, 66.9116 8.35862\nQ 67.2656 7.92062, 67.2656 7.06862\nQ 67.2656 6.23462, 66.9116 5.81462\nQ 66.5636 5.38862, 65.9156 5.38862\nQ 65.2676 5.38862, 64.9136 5.80862\nQ 64.5656 6.22862, 64.5656 7.06862\nQ 64.5656 7.92662, 64.9136 8.35862\nQ 65.2676 8.79062, 65.9156 8.79062\n' fill='#FF0000'/>\n<path class='atom-3' d='M 67.6732 17.9462\nL 69.0652 20.1962\nQ 69.2032 20.4182, 69.4252 20.8202\nQ 69.6472 21.2222, 69.6592 21.2462\nL 69.6592 17.9462\nL 70.2232 17.9462\nL 70.2232 22.1942\nL 69.6412 22.1942\nL 68.1472 19.7342\nQ 67.9732 19.4462, 67.7872 19.1162\nQ 67.6072 18.7862, 67.5532 18.6842\nL 67.5532 22.1942\nL 67.0012 22.1942\nL 67.0012 17.9462\nL 67.6732 17.9462\n' fill='#0000FF'/>\n<path class='atom-3' d='M 66.9502 22.619\nL 67.5262 22.619\nL 67.5262 24.425\nL 69.6982 24.425\nL 69.6982 22.619\nL 70.2742 22.619\nL 70.2742 26.867\nL 69.6982 26.867\nL 69.6982 24.905\nL 67.5262 24.905\nL 67.5262 26.867\nL 66.9502 26.867\nL 66.9502 22.619\n' fill='#0000FF'/>\n<path class='atom-7' d='M 89.0768 2.27805\nQ 89.4848 2.39205, 89.6888 2.64405\nQ 89.8988 2.89005, 89.8988 3.25605\nQ 89.8988 3.84405, 89.5208 4.18005\nQ 89.1488 4.51005, 88.4408 4.51005\nL 87.0128 4.51005\nL 87.0128 0.262052\nL 88.2668 0.262052\nQ 88.9928 0.262052, 89.3588 0.556052\nQ 89.7248 0.850052, 89.7248 1.39005\nQ 89.7248 2.03205, 89.0768 2.27805\nM 87.5828 0.742052\nL 87.5828 2.07405\nL 88.2668 2.07405\nQ 88.6868 2.07405, 88.9028 1.90605\nQ 89.1248 1.73205, 89.1248 1.39005\nQ 89.1248 0.742052, 88.2668 0.742052\nL 87.5828 0.742052\nM 88.4408 4.03005\nQ 88.8548 4.03005, 89.0768 3.83205\nQ 89.2988 3.63405, 89.2988 3.25605\nQ 89.2988 2.90805, 89.0528 2.73405\nQ 88.8128 2.55405, 88.3508 2.55405\nL 87.5828 2.55405\nL 87.5828 4.03005\nL 88.4408 4.03005\n' fill='#7F4C19'/>\n<path class='atom-7' d='M 90.8648 1.42605\nL 90.9308 1.85205\nQ 91.2548 1.37205, 91.7828 1.37205\nQ 91.9508 1.37205, 92.1788 1.43205\nL 92.0888 1.93605\nQ 91.8308 1.87605, 91.6868 1.87605\nQ 91.4348 1.87605, 91.2668 1.97805\nQ 91.1048 2.07405, 90.9728 2.30805\nL 90.9728 4.51005\nL 90.4088 4.51005\nL 90.4088 1.42605\nL 90.8648 1.42605\n' fill='#7F4C19'/>\n<path class='atom-9' d='M 87.805 20.5609\nL 89.197 22.8109\nQ 89.335 23.0329, 89.557 23.4349\nQ 89.779 23.8369, 89.791 23.8609\nL 89.791 20.5609\nL 90.355 20.5609\nL 90.355 24.8089\nL 89.773 24.8089\nL 88.279 22.3489\nQ 88.105 22.0609, 87.919 21.7309\nQ 87.739 21.4009, 87.685 21.2989\nL 87.685 24.8089\nL 87.133 24.8089\nL 87.133 20.5609\nL 87.805 20.5609\n' fill='#0000FF'/>\n<path class='atom-9' d='M 90.865 20.5609\nL 91.441 20.5609\nL 91.441 22.3669\nL 93.613 22.3669\nL 93.613 20.5609\nL 94.189 20.5609\nL 94.189 24.8089\nL 93.613 24.8089\nL 93.613 22.8469\nL 91.441 22.8469\nL 91.441 24.8089\nL 90.865 24.8089\nL 90.865 20.5609\n' fill='#0000FF'/>\n<path class='atom-11' d='M 76.8721 31.539\nQ 76.8721 30.519, 77.3761 29.949\nQ 77.8801 29.379, 78.8221 29.379\nQ 79.7641 29.379, 80.2681 29.949\nQ 80.7721 30.519, 80.7721 31.539\nQ 80.7721 32.571, 80.2621 33.159\nQ 79.7521 33.741, 78.8221 33.741\nQ 77.8861 33.741, 77.3761 33.159\nQ 76.8721 32.577, 76.8721 31.539\nM 78.8221 33.261\nQ 79.4701 33.261, 79.8181 32.829\nQ 80.1721 32.391, 80.1721 31.539\nQ 80.1721 30.705, 79.8181 30.285\nQ 79.4701 29.859, 78.8221 29.859\nQ 78.1741 29.859, 77.8201 30.279\nQ 77.4721 30.699, 77.4721 31.539\nQ 77.4721 32.397, 77.8201 32.829\nQ 78.1741 33.261, 78.8221 33.261\n' fill='#FF0000'/>\n</svg>\n","37471":"<?xml version='1.0' encoding='iso-8859-1'?>\n<svg version='1.1' baseProfile='full'\n xmlns='http://www.w3.org/2000/svg'\n xmlns:rdkit='http://www.rdkit.org/xml'\n xmlns:xlink='http://www.w3.org/1999/xlink'\n xml:space='preserve'\nwidth='150px' height='34px' viewBox='0 0 150 34'>\n<!-- END OF HEADER -->\n<path class='bond-0' d='M 45.5361,5.58068 L 47.1261,10.1705' style='fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-0' d='M 47.1261,10.1705 L 48.7161,14.7604' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-1' d='M 48.7161,14.7604 L 61.2103,17.1649' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-2' d='M 61.2103,17.1649 L 65.375,29.1874' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-2' d='M 64.2395,18.1353 L 67.1548,26.5511' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-11' d='M 61.2103,17.1649 L 69.5397,7.54686' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-3' d='M 65.375,29.1874 L 70.4493,30.164' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-3' d='M 70.4493,30.164 L 75.5236,31.1405' style='fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-4' d='M 80.0759,29.0438 L 83.1373,25.5089' style='fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-4' d='M 83.1373,25.5089 L 86.1986,21.9739' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-4' d='M 79.0707,26.3174 L 81.2137,23.843' style='fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-4' d='M 81.2137,23.843 L 83.3566,21.3685' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-5' d='M 86.1986,21.9739 L 98.6928,24.3784' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-12' d='M 86.1986,21.9739 L 82.0339,9.95136' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-6' d='M 98.6928,24.3784 L 107.022,14.7604' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-6' d='M 98.0186,21.2698 L 103.849,14.5372' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-7' d='M 107.022,14.7604 L 102.858,2.73784' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-8' d='M 102.858,2.73784 L 90.3634,0.333333' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-8' d='M 100.503,4.876 L 91.7566,3.19285' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-9' d='M 90.3634,0.333333 L 82.0339,9.95136' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-10' d='M 82.0339,9.95136 L 69.5397,7.54686' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-10' d='M 79.6789,12.0895 L 70.9329,10.4064' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='atom-0' d='M 43.6123 0.613841\nL 45.0043 2.86384\nQ 45.1423 3.08584, 45.3643 3.48784\nQ 45.5863 3.88984, 45.5983 3.91384\nL 45.5983 0.613841\nL 46.1623 0.613841\nL 46.1623 4.86184\nL 45.5803 4.86184\nL 44.0863 2.40184\nQ 43.9123 2.11384, 43.7263 1.78384\nQ 43.5463 1.45384, 43.4923 1.35184\nL 43.4923 4.86184\nL 42.9403 4.86184\nL 42.9403 0.613841\nL 43.6123 0.613841\n' fill='#0000FF'/>\n<path class='atom-0' d='M 46.6723 0.613841\nL 47.2483 0.613841\nL 47.2483 2.41984\nL 49.4203 2.41984\nL 49.4203 0.613841\nL 49.9963 0.613841\nL 49.9963 4.86184\nL 49.4203 4.86184\nL 49.4203 2.89984\nL 47.2483 2.89984\nL 47.2483 4.86184\nL 46.6723 4.86184\nL 46.6723 0.613841\n' fill='#0000FF'/>\n<path class='atom-0' d='M 50.2023 4.7128\nQ 50.3052 4.44748, 50.5507 4.30096\nQ 50.7963 4.15048, 51.1368 4.15048\nQ 51.5605 4.15048, 51.7981 4.38016\nQ 52.0357 4.60984, 52.0357 5.01772\nQ 52.0357 5.43352, 51.7269 5.8216\nQ 51.4219 6.20968, 50.7883 6.66904\nL 52.0833 6.66904\nL 52.0833 6.98584\nL 50.1943 6.98584\nL 50.1943 6.72052\nQ 50.7171 6.34828, 51.0259 6.07108\nQ 51.3388 5.79388, 51.4893 5.5444\nQ 51.6397 5.29492, 51.6397 5.03752\nQ 51.6397 4.76824, 51.5051 4.61776\nQ 51.3705 4.46728, 51.1368 4.46728\nQ 50.9111 4.46728, 50.7606 4.55836\nQ 50.6101 4.64944, 50.5032 4.8514\nL 50.2023 4.7128\n' fill='#0000FF'/>\n<path class='atom-4' d='M 76.9302 29.4679\nL 78.3222 31.7179\nQ 78.4602 31.9399, 78.6822 32.3419\nQ 78.9042 32.7439, 78.9162 32.7679\nL 78.9162 29.4679\nL 79.4802 29.4679\nL 79.4802 33.7159\nL 78.8982 33.7159\nL 77.4042 31.2559\nQ 77.2302 30.9679, 77.0442 30.6379\nQ 76.8642 30.3079, 76.8102 30.2059\nL 76.8102 33.7159\nL 76.2582 33.7159\nL 76.2582 29.4679\nL 76.9302 29.4679\n' fill='#0000FF'/>\n</svg>\n","37473":"<?xml version='1.0' encoding='iso-8859-1'?>\n<svg version='1.1' baseProfile='full'\n xmlns='http://www.w3.org/2000/svg'\n xmlns:rdkit='http://www.rdkit.org/xml'\n xmlns:xlink='http://www.w3.org/1999/xlink'\n xml:space='preserve'\nwidth='150px' height='34px' viewBox='0 0 150 34'>\n<!-- END OF HEADER -->\n<path class='bond-0' d='M 49.5539,13.8358 L 52.6553,16.9373' style='fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-0' d='M 52.6553,16.9373 L 55.7568,20.0388' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-1' d='M 54.6107,19.7317 L 53.4539,24.049' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-1' d='M 53.4539,24.049 L 52.297,28.3663' style='fill:none;fill-rule:evenodd;stroke:#FF0000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-1' d='M 56.9029,20.3459 L 55.7461,24.6632' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-1' d='M 55.7461,24.6632 L 54.5893,28.9805' style='fill:none;fill-rule:evenodd;stroke:#FF0000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-2' d='M 55.7568,20.0388 L 67.2181,16.9677' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-3' d='M 67.2181,16.9677 L 75.6084,25.358' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-3' d='M 70.1547,16.5482 L 76.0279,22.4214' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-12' d='M 67.2181,16.9677 L 70.2892,5.50639' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-4' d='M 75.6084,25.358 L 87.0697,22.2869' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-5' d='M 87.0697,22.2869 L 95.46,30.6772' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-5' d='M 90.0063,21.8674 L 95.8795,27.7406' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-13' d='M 87.0697,22.2869 L 90.1408,10.8256' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-6' d='M 95.46,30.6772 L 106.921,27.6061' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-7' d='M 106.921,27.6061 L 109.992,16.1448' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-7' d='M 105.09,25.2727 L 107.239,17.2498' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-8' d='M 109.992,16.1448 L 101.602,7.75455' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-9' d='M 101.602,7.75455 L 90.1408,10.8256' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-9' d='M 100.497,10.5075 L 92.4742,12.6572' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-10' d='M 90.1408,10.8256 L 87.2088,7.89363' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-10' d='M 87.2088,7.89363 L 84.2768,4.96165' style='fill:none;fill-rule:evenodd;stroke:#FF0000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-11' d='M 79.1218,3.13969 L 74.7055,4.32304' style='fill:none;fill-rule:evenodd;stroke:#FF0000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-11' d='M 74.7055,4.32304 L 70.2892,5.50639' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='atom-0' d='M 39.8466 9.52449\nL 40.4226 9.52449\nL 40.4226 11.3305\nL 42.5946 11.3305\nL 42.5946 9.52449\nL 43.1706 9.52449\nL 43.1706 13.7725\nL 42.5946 13.7725\nL 42.5946 11.8105\nL 40.4226 11.8105\nL 40.4226 13.7725\nL 39.8466 13.7725\nL 39.8466 9.52449\n' fill='#0000FF'/>\n<path class='atom-0' d='M 43.3765 13.6235\nQ 43.4795 13.3581, 43.725 13.2116\nQ 43.9705 13.0611, 44.3111 13.0611\nQ 44.7348 13.0611, 44.9724 13.2908\nQ 45.21 13.5205, 45.21 13.9284\nQ 45.21 14.3442, 44.9011 14.7323\nQ 44.5962 15.1203, 43.9626 15.5797\nL 45.2575 15.5797\nL 45.2575 15.8965\nL 43.3686 15.8965\nL 43.3686 15.6312\nQ 43.8913 15.2589, 44.2002 14.9817\nQ 44.5131 14.7045, 44.6635 14.4551\nQ 44.814 14.2056, 44.814 13.9482\nQ 44.814 13.6789, 44.6794 13.5284\nQ 44.5447 13.3779, 44.3111 13.3779\nQ 44.0854 13.3779, 43.9349 13.469\nQ 43.7844 13.5601, 43.6775 13.7621\nL 43.3765 13.6235\n' fill='#0000FF'/>\n<path class='atom-0' d='M 46.4275 9.52449\nL 47.8195 11.7745\nQ 47.9575 11.9965, 48.1795 12.3985\nQ 48.4015 12.8005, 48.4135 12.8245\nL 48.4135 9.52449\nL 48.9775 9.52449\nL 48.9775 13.7725\nL 48.3955 13.7725\nL 46.9015 11.3125\nQ 46.7275 11.0245, 46.5415 10.6945\nQ 46.3615 10.3645, 46.3075 10.2625\nL 46.3075 13.7725\nL 45.7555 13.7725\nL 45.7555 9.52449\nL 46.4275 9.52449\n' fill='#0000FF'/>\n<path class='atom-2' d='M 50.7358 31.5121\nQ 50.7358 30.4921, 51.2398 29.9221\nQ 51.7438 29.3521, 52.6858 29.3521\nQ 53.6278 29.3521, 54.1318 29.9221\nQ 54.6358 30.4921, 54.6358 31.5121\nQ 54.6358 32.5441, 54.1258 33.1321\nQ 53.6158 33.7141, 52.6858 33.7141\nQ 51.7498 33.7141, 51.2398 33.1321\nQ 50.7358 32.5501, 50.7358 31.5121\nM 52.6858 33.2341\nQ 53.3338 33.2341, 53.6818 32.8021\nQ 54.0358 32.3641, 54.0358 31.5121\nQ 54.0358 30.6781, 53.6818 30.2581\nQ 53.3338 29.8321, 52.6858 29.8321\nQ 52.0378 29.8321, 51.6838 30.2521\nQ 51.3358 30.6721, 51.3358 31.5121\nQ 51.3358 32.3701, 51.6838 32.8021\nQ 52.0378 33.2341, 52.6858 33.2341\n' fill='#FF0000'/>\n<path class='atom-11' d='M 79.8005 2.44734\nQ 79.8005 1.42734, 80.3045 0.857338\nQ 80.8085 0.287338, 81.7505 0.287338\nQ 82.6925 0.287338, 83.1965 0.857338\nQ 83.7005 1.42734, 83.7005 2.44734\nQ 83.7005 3.47934, 83.1905 4.06734\nQ 82.6805 4.64934, 81.7505 4.64934\nQ 80.8145 4.64934, 80.3045 4.06734\nQ 79.8005 3.48534, 79.8005 2.44734\nM 81.7505 4.16934\nQ 82.3985 4.16934, 82.7465 3.73734\nQ 83.1005 3.29934, 83.1005 2.44734\nQ 83.1005 1.61334, 82.7465 1.19334\nQ 82.3985 0.767338, 81.7505 0.767338\nQ 81.1025 0.767338, 80.7485 1.18734\nQ 80.4005 1.60734, 80.4005 2.44734\nQ 80.4005 3.30534, 80.7485 3.73734\nQ 81.1025 4.16934, 81.7505 4.16934\n' fill='#FF0000'/>\n</svg>\n","37474":"<?xml version='1.0' encoding='iso-8859-1'?>\n<svg version='1.1' baseProfile='full'\n xmlns='http://www.w3.org/2000/svg'\n xmlns:rdkit='http://www.rdkit.org/xml'\n xmlns:xlink='http://www.w3.org/1999/xlink'\n xml:space='preserve'\nwidth='150px' height='34px' viewBox='0 0 150 34'>\n<!-- END OF HEADER -->\n<path class='bond-0' d='M 38.386,11.4093 L 42.5446,9.6588' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-0' d='M 42.5446,9.6588 L 46.7032,7.9083' style='fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-1' d='M 51.1552,8.63106 L 54.6219,11.2598' style='fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-1' d='M 54.6219,11.2598 L 58.0887,13.8885' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-2' d='M 56.9511,13.7454 L 56.4125,18.0261' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-2' d='M 56.4125,18.0261 L 55.8738,22.3069' style='fill:none;fill-rule:evenodd;stroke:#FF0000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-2' d='M 59.2262,14.0316 L 58.6875,18.3124' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-2' d='M 58.6875,18.3124 L 58.1489,22.5931' style='fill:none;fill-rule:evenodd;stroke:#FF0000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-3' d='M 58.0887,13.8885 L 68.6556,9.44044' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-4' d='M 68.6556,9.44044 L 72.1224,12.0692' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-4' d='M 72.1224,12.0692 L 75.5891,14.6979' style='fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-5' d='M 77.7341,19.1604 L 77.6455,23.4954' style='fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-5' d='M 77.6455,23.4954 L 77.5568,27.8303' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-13' d='M 80.0547,15.6831 L 84.41,14.3658' style='fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-13' d='M 84.41,14.3658 L 88.7653,13.0486' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-6' d='M 77.5568,27.8303 L 81.842,29.3202' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-6' d='M 81.842,29.3202 L 86.1273,30.8102' style='fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-6' d='M 79.5954,26.1115 L 82.5951,27.1544' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-6' d='M 82.5951,27.1544 L 85.5948,28.1974' style='fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-7' d='M 90.4447,28.8803 L 92.8789,25.6701' style='fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-7' d='M 92.8789,25.6701 L 95.3132,22.4598' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-8' d='M 95.3132,22.4598 L 106.737,21.4948' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-8' d='M 96.8338,20.0302 L 104.831,19.3547' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-14' d='M 95.3132,22.4598 L 88.7653,13.0486' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-9' d='M 106.737,21.4948 L 111.614,11.1186' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-10' d='M 111.614,11.1186 L 105.066,1.70733' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-10' d='M 108.75,11.0165 L 104.166,4.4286' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-11' d='M 105.066,1.70733 L 93.6418,2.67231' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-12' d='M 93.6418,2.67231 L 88.7653,13.0486' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-12' d='M 94.9856,5.20404 L 91.572,12.4674' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='atom-1' d='M 48.014 4.83725\nL 49.406 7.08725\nQ 49.544 7.30925, 49.766 7.71125\nQ 49.988 8.11325, 50 8.13725\nL 50 4.83725\nL 50.564 4.83725\nL 50.564 9.08525\nL 49.982 9.08525\nL 48.488 6.62525\nQ 48.314 6.33725, 48.128 6.00725\nQ 47.948 5.67725, 47.894 5.57525\nL 47.894 9.08525\nL 47.342 9.08525\nL 47.342 4.83725\nL 48.014 4.83725\n' fill='#0000FF'/>\n<path class='atom-1' d='M 47.291 0.164447\nL 47.867 0.164447\nL 47.867 1.97045\nL 50.039 1.97045\nL 50.039 0.164447\nL 50.615 0.164447\nL 50.615 4.41245\nL 50.039 4.41245\nL 50.039 2.45045\nL 47.867 2.45045\nL 47.867 4.41245\nL 47.291 4.41245\nL 47.291 0.164447\n' fill='#0000FF'/>\n<path class='atom-3' d='M 54.7073 25.2758\nQ 54.7073 24.2558, 55.2113 23.6858\nQ 55.7153 23.1158, 56.6573 23.1158\nQ 57.5993 23.1158, 58.1033 23.6858\nQ 58.6073 24.2558, 58.6073 25.2758\nQ 58.6073 26.3078, 58.0973 26.8958\nQ 57.5873 27.4778, 56.6573 27.4778\nQ 55.7213 27.4778, 55.2113 26.8958\nQ 54.7073 26.3138, 54.7073 25.2758\nM 56.6573 26.9978\nQ 57.3053 26.9978, 57.6533 26.5658\nQ 58.0073 26.1278, 58.0073 25.2758\nQ 58.0073 24.4418, 57.6533 24.0218\nQ 57.3053 23.5958, 56.6573 23.5958\nQ 56.0093 23.5958, 55.6553 24.0158\nQ 55.3073 24.4358, 55.3073 25.2758\nQ 55.3073 26.1338, 55.6553 26.5658\nQ 56.0093 26.9978, 56.6573 26.9978\n' fill='#FF0000'/>\n<path class='atom-5' d='M 76.8523 14.2437\nL 78.2443 16.4937\nQ 78.3823 16.7157, 78.6043 17.1177\nQ 78.8263 17.5197, 78.8383 17.5437\nL 78.8383 14.2437\nL 79.4023 14.2437\nL 79.4023 18.4917\nL 78.8203 18.4917\nL 77.3263 16.0317\nQ 77.1523 15.7437, 76.9663 15.4137\nQ 76.7863 15.0837, 76.7323 14.9817\nL 76.7323 18.4917\nL 76.1803 18.4917\nL 76.1803 14.2437\nL 76.8523 14.2437\n' fill='#0000FF'/>\n<path class='atom-7' d='M 87.4469 29.4714\nL 88.8389 31.7214\nQ 88.9769 31.9434, 89.1989 32.3454\nQ 89.4209 32.7474, 89.4329 32.7714\nL 89.4329 29.4714\nL 89.9969 29.4714\nL 89.9969 33.7194\nL 89.4149 33.7194\nL 87.9209 31.2594\nQ 87.7469 30.9714, 87.5609 30.6414\nQ 87.3809 30.3114, 87.3269 30.2094\nL 87.3269 33.7194\nL 86.7749 33.7194\nL 86.7749 29.4714\nL 87.4469 29.4714\n' fill='#0000FF'/>\n</svg>\n","37475":"<?xml version='1.0' encoding='iso-8859-1'?>\n<svg version='1.1' baseProfile='full'\n xmlns='http://www.w3.org/2000/svg'\n xmlns:rdkit='http://www.rdkit.org/xml'\n xmlns:xlink='http://www.w3.org/1999/xlink'\n xml:space='preserve'\nwidth='150px' height='34px' viewBox='0 0 150 34'>\n<!-- END OF HEADER -->\n<path class='bond-0' d='M 63.111,33.6667 L 70.6675,29.4432' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-1' d='M 70.6675,29.4432 L 70.7882,20.7873' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-2' d='M 70.7882,20.7873 L 77.8618,15.7971' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-2' d='M 70.8512,18.6241 L 75.8027,15.1309' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-14' d='M 70.7882,20.7873 L 63.8563,15.6019' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-3' d='M 77.8618,15.7971 L 86.0568,18.5867' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-7' d='M 77.8618,15.7971 L 76.9867,12.9704' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-7' d='M 76.9867,12.9704 L 76.1116,10.1437' style='fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-4' d='M 85.2076,18.7548 L 85.7863,21.677' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-4' d='M 85.7863,21.677 L 86.365,24.5992' style='fill:none;fill-rule:evenodd;stroke:#FF0000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-4' d='M 86.906,18.4185 L 87.4846,21.3407' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-4' d='M 87.4846,21.3407 L 88.0633,24.2628' style='fill:none;fill-rule:evenodd;stroke:#FF0000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-5' d='M 86.0568,18.5867 L 88.2912,16.6305' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-5' d='M 88.2912,16.6305 L 90.5255,14.6744' style='fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-6' d='M 94.6707,13.5995 L 97.7178,14.6367' style='fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-6' d='M 97.7178,14.6367 L 100.765,15.674' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-8' d='M 73.1858,7.49814 L 69.9158,7.45257' style='fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-8' d='M 69.9158,7.45257 L 66.6459,7.40699' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-9' d='M 66.6459,7.40699 L 61.6557,0.333333' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-10' d='M 66.6459,7.40699 L 63.8563,15.6019' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-10' d='M 67.8664,9.19414 L 65.9138,14.9306' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-11' d='M 63.8563,15.6019 L 55.5868,18.162' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-12' d='M 55.5868,18.162 L 49.235,12.2805' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-13' d='M 54.7427,17.9703 L 54.0844,20.8682' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-13' d='M 54.0844,20.8682 L 53.426,23.7661' style='fill:none;fill-rule:evenodd;stroke:#FF0000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-13' d='M 56.431,18.3538 L 55.7727,21.2517' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-13' d='M 55.7727,21.2517 L 55.1144,24.1496' style='fill:none;fill-rule:evenodd;stroke:#FF0000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='atom-5' d='M 85.7884 27.0905\nQ 85.7884 26.0705, 86.2924 25.5005\nQ 86.7964 24.9305, 87.7384 24.9305\nQ 88.6804 24.9305, 89.1844 25.5005\nQ 89.6884 26.0705, 89.6884 27.0905\nQ 89.6884 28.1225, 89.1784 28.7105\nQ 88.6684 29.2925, 87.7384 29.2925\nQ 86.8024 29.2925, 86.2924 28.7105\nQ 85.7884 28.1285, 85.7884 27.0905\nM 87.7384 28.8125\nQ 88.3864 28.8125, 88.7344 28.3805\nQ 89.0884 27.9425, 89.0884 27.0905\nQ 89.0884 26.2565, 88.7344 25.8365\nQ 88.3864 25.4105, 87.7384 25.4105\nQ 87.0904 25.4105, 86.7364 25.8305\nQ 86.3884 26.2505, 86.3884 27.0905\nQ 86.3884 27.9485, 86.7364 28.3805\nQ 87.0904 28.8125, 87.7384 28.8125\n' fill='#FF0000'/>\n<path class='atom-6' d='M 91.6311 10.7604\nL 93.0231 13.0104\nQ 93.1611 13.2324, 93.3831 13.6344\nQ 93.6051 14.0364, 93.6171 14.0604\nL 93.6171 10.7604\nL 94.1811 10.7604\nL 94.1811 15.0084\nL 93.5991 15.0084\nL 92.1051 12.5484\nQ 91.9311 12.2604, 91.7451 11.9304\nQ 91.5651 11.6004, 91.5111 11.4984\nL 91.5111 15.0084\nL 90.9591 15.0084\nL 90.9591 10.7604\nL 91.6311 10.7604\n' fill='#0000FF'/>\n<path class='atom-6' d='M 90.9081 6.08762\nL 91.4841 6.08762\nL 91.4841 7.89362\nL 93.6561 7.89362\nL 93.6561 6.08762\nL 94.2321 6.08762\nL 94.2321 10.3356\nL 93.6561 10.3356\nL 93.6561 8.37362\nL 91.4841 8.37362\nL 91.4841 10.3356\nL 90.9081 10.3356\nL 90.9081 6.08762\n' fill='#0000FF'/>\n<path class='atom-8' d='M 74.3628 5.40363\nL 75.7548 7.65363\nQ 75.8928 7.87563, 76.1148 8.27763\nQ 76.3368 8.67963, 76.3488 8.70363\nL 76.3488 5.40363\nL 76.9128 5.40363\nL 76.9128 9.65163\nL 76.3308 9.65163\nL 74.8368 7.19163\nQ 74.6628 6.90363, 74.4768 6.57363\nQ 74.2968 6.24363, 74.2428 6.14163\nL 74.2428 9.65163\nL 73.6908 9.65163\nL 73.6908 5.40363\nL 74.3628 5.40363\n' fill='#0000FF'/>\n<path class='atom-8' d='M 77.4228 5.40363\nL 77.9988 5.40363\nL 77.9988 7.20963\nL 80.1708 7.20963\nL 80.1708 5.40363\nL 80.7468 5.40363\nL 80.7468 9.65163\nL 80.1708 9.65163\nL 80.1708 7.68963\nL 77.9988 7.68963\nL 77.9988 9.65163\nL 77.4228 9.65163\nL 77.4228 5.40363\n' fill='#0000FF'/>\n<path class='atom-14' d='M 51.7192 26.6157\nQ 51.7192 25.5957, 52.2232 25.0257\nQ 52.7272 24.4557, 53.6692 24.4557\nQ 54.6112 24.4557, 55.1152 25.0257\nQ 55.6192 25.5957, 55.6192 26.6157\nQ 55.6192 27.6477, 55.1092 28.2357\nQ 54.5992 28.8177, 53.6692 28.8177\nQ 52.7332 28.8177, 52.2232 28.2357\nQ 51.7192 27.6537, 51.7192 26.6157\nM 53.6692 28.3377\nQ 54.3172 28.3377, 54.6652 27.9057\nQ 55.0192 27.4677, 55.0192 26.6157\nQ 55.0192 25.7817, 54.6652 25.3617\nQ 54.3172 24.9357, 53.6692 24.9357\nQ 53.0212 24.9357, 52.6672 25.3557\nQ 52.3192 25.7757, 52.3192 26.6157\nQ 52.3192 27.4737, 52.6672 27.9057\nQ 53.0212 28.3377, 53.6692 28.3377\n' fill='#FF0000'/>\n</svg>\n","37477":"<?xml version='1.0' encoding='iso-8859-1'?>\n<svg version='1.1' baseProfile='full'\n xmlns='http://www.w3.org/2000/svg'\n xmlns:rdkit='http://www.rdkit.org/xml'\n xmlns:xlink='http://www.w3.org/1999/xlink'\n xml:space='preserve'\nwidth='150px' height='34px' viewBox='0 0 150 34'>\n<!-- END OF HEADER -->\n<path class='bond-0' d='M 41.3705,20.6915 L 49.6584,17.2507' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-1' d='M 49.6584,17.2507 L 50.8225,8.35277' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-1' d='M 51.6126,16.1488 L 52.4275,9.92028' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-15' d='M 49.6584,17.2507 L 56.7822,22.7078' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-2' d='M 50.8225,8.35277 L 59.1104,4.91194' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-3' d='M 59.1104,4.91194 L 66.2342,10.3691' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-3' d='M 59.0876,7.15526 L 64.0742,10.9752' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-4' d='M 66.2342,10.3691 L 69.3224,9.08697' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-4' d='M 69.3224,9.08697 L 72.4105,7.80489' style='fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-12' d='M 66.2342,10.3691 L 65.0701,19.267' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-5' d='M 76.5949,8.51608 L 79.1204,10.4507' style='fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-5' d='M 79.1204,10.4507 L 81.6459,12.3853' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-6' d='M 80.7561,12.2689 L 80.3487,15.3834' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-6' d='M 80.3487,15.3834 L 79.9412,18.4979' style='fill:none;fill-rule:evenodd;stroke:#FF0000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-6' d='M 82.5357,12.5017 L 82.1282,15.6162' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-6' d='M 82.1282,15.6162 L 81.7208,18.7307' style='fill:none;fill-rule:evenodd;stroke:#FF0000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-7' d='M 81.6459,12.3853 L 84.7341,11.1033' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-7' d='M 84.7341,11.1033 L 87.8222,9.82117' style='fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-8' d='M 92.0066,10.5324 L 94.5321,12.467' style='fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-8' d='M 94.5321,12.467 L 97.0576,14.4016' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-9' d='M 97.0576,14.4016 L 105.69,11.7896 L 105.001,10.132 Z' style='fill:#000000;fill-rule:evenodd;fill-opacity:1;stroke:#000000;stroke-width:1px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1;' />\n<path class='bond-10' d='M 97.0576,14.4016 L 95.8935,23.2996' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-11' d='M 95.8935,23.2996 L 98.2495,25.1044' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-11' d='M 98.2495,25.1044 L 100.605,26.9091' style='fill:none;fill-rule:evenodd;stroke:#FF0000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-13' d='M 65.0701,19.267 L 56.7822,22.7078' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-13' d='M 63.1388,18.1255 L 57.3372,20.5341' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-14' d='M 56.7822,22.7078 L 56.3732,25.8343' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-14' d='M 56.3732,25.8343 L 55.9642,28.9608' style='fill:none;fill-rule:evenodd;stroke:#33CCCC;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='atom-5' d='M 73.5831 4.80423\nL 74.9751 7.05423\nQ 75.1131 7.27623, 75.3351 7.67823\nQ 75.5571 8.08023, 75.5691 8.10423\nL 75.5691 4.80423\nL 76.1331 4.80423\nL 76.1331 9.05223\nL 75.5511 9.05223\nL 74.0571 6.59223\nQ 73.8831 6.30423, 73.6971 5.97423\nQ 73.5171 5.64423, 73.4631 5.54223\nL 73.4631 9.05223\nL 72.9111 9.05223\nL 72.9111 4.80423\nL 73.5831 4.80423\n' fill='#0000FF'/>\n<path class='atom-5' d='M 72.8601 0.131425\nL 73.4361 0.131425\nL 73.4361 1.93743\nL 75.6081 1.93743\nL 75.6081 0.131425\nL 76.1841 0.131425\nL 76.1841 4.37943\nL 75.6081 4.37943\nL 75.6081 2.41743\nL 73.4361 2.41743\nL 73.4361 4.37943\nL 72.8601 4.37943\nL 72.8601 0.131425\n' fill='#0000FF'/>\n<path class='atom-7' d='M 78.5318 21.2953\nQ 78.5318 20.2753, 79.0358 19.7053\nQ 79.5398 19.1353, 80.4818 19.1353\nQ 81.4238 19.1353, 81.9278 19.7053\nQ 82.4318 20.2753, 82.4318 21.2953\nQ 82.4318 22.3273, 81.9218 22.9153\nQ 81.4118 23.4973, 80.4818 23.4973\nQ 79.5458 23.4973, 79.0358 22.9153\nQ 78.5318 22.3333, 78.5318 21.2953\nM 80.4818 23.0173\nQ 81.1298 23.0173, 81.4778 22.5853\nQ 81.8318 22.1473, 81.8318 21.2953\nQ 81.8318 20.4613, 81.4778 20.0413\nQ 81.1298 19.6153, 80.4818 19.6153\nQ 79.8338 19.6153, 79.4798 20.0353\nQ 79.1318 20.4553, 79.1318 21.2953\nQ 79.1318 22.1533, 79.4798 22.5853\nQ 79.8338 23.0173, 80.4818 23.0173\n' fill='#FF0000'/>\n<path class='atom-8' d='M 88.9948 6.82051\nL 90.3868 9.07051\nQ 90.5248 9.29251, 90.7468 9.69451\nQ 90.9688 10.0965, 90.9808 10.1205\nL 90.9808 6.82051\nL 91.5448 6.82051\nL 91.5448 11.0685\nL 90.9628 11.0685\nL 89.4688 8.60851\nQ 89.2948 8.32051, 89.1088 7.99051\nQ 88.9288 7.66051, 88.8748 7.55851\nL 88.8748 11.0685\nL 88.3228 11.0685\nL 88.3228 6.82051\nL 88.9948 6.82051\n' fill='#0000FF'/>\n<path class='atom-8' d='M 88.2718 2.14771\nL 88.8478 2.14771\nL 88.8478 3.95371\nL 91.0198 3.95371\nL 91.0198 2.14771\nL 91.5958 2.14771\nL 91.5958 6.39571\nL 91.0198 6.39571\nL 91.0198 4.43371\nL 88.8478 4.43371\nL 88.8478 6.39571\nL 88.2718 6.39571\nL 88.2718 2.14771\n' fill='#0000FF'/>\n<path class='atom-12' d='M 101.067 28.7687\nQ 101.067 27.7487, 101.571 27.1787\nQ 102.075 26.6087, 103.017 26.6087\nQ 103.959 26.6087, 104.463 27.1787\nQ 104.967 27.7487, 104.967 28.7687\nQ 104.967 29.8007, 104.457 30.3887\nQ 103.947 30.9707, 103.017 30.9707\nQ 102.081 30.9707, 101.571 30.3887\nQ 101.067 29.8067, 101.067 28.7687\nM 103.017 30.4907\nQ 103.665 30.4907, 104.013 30.0587\nQ 104.367 29.6207, 104.367 28.7687\nQ 104.367 27.9347, 104.013 27.5147\nQ 103.665 27.0887, 103.017 27.0887\nQ 102.369 27.0887, 102.015 27.5087\nQ 101.667 27.9287, 101.667 28.7687\nQ 101.667 29.6267, 102.015 30.0587\nQ 102.369 30.4907, 103.017 30.4907\n' fill='#FF0000'/>\n<path class='atom-12' d='M 105.477 26.6567\nL 106.053 26.6567\nL 106.053 28.4627\nL 108.225 28.4627\nL 108.225 26.6567\nL 108.801 26.6567\nL 108.801 30.9047\nL 108.225 30.9047\nL 108.225 28.9427\nL 106.053 28.9427\nL 106.053 30.9047\nL 105.477 30.9047\nL 105.477 26.6567\n' fill='#FF0000'/>\n<path class='atom-15' d='M 54.3551 29.4818\nL 56.8811 29.4818\nL 56.8811 29.9678\nL 54.9251 29.9678\nL 54.9251 31.2578\nL 56.6651 31.2578\nL 56.6651 31.7498\nL 54.9251 31.7498\nL 54.9251 33.7298\nL 54.3551 33.7298\nL 54.3551 29.4818\n' fill='#33CCCC'/>\n</svg>\n","37478":"<?xml version='1.0' encoding='iso-8859-1'?>\n<svg version='1.1' baseProfile='full'\n xmlns='http://www.w3.org/2000/svg'\n xmlns:rdkit='http://www.rdkit.org/xml'\n xmlns:xlink='http://www.w3.org/1999/xlink'\n xml:space='preserve'\nwidth='150px' height='34px' viewBox='0 0 150 34'>\n<!-- END OF HEADER -->\n<path class='bond-0' d='M 36.0063,16.9859 L 39.9928,15.761' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-0' d='M 39.9928,15.761 L 43.9792,14.5361' style='fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-1' d='M 48.3341,15.8427 L 51.1686,18.4785' style='fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-1' d='M 51.1686,18.4785 L 54.0031,21.1142' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-2' d='M 52.964,20.8759 L 52.0889,24.6907' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-2' d='M 52.0889,24.6907 L 51.2139,28.5055' style='fill:none;fill-rule:evenodd;stroke:#FF0000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-2' d='M 55.0421,21.3526 L 54.167,25.1674' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-2' d='M 54.167,25.1674 L 53.292,28.9822' style='fill:none;fill-rule:evenodd;stroke:#FF0000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-3' d='M 54.0031,21.1142 L 64.1932,17.9832' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-4' d='M 64.1932,17.9832 L 71.9999,25.2425' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-4' d='M 66.8161,17.5107 L 72.2807,22.5923' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-15' d='M 64.1932,17.9832 L 66.5767,7.59271' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-5' d='M 71.9999,25.2425 L 82.19,22.1115' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-6' d='M 82.19,22.1115 L 89.9966,29.3709' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-6' d='M 84.8129,21.639 L 90.2775,26.7206' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-16' d='M 82.19,22.1115 L 84.5735,11.721' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-7' d='M 89.9966,29.3709 L 100.187,26.2398' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-8' d='M 100.187,26.2398 L 102.57,15.8493' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-8' d='M 98.4662,24.2045 L 100.135,16.9312' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-9' d='M 102.57,15.8493 L 106.731,14.571' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-9' d='M 106.731,14.571 L 110.891,13.2926' style='fill:none;fill-rule:evenodd;stroke:#33CCCC;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-10' d='M 102.57,15.8493 L 94.7636,8.58995' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-11' d='M 94.7636,8.58995 L 84.5735,11.721' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-11' d='M 93.8613,11.0976 L 86.7282,13.2894' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-12' d='M 84.5735,11.721 L 81.739,9.08527' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-12' d='M 81.739,9.08527 L 78.9045,6.44951' style='fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-13' d='M 74.5496,5.1429 L 70.5632,6.36781' style='fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-13' d='M 70.5632,6.36781 L 66.5767,7.59271' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-13' d='M 73.9799,7.5484 L 71.1894,8.40583' style='fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-13' d='M 71.1894,8.40583 L 68.3988,9.26327' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-14' d='M 66.5767,7.59271 L 58.77,0.333333' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='atom-1' d='M 45.2574 11.7309\nL 46.6494 13.9809\nQ 46.7874 14.2029, 47.0094 14.6049\nQ 47.2314 15.0069, 47.2434 15.0309\nL 47.2434 11.7309\nL 47.8074 11.7309\nL 47.8074 15.9789\nL 47.2254 15.9789\nL 45.7314 13.5189\nQ 45.5574 13.2309, 45.3714 12.9009\nQ 45.1914 12.5709, 45.1374 12.4689\nL 45.1374 15.9789\nL 44.5854 15.9789\nL 44.5854 11.7309\nL 45.2574 11.7309\n' fill='#0000FF'/>\n<path class='atom-1' d='M 44.5344 7.05806\nL 45.1104 7.05806\nL 45.1104 8.86406\nL 47.2824 8.86406\nL 47.2824 7.05806\nL 47.8584 7.05806\nL 47.8584 11.3061\nL 47.2824 11.3061\nL 47.2824 9.34406\nL 45.1104 9.34406\nL 45.1104 11.3061\nL 44.5344 11.3061\nL 44.5344 7.05806\n' fill='#0000FF'/>\n<path class='atom-3' d='M 49.6696 31.5167\nQ 49.6696 30.4967, 50.1736 29.9267\nQ 50.6776 29.3567, 51.6196 29.3567\nQ 52.5616 29.3567, 53.0656 29.9267\nQ 53.5696 30.4967, 53.5696 31.5167\nQ 53.5696 32.5487, 53.0596 33.1367\nQ 52.5496 33.7187, 51.6196 33.7187\nQ 50.6836 33.7187, 50.1736 33.1367\nQ 49.6696 32.5547, 49.6696 31.5167\nM 51.6196 33.2387\nQ 52.2676 33.2387, 52.6156 32.8067\nQ 52.9696 32.3687, 52.9696 31.5167\nQ 52.9696 30.6827, 52.6156 30.2627\nQ 52.2676 29.8367, 51.6196 29.8367\nQ 50.9716 29.8367, 50.6176 30.2567\nQ 50.2696 30.6767, 50.2696 31.5167\nQ 50.2696 32.3747, 50.6176 32.8067\nQ 50.9716 33.2387, 51.6196 33.2387\n' fill='#FF0000'/>\n<path class='atom-10' d='M 111.497 10.5943\nL 114.023 10.5943\nL 114.023 11.0803\nL 112.067 11.0803\nL 112.067 12.3703\nL 113.807 12.3703\nL 113.807 12.8623\nL 112.067 12.8623\nL 112.067 14.8423\nL 111.497 14.8423\nL 111.497 10.5943\n' fill='#33CCCC'/>\n<path class='atom-13' d='M 75.8278 2.33764\nL 77.2198 4.58764\nQ 77.3578 4.80964, 77.5798 5.21164\nQ 77.8018 5.61364, 77.8138 5.63764\nL 77.8138 2.33764\nL 78.3778 2.33764\nL 78.3778 6.58564\nL 77.7958 6.58564\nL 76.3018 4.12564\nQ 76.1278 3.83764, 75.9418 3.50764\nQ 75.7618 3.17764, 75.7078 3.07564\nL 75.7078 6.58564\nL 75.1558 6.58564\nL 75.1558 2.33764\nL 75.8278 2.33764\n' fill='#0000FF'/>\n</svg>\n","37483":"<?xml version='1.0' encoding='iso-8859-1'?>\n<svg version='1.1' baseProfile='full'\n xmlns='http://www.w3.org/2000/svg'\n xmlns:rdkit='http://www.rdkit.org/xml'\n xmlns:xlink='http://www.w3.org/1999/xlink'\n xml:space='preserve'\nwidth='150px' height='34px' viewBox='0 0 150 34'>\n<!-- END OF HEADER -->\n<path class='bond-0' d='M 18.3069,22.2039 L 22.4498,25.0626' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-0' d='M 22.4498,25.0626 L 26.5927,27.9212' style='fill:none;fill-rule:evenodd;stroke:#FF0000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-1' d='M 31.9212,28.4741 L 36.5797,26.2627' style='fill:none;fill-rule:evenodd;stroke:#FF0000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-1' d='M 36.5797,26.2627 L 41.2381,24.0514' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-2' d='M 41.2381,24.0514 L 42.3047,10.812' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-2' d='M 44.046,22.2788 L 44.7926,13.0112' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-16' d='M 41.2381,24.0514 L 45.5505,27.027' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-16' d='M 45.5505,27.027 L 49.8629,30.0026' style='fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-3' d='M 42.3047,10.812 L 54.3036,5.11607' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-4' d='M 54.3036,5.11607 L 65.2359,12.6595' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-4' d='M 54.4348,8.43404 L 62.0874,13.7144' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-5' d='M 65.2359,12.6595 L 70.0639,10.3676' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-5' d='M 70.0639,10.3676 L 74.8918,8.07575' style='fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-14' d='M 65.2359,12.6595 L 64.1693,25.8988' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-6' d='M 79.5423,8.55568 L 83.8547,11.5313' style='fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-6' d='M 83.8547,11.5313 L 88.1671,14.5069' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-7' d='M 86.8432,14.4002 L 86.4276,19.5592' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-7' d='M 86.4276,19.5592 L 86.0119,24.7182' style='fill:none;fill-rule:evenodd;stroke:#FF0000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-7' d='M 89.4911,14.6135 L 89.0754,19.7725' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-7' d='M 89.0754,19.7725 L 88.6598,24.9315' style='fill:none;fill-rule:evenodd;stroke:#FF0000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-8' d='M 88.1671,14.5069 L 92.9951,12.215' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-8' d='M 92.9951,12.215 L 97.823,9.92318' style='fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-9' d='M 102.473,10.4031 L 106.786,13.3787' style='fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-9' d='M 106.786,13.3787 L 111.098,16.3543' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-10' d='M 111.098,16.3543 L 123.627,11.9438' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-10' d='M 113.86,18.1985 L 122.63,15.1111' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-17' d='M 111.098,16.3543 L 111.225,21.5471' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-17' d='M 111.225,21.5471 L 111.351,26.7399' style='fill:none;fill-rule:evenodd;stroke:#CCCC00;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-11' d='M 123.627,11.9438 L 131.693,22.4962' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-12' d='M 131.693,22.4962 L 124.15,33.4285' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-12' d='M 128.375,22.6274 L 123.095,30.28' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-13' d='M 124.15,33.4285 L 118.845,31.8464' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-13' d='M 118.845,31.8464 L 113.54,30.2644' style='fill:none;fill-rule:evenodd;stroke:#CCCC00;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-15' d='M 64.1693,25.8988 L 59.3414,28.1906' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-15' d='M 59.3414,28.1906 L 54.5134,30.4825' style='fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-15' d='M 61.5817,24.1866 L 58.2022,25.7909' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-15' d='M 58.2022,25.7909 L 54.8226,27.3952' style='fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='atom-1' d='M 27.2892 29.7593\nQ 27.2892 28.7393, 27.7932 28.1693\nQ 28.2972 27.5993, 29.2392 27.5993\nQ 30.1812 27.5993, 30.6852 28.1693\nQ 31.1892 28.7393, 31.1892 29.7593\nQ 31.1892 30.7913, 30.6792 31.3793\nQ 30.1692 31.9613, 29.2392 31.9613\nQ 28.3032 31.9613, 27.7932 31.3793\nQ 27.2892 30.7973, 27.2892 29.7593\nM 29.2392 31.4813\nQ 29.8872 31.4813, 30.2352 31.0493\nQ 30.5892 30.6113, 30.5892 29.7593\nQ 30.5892 28.9253, 30.2352 28.5053\nQ 29.8872 28.0793, 29.2392 28.0793\nQ 28.5912 28.0793, 28.2372 28.4993\nQ 27.8892 28.9193, 27.8892 29.7593\nQ 27.8892 30.6173, 28.2372 31.0493\nQ 28.5912 31.4813, 29.2392 31.4813\n' fill='#FF0000'/>\n<path class='atom-6' d='M 76.2958 4.8395\nL 77.6878 7.0895\nQ 77.8258 7.3115, 78.0478 7.7135\nQ 78.2698 8.1155, 78.2818 8.1395\nL 78.2818 4.8395\nL 78.8458 4.8395\nL 78.8458 9.0875\nL 78.2638 9.0875\nL 76.7698 6.6275\nQ 76.5958 6.3395, 76.4098 6.0095\nQ 76.2298 5.6795, 76.1758 5.5775\nL 76.1758 9.0875\nL 75.6238 9.0875\nL 75.6238 4.8395\nL 76.2958 4.8395\n' fill='#0000FF'/>\n<path class='atom-6' d='M 75.5728 0.166703\nL 76.1488 0.166703\nL 76.1488 1.9727\nL 78.3208 1.9727\nL 78.3208 0.166703\nL 78.8968 0.166703\nL 78.8968 4.4147\nL 78.3208 4.4147\nL 78.3208 2.4527\nL 76.1488 2.4527\nL 76.1488 4.4147\nL 75.5728 4.4147\nL 75.5728 0.166703\n' fill='#0000FF'/>\n<path class='atom-8' d='M 85.1505 27.7582\nQ 85.1505 26.7382, 85.6545 26.1682\nQ 86.1585 25.5982, 87.1005 25.5982\nQ 88.0425 25.5982, 88.5465 26.1682\nQ 89.0505 26.7382, 89.0505 27.7582\nQ 89.0505 28.7902, 88.5405 29.3782\nQ 88.0305 29.9602, 87.1005 29.9602\nQ 86.1645 29.9602, 85.6545 29.3782\nQ 85.1505 28.7962, 85.1505 27.7582\nM 87.1005 29.4802\nQ 87.7485 29.4802, 88.0965 29.0482\nQ 88.4505 28.6102, 88.4505 27.7582\nQ 88.4505 26.9242, 88.0965 26.5042\nQ 87.7485 26.0782, 87.1005 26.0782\nQ 86.4525 26.0782, 86.0985 26.4982\nQ 85.7505 26.9182, 85.7505 27.7582\nQ 85.7505 28.6162, 86.0985 29.0482\nQ 86.4525 29.4802, 87.1005 29.4802\n' fill='#FF0000'/>\n<path class='atom-9' d='M 99.227 6.68693\nL 100.619 8.93693\nQ 100.757 9.15893, 100.979 9.56093\nQ 101.201 9.96293, 101.213 9.98693\nL 101.213 6.68693\nL 101.777 6.68693\nL 101.777 10.9349\nL 101.195 10.9349\nL 99.701 8.47493\nQ 99.527 8.18693, 99.341 7.85693\nQ 99.161 7.52693, 99.107 7.42493\nL 99.107 10.9349\nL 98.555 10.9349\nL 98.555 6.68693\nL 99.227 6.68693\n' fill='#0000FF'/>\n<path class='atom-9' d='M 98.504 2.01413\nL 99.08 2.01413\nL 99.08 3.82013\nL 101.252 3.82013\nL 101.252 2.01413\nL 101.828 2.01413\nL 101.828 6.26213\nL 101.252 6.26213\nL 101.252 4.30013\nL 99.08 4.30013\nL 99.08 6.26213\nL 98.504 6.26213\nL 98.504 2.01413\n' fill='#0000FF'/>\n<path class='atom-14' d='M 110.221 31.0906\nQ 110.269 31.1086, 110.467 31.1926\nQ 110.665 31.2766, 110.881 31.3306\nQ 111.103 31.3786, 111.319 31.3786\nQ 111.721 31.3786, 111.955 31.1866\nQ 112.189 30.9886, 112.189 30.6466\nQ 112.189 30.4126, 112.069 30.2686\nQ 111.955 30.1246, 111.775 30.0466\nQ 111.595 29.9686, 111.295 29.8786\nQ 110.917 29.7646, 110.689 29.6566\nQ 110.467 29.5486, 110.305 29.3206\nQ 110.149 29.0926, 110.149 28.7086\nQ 110.149 28.1746, 110.509 27.8446\nQ 110.875 27.5146, 111.595 27.5146\nQ 112.087 27.5146, 112.645 27.7486\nL 112.507 28.2106\nQ 111.997 28.0006, 111.613 28.0006\nQ 111.199 28.0006, 110.971 28.1746\nQ 110.743 28.3426, 110.749 28.6366\nQ 110.749 28.8646, 110.863 29.0026\nQ 110.983 29.1406, 111.151 29.2186\nQ 111.325 29.2966, 111.613 29.3866\nQ 111.997 29.5066, 112.225 29.6266\nQ 112.453 29.7466, 112.615 29.9926\nQ 112.783 30.2326, 112.783 30.6466\nQ 112.783 31.2346, 112.387 31.5526\nQ 111.997 31.8646, 111.343 31.8646\nQ 110.965 31.8646, 110.677 31.7806\nQ 110.395 31.7026, 110.059 31.5646\nL 110.221 31.0906\n' fill='#CCCC00'/>\n<path class='atom-16' d='M 51.2314 29.4707\nL 52.6234 31.7207\nQ 52.7614 31.9427, 52.9834 32.3447\nQ 53.2054 32.7467, 53.2174 32.7707\nL 53.2174 29.4707\nL 53.7814 29.4707\nL 53.7814 33.7187\nL 53.1994 33.7187\nL 51.7054 31.2587\nQ 51.5314 30.9707, 51.3454 30.6407\nQ 51.1654 30.3107, 51.1114 30.2087\nL 51.1114 33.7187\nL 50.5594 33.7187\nL 50.5594 29.4707\nL 51.2314 29.4707\n' fill='#0000FF'/>\n</svg>\n","37484":"<?xml version='1.0' encoding='iso-8859-1'?>\n<svg version='1.1' baseProfile='full'\n xmlns='http://www.w3.org/2000/svg'\n xmlns:rdkit='http://www.rdkit.org/xml'\n xmlns:xlink='http://www.w3.org/1999/xlink'\n xml:space='preserve'\nwidth='150px' height='34px' viewBox='0 0 150 34'>\n<!-- END OF HEADER -->\n<path class='bond-0' d='M 74.4529,9.9982 L 74.4529,15.1744' style='fill:none;fill-rule:evenodd;stroke:#FF0000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-0' d='M 74.4529,15.1744 L 74.4529,20.3506' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-0' d='M 77.1218,9.9982 L 77.1218,15.1744' style='fill:none;fill-rule:evenodd;stroke:#FF0000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-0' d='M 77.1218,15.1744 L 77.1218,20.3506' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-1' d='M 75.7874,20.3506 L 80.4009,23.0142' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-1' d='M 80.4009,23.0142 L 85.0145,25.6779' style='fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-8' d='M 75.7874,20.3506 L 71.1738,23.0142' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-8' d='M 71.1738,23.0142 L 66.5602,25.6779' style='fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-2' d='M 89.6742,25.6779 L 94.2877,23.0142' style='fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-2' d='M 94.2877,23.0142 L 98.9013,20.3506' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-3' d='M 98.9013,20.3506 L 110.458,27.023' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-3' d='M 101.969,19.0401 L 110.059,23.7108' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-15' d='M 98.9013,20.3506 L 98.9013,7.00575' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-4' d='M 110.458,27.023 L 122.015,20.3506' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-5' d='M 122.015,20.3506 L 122.015,7.00575' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-5' d='M 119.346,18.3489 L 119.346,9.00748' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-6' d='M 122.015,7.00575 L 110.458,0.333333' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-7' d='M 110.458,0.333333 L 98.9013,7.00575' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-7' d='M 110.059,3.64559 L 101.969,8.31628' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-9' d='M 61.9005,25.6779 L 57.287,23.0142' style='fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-9' d='M 57.287,23.0142 L 52.6734,20.3506' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-10' d='M 52.6734,20.3506 L 52.6734,7.00575' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-10' d='M 50.0044,18.3489 L 50.0044,9.00748' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-16' d='M 52.6734,20.3506 L 41.1164,27.023' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-11' d='M 52.6734,7.00575 L 41.1164,0.333333' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-12' d='M 41.1164,0.333333 L 29.5595,7.00575' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-12' d='M 40.7174,3.64559 L 32.6275,8.31628' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-13' d='M 29.5595,7.00575 L 29.5595,12.2269' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-13' d='M 29.5595,12.2269 L 29.5595,17.4481' style='fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-14' d='M 31.8893,21.6957 L 36.5029,24.3594' style='fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-14' d='M 36.5029,24.3594 L 41.1164,27.023' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-14' d='M 34.6079,20.1834 L 37.8374,22.048' style='fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-14' d='M 37.8374,22.048 L 41.0669,23.9125' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='atom-0' d='M 73.8374 7.01775\nQ 73.8374 5.99775, 74.3414 5.42775\nQ 74.8454 4.85775, 75.7874 4.85775\nQ 76.7294 4.85775, 77.2334 5.42775\nQ 77.7374 5.99775, 77.7374 7.01775\nQ 77.7374 8.04975, 77.2274 8.63775\nQ 76.7174 9.21975, 75.7874 9.21975\nQ 74.8514 9.21975, 74.3414 8.63775\nQ 73.8374 8.05575, 73.8374 7.01775\nM 75.7874 8.73975\nQ 76.4354 8.73975, 76.7834 8.30775\nQ 77.1374 7.86975, 77.1374 7.01775\nQ 77.1374 6.18375, 76.7834 5.76375\nQ 76.4354 5.33775, 75.7874 5.33775\nQ 75.1394 5.33775, 74.7854 5.75775\nQ 74.4374 6.17775, 74.4374 7.01775\nQ 74.4374 7.87575, 74.7854 8.30775\nQ 75.1394 8.73975, 75.7874 8.73975\n' fill='#FF0000'/>\n<path class='atom-2' d='M 86.4053 24.899\nL 87.7973 27.149\nQ 87.9353 27.371, 88.1573 27.773\nQ 88.3793 28.175, 88.3913 28.199\nL 88.3913 24.899\nL 88.9553 24.899\nL 88.9553 29.147\nL 88.3733 29.147\nL 86.8793 26.687\nQ 86.7053 26.399, 86.5193 26.069\nQ 86.3393 25.739, 86.2853 25.637\nL 86.2853 29.147\nL 85.7333 29.147\nL 85.7333 24.899\nL 86.4053 24.899\n' fill='#0000FF'/>\n<path class='atom-2' d='M 85.6823 29.5718\nL 86.2583 29.5718\nL 86.2583 31.3778\nL 88.4303 31.3778\nL 88.4303 29.5718\nL 89.0063 29.5718\nL 89.0063 33.8198\nL 88.4303 33.8198\nL 88.4303 31.8578\nL 86.2583 31.8578\nL 86.2583 33.8198\nL 85.6823 33.8198\nL 85.6823 29.5718\n' fill='#0000FF'/>\n<path class='atom-9' d='M 63.2914 24.899\nL 64.6834 27.149\nQ 64.8214 27.371, 65.0434 27.773\nQ 65.2654 28.175, 65.2774 28.199\nL 65.2774 24.899\nL 65.8414 24.899\nL 65.8414 29.147\nL 65.2594 29.147\nL 63.7654 26.687\nQ 63.5914 26.399, 63.4054 26.069\nQ 63.2254 25.739, 63.1714 25.637\nL 63.1714 29.147\nL 62.6194 29.147\nL 62.6194 24.899\nL 63.2914 24.899\n' fill='#0000FF'/>\n<path class='atom-9' d='M 62.5684 29.5718\nL 63.1444 29.5718\nL 63.1444 31.3778\nL 65.3164 31.3778\nL 65.3164 29.5718\nL 65.8924 29.5718\nL 65.8924 33.8198\nL 65.3164 33.8198\nL 65.3164 31.8578\nL 63.1444 31.8578\nL 63.1444 33.8198\nL 62.5684 33.8198\nL 62.5684 29.5718\n' fill='#0000FF'/>\n<path class='atom-14' d='M 28.6205 18.2266\nL 30.0125 20.4766\nQ 30.1505 20.6986, 30.3725 21.1006\nQ 30.5945 21.5026, 30.6065 21.5266\nL 30.6065 18.2266\nL 31.1705 18.2266\nL 31.1705 22.4746\nL 30.5885 22.4746\nL 29.0945 20.0146\nQ 28.9205 19.7266, 28.7345 19.3966\nQ 28.5545 19.0666, 28.5005 18.9646\nL 28.5005 22.4746\nL 27.9485 22.4746\nL 27.9485 18.2266\nL 28.6205 18.2266\n' fill='#0000FF'/>\n</svg>\n","37486":"<?xml version='1.0' encoding='iso-8859-1'?>\n<svg version='1.1' baseProfile='full'\n xmlns='http://www.w3.org/2000/svg'\n xmlns:rdkit='http://www.rdkit.org/xml'\n xmlns:xlink='http://www.w3.org/1999/xlink'\n xml:space='preserve'\nwidth='150px' height='34px' viewBox='0 0 150 34'>\n<!-- END OF HEADER -->\n<path class='bond-0' d='M 21.8395,21.9636 L 25.6006,24.4466' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-0' d='M 25.6006,24.4466 L 29.3617,26.9297' style='fill:none;fill-rule:evenodd;stroke:#FF0000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-1' d='M 34.5659,27.3325 L 38.6777,25.2764' style='fill:none;fill-rule:evenodd;stroke:#FF0000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-1' d='M 38.6777,25.2764 L 42.7895,23.2203' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-2' d='M 42.7895,23.2203 L 43.5151,11.1248' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-2' d='M 45.3174,21.5511 L 45.8253,13.0843' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-17' d='M 42.7895,23.2203 L 52.9017,29.8964' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-3' d='M 43.5151,11.1248 L 54.3528,5.7055' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-4' d='M 54.3528,5.7055 L 64.465,12.3816' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-4' d='M 54.5344,8.72935 L 61.613,13.4026' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-5' d='M 64.465,12.3816 L 68.7463,10.2408' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-5' d='M 68.7463,10.2408 L 73.0276,8.09994' style='fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-15' d='M 64.465,12.3816 L 63.7394,24.4771' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-6' d='M 77.5538,8.44837 L 81.4844,11.0434' style='fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-6' d='M 81.4844,11.0434 L 85.415,13.6384' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-7' d='M 84.2054,13.5658 L 83.9282,18.1865' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-7' d='M 83.9282,18.1865 L 83.651,22.8071' style='fill:none;fill-rule:evenodd;stroke:#FF0000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-7' d='M 86.6245,13.7109 L 86.3473,18.3316' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-7' d='M 86.3473,18.3316 L 86.0701,22.9523' style='fill:none;fill-rule:evenodd;stroke:#FF0000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-8' d='M 85.415,13.6384 L 89.6962,11.4975' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-8' d='M 89.6962,11.4975 L 93.9775,9.35669' style='fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-9' d='M 98.5037,9.70512 L 102.434,12.3001' style='fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-9' d='M 102.434,12.3001 L 106.365,14.8951' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-10' d='M 106.365,14.8951 L 105.639,26.9906' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-10' d='M 108.675,16.8545 L 108.167,25.3214' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-18' d='M 106.365,14.8951 L 117.203,9.47575' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-11' d='M 105.639,26.9906 L 115.751,33.6667' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-12' d='M 115.751,33.6667 L 120.033,31.5258' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-12' d='M 120.033,31.5258 L 124.314,29.385' style='fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-12' d='M 115.952,30.8569 L 118.949,29.3583' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-12' d='M 118.949,29.3583 L 121.946,27.8597' style='fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-13' d='M 126.759,25.4172 L 127.037,20.7845' style='fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-13' d='M 127.037,20.7845 L 127.315,16.1519' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-14' d='M 127.315,16.1519 L 117.203,9.47575' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-14' d='M 124.463,17.1729 L 117.384,12.4996' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-16' d='M 63.7394,24.4771 L 52.9017,29.8964' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-16' d='M 61.0299,23.1224 L 53.4435,26.916' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='atom-1' d='M 30.0017 28.6517\nQ 30.0017 27.6317, 30.5057 27.0617\nQ 31.0097 26.4917, 31.9517 26.4917\nQ 32.8937 26.4917, 33.3977 27.0617\nQ 33.9017 27.6317, 33.9017 28.6517\nQ 33.9017 29.6837, 33.3917 30.2717\nQ 32.8817 30.8537, 31.9517 30.8537\nQ 31.0157 30.8537, 30.5057 30.2717\nQ 30.0017 29.6897, 30.0017 28.6517\nM 31.9517 30.3737\nQ 32.5997 30.3737, 32.9477 29.9417\nQ 33.3017 29.5037, 33.3017 28.6517\nQ 33.3017 27.8177, 32.9477 27.3977\nQ 32.5997 26.9717, 31.9517 26.9717\nQ 31.3037 26.9717, 30.9497 27.3917\nQ 30.6017 27.8117, 30.6017 28.6517\nQ 30.6017 29.5097, 30.9497 29.9417\nQ 31.3037 30.3737, 31.9517 30.3737\n' fill='#FF0000'/>\n<path class='atom-6' d='M 74.3638 4.83825\nL 75.7558 7.08825\nQ 75.8938 7.31025, 76.1158 7.71225\nQ 76.3378 8.11425, 76.3498 8.13825\nL 76.3498 4.83825\nL 76.9138 4.83825\nL 76.9138 9.08625\nL 76.3318 9.08625\nL 74.8378 6.62625\nQ 74.6638 6.33825, 74.4778 6.00825\nQ 74.2978 5.67825, 74.2438 5.57625\nL 74.2438 9.08625\nL 73.6918 9.08625\nL 73.6918 4.83825\nL 74.3638 4.83825\n' fill='#0000FF'/>\n<path class='atom-6' d='M 73.6408 0.165449\nL 74.2168 0.165449\nL 74.2168 1.97145\nL 76.3888 1.97145\nL 76.3888 0.165449\nL 76.9648 0.165449\nL 76.9648 4.41345\nL 76.3888 4.41345\nL 76.3888 2.45145\nL 74.2168 2.45145\nL 74.2168 4.41345\nL 73.6408 4.41345\nL 73.6408 0.165449\n' fill='#0000FF'/>\n<path class='atom-8' d='M 82.7394 25.7458\nQ 82.7394 24.7258, 83.2434 24.1558\nQ 83.7474 23.5858, 84.6894 23.5858\nQ 85.6314 23.5858, 86.1354 24.1558\nQ 86.6394 24.7258, 86.6394 25.7458\nQ 86.6394 26.7778, 86.1294 27.3658\nQ 85.6194 27.9478, 84.6894 27.9478\nQ 83.7534 27.9478, 83.2434 27.3658\nQ 82.7394 26.7838, 82.7394 25.7458\nM 84.6894 27.4678\nQ 85.3374 27.4678, 85.6854 27.0358\nQ 86.0394 26.5978, 86.0394 25.7458\nQ 86.0394 24.9118, 85.6854 24.4918\nQ 85.3374 24.0658, 84.6894 24.0658\nQ 84.0414 24.0658, 83.6874 24.4858\nQ 83.3394 24.9058, 83.3394 25.7458\nQ 83.3394 26.6038, 83.6874 27.0358\nQ 84.0414 27.4678, 84.6894 27.4678\n' fill='#FF0000'/>\n<path class='atom-9' d='M 95.3137 6.095\nL 96.7057 8.345\nQ 96.8437 8.567, 97.0657 8.969\nQ 97.2877 9.371, 97.2997 9.395\nL 97.2997 6.095\nL 97.8637 6.095\nL 97.8637 10.343\nL 97.2817 10.343\nL 95.7877 7.883\nQ 95.6137 7.595, 95.4277 7.265\nQ 95.2477 6.935, 95.1937 6.833\nL 95.1937 10.343\nL 94.6417 10.343\nL 94.6417 6.095\nL 95.3137 6.095\n' fill='#0000FF'/>\n<path class='atom-9' d='M 94.5907 1.4222\nL 95.1667 1.4222\nL 95.1667 3.2282\nL 97.3387 3.2282\nL 97.3387 1.4222\nL 97.9147 1.4222\nL 97.9147 5.6702\nL 97.3387 5.6702\nL 97.3387 3.7082\nL 95.1667 3.7082\nL 95.1667 5.6702\nL 94.5907 5.6702\nL 94.5907 1.4222\n' fill='#0000FF'/>\n<path class='atom-13' d='M 125.65 26.1233\nL 127.042 28.3733\nQ 127.18 28.5953, 127.402 28.9973\nQ 127.624 29.3993, 127.636 29.4233\nL 127.636 26.1233\nL 128.2 26.1233\nL 128.2 30.3713\nL 127.618 30.3713\nL 126.124 27.9113\nQ 125.95 27.6233, 125.764 27.2933\nQ 125.584 26.9633, 125.53 26.8613\nL 125.53 30.3713\nL 124.978 30.3713\nL 124.978 26.1233\nL 125.65 26.1233\n' fill='#0000FF'/>\n</svg>\n","37495":"<?xml version='1.0' encoding='iso-8859-1'?>\n<svg version='1.1' baseProfile='full'\n xmlns='http://www.w3.org/2000/svg'\n xmlns:rdkit='http://www.rdkit.org/xml'\n xmlns:xlink='http://www.w3.org/1999/xlink'\n xml:space='preserve'\nwidth='150px' height='34px' viewBox='0 0 150 34'>\n<!-- END OF HEADER -->\n<path class='bond-0' d='M 26.9482,10.7073 L 30.3517,15.8718' style='fill:none;fill-rule:evenodd;stroke:#FF0000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-0' d='M 30.3517,15.8718 L 33.7552,21.0363' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-1' d='M 33.7552,21.0363 L 50.0045,20.075' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-2' d='M 50.0045,20.075 L 57.2966,5.52214' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-13' d='M 50.0045,20.075 L 58.9616,33.6667' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-3' d='M 57.2966,5.52214 L 73.5458,4.56084' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-4' d='M 73.5458,4.56084 L 76.9815,9.77419' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-4' d='M 76.9815,9.77419 L 80.4172,14.9875' style='fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-5' d='M 85.1998,17.9929 L 91.976,17.592' style='fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-5' d='M 91.976,17.592 L 98.7522,17.1912' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-11' d='M 80.901,21.3494 L 78.0559,27.0274' style='fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-11' d='M 78.0559,27.0274 L 75.2108,32.7054' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-6' d='M 98.7522,17.1912 L 102.188,22.4045' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-6' d='M 102.188,22.4045 L 105.624,27.6179' style='fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-6' d='M 102.501,16.9637 L 104.906,20.6131' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-6' d='M 104.906,20.6131 L 107.311,24.2624' style='fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-14' d='M 98.7522,17.1912 L 101.597,11.5132' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-14' d='M 101.597,11.5132 L 104.442,5.83521' style='fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-7' d='M 110.406,30.6232 L 117.182,30.2224' style='fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-7' d='M 117.182,30.2224 L 123.959,29.8215' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-8' d='M 123.959,29.8215 L 131.251,15.2686' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-8' d='M 122.142,26.1801 L 127.246,15.9931' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-9' d='M 131.251,15.2686 L 122.294,1.67696' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-10' d='M 122.294,1.67696 L 115.517,2.07783' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-10' d='M 115.517,2.07783 L 108.741,2.47871' style='fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-10' d='M 120.453,5.04707 L 115.71,5.32768' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-10' d='M 115.71,5.32768 L 110.966,5.6083' style='fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-12' d='M 75.2108,32.7054 L 58.9616,33.6667' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='atom-0' d='M 18.7493 5.16585\nL 19.3743 5.16585\nL 19.3743 7.12568\nL 21.7314 7.12568\nL 21.7314 5.16585\nL 22.3564 5.16585\nL 22.3564 9.77569\nL 21.7314 9.77569\nL 21.7314 7.64657\nL 19.3743 7.64657\nL 19.3743 9.77569\nL 18.7493 9.77569\nL 18.7493 5.16585\n' fill='#FF0000'/>\n<path class='atom-0' d='M 22.682 7.45775\nQ 22.682 6.35087, 23.2289 5.73232\nQ 23.7758 5.11376, 24.7981 5.11376\nQ 25.8203 5.11376, 26.3672 5.73232\nQ 26.9142 6.35087, 26.9142 7.45775\nQ 26.9142 8.57765, 26.3607 9.21574\nQ 25.8073 9.84731, 24.7981 9.84731\nQ 23.7823 9.84731, 23.2289 9.21574\nQ 22.682 8.58416, 22.682 7.45775\nM 24.7981 9.32642\nQ 25.5013 9.32642, 25.8789 8.85763\nQ 26.2631 8.38232, 26.2631 7.45775\nQ 26.2631 6.55271, 25.8789 6.09694\nQ 25.5013 5.63465, 24.7981 5.63465\nQ 24.0949 5.63465, 23.7107 6.09042\nQ 23.3331 6.5462, 23.3331 7.45775\nQ 23.3331 8.38883, 23.7107 8.85763\nQ 24.0949 9.32642, 24.7981 9.32642\n' fill='#FF0000'/>\n<path class='atom-5' d='M 81.484 15.8475\nL 82.9945 18.2892\nQ 83.1443 18.5301, 83.3852 18.9663\nQ 83.6261 19.4026, 83.6391 19.4286\nL 83.6391 15.8475\nL 84.2512 15.8475\nL 84.2512 20.4574\nL 83.6196 20.4574\nL 81.9983 17.7878\nQ 81.8095 17.4753, 81.6077 17.1172\nQ 81.4124 16.7591, 81.3538 16.6484\nL 81.3538 20.4574\nL 80.7547 20.4574\nL 80.7547 15.8475\nL 81.484 15.8475\n' fill='#0000FF'/>\n<path class='atom-7' d='M 106.69 28.4779\nL 108.201 30.9195\nQ 108.351 31.1604, 108.592 31.5967\nQ 108.832 32.0329, 108.846 32.059\nL 108.846 28.4779\nL 109.458 28.4779\nL 109.458 33.0877\nL 108.826 33.0877\nL 107.205 30.4182\nQ 107.016 30.1056, 106.814 29.7475\nQ 106.619 29.3894, 106.56 29.2787\nL 106.56 33.0877\nL 105.961 33.0877\nL 105.961 28.4779\nL 106.69 28.4779\n' fill='#0000FF'/>\n<path class='atom-11' d='M 105.025 0.333333\nL 106.536 2.77498\nQ 106.686 3.01589, 106.927 3.45213\nQ 107.167 3.88837, 107.181 3.91442\nL 107.181 0.333333\nL 107.793 0.333333\nL 107.793 4.94317\nL 107.161 4.94317\nL 105.54 2.27363\nQ 105.351 1.9611, 105.149 1.60299\nQ 104.954 1.24488, 104.895 1.13419\nL 104.895 4.94317\nL 104.296 4.94317\nL 104.296 0.333333\nL 105.025 0.333333\n' fill='#0000FF'/>\n</svg>\n","37496":"<?xml version='1.0' encoding='iso-8859-1'?>\n<svg version='1.1' baseProfile='full'\n xmlns='http://www.w3.org/2000/svg'\n xmlns:rdkit='http://www.rdkit.org/xml'\n xmlns:xlink='http://www.w3.org/1999/xlink'\n xml:space='preserve'\nwidth='150px' height='34px' viewBox='0 0 150 34'>\n<!-- END OF HEADER -->\n<path class='bond-0' d='M 41.3545,17.2993 L 45.4404,16.1883' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-0' d='M 45.4404,16.1883 L 49.5264,15.0772' style='fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-1' d='M 53.8887,16.5913 L 56.6452,19.3274' style='fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-1' d='M 56.6452,19.3274 L 59.4017,22.0635' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-2' d='M 59.4017,22.0635 L 69.8006,19.2359' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-3' d='M 70.8425,19.5109 L 71.8442,15.7165' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-3' d='M 71.8442,15.7165 L 72.8459,11.9221' style='fill:none;fill-rule:evenodd;stroke:#FF0000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-3' d='M 68.7586,18.9608 L 69.7603,15.1664' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-3' d='M 69.7603,15.1664 L 70.7619,11.372' style='fill:none;fill-rule:evenodd;stroke:#FF0000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-4' d='M 69.8006,19.2359 L 72.557,21.972' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-4' d='M 72.557,21.972 L 75.3135,24.7081' style='fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-5' d='M 79.6759,26.2222 L 83.7618,25.1111' style='fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-5' d='M 83.7618,25.1111 L 87.8477,24.0001' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-6' d='M 87.8477,24.0001 L 90.5983,13.5805' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-6' d='M 90.3442,22.9873 L 92.2696,15.6936' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-12' d='M 87.8477,24.0001 L 90.6042,26.7362' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-12' d='M 90.6042,26.7362 L 93.3606,29.4723' style='fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-7' d='M 90.5983,13.5805 L 100.997,10.7529' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-8' d='M 100.997,10.7529 L 103.748,0.333333' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-9' d='M 100.997,10.7529 L 108.645,18.3447' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-9' d='M 100.626,13.4213 L 105.98,18.7356' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-10' d='M 108.645,18.3447 L 105.895,28.7643' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-11' d='M 105.895,28.7643 L 101.809,29.8753' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-11' d='M 101.809,29.8753 L 97.723,30.9864' style='fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-11' d='M 104.104,27.0178 L 101.243,27.7955' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-11' d='M 101.243,27.7955 L 98.3833,28.5733' style='fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='atom-1' d='M 50.8144 12.3477\nL 52.2064 14.5977\nQ 52.3444 14.8197, 52.5664 15.2217\nQ 52.7884 15.6237, 52.8004 15.6477\nL 52.8004 12.3477\nL 53.3644 12.3477\nL 53.3644 16.5957\nL 52.7824 16.5957\nL 51.2884 14.1357\nQ 51.1144 13.8477, 50.9284 13.5177\nQ 50.7484 13.1877, 50.6944 13.0857\nL 50.6944 16.5957\nL 50.1424 16.5957\nL 50.1424 12.3477\nL 50.8144 12.3477\n' fill='#0000FF'/>\n<path class='atom-1' d='M 50.0914 7.67485\nL 50.6674 7.67485\nL 50.6674 9.48085\nL 52.8394 9.48085\nL 52.8394 7.67485\nL 53.4154 7.67485\nL 53.4154 11.9229\nL 52.8394 11.9229\nL 52.8394 9.96085\nL 50.6674 9.96085\nL 50.6674 11.9229\nL 50.0914 11.9229\nL 50.0914 7.67485\n' fill='#0000FF'/>\n<path class='atom-4' d='M 70.6012 8.82832\nQ 70.6012 7.80832, 71.1052 7.23832\nQ 71.6092 6.66832, 72.5512 6.66832\nQ 73.4932 6.66832, 73.9972 7.23832\nQ 74.5012 7.80832, 74.5012 8.82832\nQ 74.5012 9.86032, 73.9912 10.4483\nQ 73.4812 11.0303, 72.5512 11.0303\nQ 71.6152 11.0303, 71.1052 10.4483\nQ 70.6012 9.86632, 70.6012 8.82832\nM 72.5512 10.5503\nQ 73.1992 10.5503, 73.5472 10.1183\nQ 73.9012 9.68032, 73.9012 8.82832\nQ 73.9012 7.99432, 73.5472 7.57432\nQ 73.1992 7.14832, 72.5512 7.14832\nQ 71.9032 7.14832, 71.5492 7.56832\nQ 71.2012 7.98832, 71.2012 8.82832\nQ 71.2012 9.68632, 71.5492 10.1183\nQ 71.9032 10.5503, 72.5512 10.5503\n' fill='#FF0000'/>\n<path class='atom-5' d='M 76.5098 24.7037\nL 77.9018 26.9537\nQ 78.0398 27.1757, 78.2618 27.5777\nQ 78.4838 27.9797, 78.4958 28.0037\nL 78.4958 24.7037\nL 79.0598 24.7037\nL 79.0598 28.9517\nL 78.4778 28.9517\nL 76.9838 26.4917\nQ 76.8098 26.2037, 76.6238 25.8737\nQ 76.4438 25.5437, 76.3898 25.4417\nL 76.3898 28.9517\nL 75.8378 28.9517\nL 75.8378 24.7037\nL 76.5098 24.7037\n' fill='#0000FF'/>\n<path class='atom-5' d='M 75.7868 29.3765\nL 76.3628 29.3765\nL 76.3628 31.1825\nL 78.5348 31.1825\nL 78.5348 29.3765\nL 79.1108 29.3765\nL 79.1108 33.6245\nL 78.5348 33.6245\nL 78.5348 31.6625\nL 76.3628 31.6625\nL 76.3628 33.6245\nL 75.7868 33.6245\nL 75.7868 29.3765\n' fill='#0000FF'/>\n<path class='atom-12' d='M 94.557 29.4679\nL 95.949 31.7179\nQ 96.087 31.9399, 96.309 32.3419\nQ 96.531 32.7439, 96.543 32.7679\nL 96.543 29.4679\nL 97.107 29.4679\nL 97.107 33.7159\nL 96.525 33.7159\nL 95.031 31.2559\nQ 94.857 30.9679, 94.671 30.6379\nQ 94.491 30.3079, 94.437 30.2059\nL 94.437 33.7159\nL 93.885 33.7159\nL 93.885 29.4679\nL 94.557 29.4679\n' fill='#0000FF'/>\n</svg>\n","37497":"<?xml version='1.0' encoding='iso-8859-1'?>\n<svg version='1.1' baseProfile='full'\n xmlns='http://www.w3.org/2000/svg'\n xmlns:rdkit='http://www.rdkit.org/xml'\n xmlns:xlink='http://www.w3.org/1999/xlink'\n xml:space='preserve'\nwidth='150px' height='34px' viewBox='0 0 150 34'>\n<!-- END OF HEADER -->\n<path class='bond-0' d='M 20.6464,3.86355 L 29.9292,13.0773' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-1' d='M 29.9292,13.0773 L 42.5498,9.64505' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-2' d='M 42.5498,9.64505 L 51.8325,18.8588' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-3' d='M 50.568,18.525 L 49.2813,23.3997' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-3' d='M 49.2813,23.3997 L 47.9946,28.2744' style='fill:none;fill-rule:evenodd;stroke:#FF0000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-3' d='M 53.0971,19.1926 L 51.8104,24.0673' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-3' d='M 51.8104,24.0673 L 50.5237,28.942' style='fill:none;fill-rule:evenodd;stroke:#FF0000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-4' d='M 51.8325,18.8588 L 56.9635,17.4634' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-4' d='M 56.9635,17.4634 L 62.0946,16.068' style='fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-5' d='M 66.7006,17.6572 L 70.2183,21.1487' style='fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-5' d='M 70.2183,21.1487 L 73.7359,24.6402' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-6' d='M 73.7359,24.6402 L 86.3566,21.208' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-7' d='M 86.3566,21.208 L 90.3152,24.3892' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-7' d='M 90.3152,24.3892 L 94.2738,27.5705' style='fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-7' d='M 89.1828,20.1234 L 91.9538,22.3502' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-7' d='M 91.9538,22.3502 L 94.7248,24.5771' style='fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-15' d='M 86.3566,21.208 L 88.1348,16.5234' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-15' d='M 88.1348,16.5234 L 89.913,11.8389' style='fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-8' d='M 98.8543,27.8933 L 103.174,25.065' style='fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-8' d='M 103.174,25.065 L 107.494,22.2367' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-9' d='M 107.494,22.2367 L 120.14,25.5747' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-9' d='M 110.058,20.2082 L 118.911,22.5448' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-16' d='M 107.494,22.2367 L 104.062,9.61606' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-10' d='M 120.14,25.5747 L 129.354,16.2919' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-11' d='M 129.354,16.2919 L 125.921,3.67128' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-11' d='M 126.315,15.0853 L 123.912,6.25082' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-12' d='M 125.921,3.67128 L 113.275,0.333333' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-13' d='M 113.275,0.333333 L 104.062,9.61606' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-13' d='M 113.75,3.56848 L 107.3,10.0664' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-14' d='M 104.062,9.61606 L 98.7166,9.35593' style='fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='bond-14' d='M 98.7166,9.35593 L 93.3716,9.0958' style='fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1' />\n<path class='atom-4' d='M 46.5446 31.5167\nQ 46.5446 30.4967, 47.0486 29.9267\nQ 47.5526 29.3567, 48.4946 29.3567\nQ 49.4366 29.3567, 49.9406 29.9267\nQ 50.4446 30.4967, 50.4446 31.5167\nQ 50.4446 32.5487, 49.9346 33.1367\nQ 49.4246 33.7187, 48.4946 33.7187\nQ 47.5586 33.7187, 47.0486 33.1367\nQ 46.5446 32.5547, 46.5446 31.5167\nM 48.4946 33.2387\nQ 49.1426 33.2387, 49.4906 32.8067\nQ 49.8446 32.3687, 49.8446 31.5167\nQ 49.8446 30.6827, 49.4906 30.2627\nQ 49.1426 29.8367, 48.4946 29.8367\nQ 47.8466 29.8367, 47.4926 30.2567\nQ 47.1446 30.6767, 47.1446 31.5167\nQ 47.1446 32.3747, 47.4926 32.8067\nQ 47.8466 33.2387, 48.4946 33.2387\n' fill='#FF0000'/>\n<path class='atom-5' d='M 63.5142 13.3025\nL 64.9062 15.5525\nQ 65.0442 15.7745, 65.2662 16.1765\nQ 65.4882 16.5785, 65.5002 16.6025\nL 65.5002 13.3025\nL 66.0642 13.3025\nL 66.0642 17.5505\nL 65.4822 17.5505\nL 63.9882 15.0905\nQ 63.8142 14.8025, 63.6282 14.4725\nQ 63.4482 14.1425, 63.3942 14.0405\nL 63.3942 17.5505\nL 62.8422 17.5505\nL 62.8422 13.3025\nL 63.5142 13.3025\n' fill='#0000FF'/>\n<path class='atom-5' d='M 62.7912 8.62974\nL 63.3672 8.62974\nL 63.3672 10.4357\nL 65.5392 10.4357\nL 65.5392 8.62974\nL 66.1152 8.62974\nL 66.1152 12.8777\nL 65.5392 12.8777\nL 65.5392 10.9157\nL 63.3672 10.9157\nL 63.3672 12.8777\nL 62.7912 12.8777\nL 62.7912 8.62974\n' fill='#0000FF'/>\n<path class='atom-8' d='M 95.6126 27.277\nL 97.0046 29.527\nQ 97.1426 29.749, 97.3646 30.151\nQ 97.5866 30.553, 97.5986 30.577\nL 97.5986 27.277\nL 98.1626 27.277\nL 98.1626 31.525\nL 97.5806 31.525\nL 96.0866 29.065\nQ 95.9126 28.777, 95.7266 28.447\nQ 95.5466 28.117, 95.4926 28.015\nL 95.4926 31.525\nL 94.9406 31.525\nL 94.9406 27.277\nL 95.6126 27.277\n' fill='#0000FF'/>\n<path class='atom-15' d='M 85.5651 6.85629\nL 86.1411 6.85629\nL 86.1411 8.66229\nL 88.3131 8.66229\nL 88.3131 6.85629\nL 88.8891 6.85629\nL 88.8891 11.1043\nL 88.3131 11.1043\nL 88.3131 9.14229\nL 86.1411 9.14229\nL 86.1411 11.1043\nL 85.5651 11.1043\nL 85.5651 6.85629\n' fill='#0000FF'/>\n<path class='atom-15' d='M 90.0591 6.85629\nL 91.4511 9.10629\nQ 91.5891 9.32829, 91.8111 9.73029\nQ 92.0331 10.1323, 92.0451 10.1563\nL 92.0451 6.85629\nL 92.6091 6.85629\nL 92.6091 11.1043\nL 92.0271 11.1043\nL 90.5331 8.64429\nQ 90.3591 8.35629, 90.1731 8.02629\nQ 89.9931 7.69629, 89.9391 7.59429\nL 89.9391 11.1043\nL 89.3871 11.1043\nL 89.3871 6.85629\nL 90.0591 6.85629\n' fill='#0000FF'/>\n</svg>\n"}}},"projectReducers":{"currentProject":{"projectID":null,"authorID":null,"title":null,"description":null,"targetID":null,"tags":[],"type":null},"isLoadingCurrentSnapshot":false,"currentSnapshot":{"id":null,"type":"INIT","title":"Initial Snapshot","author":null,"description":"Auto generated initial snapshot","created":"2021-01-25T16:38:22.547Z","parent":null,"children":[],"data":{"apiReducers":{"target_id_list":[{"id":2,"title":"NUDT7A","project_id":[2],"protein_set":[15617,15618,15619,15620,15621,15622,15623,15624,15625,15626,15627,15628,15629,15630,15631],"template_protein":"/media/pdbs/NUDT7A-x0140_1_apo_hYaNUGN.pdb","metadata":null,"zip_archive":null},{"id":4,"title":"ATAD","project_id":[2],"protein_set":[13044,13045,13046,13047,13048,13049,13050,13051],"template_protein":"/media/pdbs/ATAD2A-x1712_1_apo_QcCBCZx.pdb","metadata":null,"zip_archive":null},{"id":5,"title":"BRD1A","project_id":[2],"protein_set":[13055,13056,13057,13058,13059,13060,13061,13062,13063,13064,13065,13066,13067,13068,13069,13070,13071,13072,13073],"template_protein":"/media/pdbs/BRD1A-x0900_1_apo_X36iTCu.pdb","metadata":null,"zip_archive":null},{"id":7,"title":"DCP2B","project_id":[2],"protein_set":[14666,14667,14668,14669,14670,14671,14672,14673,14674,14675,14676,14677,14678,14679,14680,14681,14682,14683,14684,14685,14686,14687,14688,14689,14690,14691,14692,14693,14694,14695,14696,14697,14698,14699,14700,14701,14702,14703,14704,14705,14706,14707,14708,14709,14710,14711,14712,14713,14714,14715,14716,14717,14718,14719,14720,14721,14722,14723,14724,14725,14726,14727,14728,14729,14730,14731,14732,14733,14734,14735,14736,14737,14738],"template_protein":"/media/pdbs/DCP2B-x0020_1_apo_5td9srg.pdb","metadata":null,"zip_archive":null},{"id":8,"title":"FAM83BA","project_id":[2],"protein_set":[13325,13326,13327,13328,13329,13330,13331,13332,13333,13334,13335,13336,13337,13338],"template_protein":"/media/pdbs/FAM83BA-x0131_1_apo_G2blbbF.pdb","metadata":null,"zip_archive":null},{"id":12,"title":"MURD","project_id":[2],"protein_set":[6378,6379,6380,6381],"template_protein":"/media/pdbs/MURD-x0349_apo_0Z35oUA.pdb","metadata":null,"zip_archive":null},{"id":15,"title":"NUDT4A","project_id":[2],"protein_set":[13536,13537,13538,13539,13540,13541,13542,13543],"template_protein":"/media/pdbs/NUDT4A-x0159_1_apo_MptlW5D.pdb","metadata":null,"zip_archive":null},{"id":17,"title":"OXA10OTA","project_id":[2],"protein_set":[13953,13954,13955,13956,13957,13958,13959,13960,13961,13962,13963,13964,13965,13966,13967,13968,13969,13970],"template_protein":"/media/pdbs/OXA10OTA-x0038_1_apo_b0APxOF.pdb","metadata":null,"zip_archive":null},{"id":18,"title":"PARP14A","project_id":[2],"protein_set":[13971,13972,13973,13974,13975,13976,13977,13978,13979,13980,13981,13982,13983,13984,13985,13986,13987,13988],"template_protein":"/media/pdbs/PARP14A-x0137_1_apo_RiuanPQ.pdb","metadata":null,"zip_archive":null},{"id":19,"title":"PHIPA","project_id":[2],"protein_set":[32646,32657,32651,32628,32655,32616,32629,32620,32640,32611,32630,32623,32653,32617,32631,32618,32648,32641,32619,32632,32634,32654,32659,32622,32642,32615,32612,32625,32660,32621,32626,32649,32643,32627,32663,32635,32644,32662,32656,32650,32639,32645,32647,32614,32652,32613,32636,32658,32624,32661,32638,32633,32637],"template_protein":"/media/pdbs/PHIPA-x20671_0_apo.pdb","metadata":"https://fragalysis.apps.xchem.diamond.ac.uk/media/metadata/metadata_oHB8XOf.csv","zip_archive":"https://fragalysis.apps.xchem.diamond.ac.uk/media/targets/PHIPA.zip"},{"id":20,"title":"PTP1B","project_id":[2],"protein_set":[6480,6481,6482,6483,6484,6485,6486,6487,6488,6489,6490,6491,6492,6493,6494,6495,6496,6497,6498,6499,6500,6501,6502,6503,6504,6505,6506,6507,6508,6509,6510,6511,6512,6513,6514,6515,6516,6517,6518,6519,6520,6521,6522,6523,6524,6525,6526,6527,6528,6529,6530,6531,6532,6533,6534,6535,6536,6537,6538,6539,6540,6541,6542,6543,6544,6545,6546,6547,6548,6549,6550,6551,6552,6553,6554,6555,6556,6557,6558,6559,6560,6561,6562,6563,6564,6565,6566,6567,6568,6569,6570,6571,6572,6573,6574,6575,6576,6577,6578,6579,6580,6581,6582,6583,6584,6585,6586,6587,6588,6589,6590,6591,6592,6593,6594,6595,6596,6597,6598,6599,6600,6601,6602,6603,6604,6605,6606,6607,6608,6609,6610,6611,6612,6613,6614,6615,6616,6617,6618],"template_protein":"/media/pdbs/PTP1B-y0049_apo_N9naW4T.pdb","metadata":null,"zip_archive":null},{"id":22,"title":"SMTGR","project_id":[2],"protein_set":[7192,7193,7194,7195,7196,7197,7198,7199,7200,7201,7202,7203,7204,7205,7206,7207,7208,7209,7210,7211,7212,7213,7214,7215],"template_protein":"/media/pdbs/smTGR-x2053_apo_zrHDWbw.pdb","metadata":null,"zip_archive":null},{"id":29,"title":"ATAD2A","project_id":[2],"protein_set":[13052,13053,13054],"template_protein":"/media/pdbs/ATAD2A-x1803_1_apo_D4wOsMM.pdb","metadata":null,"zip_archive":null},{"id":30,"title":"CAMK1DA","project_id":[2],"protein_set":[13074,13075,13076,13077,13078,13079,13080,13081,13082,13083,13084,13085,13086,13087,13088,13089,13090,13091,13092],"template_protein":"/media/pdbs/CAMK1DA-x0049_1_apo_Xd3Xer3.pdb","metadata":null,"zip_archive":null},{"id":31,"title":"DCLRE1AA","project_id":[2],"protein_set":[13247,13218,13219,13220,13221,13222,13223,13224,13225,13226,13227,13228,13229,13230,13231,13232,13233,13234,13235,13236,13237,13238,13239,13240,13241,13242,13243,13244,13245,13246,13248,13249,13250,13251],"template_protein":"/media/pdbs/DCLRE1AA-x1013_1_apo_98NeoJT.pdb","metadata":null,"zip_archive":null},{"id":32,"title":"FALZA","project_id":[2],"protein_set":[6928,6929,6930,6931,6932,6933,6934,6935],"template_protein":"/media/pdbs/FALZA-x0079_1_apo_pDzqSU5.pdb","metadata":null,"zip_archive":null},{"id":35,"title":"HAO1A","project_id":[2],"protein_set":[6938,6939,6940,6941,6942,6943,6944,6945,6946,6947,6948,6949,6950,6951,6952,6953,6954,6955,6956,6957,6958,6959,6960,6961,6962,6963,6964,6965,6966,6967,6968,6969,6970,6971,6972,6973,6974,6975,6976,6977,6978,6979,6980,6981,6982,6983],"template_protein":"/media/pdbs/HAO1A-x0208_1_apo_MQrMrik.pdb","metadata":null,"zip_archive":null},{"id":37,"title":"MUREECA","project_id":[2],"protein_set":[17944,17945,17946,17947,17948,17949,17950,17951,17952,17953,17954,17955,17956,17957,17958,17959,17960,17961,17962,17963,17964,17965],"template_protein":"/media/pdbs/MUREECA-x0114_1_apo_SbbuYzF.pdb","metadata":null,"zip_archive":null},{"id":38,"title":"NUDT21A","project_id":[2],"protein_set":[13491,13492,13493,13494,13495,13496,13497,13498,13499,13500,13501,13502,13503,13504,13505,13506,13507,13508,13509,13510,13511,13512,13513,13514,13515,13516,13517,13518,13519,13520,13521,13522,13523,13524,13525,13526,13527,13528,13529,13530,13531,13532,13533,13534,13535],"template_protein":"/media/pdbs/NUDT21A-x0159_1_apo_VSKfMPI.pdb","metadata":null,"zip_archive":null},{"id":39,"title":"NUDT4","project_id":[2],"protein_set":[7069,7070,7071,7072,7073,7074],"template_protein":"/media/pdbs/NUDT4A-x0159_apo_Z09M2Hp.pdb","metadata":null,"zip_archive":null},{"id":40,"title":"NUDT5A","project_id":[2],"protein_set":[18136,18137,18138,18139,18140,18141,18142,18143,18144,18145,18146,18147,18148,18149,18150,18151,18152,18153,18154,18155,18156,18157,18158,18159,18160,18161,18162,18163,18164,18165,18166,18167,18168,18169,18170,18171,18172,18173,18174,18175,18176,18177,18178,18179,18180,18181,18182,18183,18184,18185,18186,18187,18188,18189,18190,18191,18192,18193,18194,18195,18196,18197,18198,18199,18200,18201,18202,18203,18204,18205,18206,18207,18208,18209,18210,18211,18212,18213,18214,18215,18216,18217,18218,18219,18220,18221,18222,18223,18224,18225,18226,18227,18228,18229,18230,18231,18232,18233,18234,18235,18236,18237,18238,18239,18240,18241,18242,18243,18244,18245,18246,18247,18248,18249,18250,18251,18252,18253,18254,18255,18256,18257,18258,18259,18260,18261,18262,18263,18264,18265,18266,18267,18268,18269,18270,18271,18272,18273,18274,18275,18276,18277,18278,18279,18280,18281,18282,18283,18284,18285,18286,18287,18288,18289,18290,18291,18292,18293,18294,18295,18296,18297,18298,18299,18300,18301,18302,18303,18304],"template_protein":"/media/pdbs/NUDT5A-x0114_1_apo_lZ7GhcD.pdb","metadata":null,"zip_archive":null},{"id":41,"title":"NUDT7A_CRUDE","project_id":[2],"protein_set":[13690,13657,13658,13659,13660,13661,13662,13663,13664,13665,13666,13667,13668,13669,13670,13671,13672,13673,13674,13675,13676,13677,13678,13679,13680,13681,13682,13683,13684,13685,13686,13687,13688,13689,13691,13692,13693,13694,13695,13696,13697,13698,13699,13700,13701,13702,13703,13704,13705,13706,13707,13708,13709,13710,13711,13712,13713,13714,13715,13716,13717,13718,13719,13720,13721,13722,13723,13724,13725,13726,13727,13728,13729,13730,13731,13732,13733,13734,13735,13736,13737,13738,13739,13740,13741,13742,13743,13744,13745,13746,13747,13748,13749,13750,13751,13752,13753,13754,13755,13756,13757,13758,13759,13760,13761,13762,13763,13764,13765,13766,13767,13768,13769,13770,13771,13772,13773,13774,13775,13776,13777,13778,13779,13780,13781,13782,13783,13784,13785,13786,13787,13788,13789,13790,13791,13792,13793,13794,13795,13796,13797,13798,13799,13800,13801,13802,13803,13804,13805,13806,13807,13808,13809,13810,13811,13812,13813,13814,13815,13816,13817,13818,13819,13820,13821,13822,13823,13824,13825,13826,13827,13828,13829,13830,13831,13832,13833,13834,13835,13836,13837,13838,13839,13840,13841,13842,13843,13844,13845,13846,13847,13848,13849,13850,13851,13852,13853,13854,13855,13856,13857,13858,13859,13860,13861,13862,13863,13864,13865,13866,13867,13868,13869,13870,13871,13872,13873,13874,13875,13876,13877,13878,13879,13880,13881,13882,13883,13884,13885,13886,13887,13888,13889,13890,13891,13892,13893,13894,13895,13896,13897,13898,13899,13900,13901,13902,13903,13904,13905,13906,13907,13908,13909,13910,13911,13912,13913,13914,13915,13916,13917,13918,13919,13920,13921,13922,13923,13924,13925,13926,13927,13928,13929,13930,13931,13932,13933,13934,13935,13936,13937,13938,13939,13940,13941,13942,13943,13944,13945,13946,13947,13948,13949,13950,13951],"template_protein":"/media/pdbs/NUDT7A_Crude-x0230_2_apo_NEcz29u.pdb","metadata":null,"zip_archive":null},{"id":46,"title":"smTGRNEW","project_id":[2],"protein_set":[7216,7217,7218,7219,7220,7221,7222,7223,7224],"template_protein":"/media/pdbs/smTGR-x20531_apo_ddCGiaP.pdb","metadata":null,"zip_archive":null},{"id":47,"title":"STAG1A","project_id":[2],"protein_set":[14789,14790,14791,14792,14793,14794,14795,14796,14797,14798,14799,14800,14801,14802,14803,14804,14805,14806,14807,14808,14809],"template_protein":"/media/pdbs/STAG1A-x0237_1_apo_T6h9LGK.pdb","metadata":null,"zip_archive":null},{"id":48,"title":"TBXTA","project_id":[2],"protein_set":[14810,14811,14812,14813,14814,14815,14816,14817,14818,14819,14820,14821,14822,14823,14824,14825,14826,14827,14828,14829,14830,14831,14832,14833,14834,14835,14836,14837,14838,14839,14840,14841,14842,14843,14844,14845,14846,14847,14848,14849,14850,14851,14852,14853,14854,14855,14856,14857,14858,14859,14860,14861,14862],"template_protein":"/media/pdbs/TBXTA-x0024_1_apo_kFHAPSk.pdb","metadata":null,"zip_archive":null},{"id":50,"title":"VIM2","project_id":[2],"protein_set":[14416,14414,14415,14410,14411,14412,14413,14417,14418,14419,14420,14421,14422,14423,14424,14425,14426,14427,14428,14429,14430,14431,14432,14433,14434,14435,14436,14437,14438,14439,14440,14441,14442,14443,14444,14445,14446,14447,14448,14449,14450,14451,14452,14453,14454,14455,14456,14457,14458,14459,14460,14461,14462,14463,14464,14465,14466,14467,14468,14469,14470,14471,14472,14473,14474,14475,14476,14477,14478,14479,14480,14481,14482,14483,14484,14485,14486,14487,14488,14489,14490,14491,14492,14493,14494,14495,14496,14497,14498,14499,14500,14501,14502,14503,14504,14505,14506,14507,14508,14509,14510,14511,14512,14513,14514,14515,14516,14517,14518,14519,14520,14521,14522,14523,14524,14525,14526,14527,14528,14529,14530,14531,14532,14533,14534,14535,14536,14537,14538,14539,14540,14541,14542,14543,14544,14545,14546,14547,14548,14549,14550,14551,14552,14553,14554,14555,14556,14557,14558,14559,14560,14561,14562,14563,14564,14565,14566,14567,14568,14569,14570,14571,14572,14573],"template_protein":"/media/pdbs/VIM2-MB-11_3_apo_rfpPQz8.pdb","metadata":null,"zip_archive":null},{"id":51,"title":"XX02KALRNA","project_id":[2],"protein_set":[14902,14903,14904,14905,14906,14907,14908,14909,14910,14911,14912,14913],"template_protein":"/media/pdbs/XX02KALRNA-x1376_1_apo_9VSCvR8.pdb","metadata":null,"zip_archive":null},{"id":52,"title":"TNCA","project_id":[2],"protein_set":[14354,14355,14356,14357,14358,14359,14360,14361,14362,14363,14364,14365,14366,14367,14368,14369,14370],"template_protein":"/media/pdbs/TNCA-x0062_1_apo_Vc9bxy2.pdb","metadata":null,"zip_archive":null},{"id":53,"title":"ALAS2A","project_id":[2],"protein_set":[17966],"template_protein":"NOT AVAILABLE","metadata":null,"zip_archive":null},{"id":54,"title":"EPB41L3A","project_id":[2],"protein_set":[18435,18460,31243,31233,31217,31218,31251,31234,31219,31220,31244,31235,31221,31222,18428,31223,31263,31224,31236,31225,31245,31226,31237,31227,31252,31228,31238,31229,31246,31230,31239,31231,31257,31232,31247,31240,31253,31241,31248,31242,31261,31254,31249,31258,31250,31255,31265,31259,31256,31262,31260,31264],"template_protein":"/media/pdbs/EPB41L3A-x0306_1_apo.pdb","metadata":"https://fragalysis.apps.xchem.diamond.ac.uk/media/metadata/metadata_NJuLr98.csv","zip_archive":"https://fragalysis.apps.xchem.diamond.ac.uk/media/targets/EPB41L3A.zip"},{"id":61,"title":"mArh","project_id":[2],"protein_set":[31678,31674,31681,31675,31671,31672,31679,31676,31673,31683,31677,31682,31680,31686,31685,31684,31687,31688,31689,31690,31691,31692,31693,31694,31695,31696,31697,31698,31700,31704,31701,31707,31702,31699,31705,31703,31710,31706,31709,31708,31711,31712,31713,31714,31715,31716,31717,31718,31719,31720,31721,31722,31723,31724,31725,31726,31727,31728,31729,31730,31731,31732,31733,31734,31747,31735,31756,31736,31748,31737,31738,31749,31739,31762,31757,31740,31750,31741,31742,31751,31743,31766,31758,31744,31752,31745,31746,31753,31763,31759,31754,31755,31769,31760,31764,31761,31767,31765,31772,31768,31771,31770,31773,31774,31775,31776,31777,31778,31779,31780,31794,31781,31810,31782,31795,31783,31804,31784,31796,31785,31818,31786,31815,31797,31787,31805,31788,31798,31789,31811,31790,31799,31791,31806,31792,31800,31793,31807,31801,31812,31802,31808,31803,31816,31809,31813,31822,31819,31814,31817,31821,31820,31823,31825,31824,31826,31827,31828,31829,31830,31831,31854,31832,31845,31833,31865,31834,31846,31835,31855,31836,31847,31837,31861,31838,31848,31839,31856,31840,31849,31841,31868,31842,31850,31843,31857,31844,31851,31862,31852,31858,31853,31866,31863,31859,31860,31872,31864,31867,31869,31871,31870,31916,31887,31898,31888,31873,31906,31874,31889,31875,31899,31876,31890,31877,31912,31878,31891,31879,31900,31880,31892,31881,31907,31882,31893,31883,31901,31884,31894,31885,31886,31919,31902,31895,31908,31896,31903,31897,31913,31909,31904,31905,31917,31914,31910,31911,31921,31915,31918,31920,31924,31922,31923,31925,31926,31927,31928,31929,31930,31931,31969,31932,31949,31933,31961,31934,31950,31935,31975,31936,31951,31937,31962,31938,31952,31939,31970,31940,31953,31941,31963,31942,31954,31943,31979,31944,31955,31945,31964,31946,31956,31947,31971,31948,31965,31957,31958,31976,31966,31959,31960,31972,31967,31982,31968,31973,31977,31980,31974,31984,31978,31983,31981,31987,31985,31986,31988,31989,31990,31991,31992,31993,31994,31996,31995,31997,31998,31999,32000,32001,32002,32003,32004,32005],"template_protein":"/media/pdbs/mArh-3ew5_B_0B_apo.pdb","metadata":"https://fragalysis.apps.xchem.diamond.ac.uk/media/metadata/metadata_7AuLXgA.csv","zip_archive":"https://fragalysis.apps.xchem.diamond.ac.uk/media/targets/mArh.zip"},{"id":65,"title":"INPP5DA","project_id":[2],"protein_set":[31501,31518,31510,31503,31504,31512,31505,31524,31506,31519,31513,31507,31508,31514,31509,31528,31515,31521,31516,31517,31525,31522,31523,31526,31535,31531,31527,31530,31532,31533,31534,31536,31537,31539,31499,31500,31540,31542,31550,31543,31544,31574,31551,31546,31565,31547,31552,31548,31549,31584,31553,31555,31566,31556,31575,31567,31557,31558,31580,31568,31559,31560,31576,31569,31561,31562,31587,31570,31564,31571,31577,31573,31578,31582,31579,31583,31585,31586,31588,31589,31591,31592,31593,31595,31596,31541,31594,31605,31606,31607,31597,31598,31599,31600,31601,31602,31603,31604,31502,31511,31520,31529,31538,31545,31554,31563,31572,31581,31590],"template_protein":"/media/pdbs/INPP5DA-x0021_0_apo.pdb","metadata":"https://fragalysis.apps.xchem.diamond.ac.uk/media/metadata/metadata_MR1dz1c.csv","zip_archive":"https://fragalysis.apps.xchem.diamond.ac.uk/media/targets/INPP5DA.zip"},{"id":66,"title":"nsp13","project_id":[2],"protein_set":[40304,40335,40336,40337,40338,40287,40276,40288,40289,40277,40290,40291,40278,40292,40279,40293,40280,40281,40282,40283,40284,40285,40286,40305,40294,40306,40307,40295,40308,40309,40296,40310,40297,40311,40298,40299,40300,40301,40302,40303,40323,40324,40312,40325,40313,40326,40327,40314,40328,40329,40315,40316,40317,40318,40319,40320,40321,40322,40330,40331,40332,40333,40334,40339,40340],"template_protein":"/media/pdbs/nsp13-x0257_0B_apo.pdb","metadata":"https://fragalysis.apps.xchem.diamond.ac.uk/media/metadata/metadata_Y8Y99vz.csv","zip_archive":"https://fragalysis.apps.xchem.diamond.ac.uk/media/targets/nsp13.zip"},{"id":67,"title":"Mac1","project_id":[2],"protein_set":[37438,37473,37407,37372,37380,37386,37371,37376,37373,37394,37388,37377,37374,37368,37385,37384,37382,37381,37390,37379,37389,37378,37375,37369,37391,37392,37393,37387,37383,37370,37399,37420,37405,37417,37414,37418,37404,37411,37408,37406,37395,37415,37421,37397,37401,37403,37402,37413,37412,37416,37423,37396,37410,37422,37419,37424,37409,37400,37447,37437,37456,37432,37434,37426,37463,37427,37436,37433,37453,37450,37444,37443,37442,37441,37451,37457,37435,37428,37460,37440,37425,37430,37455,37445,37431,37439,37459,37446,37467,37466,37458,37465,37448,37462,37461,37449,37454,37429,37464,37452,37492,37489,37491,37488,37487,37498,37495,37477,37480,37479,37476,37469,37474,37471,37496,37483,37499,37493,37494,37486,37485,37478,37490,37482,37500,37484,37481,37475,37470,37497,37516,37515,37514,37513,37512,37506,37503,37508,37511,37510,37502,37504,37591,37519,37561,37517,37520,37521,37565,37518,37501,37601,37558,37602,37538,37468,37507,37509,37398,37505,37472,37542,37545,37536,37523,37546,37563,37548,37552,37549,37525,37524,37539,37562,37551,37547,37553,37559,37555,37556,37550,37564,37566,37526,37522,37531,37529,37532,37535,37568,37560,37543,37554,37544,37527,37537,37530,37528,37533,37540,37534,37567,37557,37541,37592,37595,37578,37580,37589,37594,37597,37569,37596,37570,37598,37579,37590,37577,37584,37571,37588,37586,37587,37572,37593,37583,37581,37576,37575,37574,37573,37599,37600,37582,37585,37643,37625,37636,37638,37642,37615,37613,37624,37611,37603,37639,37610,37609,37612,37635,37633,37632,37637,37640,37621,37629,37626,37641,37618,37606,37604,37628,37622,37627,37617,37634,37623,37608,37605,37644,37607,37616,37620,37631,37630,37619,37614],"template_protein":"/media/pdbs/Mac1-DLS-X0681_0A_apo_YaUy11d.pdb","metadata":"https://fragalysis.apps.xchem.diamond.ac.uk/media/metadata/metadata_wAHiLRP.csv","zip_archive":"https://fragalysis.apps.xchem.diamond.ac.uk/media/targets/Mac1.zip"},{"id":68,"title":"Mpro","project_id":[2],"protein_set":[39984,40386,40041,40000,40008,40029,39960,40105,40159,39987,40114,40044,39896,40009,39962,40068,40033,40155,39935,40181,39929,40173,39889,39890,40063,40069,40138,40110,40144,40195,40021,39945,39895,39918,39904,39888,39891,39905,39892,39893,39902,39908,39898,39909,39907,39897,39900,39899,39906,39894,39903,39910,39901,39915,39912,39916,39913,39920,39911,39917,39922,39919,39924,39921,39925,39923,39914,39926,39927,39967,39959,39954,39958,39934,39933,39941,39953,39928,39972,39957,39956,39939,39975,39964,39949,39940,39944,39966,39943,39930,39938,39931,39942,39948,39932,39955,39936,39950,39969,39947,39946,39971,39961,39952,39937,39963,39977,39974,39951,39965,39970,39973,39968,39976,39982,39979,39978,39981,39980,39985,39988,39997,39991,39990,39995,39989,39998,39993,39996,39986,39992,39994,39999,39983,40003,40004,40007,40001,40005,40006,40002,40024,40014,40030,40059,40022,40011,40013,40040,40037,40012,40043,40060,40018,40056,40054,40025,40062,40026,40031,40057,40050,40051,40065,40052,40046,40038,40039,40058,40016,40035,40020,40010,40027,40042,40034,40023,40017,40028,40019,40053,40048,40047,40055,40045,40061,40064,40049,40032,40015,40036,40094,40082,40101,40078,40097,40119,40080,40118,40099,40067,40075,40091,40074,40121,40098,40096,40073,40093,40087,40079,40066,40076,40086,40120,40095,40090,40092,40083,40072,40109,40085,40088,40104,40117,40107,40081,40113,40108,40115,40089,40100,40111,40106,40112,40103,40084,40116,40070,40102,40077,40071,40124,40122,40127,40125,40128,40123,40126,40385,40130,40158,40168,40152,40154,40166,40167,40137,40132,40145,40133,40183,40134,40157,40136,40143,40162,40160,40142,40139,40151,40165,40140,40171,40135,40156,40147,40149,40163,40153,40164,40146,40150,40148,40161,40185,40141,40170,40175,40179,40174,40180,40172,40176,40182,40177,40169,40184,40178,40131,40129,40222,40224,40191,40189,40192,40201,40199,40193,40230,40212,40203,40187,40241,40188,40206,40196,40218,40194,40226,40239,40229,40207,40240,40213,40200,40236,40209,40198,40223,40227,40205,40210,40231,40215,40202,40233,40190,40197,40214,40220,40217,40235,40228,40204,40216,40186,40238,40211,40234,40232,40225,40237,40219,40208,40221,40405,40406,40407,40408,40341,40342,40343,40344,40345,40346,40347,40348,40349,40350,40351,40352,40353,40354,40355,40356,40357,40358,40359,40360,40361,40362,40363,40364,40365,40366,40367,40368,40369,40370,40371,40372,40373,40374,40375,40376,40377,40378,40379,40380,40381,40382,40383,40384,40387,40388,40389,40390,40391,40392,40393,40394,40395,40396,40397,40398,40399,40400,40401,40402,40403,40404,40409,40410,40411,40412,40413,40414,40415,40416,40417,40418,40419,40420,40421,40422,40423,40424,40425,40426,40427,40428,40429,40430,40431,40432,40433,40434,40435,40436,40437,40438,40439,40440,40441,40442,40443,40444,40445,40446,40447,40448,40449,40450,40451],"template_protein":"/media/pdbs/Mpro-x10417_0A_apo.pdb","metadata":"https://fragalysis.apps.xchem.diamond.ac.uk/media/metadata/metadata_hL61MZl.csv","zip_archive":"https://fragalysis.apps.xchem.diamond.ac.uk/media/targets/Mpro.zip"},{"id":69,"title":"NSP15_B","project_id":[2],"protein_set":[37646,37645,37652,37647,37650,37648,37653,37649],"template_protein":"/media/pdbs/NSP15_B-x0422_1B_apo.pdb","metadata":"https://fragalysis.apps.xchem.diamond.ac.uk/media/metadata/metadata.csv","zip_archive":"https://fragalysis.apps.xchem.diamond.ac.uk/media/targets/NSP15_B.zip"},{"id":70,"title":"MUREECOLI","project_id":[2],"protein_set":[40246,40263,40266,40260,40269,40272,40257,40275,40264,40261,40250,40247,40273,40254,40267,40258,40270,40251,40248,40274,40265,40245,40255,40262,40252,40259,40268,40249,40271,40256,40253,40242,40243,40244],"template_protein":"/media/pdbs/MUREECOLI-7B61_0B_apo_QRs2Wwd.pdb","metadata":"https://fragalysis.apps.xchem.diamond.ac.uk/media/metadata/metadata_GdyxtUF.csv","zip_archive":"https://fragalysis.apps.xchem.diamond.ac.uk/media/targets/MUREECOLI.zip"}],"mol_group_list":[{"id":238505,"group_type":"MC","mol_id":[37457,37466,37458,37460,37471,37461,37467,37462,37474,37463,37468,37464,37465,37469,37470,37473,37475,37478,37477,37483,37484,37486,37495,37496,37500,37497,37503,37506,37509,37515,37516,37517,37518,37527,37545,37521,37528,37530,37531,37548,37532,37533,37539,37540,37550,37549,37551,37554,37555,37556,37558,37580,37560,37568,37562,37569,37563,37565,37578,37576,37577,37581,37584],"target_id":67,"x_com":27.238283583303307,"y_com":49.21699084151727,"z_com":-7.016167950826643,"description":"A1 - Adenine site (XChem)"},{"id":238506,"group_type":"MC","mol_id":[37588,37591,37592,37605,37606,37607,37608,37599,37600,37609,37601,37602,37610,37603,37604,37611,37625,37612,37634,37613,37614,37641,37615,37635,37645,37628,37618,37648,37621,37642,37631,37624,37637,37638,37639,37652,37640,37644,37651,37650,37653,37654,37655,37658,37659,37660,37669,37675,37679,37676,37686,37666,37667,37668,37677,37680,37683,37678,37681,37685,37684,37687,37690,37693,37716,37722,37717,37699,37700,37702,37711,37718,37704,37727,37706,37713,37714,37715,37724,37730,37721,37728,37726,37732,37729,37731],"target_id":67,"x_com":27.726189840367525,"y_com":48.088785194747636,"z_com":-6.333846525371354,"description":"A2 - Adenine site (UCSF)"},{"id":238507,"group_type":"MC","mol_id":[37493,37507,37522,37529,37534,37552,37553,37582,37574,37575,37583],"target_id":67,"x_com":31.65100795413972,"y_com":43.278296929879644,"z_com":-5.619644133695017,"description":"B1 - Oxyanion hole (XChem)"},{"id":238508,"group_type":"MC","mol_id":[37626,37627,37616,37617,37619,37629,37620,37636,37622,37623,37632,37633,37643,37647,37649,37657,37661,37662,37670,37663,37664,37665,37672,37673,37682,37688,37689,37691,37692,37694,37695,37696,37697,37710,37701,37712,37725],"target_id":67,"x_com":30.4582845424678,"y_com":44.33355534090772,"z_com":-5.312019470354383,"description":"B2 - Oxyanion hole (UCSF)"},{"id":238509,"group_type":"MC","mol_id":[37502,37505,37492,37501,37541,37544,37566,37567],"target_id":67,"x_com":20.998018064109196,"y_com":44.09051650025461,"z_com":9.46426046740865,"description":"C1 - Catalytic site (XChem)"},{"id":238510,"group_type":"MC","mol_id":[37671],"target_id":67,"x_com":21.284898853882172,"y_com":45.698160485758876,"z_com":9.998337938938745,"description":"C2 - Catalytic site (UCSF)"},{"id":238511,"group_type":"MC","mol_id":[37479,37480,37481,37485,37488,37512,37525,37526,37523,37557,37579],"target_id":67,"x_com":35.1959499106428,"y_com":40.31313119348975,"z_com":-2.94943982944573,"description":"D1 - Glycine rich loop (XChem)"},{"id":238512,"group_type":"MC","mol_id":[37709,37705],"target_id":67,"x_com":36.3677463490233,"y_com":41.33177382856768,"z_com":-3.5796752218781913,"description":"D2 - Glycine rich loop (UCSF)"},{"id":238513,"group_type":"MC","mol_id":[37733],"target_id":67,"x_com":27.838442456374175,"y_com":49.94959833576108,"z_com":2.3046774018529543,"description":"E1 - Diphosphate site (UCSF)"},{"id":238514,"group_type":"MC","mol_id":[37656,37707,37708,37698,37719,37720],"target_id":67,"x_com":6.59239776235854,"y_com":36.529496855505464,"z_com":-3.246374871271202,"description":"I - Dimer interface (UCSF)"},{"id":238515,"group_type":"MC","mol_id":[37499,37491,37511,37519,37542,37547,37571],"target_id":67,"x_com":11.41205112673282,"y_com":44.112625007100824,"z_com":-17.965020610280543,"description":"K1 - K90 site (XChem)"},{"id":238516,"group_type":"MC","mol_id":[37589,37590,37593,37595,37596,37597,37598],"target_id":67,"x_com":9.780446439600953,"y_com":46.73529399938116,"z_com":-16.922835940982644,"description":"K2 - K90 site (UCSF)"},{"id":238517,"group_type":"MC","mol_id":[37630,37646,37674,37703,37723],"target_id":67,"x_com":18.064064408695742,"y_com":41.290467751815086,"z_com":-5.883202868377023,"description":"O - Other (UCSF)"},{"id":238518,"group_type":"MC","mol_id":[37482,37487,37494,37498,37504,37508,37513,37514,37520,37536,37538,37543,37546,37559,37573,37564,37570,37585],"target_id":67,"x_com":14.38901707971803,"y_com":40.50514141903764,"z_com":-12.77409756223947,"description":"S1 - Surface (XChem)"},{"id":238519,"group_type":"MC","mol_id":[37586,37587,37594],"target_id":67,"x_com":23.065233312370676,"y_com":38.83915549847696,"z_com":-10.827840363258138,"description":"S2 - Surface (UCSF)"},{"id":238520,"group_type":"MC","mol_id":[37459,37472,37476,37489,37490,37510,37535,37524,37537,37561,37572],"target_id":67,"x_com":14.703284696109689,"y_com":36.083419530772645,"z_com":-5.466467746407585,"description":"X1 - Xtal contact (XChem)"}],"molecule_list":[],"cached_mol_lists":{},"all_mol_lists":{},"duck_yank_data":{},"pandda_event_list":[],"pandda_site_list":[],"target_on":67,"target_on_name":"Mac1","isFetching":false,"app_on":"PREVIEW","group_type":"MC","hotspot_list":[],"savingState":"UNSET","seshListSaving":false,"targetUnrecognised":false,"uuid":"UNSET","sessionIdList":[],"direct_access":{},"direct_access_processed":false},"nglReducers":{"objectsInView":{"PROTEIN_67":{"name":"PROTEIN_67","prot_url":"https://fragalysis.apps.xchem.diamond.ac.uk/media/pdbs/Mac1-DLS-X0681_0A_apo_YaUy11d.pdb","OBJECT_TYPE":"PROTEIN","nglProtStyle":"cartoon","display_div":"summary_view","representations":[{"lastKnownID":"3A8C2CE9-5B70-485E-995E-874E7FC3F5E9","uuid":"3A8C2CE9-5B70-485E-995E-874E7FC3F5E9","type":"cartoon","params":{"lazy":false,"visible":true,"quality":"medium","aspectRatio":5,"subdiv":6,"radialSegments":10,"tension":null,"capped":true,"smoothSheet":false,"radiusType":"sstruc","radiusData":{},"radiusSize":1,"radiusScale":0.7,"assembly":"default","defaultAssembly":"","clipNear":0,"clipRadius":0,"clipCenter":{"x":0,"y":0,"z":0},"flatShaded":false,"opacity":1,"depthWrite":true,"side":"double","wireframe":false,"colorScheme":"chainname","colorScale":"RdYlBu","colorReverse":false,"colorValue":9474192,"colorMode":"hcl","roughness":0.4,"metalness":0,"diffuse":16777215,"diffuseInterior":false,"useInteriorColor":true,"interiorColor":2236962,"interiorDarkening":0,"matrix":{"elements":[1,0,0,0,0,1,0,0,0,0,1,0,0,0,0,1]},"disablePicking":false,"sele":""},"templateParams":{"aspectRatio":{"type":"number","precision":1,"max":10,"min":1,"rebuild":true},"subdiv":{"type":"integer","max":50,"min":1,"rebuild":true},"radialSegments":{"type":"integer","max":50,"min":1,"rebuild":true},"tension":{"type":"number","precision":1,"max":1,"min":0.1},"capped":{"type":"boolean","rebuild":true},"smoothSheet":{"type":"boolean","rebuild":true},"radiusType":{"type":"select","options":{"":"","vdw":"by vdW radius","covalent":"by covalent radius","sstruc":"by secondary structure","bfactor":"by bfactor","size":"size","data":"data","explicit":"explicit"}},"radiusData":{"type":"hidden"},"radiusSize":{"type":"number","precision":3,"max":10,"min":0.001},"radiusScale":{"type":"number","precision":3,"max":10,"min":0.001},"assembly":{"type":"select","options":{"default":"default","":"AU","UNITCELL":"UNITCELL","SUPERCELL":"SUPERCELL"},"rebuild":true},"defaultAssembly":{"type":"hidden"},"lazy":{"type":"boolean"},"clipNear":{"type":"range","step":1,"max":100,"min":0,"buffer":true},"clipRadius":{"type":"number","precision":1,"max":1000,"min":0,"buffer":true},"clipCenter":{"type":"vector3","precision":1,"buffer":true},"flatShaded":{"type":"boolean","buffer":true},"opacity":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"depthWrite":{"type":"boolean","buffer":true},"side":{"type":"select","buffer":true,"options":{"front":"front","back":"back","double":"double"}},"wireframe":{"type":"boolean","buffer":true},"colorScheme":{"type":"select","update":"color","options":{"atomindex":"atomindex","bfactor":"bfactor","chainid":"chainid","chainindex":"chainindex","chainname":"chainname","densityfit":"densityfit","electrostatic":"electrostatic","element":"element","entityindex":"entityindex","entitytype":"entitytype","geoquality":"geoquality","hydrophobicity":"hydrophobicity","modelindex":"modelindex","moleculetype":"moleculetype","occupancy":"occupancy","partialcharge":"partialcharge","random":"random","randomcoilindex":"randomcoilindex","residueindex":"residueindex","resname":"resname","sstruc":"sstruc","uniform":"uniform","value":"value","volume":"volume"}},"colorScale":{"type":"select","update":"color","options":{"":"","OrRd":"[S] Orange-Red","PuBu":"[S] Purple-Blue","BuPu":"[S] Blue-Purple","Oranges":"[S] Oranges","BuGn":"[S] Blue-Green","YlOrBr":"[S] Yellow-Orange-Brown","YlGn":"[S] Yellow-Green","Reds":"[S] Reds","RdPu":"[S] Red-Purple","Greens":"[S] Greens","YlGnBu":"[S] Yellow-Green-Blue","Purples":"[S] Purples","GnBu":"[S] Green-Blue","Greys":"[S] Greys","YlOrRd":"[S] Yellow-Orange-Red","PuRd":"[S] Purple-Red","Blues":"[S] Blues","PuBuGn":"[S] Purple-Blue-Green","Viridis":"[D] Viridis","Spectral":"[D] Spectral","RdYlGn":"[D] Red-Yellow-Green","RdBu":"[D] Red-Blue","PiYG":"[D] Pink-Yellowgreen","PRGn":"[D] Purplered-Green","RdYlBu":"[D] Red-Yellow-Blue","BrBG":"[D] Brown-Bluegreen","RdGy":"[D] Red-Grey","PuOr":"[D] Purple-Orange","Set1":"[Q] Set1","Set2":"[Q] Set2","Set3":"[Q] Set3","Dark2":"[Q] Dark2","Paired":"[Q] Paired","Pastel1":"[Q] Pastel1","Pastel2":"[Q] Pastel2","Accent":"[Q] Accent","rainbow":"[?] Rainbow","rwb":"[?] Red-White-Blue"}},"colorReverse":{"type":"boolean","update":"color"},"colorValue":{"type":"color","update":"color"},"colorDomain":{"type":"hidden","update":"color"},"colorMode":{"type":"select","update":"color","options":{"":"","rgb":"Red Green Blue","hsv":"Hue Saturation Value","hsl":"Hue Saturation Lightness","hsi":"Hue Saturation Intensity","lab":"CIE L*a*b*","hcl":"Hue Chroma Lightness"}},"roughness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"metalness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"diffuse":{"type":"color","buffer":true},"diffuseInterior":{"type":"boolean","buffer":true},"useInteriorColor":{"type":"boolean","buffer":true},"interiorColor":{"type":"color","buffer":true},"interiorDarkening":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"matrix":{"type":"hidden","buffer":true},"disablePicking":{"type":"boolean","rebuild":true}}}]},"PROTEIN_67_MAIN":{"name":"PROTEIN_67_MAIN","prot_url":"https://fragalysis.apps.xchem.diamond.ac.uk/media/pdbs/Mac1-DLS-X0681_0A_apo_YaUy11d.pdb","OBJECT_TYPE":"PROTEIN","nglProtStyle":"cartoon","display_div":"major_view","representations":[{"lastKnownID":"74B42708-0A81-4F33-918D-80C35FB87EAC","uuid":"74B42708-0A81-4F33-918D-80C35FB87EAC","type":"cartoon","params":{"lazy":false,"visible":true,"quality":"medium","aspectRatio":5,"subdiv":6,"radialSegments":10,"tension":null,"capped":true,"smoothSheet":false,"radiusType":"sstruc","radiusData":{},"radiusSize":1,"radiusScale":0.7,"assembly":"default","defaultAssembly":"","clipNear":0,"clipRadius":0,"clipCenter":{"x":0,"y":0,"z":0},"flatShaded":false,"opacity":1,"depthWrite":true,"side":"double","wireframe":false,"colorScheme":"chainname","colorScale":"RdYlBu","colorReverse":false,"colorValue":9474192,"colorMode":"hcl","roughness":0.4,"metalness":0,"diffuse":16777215,"diffuseInterior":false,"useInteriorColor":true,"interiorColor":2236962,"interiorDarkening":0,"matrix":{"elements":[1,0,0,0,0,1,0,0,0,0,1,0,0,0,0,1]},"disablePicking":false,"sele":""},"templateParams":{"aspectRatio":{"type":"number","precision":1,"max":10,"min":1,"rebuild":true},"subdiv":{"type":"integer","max":50,"min":1,"rebuild":true},"radialSegments":{"type":"integer","max":50,"min":1,"rebuild":true},"tension":{"type":"number","precision":1,"max":1,"min":0.1},"capped":{"type":"boolean","rebuild":true},"smoothSheet":{"type":"boolean","rebuild":true},"radiusType":{"type":"select","options":{"":"","vdw":"by vdW radius","covalent":"by covalent radius","sstruc":"by secondary structure","bfactor":"by bfactor","size":"size","data":"data","explicit":"explicit"}},"radiusData":{"type":"hidden"},"radiusSize":{"type":"number","precision":3,"max":10,"min":0.001},"radiusScale":{"type":"number","precision":3,"max":10,"min":0.001},"assembly":{"type":"select","options":{"default":"default","":"AU","UNITCELL":"UNITCELL","SUPERCELL":"SUPERCELL"},"rebuild":true},"defaultAssembly":{"type":"hidden"},"lazy":{"type":"boolean"},"clipNear":{"type":"range","step":1,"max":100,"min":0,"buffer":true},"clipRadius":{"type":"number","precision":1,"max":1000,"min":0,"buffer":true},"clipCenter":{"type":"vector3","precision":1,"buffer":true},"flatShaded":{"type":"boolean","buffer":true},"opacity":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"depthWrite":{"type":"boolean","buffer":true},"side":{"type":"select","buffer":true,"options":{"front":"front","back":"back","double":"double"}},"wireframe":{"type":"boolean","buffer":true},"colorScheme":{"type":"select","update":"color","options":{"atomindex":"atomindex","bfactor":"bfactor","chainid":"chainid","chainindex":"chainindex","chainname":"chainname","densityfit":"densityfit","electrostatic":"electrostatic","element":"element","entityindex":"entityindex","entitytype":"entitytype","geoquality":"geoquality","hydrophobicity":"hydrophobicity","modelindex":"modelindex","moleculetype":"moleculetype","occupancy":"occupancy","partialcharge":"partialcharge","random":"random","randomcoilindex":"randomcoilindex","residueindex":"residueindex","resname":"resname","sstruc":"sstruc","uniform":"uniform","value":"value","volume":"volume"}},"colorScale":{"type":"select","update":"color","options":{"":"","OrRd":"[S] Orange-Red","PuBu":"[S] Purple-Blue","BuPu":"[S] Blue-Purple","Oranges":"[S] Oranges","BuGn":"[S] Blue-Green","YlOrBr":"[S] Yellow-Orange-Brown","YlGn":"[S] Yellow-Green","Reds":"[S] Reds","RdPu":"[S] Red-Purple","Greens":"[S] Greens","YlGnBu":"[S] Yellow-Green-Blue","Purples":"[S] Purples","GnBu":"[S] Green-Blue","Greys":"[S] Greys","YlOrRd":"[S] Yellow-Orange-Red","PuRd":"[S] Purple-Red","Blues":"[S] Blues","PuBuGn":"[S] Purple-Blue-Green","Viridis":"[D] Viridis","Spectral":"[D] Spectral","RdYlGn":"[D] Red-Yellow-Green","RdBu":"[D] Red-Blue","PiYG":"[D] Pink-Yellowgreen","PRGn":"[D] Purplered-Green","RdYlBu":"[D] Red-Yellow-Blue","BrBG":"[D] Brown-Bluegreen","RdGy":"[D] Red-Grey","PuOr":"[D] Purple-Orange","Set1":"[Q] Set1","Set2":"[Q] Set2","Set3":"[Q] Set3","Dark2":"[Q] Dark2","Paired":"[Q] Paired","Pastel1":"[Q] Pastel1","Pastel2":"[Q] Pastel2","Accent":"[Q] Accent","rainbow":"[?] Rainbow","rwb":"[?] Red-White-Blue"}},"colorReverse":{"type":"boolean","update":"color"},"colorValue":{"type":"color","update":"color"},"colorDomain":{"type":"hidden","update":"color"},"colorMode":{"type":"select","update":"color","options":{"":"","rgb":"Red Green Blue","hsv":"Hue Saturation Value","hsl":"Hue Saturation Lightness","hsi":"Hue Saturation Intensity","lab":"CIE L*a*b*","hcl":"Hue Chroma Lightness"}},"roughness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"metalness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"diffuse":{"type":"color","buffer":true},"diffuseInterior":{"type":"boolean","buffer":true},"useInteriorColor":{"type":"boolean","buffer":true},"interiorColor":{"type":"color","buffer":true},"interiorDarkening":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"matrix":{"type":"hidden","buffer":true},"disablePicking":{"type":"boolean","rebuild":true}}}]},"MOLECULE-GROUP_238505":{"display_div":"summary_view","OBJECT_TYPE":"SPHERE","name":"MOLECULE-GROUP_238505","radius":6,"colour":[0,0,1],"coords":[27.238283583303307,49.21699084151727,-7.016167950826643],"representations":[{"lastKnownID":"86220F7E-8E2E-4CE8-9D43-57EE867F38A5","uuid":"86220F7E-8E2E-4CE8-9D43-57EE867F38A5","type":"buffer","params":{"lazy":false,"visible":true,"quality":"medium","clipNear":0,"clipRadius":0,"clipCenter":{"x":0,"y":0,"z":0},"flatShaded":false,"opacity":1,"depthWrite":true,"side":"double","wireframe":false,"colorReverse":false,"roughness":0.4,"metalness":0,"diffuse":16777215,"diffuseInterior":false,"useInteriorColor":false,"interiorColor":2236962,"interiorDarkening":0,"matrix":{"elements":[1,0,0,0,0,1,0,0,0,0,1,0,0,0,0,1]},"disablePicking":false},"templateParams":{"lazy":{"type":"boolean"},"clipNear":{"type":"range","step":1,"max":100,"min":0,"buffer":true},"clipRadius":{"type":"number","precision":1,"max":1000,"min":0,"buffer":true},"clipCenter":{"type":"vector3","precision":1,"buffer":true},"flatShaded":{"type":"boolean","buffer":true},"opacity":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"depthWrite":{"type":"boolean","buffer":true},"side":{"type":"select","buffer":true,"options":{"front":"front","back":"back","double":"double"}},"wireframe":{"type":"boolean","buffer":true},"colorScheme":null,"colorScale":null,"colorReverse":{"type":"boolean","update":"color"},"colorValue":null,"colorDomain":null,"colorMode":null,"roughness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"metalness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"diffuse":{"type":"color","buffer":true},"diffuseInterior":{"type":"boolean","buffer":true},"useInteriorColor":{"type":"boolean","buffer":true},"interiorColor":{"type":"color","buffer":true},"interiorDarkening":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"matrix":{"type":"hidden","buffer":true},"disablePicking":{"type":"boolean","rebuild":true}}}]},"MOLECULE-GROUP_238506":{"display_div":"summary_view","OBJECT_TYPE":"SPHERE","name":"MOLECULE-GROUP_238506","radius":6,"colour":[0,0,1],"coords":[27.726189840367525,48.088785194747636,-6.333846525371354],"representations":[{"lastKnownID":"2D6C61FF-8EBC-43A1-B0BD-C27A8BE79036","uuid":"2D6C61FF-8EBC-43A1-B0BD-C27A8BE79036","type":"buffer","params":{"lazy":false,"visible":true,"quality":"medium","clipNear":0,"clipRadius":0,"clipCenter":{"x":0,"y":0,"z":0},"flatShaded":false,"opacity":1,"depthWrite":true,"side":"double","wireframe":false,"colorReverse":false,"roughness":0.4,"metalness":0,"diffuse":16777215,"diffuseInterior":false,"useInteriorColor":false,"interiorColor":2236962,"interiorDarkening":0,"matrix":{"elements":[1,0,0,0,0,1,0,0,0,0,1,0,0,0,0,1]},"disablePicking":false},"templateParams":{"lazy":{"type":"boolean"},"clipNear":{"type":"range","step":1,"max":100,"min":0,"buffer":true},"clipRadius":{"type":"number","precision":1,"max":1000,"min":0,"buffer":true},"clipCenter":{"type":"vector3","precision":1,"buffer":true},"flatShaded":{"type":"boolean","buffer":true},"opacity":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"depthWrite":{"type":"boolean","buffer":true},"side":{"type":"select","buffer":true,"options":{"front":"front","back":"back","double":"double"}},"wireframe":{"type":"boolean","buffer":true},"colorScheme":null,"colorScale":null,"colorReverse":{"type":"boolean","update":"color"},"colorValue":null,"colorDomain":null,"colorMode":null,"roughness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"metalness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"diffuse":{"type":"color","buffer":true},"diffuseInterior":{"type":"boolean","buffer":true},"useInteriorColor":{"type":"boolean","buffer":true},"interiorColor":{"type":"color","buffer":true},"interiorDarkening":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"matrix":{"type":"hidden","buffer":true},"disablePicking":{"type":"boolean","rebuild":true}}}]},"MOLECULE-GROUP_238507":{"display_div":"summary_view","OBJECT_TYPE":"SPHERE","name":"MOLECULE-GROUP_238507","radius":6,"colour":[0,0,1],"coords":[31.65100795413972,43.278296929879644,-5.619644133695017],"representations":[{"lastKnownID":"F18B82AE-EEFD-4CC2-AEF3-261F0CD311A7","uuid":"F18B82AE-EEFD-4CC2-AEF3-261F0CD311A7","type":"buffer","params":{"lazy":false,"visible":true,"quality":"medium","clipNear":0,"clipRadius":0,"clipCenter":{"x":0,"y":0,"z":0},"flatShaded":false,"opacity":1,"depthWrite":true,"side":"double","wireframe":false,"colorReverse":false,"roughness":0.4,"metalness":0,"diffuse":16777215,"diffuseInterior":false,"useInteriorColor":false,"interiorColor":2236962,"interiorDarkening":0,"matrix":{"elements":[1,0,0,0,0,1,0,0,0,0,1,0,0,0,0,1]},"disablePicking":false},"templateParams":{"lazy":{"type":"boolean"},"clipNear":{"type":"range","step":1,"max":100,"min":0,"buffer":true},"clipRadius":{"type":"number","precision":1,"max":1000,"min":0,"buffer":true},"clipCenter":{"type":"vector3","precision":1,"buffer":true},"flatShaded":{"type":"boolean","buffer":true},"opacity":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"depthWrite":{"type":"boolean","buffer":true},"side":{"type":"select","buffer":true,"options":{"front":"front","back":"back","double":"double"}},"wireframe":{"type":"boolean","buffer":true},"colorScheme":null,"colorScale":null,"colorReverse":{"type":"boolean","update":"color"},"colorValue":null,"colorDomain":null,"colorMode":null,"roughness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"metalness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"diffuse":{"type":"color","buffer":true},"diffuseInterior":{"type":"boolean","buffer":true},"useInteriorColor":{"type":"boolean","buffer":true},"interiorColor":{"type":"color","buffer":true},"interiorDarkening":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"matrix":{"type":"hidden","buffer":true},"disablePicking":{"type":"boolean","rebuild":true}}}]},"MOLECULE-GROUP_238508":{"display_div":"summary_view","OBJECT_TYPE":"SPHERE","name":"MOLECULE-GROUP_238508","radius":6,"colour":[0,0,1],"coords":[30.4582845424678,44.33355534090772,-5.312019470354383],"representations":[{"lastKnownID":"B4379D13-9EBE-49AD-9637-2670341942C8","uuid":"B4379D13-9EBE-49AD-9637-2670341942C8","type":"buffer","params":{"lazy":false,"visible":true,"quality":"medium","clipNear":0,"clipRadius":0,"clipCenter":{"x":0,"y":0,"z":0},"flatShaded":false,"opacity":1,"depthWrite":true,"side":"double","wireframe":false,"colorReverse":false,"roughness":0.4,"metalness":0,"diffuse":16777215,"diffuseInterior":false,"useInteriorColor":false,"interiorColor":2236962,"interiorDarkening":0,"matrix":{"elements":[1,0,0,0,0,1,0,0,0,0,1,0,0,0,0,1]},"disablePicking":false},"templateParams":{"lazy":{"type":"boolean"},"clipNear":{"type":"range","step":1,"max":100,"min":0,"buffer":true},"clipRadius":{"type":"number","precision":1,"max":1000,"min":0,"buffer":true},"clipCenter":{"type":"vector3","precision":1,"buffer":true},"flatShaded":{"type":"boolean","buffer":true},"opacity":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"depthWrite":{"type":"boolean","buffer":true},"side":{"type":"select","buffer":true,"options":{"front":"front","back":"back","double":"double"}},"wireframe":{"type":"boolean","buffer":true},"colorScheme":null,"colorScale":null,"colorReverse":{"type":"boolean","update":"color"},"colorValue":null,"colorDomain":null,"colorMode":null,"roughness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"metalness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"diffuse":{"type":"color","buffer":true},"diffuseInterior":{"type":"boolean","buffer":true},"useInteriorColor":{"type":"boolean","buffer":true},"interiorColor":{"type":"color","buffer":true},"interiorDarkening":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"matrix":{"type":"hidden","buffer":true},"disablePicking":{"type":"boolean","rebuild":true}}}]},"MOLECULE-GROUP_238509":{"display_div":"summary_view","OBJECT_TYPE":"SPHERE","name":"MOLECULE-GROUP_238509","radius":4,"colour":[0,0,1],"coords":[20.998018064109196,44.09051650025461,9.46426046740865],"representations":[{"lastKnownID":"16CE161E-932F-4D05-AC95-4F2B70F92815","uuid":"16CE161E-932F-4D05-AC95-4F2B70F92815","type":"buffer","params":{"lazy":false,"visible":true,"quality":"medium","clipNear":0,"clipRadius":0,"clipCenter":{"x":0,"y":0,"z":0},"flatShaded":false,"opacity":1,"depthWrite":true,"side":"double","wireframe":false,"colorReverse":false,"roughness":0.4,"metalness":0,"diffuse":16777215,"diffuseInterior":false,"useInteriorColor":false,"interiorColor":2236962,"interiorDarkening":0,"matrix":{"elements":[1,0,0,0,0,1,0,0,0,0,1,0,0,0,0,1]},"disablePicking":false},"templateParams":{"lazy":{"type":"boolean"},"clipNear":{"type":"range","step":1,"max":100,"min":0,"buffer":true},"clipRadius":{"type":"number","precision":1,"max":1000,"min":0,"buffer":true},"clipCenter":{"type":"vector3","precision":1,"buffer":true},"flatShaded":{"type":"boolean","buffer":true},"opacity":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"depthWrite":{"type":"boolean","buffer":true},"side":{"type":"select","buffer":true,"options":{"front":"front","back":"back","double":"double"}},"wireframe":{"type":"boolean","buffer":true},"colorScheme":null,"colorScale":null,"colorReverse":{"type":"boolean","update":"color"},"colorValue":null,"colorDomain":null,"colorMode":null,"roughness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"metalness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"diffuse":{"type":"color","buffer":true},"diffuseInterior":{"type":"boolean","buffer":true},"useInteriorColor":{"type":"boolean","buffer":true},"interiorColor":{"type":"color","buffer":true},"interiorDarkening":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"matrix":{"type":"hidden","buffer":true},"disablePicking":{"type":"boolean","rebuild":true}}}]},"MOLECULE-GROUP_238510":{"display_div":"summary_view","OBJECT_TYPE":"SPHERE","name":"MOLECULE-GROUP_238510","radius":2,"colour":[0,0,1],"coords":[21.284898853882172,45.698160485758876,9.998337938938745],"representations":[{"lastKnownID":"B8094071-3ECB-4421-B473-534EE00374E7","uuid":"B8094071-3ECB-4421-B473-534EE00374E7","type":"buffer","params":{"lazy":false,"visible":true,"quality":"medium","clipNear":0,"clipRadius":0,"clipCenter":{"x":0,"y":0,"z":0},"flatShaded":false,"opacity":1,"depthWrite":true,"side":"double","wireframe":false,"colorReverse":false,"roughness":0.4,"metalness":0,"diffuse":16777215,"diffuseInterior":false,"useInteriorColor":false,"interiorColor":2236962,"interiorDarkening":0,"matrix":{"elements":[1,0,0,0,0,1,0,0,0,0,1,0,0,0,0,1]},"disablePicking":false},"templateParams":{"lazy":{"type":"boolean"},"clipNear":{"type":"range","step":1,"max":100,"min":0,"buffer":true},"clipRadius":{"type":"number","precision":1,"max":1000,"min":0,"buffer":true},"clipCenter":{"type":"vector3","precision":1,"buffer":true},"flatShaded":{"type":"boolean","buffer":true},"opacity":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"depthWrite":{"type":"boolean","buffer":true},"side":{"type":"select","buffer":true,"options":{"front":"front","back":"back","double":"double"}},"wireframe":{"type":"boolean","buffer":true},"colorScheme":null,"colorScale":null,"colorReverse":{"type":"boolean","update":"color"},"colorValue":null,"colorDomain":null,"colorMode":null,"roughness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"metalness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"diffuse":{"type":"color","buffer":true},"diffuseInterior":{"type":"boolean","buffer":true},"useInteriorColor":{"type":"boolean","buffer":true},"interiorColor":{"type":"color","buffer":true},"interiorDarkening":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"matrix":{"type":"hidden","buffer":true},"disablePicking":{"type":"boolean","rebuild":true}}}]},"MOLECULE-GROUP_238511":{"display_div":"summary_view","OBJECT_TYPE":"SPHERE","name":"MOLECULE-GROUP_238511","radius":6,"colour":[0,0,1],"coords":[35.1959499106428,40.31313119348975,-2.94943982944573],"representations":[{"lastKnownID":"3F8A4F50-0EF1-43D4-B2A4-5D08BE7FFF35","uuid":"3F8A4F50-0EF1-43D4-B2A4-5D08BE7FFF35","type":"buffer","params":{"lazy":false,"visible":true,"quality":"medium","clipNear":0,"clipRadius":0,"clipCenter":{"x":0,"y":0,"z":0},"flatShaded":false,"opacity":1,"depthWrite":true,"side":"double","wireframe":false,"colorReverse":false,"roughness":0.4,"metalness":0,"diffuse":16777215,"diffuseInterior":false,"useInteriorColor":false,"interiorColor":2236962,"interiorDarkening":0,"matrix":{"elements":[1,0,0,0,0,1,0,0,0,0,1,0,0,0,0,1]},"disablePicking":false},"templateParams":{"lazy":{"type":"boolean"},"clipNear":{"type":"range","step":1,"max":100,"min":0,"buffer":true},"clipRadius":{"type":"number","precision":1,"max":1000,"min":0,"buffer":true},"clipCenter":{"type":"vector3","precision":1,"buffer":true},"flatShaded":{"type":"boolean","buffer":true},"opacity":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"depthWrite":{"type":"boolean","buffer":true},"side":{"type":"select","buffer":true,"options":{"front":"front","back":"back","double":"double"}},"wireframe":{"type":"boolean","buffer":true},"colorScheme":null,"colorScale":null,"colorReverse":{"type":"boolean","update":"color"},"colorValue":null,"colorDomain":null,"colorMode":null,"roughness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"metalness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"diffuse":{"type":"color","buffer":true},"diffuseInterior":{"type":"boolean","buffer":true},"useInteriorColor":{"type":"boolean","buffer":true},"interiorColor":{"type":"color","buffer":true},"interiorDarkening":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"matrix":{"type":"hidden","buffer":true},"disablePicking":{"type":"boolean","rebuild":true}}}]},"MOLECULE-GROUP_238512":{"display_div":"summary_view","OBJECT_TYPE":"SPHERE","name":"MOLECULE-GROUP_238512","radius":2,"colour":[0,0,1],"coords":[36.3677463490233,41.33177382856768,-3.5796752218781913],"representations":[{"lastKnownID":"4698C7ED-CA4B-49B1-A362-8D508B58FC34","uuid":"4698C7ED-CA4B-49B1-A362-8D508B58FC34","type":"buffer","params":{"lazy":false,"visible":true,"quality":"medium","clipNear":0,"clipRadius":0,"clipCenter":{"x":0,"y":0,"z":0},"flatShaded":false,"opacity":1,"depthWrite":true,"side":"double","wireframe":false,"colorReverse":false,"roughness":0.4,"metalness":0,"diffuse":16777215,"diffuseInterior":false,"useInteriorColor":false,"interiorColor":2236962,"interiorDarkening":0,"matrix":{"elements":[1,0,0,0,0,1,0,0,0,0,1,0,0,0,0,1]},"disablePicking":false},"templateParams":{"lazy":{"type":"boolean"},"clipNear":{"type":"range","step":1,"max":100,"min":0,"buffer":true},"clipRadius":{"type":"number","precision":1,"max":1000,"min":0,"buffer":true},"clipCenter":{"type":"vector3","precision":1,"buffer":true},"flatShaded":{"type":"boolean","buffer":true},"opacity":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"depthWrite":{"type":"boolean","buffer":true},"side":{"type":"select","buffer":true,"options":{"front":"front","back":"back","double":"double"}},"wireframe":{"type":"boolean","buffer":true},"colorScheme":null,"colorScale":null,"colorReverse":{"type":"boolean","update":"color"},"colorValue":null,"colorDomain":null,"colorMode":null,"roughness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"metalness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"diffuse":{"type":"color","buffer":true},"diffuseInterior":{"type":"boolean","buffer":true},"useInteriorColor":{"type":"boolean","buffer":true},"interiorColor":{"type":"color","buffer":true},"interiorDarkening":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"matrix":{"type":"hidden","buffer":true},"disablePicking":{"type":"boolean","rebuild":true}}}]},"MOLECULE-GROUP_238513":{"display_div":"summary_view","OBJECT_TYPE":"SPHERE","name":"MOLECULE-GROUP_238513","radius":2,"colour":[0,0,1],"coords":[27.838442456374175,49.94959833576108,2.3046774018529543],"representations":[{"lastKnownID":"E13FEA31-8A7A-454C-8F1F-2313D3B84BCF","uuid":"E13FEA31-8A7A-454C-8F1F-2313D3B84BCF","type":"buffer","params":{"lazy":false,"visible":true,"quality":"medium","clipNear":0,"clipRadius":0,"clipCenter":{"x":0,"y":0,"z":0},"flatShaded":false,"opacity":1,"depthWrite":true,"side":"double","wireframe":false,"colorReverse":false,"roughness":0.4,"metalness":0,"diffuse":16777215,"diffuseInterior":false,"useInteriorColor":false,"interiorColor":2236962,"interiorDarkening":0,"matrix":{"elements":[1,0,0,0,0,1,0,0,0,0,1,0,0,0,0,1]},"disablePicking":false},"templateParams":{"lazy":{"type":"boolean"},"clipNear":{"type":"range","step":1,"max":100,"min":0,"buffer":true},"clipRadius":{"type":"number","precision":1,"max":1000,"min":0,"buffer":true},"clipCenter":{"type":"vector3","precision":1,"buffer":true},"flatShaded":{"type":"boolean","buffer":true},"opacity":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"depthWrite":{"type":"boolean","buffer":true},"side":{"type":"select","buffer":true,"options":{"front":"front","back":"back","double":"double"}},"wireframe":{"type":"boolean","buffer":true},"colorScheme":null,"colorScale":null,"colorReverse":{"type":"boolean","update":"color"},"colorValue":null,"colorDomain":null,"colorMode":null,"roughness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"metalness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"diffuse":{"type":"color","buffer":true},"diffuseInterior":{"type":"boolean","buffer":true},"useInteriorColor":{"type":"boolean","buffer":true},"interiorColor":{"type":"color","buffer":true},"interiorDarkening":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"matrix":{"type":"hidden","buffer":true},"disablePicking":{"type":"boolean","rebuild":true}}}]},"MOLECULE-GROUP_238514":{"display_div":"summary_view","OBJECT_TYPE":"SPHERE","name":"MOLECULE-GROUP_238514","radius":4,"colour":[0,0,1],"coords":[6.59239776235854,36.529496855505464,-3.246374871271202],"representations":[{"lastKnownID":"84C4F147-1D90-47C9-86B2-C00545F17B73","uuid":"84C4F147-1D90-47C9-86B2-C00545F17B73","type":"buffer","params":{"lazy":false,"visible":true,"quality":"medium","clipNear":0,"clipRadius":0,"clipCenter":{"x":0,"y":0,"z":0},"flatShaded":false,"opacity":1,"depthWrite":true,"side":"double","wireframe":false,"colorReverse":false,"roughness":0.4,"metalness":0,"diffuse":16777215,"diffuseInterior":false,"useInteriorColor":false,"interiorColor":2236962,"interiorDarkening":0,"matrix":{"elements":[1,0,0,0,0,1,0,0,0,0,1,0,0,0,0,1]},"disablePicking":false},"templateParams":{"lazy":{"type":"boolean"},"clipNear":{"type":"range","step":1,"max":100,"min":0,"buffer":true},"clipRadius":{"type":"number","precision":1,"max":1000,"min":0,"buffer":true},"clipCenter":{"type":"vector3","precision":1,"buffer":true},"flatShaded":{"type":"boolean","buffer":true},"opacity":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"depthWrite":{"type":"boolean","buffer":true},"side":{"type":"select","buffer":true,"options":{"front":"front","back":"back","double":"double"}},"wireframe":{"type":"boolean","buffer":true},"colorScheme":null,"colorScale":null,"colorReverse":{"type":"boolean","update":"color"},"colorValue":null,"colorDomain":null,"colorMode":null,"roughness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"metalness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"diffuse":{"type":"color","buffer":true},"diffuseInterior":{"type":"boolean","buffer":true},"useInteriorColor":{"type":"boolean","buffer":true},"interiorColor":{"type":"color","buffer":true},"interiorDarkening":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"matrix":{"type":"hidden","buffer":true},"disablePicking":{"type":"boolean","rebuild":true}}}]},"MOLECULE-GROUP_238515":{"display_div":"summary_view","OBJECT_TYPE":"SPHERE","name":"MOLECULE-GROUP_238515","radius":4,"colour":[0,0,1],"coords":[11.41205112673282,44.112625007100824,-17.965020610280543],"representations":[{"lastKnownID":"2CE77ECE-E09B-46A1-8778-7210FA9DB9E0","uuid":"2CE77ECE-E09B-46A1-8778-7210FA9DB9E0","type":"buffer","params":{"lazy":false,"visible":true,"quality":"medium","clipNear":0,"clipRadius":0,"clipCenter":{"x":0,"y":0,"z":0},"flatShaded":false,"opacity":1,"depthWrite":true,"side":"double","wireframe":false,"colorReverse":false,"roughness":0.4,"metalness":0,"diffuse":16777215,"diffuseInterior":false,"useInteriorColor":false,"interiorColor":2236962,"interiorDarkening":0,"matrix":{"elements":[1,0,0,0,0,1,0,0,0,0,1,0,0,0,0,1]},"disablePicking":false},"templateParams":{"lazy":{"type":"boolean"},"clipNear":{"type":"range","step":1,"max":100,"min":0,"buffer":true},"clipRadius":{"type":"number","precision":1,"max":1000,"min":0,"buffer":true},"clipCenter":{"type":"vector3","precision":1,"buffer":true},"flatShaded":{"type":"boolean","buffer":true},"opacity":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"depthWrite":{"type":"boolean","buffer":true},"side":{"type":"select","buffer":true,"options":{"front":"front","back":"back","double":"double"}},"wireframe":{"type":"boolean","buffer":true},"colorScheme":null,"colorScale":null,"colorReverse":{"type":"boolean","update":"color"},"colorValue":null,"colorDomain":null,"colorMode":null,"roughness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"metalness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"diffuse":{"type":"color","buffer":true},"diffuseInterior":{"type":"boolean","buffer":true},"useInteriorColor":{"type":"boolean","buffer":true},"interiorColor":{"type":"color","buffer":true},"interiorDarkening":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"matrix":{"type":"hidden","buffer":true},"disablePicking":{"type":"boolean","rebuild":true}}}]},"MOLECULE-GROUP_238516":{"display_div":"summary_view","OBJECT_TYPE":"SPHERE","name":"MOLECULE-GROUP_238516","radius":4,"colour":[0,0,1],"coords":[9.780446439600953,46.73529399938116,-16.922835940982644],"representations":[{"lastKnownID":"19BD6257-EDDE-4E7E-AA05-886659B9A19C","uuid":"19BD6257-EDDE-4E7E-AA05-886659B9A19C","type":"buffer","params":{"lazy":false,"visible":true,"quality":"medium","clipNear":0,"clipRadius":0,"clipCenter":{"x":0,"y":0,"z":0},"flatShaded":false,"opacity":1,"depthWrite":true,"side":"double","wireframe":false,"colorReverse":false,"roughness":0.4,"metalness":0,"diffuse":16777215,"diffuseInterior":false,"useInteriorColor":false,"interiorColor":2236962,"interiorDarkening":0,"matrix":{"elements":[1,0,0,0,0,1,0,0,0,0,1,0,0,0,0,1]},"disablePicking":false},"templateParams":{"lazy":{"type":"boolean"},"clipNear":{"type":"range","step":1,"max":100,"min":0,"buffer":true},"clipRadius":{"type":"number","precision":1,"max":1000,"min":0,"buffer":true},"clipCenter":{"type":"vector3","precision":1,"buffer":true},"flatShaded":{"type":"boolean","buffer":true},"opacity":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"depthWrite":{"type":"boolean","buffer":true},"side":{"type":"select","buffer":true,"options":{"front":"front","back":"back","double":"double"}},"wireframe":{"type":"boolean","buffer":true},"colorScheme":null,"colorScale":null,"colorReverse":{"type":"boolean","update":"color"},"colorValue":null,"colorDomain":null,"colorMode":null,"roughness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"metalness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"diffuse":{"type":"color","buffer":true},"diffuseInterior":{"type":"boolean","buffer":true},"useInteriorColor":{"type":"boolean","buffer":true},"interiorColor":{"type":"color","buffer":true},"interiorDarkening":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"matrix":{"type":"hidden","buffer":true},"disablePicking":{"type":"boolean","rebuild":true}}}]},"MOLECULE-GROUP_238517":{"display_div":"summary_view","OBJECT_TYPE":"SPHERE","name":"MOLECULE-GROUP_238517","radius":2,"colour":[0,0,1],"coords":[18.064064408695742,41.290467751815086,-5.883202868377023],"representations":[{"lastKnownID":"2B9FDF98-21E4-4B56-92CE-BE635CA0F11E","uuid":"2B9FDF98-21E4-4B56-92CE-BE635CA0F11E","type":"buffer","params":{"lazy":false,"visible":true,"quality":"medium","clipNear":0,"clipRadius":0,"clipCenter":{"x":0,"y":0,"z":0},"flatShaded":false,"opacity":1,"depthWrite":true,"side":"double","wireframe":false,"colorReverse":false,"roughness":0.4,"metalness":0,"diffuse":16777215,"diffuseInterior":false,"useInteriorColor":false,"interiorColor":2236962,"interiorDarkening":0,"matrix":{"elements":[1,0,0,0,0,1,0,0,0,0,1,0,0,0,0,1]},"disablePicking":false},"templateParams":{"lazy":{"type":"boolean"},"clipNear":{"type":"range","step":1,"max":100,"min":0,"buffer":true},"clipRadius":{"type":"number","precision":1,"max":1000,"min":0,"buffer":true},"clipCenter":{"type":"vector3","precision":1,"buffer":true},"flatShaded":{"type":"boolean","buffer":true},"opacity":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"depthWrite":{"type":"boolean","buffer":true},"side":{"type":"select","buffer":true,"options":{"front":"front","back":"back","double":"double"}},"wireframe":{"type":"boolean","buffer":true},"colorScheme":null,"colorScale":null,"colorReverse":{"type":"boolean","update":"color"},"colorValue":null,"colorDomain":null,"colorMode":null,"roughness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"metalness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"diffuse":{"type":"color","buffer":true},"diffuseInterior":{"type":"boolean","buffer":true},"useInteriorColor":{"type":"boolean","buffer":true},"interiorColor":{"type":"color","buffer":true},"interiorDarkening":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"matrix":{"type":"hidden","buffer":true},"disablePicking":{"type":"boolean","rebuild":true}}}]},"MOLECULE-GROUP_238518":{"display_div":"summary_view","OBJECT_TYPE":"SPHERE","name":"MOLECULE-GROUP_238518","radius":6,"colour":[0,0,1],"coords":[14.38901707971803,40.50514141903764,-12.77409756223947],"representations":[{"lastKnownID":"23C7AF3B-3E22-4D55-BBD2-D72992406906","uuid":"23C7AF3B-3E22-4D55-BBD2-D72992406906","type":"buffer","params":{"lazy":false,"visible":true,"quality":"medium","clipNear":0,"clipRadius":0,"clipCenter":{"x":0,"y":0,"z":0},"flatShaded":false,"opacity":1,"depthWrite":true,"side":"double","wireframe":false,"colorReverse":false,"roughness":0.4,"metalness":0,"diffuse":16777215,"diffuseInterior":false,"useInteriorColor":false,"interiorColor":2236962,"interiorDarkening":0,"matrix":{"elements":[1,0,0,0,0,1,0,0,0,0,1,0,0,0,0,1]},"disablePicking":false},"templateParams":{"lazy":{"type":"boolean"},"clipNear":{"type":"range","step":1,"max":100,"min":0,"buffer":true},"clipRadius":{"type":"number","precision":1,"max":1000,"min":0,"buffer":true},"clipCenter":{"type":"vector3","precision":1,"buffer":true},"flatShaded":{"type":"boolean","buffer":true},"opacity":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"depthWrite":{"type":"boolean","buffer":true},"side":{"type":"select","buffer":true,"options":{"front":"front","back":"back","double":"double"}},"wireframe":{"type":"boolean","buffer":true},"colorScheme":null,"colorScale":null,"colorReverse":{"type":"boolean","update":"color"},"colorValue":null,"colorDomain":null,"colorMode":null,"roughness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"metalness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"diffuse":{"type":"color","buffer":true},"diffuseInterior":{"type":"boolean","buffer":true},"useInteriorColor":{"type":"boolean","buffer":true},"interiorColor":{"type":"color","buffer":true},"interiorDarkening":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"matrix":{"type":"hidden","buffer":true},"disablePicking":{"type":"boolean","rebuild":true}}}]},"MOLECULE-GROUP_238519":{"display_div":"summary_view","OBJECT_TYPE":"SPHERE","name":"MOLECULE-GROUP_238519","radius":2,"colour":[0,0,1],"coords":[23.065233312370676,38.83915549847696,-10.827840363258138],"representations":[{"lastKnownID":"B85155AD-085E-472B-B19F-8D515B08FE21","uuid":"B85155AD-085E-472B-B19F-8D515B08FE21","type":"buffer","params":{"lazy":false,"visible":true,"quality":"medium","clipNear":0,"clipRadius":0,"clipCenter":{"x":0,"y":0,"z":0},"flatShaded":false,"opacity":1,"depthWrite":true,"side":"double","wireframe":false,"colorReverse":false,"roughness":0.4,"metalness":0,"diffuse":16777215,"diffuseInterior":false,"useInteriorColor":false,"interiorColor":2236962,"interiorDarkening":0,"matrix":{"elements":[1,0,0,0,0,1,0,0,0,0,1,0,0,0,0,1]},"disablePicking":false},"templateParams":{"lazy":{"type":"boolean"},"clipNear":{"type":"range","step":1,"max":100,"min":0,"buffer":true},"clipRadius":{"type":"number","precision":1,"max":1000,"min":0,"buffer":true},"clipCenter":{"type":"vector3","precision":1,"buffer":true},"flatShaded":{"type":"boolean","buffer":true},"opacity":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"depthWrite":{"type":"boolean","buffer":true},"side":{"type":"select","buffer":true,"options":{"front":"front","back":"back","double":"double"}},"wireframe":{"type":"boolean","buffer":true},"colorScheme":null,"colorScale":null,"colorReverse":{"type":"boolean","update":"color"},"colorValue":null,"colorDomain":null,"colorMode":null,"roughness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"metalness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"diffuse":{"type":"color","buffer":true},"diffuseInterior":{"type":"boolean","buffer":true},"useInteriorColor":{"type":"boolean","buffer":true},"interiorColor":{"type":"color","buffer":true},"interiorDarkening":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"matrix":{"type":"hidden","buffer":true},"disablePicking":{"type":"boolean","rebuild":true}}}]},"MOLECULE-GROUP_238520":{"display_div":"summary_view","OBJECT_TYPE":"SPHERE","name":"MOLECULE-GROUP_238520","radius":6,"colour":[0,0,1],"coords":[14.703284696109689,36.083419530772645,-5.466467746407585],"representations":[{"lastKnownID":"E6F383FF-77B7-4477-BA0A-0EBDE301803B","uuid":"E6F383FF-77B7-4477-BA0A-0EBDE301803B","type":"buffer","params":{"lazy":false,"visible":true,"quality":"medium","clipNear":0,"clipRadius":0,"clipCenter":{"x":0,"y":0,"z":0},"flatShaded":false,"opacity":1,"depthWrite":true,"side":"double","wireframe":false,"colorReverse":false,"roughness":0.4,"metalness":0,"diffuse":16777215,"diffuseInterior":false,"useInteriorColor":false,"interiorColor":2236962,"interiorDarkening":0,"matrix":{"elements":[1,0,0,0,0,1,0,0,0,0,1,0,0,0,0,1]},"disablePicking":false},"templateParams":{"lazy":{"type":"boolean"},"clipNear":{"type":"range","step":1,"max":100,"min":0,"buffer":true},"clipRadius":{"type":"number","precision":1,"max":1000,"min":0,"buffer":true},"clipCenter":{"type":"vector3","precision":1,"buffer":true},"flatShaded":{"type":"boolean","buffer":true},"opacity":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"depthWrite":{"type":"boolean","buffer":true},"side":{"type":"select","buffer":true,"options":{"front":"front","back":"back","double":"double"}},"wireframe":{"type":"boolean","buffer":true},"colorScheme":null,"colorScale":null,"colorReverse":{"type":"boolean","update":"color"},"colorValue":null,"colorDomain":null,"colorMode":null,"roughness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"metalness":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"diffuse":{"type":"color","buffer":true},"diffuseInterior":{"type":"boolean","buffer":true},"useInteriorColor":{"type":"boolean","buffer":true},"interiorColor":{"type":"color","buffer":true},"interiorDarkening":{"type":"range","step":0.01,"max":1,"min":0,"buffer":true},"matrix":{"type":"hidden","buffer":true},"disablePicking":{"type":"boolean","rebuild":true}}}]}},"nglOrientations":{"summary_view":{"elements":[77.62926523202331,0,0,0,0,77.62926523202331,0,0,0,0,77.62926523202331,0,-23.004000186920166,-44.762001037597656,6.7270002365112305,1]},"major_view":{"elements":[112.39539183939462,0,0,0,0,112.39539183939462,0,0,0,0,112.39539183939462,0,-23.004000186920166,-44.762001037597656,6.7270002365112305,1]}},"viewParams":{"backgroundColor":"black","clipNear":42,"clipFar":100,"clipDist":10,"fogNear":50,"fogFar":62},"countOfRemainingMoleculeGroups":1,"proteinsHasLoaded":true,"countOfPendingNglObjects":{"major_view":0,"summary_view":0},"moleculeOrientations":{},"pdbCache":{}},"selectionReducers":{"to_buy_list":[],"vector_list":[],"fragmentDisplayList":[],"proteinList":[],"complexList":[],"surfaceList":[],"densityList":[],"vectorOnList":[],"countOfPendingVectorLoadRequests":0,"mol_group_selection":[],"moleculeAllSelection":[],"moleculeAllTypeSelection":[],"compoundsOfVectors":null,"bondColorMapOfVectors":null,"currentVector":null},"previewReducers":{"summary":{"oldUrl":"","compoundImage":"<svg xmlns=\"http://www.w3.org/2000/svg\" version=\"1.1\" width=\"150px\" height=\"150px\"/>","width":150,"height":150,"countOfPicked":0,"countOfExploredVectors":0,"countOfExploredSeries":0,"estimatedCost":0},"compounds":{"currentPage":-1,"compoundsPerPage":20,"currentCompounds":[],"currentCompoundClass":"blue","selectedCompoundsClass":{"blue":[],"red":[],"green":[],"purple":[],"apricot":[]},"highlightedCompoundId":null,"showedCompoundList":[],"configuration":{}},"molecule":{"sortDialogOpen":false,"imageCache":{}}},"datasetsReducers":{"datasets":[],"moleculeLists":{},"isLoadingMoleculeList":false,"scoreDatasetMap":{},"scoreCompoundMap":{},"filterDatasetMap":{},"filterPropertiesDatasetMap":{},"filterDialogOpen":false,"filteredScoreProperties":{},"filterWithInspirations":false,"ligandLists":{},"proteinLists":{},"complexLists":{},"surfaceLists":{},"inspirationLists":{},"moleculeAllSelection":{},"moleculeAllTypeSelection":{},"searchString":null,"isOpenInspirationDialog":false,"inspirationFragmentList":[],"isLoadingInspirationListOfMolecules":false,"inspirationMoleculeDataList":[],"allInspirationMoleculeDataList":[],"allInspirations":{},"isOpenCrossReferenceDialog":false,"crossReferenceCompoundName":null,"isLoadingCrossReferenceScores":false,"crossReferenceCompoundsDataList":[],"compoundsToBuyDatasetMap":{}}}},"isProjectModalOpen":false,"isProjectModalLoading":false,"listOfProjects":[],"isLoadingListOfProjects":false,"isLoadingTree":false,"currentSnapshotTree":null,"currentSnapshotList":null,"forceCreateProject":false,"isForceProjectCreated":false},"issueReducers":{"name":"Frank von Delft","email":"[email protected]","title":"UI layout is funky for Firefox (possibly not repeatable)","description":"Possibly sporadic, but not the first time I've seen it: when I went straight to my long-running firefox session, it did this.","response":"","imageSource":{},"isOpenForm":true},"datasetsReducers":{"datasets":[],"moleculeLists":{},"isLoadingMoleculeList":false,"scoreDatasetMap":{},"scoreCompoundMap":{},"filterDatasetMap":{},"filterPropertiesDatasetMap":{},"filterDialogOpen":false,"filteredScoreProperties":{},"filterWithInspirations":false,"ligandLists":{},"proteinLists":{},"complexLists":{},"surfaceLists":{},"inspirationLists":{},"moleculeAllSelection":{},"moleculeAllTypeSelection":{},"searchString":null,"isOpenInspirationDialog":false,"inspirationFragmentList":[],"isLoadingInspirationListOfMolecules":false,"inspirationMoleculeDataList":[],"allInspirationMoleculeDataList":[],"allInspirations":{},"isOpenCrossReferenceDialog":false,"crossReferenceCompoundName":null,"isLoadingCrossReferenceScores":false,"crossReferenceCompoundsDataList":[],"compoundsToBuyDatasetMap":{}},"trackingReducers":{"track_actions_list":[{"type":"TARGET_LOADED","annotation":"CHECK","timestamp":1611592701540,"username":"NOT_LOGGED_IN","object_type":"TARGET","object_name":"Mac1","object_id":67,"text":"Target Mac1 was loaded"},{"type":"SITE_TURNED_ON","annotation":"CHECK","timestamp":1611592702550,"username":"NOT_LOGGED_IN","object_type":"SITE","object_name":"A1 - Adenine site (XChem)","object_id":238505,"text":"Site A1 - Adenine site (XChem) was turned on"},{"type":"SIDECHAINS_TURNED_ON","annotation":"CHECK","timestamp":1611592703112,"username":"NOT_LOGGED_IN","object_type":"MOLECULE","object_name":"Mac1-DLS-EU0034A:EN300-321461","object_id":37457,"text":"Sidechain was turned on MOLECULE DLS-EU0034A:EN300-321461"},{"type":"LIGAND_TURNED_ON","annotation":"CHECK","timestamp":1611592703113,"username":"NOT_LOGGED_IN","object_type":"MOLECULE","object_name":"Mac1-DLS-EU0034A:EN300-321461","object_id":37457,"text":"Ligand was turned on MOLECULE DLS-EU0034A:EN300-321461"}],"undo_redo_actions_list":[{"type":"TARGET_LOADED","annotation":"CHECK","timestamp":1611592701540,"username":"NOT_LOGGED_IN","object_type":"TARGET","object_name":"Mac1","object_id":67,"text":"Target Mac1 was loaded"},{"type":"SITE_TURNED_ON","annotation":"CHECK","timestamp":1611592702550,"username":"NOT_LOGGED_IN","object_type":"SITE","object_name":"A1 - Adenine site (XChem)","object_id":238505,"text":"Site A1 - Adenine site (XChem) was turned on"},{"type":"SIDECHAINS_TURNED_ON","annotation":"CHECK","timestamp":1611592703112,"username":"NOT_LOGGED_IN","object_type":"MOLECULE","object_name":"Mac1-DLS-EU0034A:EN300-321461","object_id":37457,"text":"Sidechain was turned on MOLECULE DLS-EU0034A:EN300-321461"},{"type":"LIGAND_TURNED_ON","annotation":"CHECK","timestamp":1611592703113,"username":"NOT_LOGGED_IN","object_type":"MOLECULE","object_name":"Mac1-DLS-EU0034A:EN300-321461","object_id":37457,"text":"Ligand was turned on MOLECULE DLS-EU0034A:EN300-321461"}],"current_actions_list":[],"isTrackingMoleculesRestoring":false,"isTrackingCompoundsRestoring":false,"isUndoRedoAction":false,"isActionsSending":false,"isActionsLoading":false,"isActionSaving":false,"send_actions_list":[{"type":"TARGET_LOADED","annotation":"CHECK","timestamp":1611592701540,"username":"NOT_LOGGED_IN","object_type":"TARGET","object_name":"Mac1","object_id":67,"text":"Target Mac1 was loaded"},{"type":"SITE_TURNED_ON","annotation":"CHECK","timestamp":1611592702550,"username":"NOT_LOGGED_IN","object_type":"SITE","object_name":"A1 - Adenine site (XChem)","object_id":238505,"text":"Site A1 - Adenine site (XChem) was turned on"},{"type":"SIDECHAINS_TURNED_ON","annotation":"CHECK","timestamp":1611592703112,"username":"NOT_LOGGED_IN","object_type":"MOLECULE","object_name":"Mac1-DLS-EU0034A:EN300-321461","object_id":37457,"text":"Sidechain was turned on MOLECULE DLS-EU0034A:EN300-321461"},{"type":"LIGAND_TURNED_ON","annotation":"CHECK","timestamp":1611592703113,"username":"NOT_LOGGED_IN","object_type":"MOLECULE","object_name":"Mac1-DLS-EU0034A:EN300-321461","object_id":37457,"text":"Ligand was turned on MOLECULE DLS-EU0034A:EN300-321461"}],"project_actions_list":[],"snapshotActionImageList":[],"isActionRestoring":false,"isActionRestored":false,"isActionTracking":false,"trackingImageSource":""},"undoableTrackingReducers":{"past":[{"track_actions_list":[],"undo_redo_actions_list":[],"current_actions_list":[],"isTrackingMoleculesRestoring":false,"isTrackingCompoundsRestoring":false,"isUndoRedoAction":false,"isActionsSending":false,"isActionsLoading":false,"isActionSaving":false,"send_actions_list":[],"project_actions_list":[],"snapshotActionImageList":[],"isActionRestoring":false,"isActionRestored":false,"isActionTracking":false,"trackingImageSource":""},{"track_actions_list":[{"type":"TARGET_LOADED","annotation":"CHECK","timestamp":1611592701540,"username":"NOT_LOGGED_IN","object_type":"TARGET","object_name":"Mac1","object_id":67,"text":"Target Mac1 was loaded"}],"undo_redo_actions_list":[{"type":"TARGET_LOADED","annotation":"CHECK","timestamp":1611592701540,"username":"NOT_LOGGED_IN","object_type":"TARGET","object_name":"Mac1","object_id":67,"text":"Target Mac1 was loaded"}],"current_actions_list":[],"isTrackingMoleculesRestoring":false,"isTrackingCompoundsRestoring":false,"isUndoRedoAction":false,"isActionsSending":false,"isActionsLoading":false,"isActionSaving":false,"send_actions_list":[{"type":"TARGET_LOADED","annotation":"CHECK","timestamp":1611592701540,"username":"NOT_LOGGED_IN","object_type":"TARGET","object_name":"Mac1","object_id":67,"text":"Target Mac1 was loaded"}],"project_actions_list":[],"snapshotActionImageList":[],"isActionRestoring":false,"isActionRestored":false,"isActionTracking":true,"trackingImageSource":""},{"track_actions_list":[{"type":"TARGET_LOADED","annotation":"CHECK","timestamp":1611592701540,"username":"NOT_LOGGED_IN","object_type":"TARGET","object_name":"Mac1","object_id":67,"text":"Target Mac1 was loaded"},{"type":"SITE_TURNED_ON","annotation":"CHECK","timestamp":1611592702550,"username":"NOT_LOGGED_IN","object_type":"SITE","object_name":"A1 - Adenine site (XChem)","object_id":238505,"text":"Site A1 - Adenine site (XChem) was turned on"}],"undo_redo_actions_list":[{"type":"TARGET_LOADED","annotation":"CHECK","timestamp":1611592701540,"username":"NOT_LOGGED_IN","object_type":"TARGET","object_name":"Mac1","object_id":67,"text":"Target Mac1 was loaded"},{"type":"SITE_TURNED_ON","annotation":"CHECK","timestamp":1611592702550,"username":"NOT_LOGGED_IN","object_type":"SITE","object_name":"A1 - Adenine site (XChem)","object_id":238505,"text":"Site A1 - Adenine site (XChem) was turned on"}],"current_actions_list":[],"isTrackingMoleculesRestoring":false,"isTrackingCompoundsRestoring":false,"isUndoRedoAction":false,"isActionsSending":false,"isActionsLoading":false,"isActionSaving":false,"send_actions_list":[{"type":"TARGET_LOADED","annotation":"CHECK","timestamp":1611592701540,"username":"NOT_LOGGED_IN","object_type":"TARGET","object_name":"Mac1","object_id":67,"text":"Target Mac1 was loaded"},{"type":"SITE_TURNED_ON","annotation":"CHECK","timestamp":1611592702550,"username":"NOT_LOGGED_IN","object_type":"SITE","object_name":"A1 - Adenine site (XChem)","object_id":238505,"text":"Site A1 - Adenine site (XChem) was turned on"}],"project_actions_list":[],"snapshotActionImageList":[],"isActionRestoring":false,"isActionRestored":false,"isActionTracking":true,"trackingImageSource":""},{"track_actions_list":[{"type":"TARGET_LOADED","annotation":"CHECK","timestamp":1611592701540,"username":"NOT_LOGGED_IN","object_type":"TARGET","object_name":"Mac1","object_id":67,"text":"Target Mac1 was loaded"},{"type":"SITE_TURNED_ON","annotation":"CHECK","timestamp":1611592702550,"username":"NOT_LOGGED_IN","object_type":"SITE","object_name":"A1 - Adenine site (XChem)","object_id":238505,"text":"Site A1 - Adenine site (XChem) was turned on"},{"type":"SIDECHAINS_TURNED_ON","annotation":"CHECK","timestamp":1611592703112,"username":"NOT_LOGGED_IN","object_type":"MOLECULE","object_name":"Mac1-DLS-EU0034A:EN300-321461","object_id":37457,"text":"Sidechain was turned on MOLECULE DLS-EU0034A:EN300-321461"}],"undo_redo_actions_list":[{"type":"TARGET_LOADED","annotation":"CHECK","timestamp":1611592701540,"username":"NOT_LOGGED_IN","object_type":"TARGET","object_name":"Mac1","object_id":67,"text":"Target Mac1 was loaded"},{"type":"SITE_TURNED_ON","annotation":"CHECK","timestamp":1611592702550,"username":"NOT_LOGGED_IN","object_type":"SITE","object_name":"A1 - Adenine site (XChem)","object_id":238505,"text":"Site A1 - Adenine site (XChem) was turned on"},{"type":"SIDECHAINS_TURNED_ON","annotation":"CHECK","timestamp":1611592703112,"username":"NOT_LOGGED_IN","object_type":"MOLECULE","object_name":"Mac1-DLS-EU0034A:EN300-321461","object_id":37457,"text":"Sidechain was turned on MOLECULE DLS-EU0034A:EN300-321461"}],"current_actions_list":[],"isTrackingMoleculesRestoring":false,"isTrackingCompoundsRestoring":false,"isUndoRedoAction":false,"isActionsSending":false,"isActionsLoading":false,"isActionSaving":false,"send_actions_list":[{"type":"TARGET_LOADED","annotation":"CHECK","timestamp":1611592701540,"username":"NOT_LOGGED_IN","object_type":"TARGET","object_name":"Mac1","object_id":67,"text":"Target Mac1 was loaded"},{"type":"SITE_TURNED_ON","annotation":"CHECK","timestamp":1611592702550,"username":"NOT_LOGGED_IN","object_type":"SITE","object_name":"A1 - Adenine site (XChem)","object_id":238505,"text":"Site A1 - Adenine site (XChem) was turned on"},{"type":"SIDECHAINS_TURNED_ON","annotation":"CHECK","timestamp":1611592703112,"username":"NOT_LOGGED_IN","object_type":"MOLECULE","object_name":"Mac1-DLS-EU0034A:EN300-321461","object_id":37457,"text":"Sidechain was turned on MOLECULE DLS-EU0034A:EN300-321461"}],"project_actions_list":[],"snapshotActionImageList":[],"isActionRestoring":false,"isActionRestored":false,"isActionTracking":true,"trackingImageSource":""}],"present":{"track_actions_list":[{"type":"TARGET_LOADED","annotation":"CHECK","timestamp":1611592701540,"username":"NOT_LOGGED_IN","object_type":"TARGET","object_name":"Mac1","object_id":67,"text":"Target Mac1 was loaded"},{"type":"SITE_TURNED_ON","annotation":"CHECK","timestamp":1611592702550,"username":"NOT_LOGGED_IN","object_type":"SITE","object_name":"A1 - Adenine site (XChem)","object_id":238505,"text":"Site A1 - Adenine site (XChem) was turned on"},{"type":"SIDECHAINS_TURNED_ON","annotation":"CHECK","timestamp":1611592703112,"username":"NOT_LOGGED_IN","object_type":"MOLECULE","object_name":"Mac1-DLS-EU0034A:EN300-321461","object_id":37457,"text":"Sidechain was turned on MOLECULE DLS-EU0034A:EN300-321461"},{"type":"LIGAND_TURNED_ON","annotation":"CHECK","timestamp":1611592703113,"username":"NOT_LOGGED_IN","object_type":"MOLECULE","object_name":"Mac1-DLS-EU0034A:EN300-321461","object_id":37457,"text":"Ligand was turned on MOLECULE DLS-EU0034A:EN300-321461"}],"undo_redo_actions_list":[{"type":"TARGET_LOADED","annotation":"CHECK","timestamp":1611592701540,"username":"NOT_LOGGED_IN","object_type":"TARGET","object_name":"Mac1","object_id":67,"text":"Target Mac1 was loaded"},{"type":"SITE_TURNED_ON","annotation":"CHECK","timestamp":1611592702550,"username":"NOT_LOGGED_IN","object_type":"SITE","object_name":"A1 - Adenine site (XChem)","object_id":238505,"text":"Site A1 - Adenine site (XChem) was turned on"},{"type":"SIDECHAINS_TURNED_ON","annotation":"CHECK","timestamp":1611592703112,"username":"NOT_LOGGED_IN","object_type":"MOLECULE","object_name":"Mac1-DLS-EU0034A:EN300-321461","object_id":37457,"text":"Sidechain was turned on MOLECULE DLS-EU0034A:EN300-321461"},{"type":"LIGAND_TURNED_ON","annotation":"CHECK","timestamp":1611592703113,"username":"NOT_LOGGED_IN","object_type":"MOLECULE","object_name":"Mac1-DLS-EU0034A:EN300-321461","object_id":37457,"text":"Ligand was turned on MOLECULE DLS-EU0034A:EN300-321461"}],"current_actions_list":[],"isTrackingMoleculesRestoring":false,"isTrackingCompoundsRestoring":false,"isUndoRedoAction":false,"isActionsSending":false,"isActionsLoading":false,"isActionSaving":false,"send_actions_list":[{"type":"TARGET_LOADED","annotation":"CHECK","timestamp":1611592701540,"username":"NOT_LOGGED_IN","object_type":"TARGET","object_name":"Mac1","object_id":67,"text":"Target Mac1 was loaded"},{"type":"SITE_TURNED_ON","annotation":"CHECK","timestamp":1611592702550,"username":"NOT_LOGGED_IN","object_type":"SITE","object_name":"A1 - Adenine site (XChem)","object_id":238505,"text":"Site A1 - Adenine site (XChem) was turned on"},{"type":"SIDECHAINS_TURNED_ON","annotation":"CHECK","timestamp":1611592703112,"username":"NOT_LOGGED_IN","object_type":"MOLECULE","object_name":"Mac1-DLS-EU0034A:EN300-321461","object_id":37457,"text":"Sidechain was turned on MOLECULE DLS-EU0034A:EN300-321461"},{"type":"LIGAND_TURNED_ON","annotation":"CHECK","timestamp":1611592703113,"username":"NOT_LOGGED_IN","object_type":"MOLECULE","object_name":"Mac1-DLS-EU0034A:EN300-321461","object_id":37457,"text":"Ligand was turned on MOLECULE DLS-EU0034A:EN300-321461"}],"project_actions_list":[],"snapshotActionImageList":[],"isActionRestoring":false,"isActionRestored":false,"isActionTracking":false,"trackingImageSource":""},"future":[],"group":null,"_latestUnfiltered":{"track_actions_list":[{"type":"TARGET_LOADED","annotation":"CHECK","timestamp":1611592701540,"username":"NOT_LOGGED_IN","object_type":"TARGET","object_name":"Mac1","object_id":67,"text":"Target Mac1 was loaded"},{"type":"SITE_TURNED_ON","annotation":"CHECK","timestamp":1611592702550,"username":"NOT_LOGGED_IN","object_type":"SITE","object_name":"A1 - Adenine site (XChem)","object_id":238505,"text":"Site A1 - Adenine site (XChem) was turned on"},{"type":"SIDECHAINS_TURNED_ON","annotation":"CHECK","timestamp":1611592703112,"username":"NOT_LOGGED_IN","object_type":"MOLECULE","object_name":"Mac1-DLS-EU0034A:EN300-321461","object_id":37457,"text":"Sidechain was turned on MOLECULE DLS-EU0034A:EN300-321461"},{"type":"LIGAND_TURNED_ON","annotation":"CHECK","timestamp":1611592703113,"username":"NOT_LOGGED_IN","object_type":"MOLECULE","object_name":"Mac1-DLS-EU0034A:EN300-321461","object_id":37457,"text":"Ligand was turned on MOLECULE DLS-EU0034A:EN300-321461"}],"undo_redo_actions_list":[{"type":"TARGET_LOADED","annotation":"CHECK","timestamp":1611592701540,"username":"NOT_LOGGED_IN","object_type":"TARGET","object_name":"Mac1","object_id":67,"text":"Target Mac1 was loaded"},{"type":"SITE_TURNED_ON","annotation":"CHECK","timestamp":1611592702550,"username":"NOT_LOGGED_IN","object_type":"SITE","object_name":"A1 - Adenine site (XChem)","object_id":238505,"text":"Site A1 - Adenine site (XChem) was turned on"},{"type":"SIDECHAINS_TURNED_ON","annotation":"CHECK","timestamp":1611592703112,"username":"NOT_LOGGED_IN","object_type":"MOLECULE","object_name":"Mac1-DLS-EU0034A:EN300-321461","object_id":37457,"text":"Sidechain was turned on MOLECULE DLS-EU0034A:EN300-321461"},{"type":"LIGAND_TURNED_ON","annotation":"CHECK","timestamp":1611592703113,"username":"NOT_LOGGED_IN","object_type":"MOLECULE","object_name":"Mac1-DLS-EU0034A:EN300-321461","object_id":37457,"text":"Ligand was turned on MOLECULE DLS-EU0034A:EN300-321461"}],"current_actions_list":[],"isTrackingMoleculesRestoring":false,"isTrackingCompoundsRestoring":false,"isUndoRedoAction":false,"isActionsSending":false,"isActionsLoading":false,"isActionSaving":false,"send_actions_list":[{"type":"TARGET_LOADED","annotation":"CHECK","timestamp":1611592701540,"username":"NOT_LOGGED_IN","object_type":"TARGET","object_name":"Mac1","object_id":67,"text":"Target Mac1 was loaded"},{"type":"SITE_TURNED_ON","annotation":"CHECK","timestamp":1611592702550,"username":"NOT_LOGGED_IN","object_type":"SITE","object_name":"A1 - Adenine site (XChem)","object_id":238505,"text":"Site A1 - Adenine site (XChem) was turned on"},{"type":"SIDECHAINS_TURNED_ON","annotation":"CHECK","timestamp":1611592703112,"username":"NOT_LOGGED_IN","object_type":"MOLECULE","object_name":"Mac1-DLS-EU0034A:EN300-321461","object_id":37457,"text":"Sidechain was turned on MOLECULE DLS-EU0034A:EN300-321461"},{"type":"LIGAND_TURNED_ON","annotation":"CHECK","timestamp":1611592703113,"username":"NOT_LOGGED_IN","object_type":"MOLECULE","object_name":"Mac1-DLS-EU0034A:EN300-321461","object_id":37457,"text":"Ligand was turned on MOLECULE DLS-EU0034A:EN300-321461"}],"project_actions_list":[],"snapshotActionImageList":[],"isActionRestoring":false,"isActionRestored":false,"isActionTracking":true,"trackingImageSource":""},"index":4,"limit":5}}